vendor: update everything
* If possible, update each dependency to the latest available version. * Use releases over commit IDs and avoid vendoring branches. Signed-off-by: Valentin Rothberg <rothberg@redhat.com>
This commit is contained in:
parent
545f244212
commit
bd40dcfc2b
156
vendor.conf
156
vendor.conf
|
@ -1,107 +1,107 @@
|
|||
# Note: please use releases where possible. Vendoring branches (e.g., master)
|
||||
# should be avoided at all costs.
|
||||
#
|
||||
github.com/Azure/go-ansiterm 19f72df4d05d31cbe1c56bfc8045c96babff6c7e
|
||||
# TODO: no release, can we find an alternative?
|
||||
github.com/Azure/go-ansiterm d6e3b3328b783f23731bc4d058875b0371ff8109
|
||||
github.com/BurntSushi/toml v0.2.0
|
||||
github.com/Microsoft/go-winio 78439966b38d69bf38227fbf57ac8a6fee70f69a
|
||||
github.com/Microsoft/hcsshim 43f9725307998e09f2e3816c2c0c36dc98f0c982
|
||||
github.com/Microsoft/go-winio v0.4.11
|
||||
github.com/Microsoft/hcsshim v0.8.3
|
||||
github.com/blang/semver v3.5.0
|
||||
github.com/boltdb/bolt master
|
||||
github.com/buger/goterm 2f8dfbc7dbbff5dd1d391ed91482c24df243b2d3
|
||||
github.com/checkpoint-restore/go-criu master
|
||||
github.com/containerd/cgroups 58556f5ad8448d99a6f7bea69ea4bdb7747cfeb0
|
||||
github.com/containerd/continuity master
|
||||
github.com/boltdb/bolt v1.3.1
|
||||
# TODO: no release, can we find an alternative?
|
||||
github.com/buger/goterm c206103e1f37c0c6c5c039706305ea2aa6e8ad3b
|
||||
github.com/checkpoint-restore/go-criu v3.11
|
||||
github.com/containerd/cgroups 39b18af02c4120960f517a3a4c2588fabb61d02c
|
||||
github.com/containerd/continuity 004b46473808b3e7a4a3049c20e4376c91eb966d
|
||||
github.com/containernetworking/cni v0.7.0-alpha1
|
||||
github.com/containernetworking/plugins 1562a1e60ed101aacc5e08ed9dbeba8e9f3d4ec1
|
||||
github.com/containers/image f0cbc16b444d729362c78244c715b45bf4019b71
|
||||
github.com/containernetworking/plugins v0.7.4
|
||||
github.com/containers/image v1.3
|
||||
github.com/containers/storage v1.4
|
||||
github.com/containers/psgo dc0bc9fac5b715034c4310ed4d795b3182360842
|
||||
github.com/containers/psgo v1.1
|
||||
github.com/coreos/go-systemd v14
|
||||
github.com/cri-o/ocicni 2d2983e40c242322a56c22a903785e7f83eb378c
|
||||
github.com/cyphar/filepath-securejoin v0.2.1
|
||||
github.com/davecgh/go-spew v1.1.0
|
||||
github.com/docker/distribution 7a8efe719e55bbfaff7bc5718cdf0ed51ca821df
|
||||
github.com/docker/distribution 5f6282db7d65e6d72ad7c2cc66310724a57be716
|
||||
github.com/docker/docker 86f080cff0914e9694068ed78d503701667c4c00
|
||||
github.com/docker/docker-credential-helpers d68f9aeca33f5fd3f08eeae5e9d175edf4e731d1
|
||||
github.com/docker/go-connections 3ede32e2033de7505e6500d6c868c2b9ed9f169d
|
||||
github.com/docker/docker-credential-helpers v0.6.1
|
||||
github.com/docker/go-connections v0.4.0
|
||||
github.com/docker/go-units v0.3.2
|
||||
github.com/docker/libtrust aabc10ec26b754e797f9028f4589c5b7bd90dc20
|
||||
github.com/docker/spdystream ed496381df8283605c435b86d4fdd6f4f20b8c6e
|
||||
github.com/fatih/camelcase f6a740d52f961c60348ebb109adde9f4635d7540
|
||||
github.com/fsnotify/fsnotify 7d7316ed6e1ed2de075aab8dfc76de5d158d66e1
|
||||
github.com/ghodss/yaml 04f313413ffd65ce25f2541bfd2b2ceec5c0908c
|
||||
github.com/godbus/dbus a389bdde4dd695d414e47b755e95e72b7826432c
|
||||
github.com/gogo/protobuf c0656edd0d9eab7c66d1eb0c568f9039345796f7
|
||||
github.com/docker/spdystream 6480d4af844c189cf5dd913db24ddd339d3a4f85
|
||||
github.com/fatih/camelcase v1.0.0
|
||||
github.com/fsnotify/fsnotify v1.4.7
|
||||
github.com/ghodss/yaml v1.0.0
|
||||
# starting with dbus 5.0.0 coreos/go-systemd doesn't compile anymore
|
||||
github.com/godbus/dbus v4.1.0
|
||||
github.com/golang/protobuf v1.2.0
|
||||
github.com/gogo/protobuf v1.2.0
|
||||
github.com/golang/glog 23def4e6c14b4da8ac2ed8007337bc5eb5007998
|
||||
github.com/golang/groupcache b710c8433bd175204919eb38776e944233235d03
|
||||
github.com/golang/protobuf 4bd1920723d7b7c925de087aa32e2187708897f7
|
||||
github.com/google/gofuzz 44d81051d367757e1c7c6a5a86423ece9afcf63c
|
||||
github.com/googleapis/gnostic 0c5108395e2debce0d731cf0287ddf7242066aba
|
||||
github.com/gorilla/context v1.1
|
||||
github.com/gorilla/mux v1.3.0
|
||||
github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55
|
||||
github.com/hashicorp/go-multierror 83588e72410abfbe4df460eeb6f30841ae47d4c4
|
||||
github.com/hashicorp/golang-lru 0a025b7e63adc15a622f29b0b2c4c3848243bbf6
|
||||
github.com/imdario/mergo 0.2.2
|
||||
github.com/google/gofuzz 24818f796faf91cd76ec7bddd72458fbced7a6c1
|
||||
github.com/gorilla/context v1.1.1
|
||||
github.com/gorilla/mux v1.6.2
|
||||
github.com/hashicorp/errwrap v1.0.0
|
||||
github.com/hashicorp/go-multierror v1.0.0
|
||||
github.com/imdario/mergo v0.3.6
|
||||
github.com/json-iterator/go 1.1.5
|
||||
github.com/kr/pty v1.0.0
|
||||
github.com/mattn/go-runewidth v0.0.1
|
||||
github.com/modern-go/concurrent 1.0.3
|
||||
github.com/modern-go/reflect2 v1.0.1
|
||||
github.com/mattn/go-runewidth v0.0.4
|
||||
github.com/mistifyio/go-zfs v2.1.1
|
||||
github.com/mtrmac/gpgme b2432428689ca58c2b8e8dea9449d3295cf96fc9
|
||||
github.com/opencontainers/go-digest c9281466c8b2f606084ac71339773efd177436e7
|
||||
github.com/opencontainers/image-spec v1.0.0
|
||||
github.com/opencontainers/runc bbb17efcb4c0ab986407812a31ba333a7450064c
|
||||
github.com/opencontainers/runtime-spec d810dbc60d8c5aeeb3d054bd1132fab2121968ce
|
||||
github.com/opencontainers/runtime-tools master
|
||||
github.com/opencontainers/selinux 51c6c0a5dbc675792e953298cb9871819d6f9bb8
|
||||
github.com/ostreedev/ostree-go master
|
||||
github.com/pkg/errors v0.8.0
|
||||
github.com/pmezard/go-difflib 792786c7400a136282c1664665ae0a8db921c6c2
|
||||
github.com/pquerna/ffjson d49c2bc1aa135aad0c6f4fc2056623ec78f5d5ac
|
||||
github.com/opencontainers/runc v1.0.0-rc6
|
||||
github.com/opencontainers/runtime-spec 1722abf79c2f8f2675f47367f827c6491472cf27
|
||||
github.com/opencontainers/runtime-tools v0.8.0
|
||||
github.com/opencontainers/selinux v1.0.0
|
||||
github.com/ostreedev/ostree-go d0388bd827cfac6fa8eec760246eb8375674b2a0
|
||||
github.com/pkg/errors v0.8.1
|
||||
github.com/pmezard/go-difflib v1.0.0
|
||||
github.com/pquerna/ffjson e517b90714f7c0eabe6d2e570a5886ae077d6db6
|
||||
github.com/seccomp/libseccomp-golang v0.9.0
|
||||
github.com/seccomp/containers-golang master
|
||||
github.com/seccomp/containers-golang v0.1
|
||||
# TODO: logrus.IsTerminal() is private starting with v1.1.x and requires code changes in libpod
|
||||
github.com/sirupsen/logrus v1.0.0
|
||||
github.com/spf13/pflag 9ff6c6923cfffbcd502984b8e0c80539a94968b7
|
||||
github.com/stretchr/testify 4d4bfba8f1d1027c4fdbe371823030df51419987
|
||||
github.com/syndtr/gocapability e7cb7fa329f456b3855136a2642b197bad7366ba
|
||||
github.com/spf13/pflag v1.0.3
|
||||
github.com/stretchr/testify v1.3.0
|
||||
github.com/syndtr/gocapability d98352740cb2c55f81556b63d4a1ec64c5a319c2
|
||||
github.com/tchap/go-patricia v2.2.6
|
||||
github.com/ulule/deepcopier master
|
||||
github.com/urfave/cli 934abfb2f102315b5794e15ebc7949e4ca253920
|
||||
github.com/vbatts/tar-split v0.10.2
|
||||
github.com/vishvananda/netlink master
|
||||
github.com/vishvananda/netns master
|
||||
github.com/xeipuuv/gojsonpointer master
|
||||
github.com/xeipuuv/gojsonreference master
|
||||
github.com/xeipuuv/gojsonschema master
|
||||
golang.org/x/crypto 81e90905daefcd6fd217b62423c0908922eadb30
|
||||
golang.org/x/net c427ad74c6d7a814201695e9ffde0c5d400a7674
|
||||
golang.org/x/sys master
|
||||
golang.org/x/text f72d8390a633d5dfb0cc84043294db9f6c935756
|
||||
golang.org/x/time f51c12702a4d776e4c1fa9b0fabab841babae631
|
||||
golang.org/x/sync master
|
||||
google.golang.org/grpc v1.0.4 https://github.com/grpc/grpc-go
|
||||
github.com/ulule/deepcopier ca99b135e50f526fde9cd88705f0ff2f3f95b77c
|
||||
# TODO: urfave/cli is not active anymore. We should transition to another library.
|
||||
github.com/urfave/cli b67dcf995b6a7b7f14fad5fcb7cc5441b05e814b
|
||||
github.com/vbatts/tar-split v0.11.1
|
||||
github.com/vishvananda/netlink v1.0.0
|
||||
github.com/vishvananda/netns 13995c7128ccc8e51e9a6bd2b551020a27180abd
|
||||
github.com/xeipuuv/gojsonpointer 4e3ac2762d5f479393488629ee9370b50873b3a6
|
||||
github.com/xeipuuv/gojsonreference bd5ef7bd5415a7ac448318e64f11a24cd21e594b
|
||||
github.com/xeipuuv/gojsonschema v1.1.0
|
||||
golang.org/x/crypto ff983b9c42bc9fbf91556e191cc8efb585c16908 https://github.com/golang/crypto
|
||||
golang.org/x/net 45ffb0cd1ba084b73e26dee67e667e1be5acce83 https://github.com/golang/net
|
||||
golang.org/x/sys 7fbe1cd0fcc20051e1fcb87fbabec4a1bacaaeba https://github.com/golang/sys
|
||||
golang.org/x/text e6919f6577db79269a6443b9dc46d18f2238fb5d https://github.com/golang/text
|
||||
golang.org/x/time 85acf8d2951cb2a3bde7632f9ff273ef0379bcbd https://github.com/golang/time
|
||||
golang.org/x/sync 37e7f081c4d4c64e13b10787722085407fe5d15f https://github.com/golang/sync
|
||||
gopkg.in/cheggaaa/pb.v1 v1.0.27
|
||||
gopkg.in/inf.v0 v0.9.0
|
||||
gopkg.in/inf.v0 v0.9.1
|
||||
gopkg.in/mgo.v2 v2
|
||||
gopkg.in/square/go-jose.v2 v2.1.3
|
||||
gopkg.in/yaml.v2 v2
|
||||
k8s.io/api 5ce4aa0bf2f097f6021127b3d879eeda82026be8 https://github.com/kubernetes/api
|
||||
k8s.io/apiextensions-apiserver 1b31e26d82f1ec2e945c560790e98f34bb5f2e63 https://github.com/kubernetes/apiextensions-apiserver
|
||||
k8s.io/apimachinery 616b23029fa3dc3e0ccefd47963f5651a6543d94 https://github.com/kubernetes/apimachinery
|
||||
k8s.io/apiserver 4d1163080139f1f9094baf8a3a6099e85e1867f6 https://github.com/kubernetes/apiserver
|
||||
k8s.io/client-go 7cd1d3291b7d9b1e2d54d4b69eb65995eaf8888e https://github.com/kubernetes/client-go
|
||||
k8s.io/kube-openapi 275e2ce91dec4c05a4094a7b1daee5560b555ac9 https://github.com/kubernetes/kube-openapi
|
||||
k8s.io/utils 258e2a2fa64568210fbd6267cf1d8fd87c3cb86e https://github.com/kubernetes/utils
|
||||
github.com/mrunalp/fileutils master
|
||||
github.com/varlink/go master
|
||||
gopkg.in/yaml.v2 v2.2.2
|
||||
k8s.io/api kubernetes-1.10.13-beta.0 https://github.com/kubernetes/api
|
||||
k8s.io/apimachinery kubernetes-1.10.13-beta.0 https://github.com/kubernetes/apimachinery
|
||||
k8s.io/client-go kubernetes-1.10.13-beta.0 https://github.com/kubernetes/client-go
|
||||
github.com/mrunalp/fileutils 7d4729fb36185a7c1719923406c9d40e54fb93c7
|
||||
github.com/varlink/go e9fdc57f40123518ac513eb3443e50625ad6b434
|
||||
github.com/containers/buildah e7ca330f923701dba8859f5c014d0a9a3f7f0a49
|
||||
github.com/Nvveen/Gotty master
|
||||
github.com/fsouza/go-dockerclient master
|
||||
github.com/openshift/imagebuilder master
|
||||
github.com/ulikunitz/xz v0.5.4
|
||||
github.com/coreos/go-iptables 25d087f3cffd9aedc0c2b7eff25f23cbf3c20fe1
|
||||
# TODO: Gotty has not been updated since 2012. Can we find replacement?
|
||||
github.com/Nvveen/Gotty cd527374f1e5bff4938207604a14f2e38a9cf512
|
||||
# do not go beyond the below commit as the next one requires a more recent
|
||||
# docker which is in conflict with openshift/imagebuilder
|
||||
github.com/fsouza/go-dockerclient 29c1814d12c072344bb91aac5d2ff719db39c523
|
||||
github.com/openshift/imagebuilder 474d0f9df2cbabf006bd2b1c263a7b0789e228e0
|
||||
github.com/ulikunitz/xz v0.5.5
|
||||
github.com/coreos/go-iptables v0.4.0
|
||||
github.com/google/shlex c34317bd91bf98fab745d77b03933cf8769299fe
|
||||
github.com/pkg/profile v1.2.1
|
||||
github.com/klauspost/pgzip v1.2.1
|
||||
github.com/klauspost/compress v1.4.1
|
||||
github.com/klauspost/cpuid v1.2.0
|
||||
github.com/modern-go/reflect2 1.0.1
|
||||
github.com/modern-go/concurrent 1.0.3
|
|
@ -5,7 +5,7 @@ type csiEntryState struct {
|
|||
}
|
||||
|
||||
func (csiState csiEntryState) Handle(b byte) (s state, e error) {
|
||||
logger.Infof("CsiEntry::Handle %#x", b)
|
||||
csiState.parser.logf("CsiEntry::Handle %#x", b)
|
||||
|
||||
nextState, err := csiState.baseState.Handle(b)
|
||||
if nextState != nil || err != nil {
|
||||
|
@ -25,7 +25,7 @@ func (csiState csiEntryState) Handle(b byte) (s state, e error) {
|
|||
}
|
||||
|
||||
func (csiState csiEntryState) Transition(s state) error {
|
||||
logger.Infof("CsiEntry::Transition %s --> %s", csiState.Name(), s.Name())
|
||||
csiState.parser.logf("CsiEntry::Transition %s --> %s", csiState.Name(), s.Name())
|
||||
csiState.baseState.Transition(s)
|
||||
|
||||
switch s {
|
||||
|
|
|
@ -5,7 +5,7 @@ type csiParamState struct {
|
|||
}
|
||||
|
||||
func (csiState csiParamState) Handle(b byte) (s state, e error) {
|
||||
logger.Infof("CsiParam::Handle %#x", b)
|
||||
csiState.parser.logf("CsiParam::Handle %#x", b)
|
||||
|
||||
nextState, err := csiState.baseState.Handle(b)
|
||||
if nextState != nil || err != nil {
|
||||
|
@ -26,7 +26,7 @@ func (csiState csiParamState) Handle(b byte) (s state, e error) {
|
|||
}
|
||||
|
||||
func (csiState csiParamState) Transition(s state) error {
|
||||
logger.Infof("CsiParam::Transition %s --> %s", csiState.Name(), s.Name())
|
||||
csiState.parser.logf("CsiParam::Transition %s --> %s", csiState.Name(), s.Name())
|
||||
csiState.baseState.Transition(s)
|
||||
|
||||
switch s {
|
||||
|
|
|
@ -5,7 +5,7 @@ type escapeIntermediateState struct {
|
|||
}
|
||||
|
||||
func (escState escapeIntermediateState) Handle(b byte) (s state, e error) {
|
||||
logger.Infof("escapeIntermediateState::Handle %#x", b)
|
||||
escState.parser.logf("escapeIntermediateState::Handle %#x", b)
|
||||
nextState, err := escState.baseState.Handle(b)
|
||||
if nextState != nil || err != nil {
|
||||
return nextState, err
|
||||
|
@ -24,7 +24,7 @@ func (escState escapeIntermediateState) Handle(b byte) (s state, e error) {
|
|||
}
|
||||
|
||||
func (escState escapeIntermediateState) Transition(s state) error {
|
||||
logger.Infof("escapeIntermediateState::Transition %s --> %s", escState.Name(), s.Name())
|
||||
escState.parser.logf("escapeIntermediateState::Transition %s --> %s", escState.Name(), s.Name())
|
||||
escState.baseState.Transition(s)
|
||||
|
||||
switch s {
|
||||
|
|
|
@ -5,7 +5,7 @@ type escapeState struct {
|
|||
}
|
||||
|
||||
func (escState escapeState) Handle(b byte) (s state, e error) {
|
||||
logger.Infof("escapeState::Handle %#x", b)
|
||||
escState.parser.logf("escapeState::Handle %#x", b)
|
||||
nextState, err := escState.baseState.Handle(b)
|
||||
if nextState != nil || err != nil {
|
||||
return nextState, err
|
||||
|
@ -28,7 +28,7 @@ func (escState escapeState) Handle(b byte) (s state, e error) {
|
|||
}
|
||||
|
||||
func (escState escapeState) Transition(s state) error {
|
||||
logger.Infof("Escape::Transition %s --> %s", escState.Name(), s.Name())
|
||||
escState.parser.logf("Escape::Transition %s --> %s", escState.Name(), s.Name())
|
||||
escState.baseState.Transition(s)
|
||||
|
||||
switch s {
|
||||
|
|
|
@ -5,7 +5,7 @@ type oscStringState struct {
|
|||
}
|
||||
|
||||
func (oscState oscStringState) Handle(b byte) (s state, e error) {
|
||||
logger.Infof("OscString::Handle %#x", b)
|
||||
oscState.parser.logf("OscString::Handle %#x", b)
|
||||
nextState, err := oscState.baseState.Handle(b)
|
||||
if nextState != nil || err != nil {
|
||||
return nextState, err
|
||||
|
|
|
@ -2,14 +2,10 @@ package ansiterm
|
|||
|
||||
import (
|
||||
"errors"
|
||||
"io/ioutil"
|
||||
"log"
|
||||
"os"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
var logger *logrus.Logger
|
||||
|
||||
type AnsiParser struct {
|
||||
currState state
|
||||
eventHandler AnsiEventHandler
|
||||
|
@ -23,50 +19,69 @@ type AnsiParser struct {
|
|||
ground state
|
||||
oscString state
|
||||
stateMap []state
|
||||
|
||||
logf func(string, ...interface{})
|
||||
}
|
||||
|
||||
func CreateParser(initialState string, evtHandler AnsiEventHandler) *AnsiParser {
|
||||
logFile := ioutil.Discard
|
||||
type Option func(*AnsiParser)
|
||||
|
||||
if isDebugEnv := os.Getenv(LogEnv); isDebugEnv == "1" {
|
||||
logFile, _ = os.Create("ansiParser.log")
|
||||
func WithLogf(f func(string, ...interface{})) Option {
|
||||
return func(ap *AnsiParser) {
|
||||
ap.logf = f
|
||||
}
|
||||
}
|
||||
|
||||
logger = &logrus.Logger{
|
||||
Out: logFile,
|
||||
Formatter: new(logrus.TextFormatter),
|
||||
Level: logrus.InfoLevel,
|
||||
}
|
||||
|
||||
parser := &AnsiParser{
|
||||
func CreateParser(initialState string, evtHandler AnsiEventHandler, opts ...Option) *AnsiParser {
|
||||
ap := &AnsiParser{
|
||||
eventHandler: evtHandler,
|
||||
context: &ansiContext{},
|
||||
}
|
||||
|
||||
parser.csiEntry = csiEntryState{baseState{name: "CsiEntry", parser: parser}}
|
||||
parser.csiParam = csiParamState{baseState{name: "CsiParam", parser: parser}}
|
||||
parser.dcsEntry = dcsEntryState{baseState{name: "DcsEntry", parser: parser}}
|
||||
parser.escape = escapeState{baseState{name: "Escape", parser: parser}}
|
||||
parser.escapeIntermediate = escapeIntermediateState{baseState{name: "EscapeIntermediate", parser: parser}}
|
||||
parser.error = errorState{baseState{name: "Error", parser: parser}}
|
||||
parser.ground = groundState{baseState{name: "Ground", parser: parser}}
|
||||
parser.oscString = oscStringState{baseState{name: "OscString", parser: parser}}
|
||||
|
||||
parser.stateMap = []state{
|
||||
parser.csiEntry,
|
||||
parser.csiParam,
|
||||
parser.dcsEntry,
|
||||
parser.escape,
|
||||
parser.escapeIntermediate,
|
||||
parser.error,
|
||||
parser.ground,
|
||||
parser.oscString,
|
||||
for _, o := range opts {
|
||||
o(ap)
|
||||
}
|
||||
|
||||
parser.currState = getState(initialState, parser.stateMap)
|
||||
if isDebugEnv := os.Getenv(LogEnv); isDebugEnv == "1" {
|
||||
logFile, _ := os.Create("ansiParser.log")
|
||||
logger := log.New(logFile, "", log.LstdFlags)
|
||||
if ap.logf != nil {
|
||||
l := ap.logf
|
||||
ap.logf = func(s string, v ...interface{}) {
|
||||
l(s, v...)
|
||||
logger.Printf(s, v...)
|
||||
}
|
||||
} else {
|
||||
ap.logf = logger.Printf
|
||||
}
|
||||
}
|
||||
|
||||
logger.Infof("CreateParser: parser %p", parser)
|
||||
return parser
|
||||
if ap.logf == nil {
|
||||
ap.logf = func(string, ...interface{}) {}
|
||||
}
|
||||
|
||||
ap.csiEntry = csiEntryState{baseState{name: "CsiEntry", parser: ap}}
|
||||
ap.csiParam = csiParamState{baseState{name: "CsiParam", parser: ap}}
|
||||
ap.dcsEntry = dcsEntryState{baseState{name: "DcsEntry", parser: ap}}
|
||||
ap.escape = escapeState{baseState{name: "Escape", parser: ap}}
|
||||
ap.escapeIntermediate = escapeIntermediateState{baseState{name: "EscapeIntermediate", parser: ap}}
|
||||
ap.error = errorState{baseState{name: "Error", parser: ap}}
|
||||
ap.ground = groundState{baseState{name: "Ground", parser: ap}}
|
||||
ap.oscString = oscStringState{baseState{name: "OscString", parser: ap}}
|
||||
|
||||
ap.stateMap = []state{
|
||||
ap.csiEntry,
|
||||
ap.csiParam,
|
||||
ap.dcsEntry,
|
||||
ap.escape,
|
||||
ap.escapeIntermediate,
|
||||
ap.error,
|
||||
ap.ground,
|
||||
ap.oscString,
|
||||
}
|
||||
|
||||
ap.currState = getState(initialState, ap.stateMap)
|
||||
|
||||
ap.logf("CreateParser: parser %p", ap)
|
||||
return ap
|
||||
}
|
||||
|
||||
func getState(name string, states []state) state {
|
||||
|
@ -97,7 +112,7 @@ func (ap *AnsiParser) handle(b byte) error {
|
|||
}
|
||||
|
||||
if newState == nil {
|
||||
logger.Warning("newState is nil")
|
||||
ap.logf("WARNING: newState is nil")
|
||||
return errors.New("New state of 'nil' is invalid.")
|
||||
}
|
||||
|
||||
|
@ -111,23 +126,23 @@ func (ap *AnsiParser) handle(b byte) error {
|
|||
}
|
||||
|
||||
func (ap *AnsiParser) changeState(newState state) error {
|
||||
logger.Infof("ChangeState %s --> %s", ap.currState.Name(), newState.Name())
|
||||
ap.logf("ChangeState %s --> %s", ap.currState.Name(), newState.Name())
|
||||
|
||||
// Exit old state
|
||||
if err := ap.currState.Exit(); err != nil {
|
||||
logger.Infof("Exit state '%s' failed with : '%v'", ap.currState.Name(), err)
|
||||
ap.logf("Exit state '%s' failed with : '%v'", ap.currState.Name(), err)
|
||||
return err
|
||||
}
|
||||
|
||||
// Perform transition action
|
||||
if err := ap.currState.Transition(newState); err != nil {
|
||||
logger.Infof("Transition from '%s' to '%s' failed with: '%v'", ap.currState.Name(), newState.Name, err)
|
||||
ap.logf("Transition from '%s' to '%s' failed with: '%v'", ap.currState.Name(), newState.Name, err)
|
||||
return err
|
||||
}
|
||||
|
||||
// Enter new state
|
||||
if err := newState.Enter(); err != nil {
|
||||
logger.Infof("Enter state '%s' failed with: '%v'", newState.Name(), err)
|
||||
ap.logf("Enter state '%s' failed with: '%v'", newState.Name(), err)
|
||||
return err
|
||||
}
|
||||
|
||||
|
|
|
@ -27,7 +27,6 @@ func parseParams(bytes []byte) ([]string, error) {
|
|||
params = append(params, s)
|
||||
}
|
||||
|
||||
logger.Infof("Parsed params: %v with length: %d", params, len(params))
|
||||
return params, nil
|
||||
}
|
||||
|
||||
|
@ -37,7 +36,6 @@ func parseCmd(context ansiContext) (string, error) {
|
|||
|
||||
func getInt(params []string, dflt int) int {
|
||||
i := getInts(params, 1, dflt)[0]
|
||||
logger.Infof("getInt: %v", i)
|
||||
return i
|
||||
}
|
||||
|
||||
|
@ -60,8 +58,6 @@ func getInts(params []string, minCount int, dflt int) []int {
|
|||
}
|
||||
}
|
||||
|
||||
logger.Infof("getInts: %v", ints)
|
||||
|
||||
return ints
|
||||
}
|
||||
|
||||
|
|
|
@ -1,19 +1,15 @@
|
|||
package ansiterm
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
)
|
||||
|
||||
func (ap *AnsiParser) collectParam() error {
|
||||
currChar := ap.context.currentChar
|
||||
logger.Infof("collectParam %#x", currChar)
|
||||
ap.logf("collectParam %#x", currChar)
|
||||
ap.context.paramBuffer = append(ap.context.paramBuffer, currChar)
|
||||
return nil
|
||||
}
|
||||
|
||||
func (ap *AnsiParser) collectInter() error {
|
||||
currChar := ap.context.currentChar
|
||||
logger.Infof("collectInter %#x", currChar)
|
||||
ap.logf("collectInter %#x", currChar)
|
||||
ap.context.paramBuffer = append(ap.context.interBuffer, currChar)
|
||||
return nil
|
||||
}
|
||||
|
@ -21,8 +17,8 @@ func (ap *AnsiParser) collectInter() error {
|
|||
func (ap *AnsiParser) escDispatch() error {
|
||||
cmd, _ := parseCmd(*ap.context)
|
||||
intermeds := ap.context.interBuffer
|
||||
logger.Infof("escDispatch currentChar: %#x", ap.context.currentChar)
|
||||
logger.Infof("escDispatch: %v(%v)", cmd, intermeds)
|
||||
ap.logf("escDispatch currentChar: %#x", ap.context.currentChar)
|
||||
ap.logf("escDispatch: %v(%v)", cmd, intermeds)
|
||||
|
||||
switch cmd {
|
||||
case "D": // IND
|
||||
|
@ -43,8 +39,9 @@ func (ap *AnsiParser) escDispatch() error {
|
|||
func (ap *AnsiParser) csiDispatch() error {
|
||||
cmd, _ := parseCmd(*ap.context)
|
||||
params, _ := parseParams(ap.context.paramBuffer)
|
||||
ap.logf("Parsed params: %v with length: %d", params, len(params))
|
||||
|
||||
logger.Infof("csiDispatch: %v(%v)", cmd, params)
|
||||
ap.logf("csiDispatch: %v(%v)", cmd, params)
|
||||
|
||||
switch cmd {
|
||||
case "@":
|
||||
|
@ -102,7 +99,7 @@ func (ap *AnsiParser) csiDispatch() error {
|
|||
top, bottom := ints[0], ints[1]
|
||||
return ap.eventHandler.DECSTBM(top, bottom)
|
||||
default:
|
||||
logger.Errorf(fmt.Sprintf("Unsupported CSI command: '%s', with full context: %v", cmd, ap.context))
|
||||
ap.logf("ERROR: Unsupported CSI command: '%s', with full context: %v", cmd, ap.context)
|
||||
return nil
|
||||
}
|
||||
|
||||
|
|
|
@ -175,7 +175,7 @@ func GetStdFile(nFile int) (*os.File, uintptr) {
|
|||
|
||||
fd, err := syscall.GetStdHandle(nFile)
|
||||
if err != nil {
|
||||
panic(fmt.Errorf("Invalid standard handle indentifier: %v -- %v", nFile, err))
|
||||
panic(fmt.Errorf("Invalid standard handle identifier: %v -- %v", nFile, err))
|
||||
}
|
||||
|
||||
return file, uintptr(fd)
|
||||
|
|
|
@ -57,9 +57,14 @@ const (
|
|||
ENABLE_INSERT_MODE = 0x0020
|
||||
ENABLE_QUICK_EDIT_MODE = 0x0040
|
||||
ENABLE_EXTENDED_FLAGS = 0x0080
|
||||
ENABLE_AUTO_POSITION = 0x0100
|
||||
ENABLE_VIRTUAL_TERMINAL_INPUT = 0x0200
|
||||
|
||||
ENABLE_PROCESSED_OUTPUT = 0x0001
|
||||
ENABLE_WRAP_AT_EOL_OUTPUT = 0x0002
|
||||
ENABLE_VIRTUAL_TERMINAL_PROCESSING = 0x0004
|
||||
DISABLE_NEWLINE_AUTO_RETURN = 0x0008
|
||||
ENABLE_LVB_GRID_WORLDWIDE = 0x0010
|
||||
|
||||
// Character attributes
|
||||
// Note:
|
||||
|
|
|
@ -34,7 +34,7 @@ func (h *windowsAnsiEventHandler) setCursorPosition(position COORD, window SMALL
|
|||
if err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("Cursor position set: (%d, %d)", position.X, position.Y)
|
||||
h.logf("Cursor position set: (%d, %d)", position.X, position.Y)
|
||||
return err
|
||||
}
|
||||
|
||||
|
|
|
@ -50,8 +50,8 @@ func (h *windowsAnsiEventHandler) insertLines(param int) error {
|
|||
|
||||
// scroll scrolls the provided scroll region by param lines. The scroll region is in buffer coordinates.
|
||||
func (h *windowsAnsiEventHandler) scroll(param int, sr scrollRegion, info *CONSOLE_SCREEN_BUFFER_INFO) error {
|
||||
logger.Infof("scroll: scrollTop: %d, scrollBottom: %d", sr.top, sr.bottom)
|
||||
logger.Infof("scroll: windowTop: %d, windowBottom: %d", info.Window.Top, info.Window.Bottom)
|
||||
h.logf("scroll: scrollTop: %d, scrollBottom: %d", sr.top, sr.bottom)
|
||||
h.logf("scroll: windowTop: %d, windowBottom: %d", info.Window.Top, info.Window.Bottom)
|
||||
|
||||
// Copy from and clip to the scroll region (full buffer width)
|
||||
scrollRect := SMALL_RECT{
|
||||
|
|
|
@ -4,16 +4,13 @@ package winterm
|
|||
|
||||
import (
|
||||
"bytes"
|
||||
"io/ioutil"
|
||||
"log"
|
||||
"os"
|
||||
"strconv"
|
||||
|
||||
"github.com/Azure/go-ansiterm"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
var logger *logrus.Logger
|
||||
|
||||
type windowsAnsiEventHandler struct {
|
||||
fd uintptr
|
||||
file *os.File
|
||||
|
@ -28,32 +25,52 @@ type windowsAnsiEventHandler struct {
|
|||
marginByte byte
|
||||
curInfo *CONSOLE_SCREEN_BUFFER_INFO
|
||||
curPos COORD
|
||||
logf func(string, ...interface{})
|
||||
}
|
||||
|
||||
func CreateWinEventHandler(fd uintptr, file *os.File) ansiterm.AnsiEventHandler {
|
||||
logFile := ioutil.Discard
|
||||
type Option func(*windowsAnsiEventHandler)
|
||||
|
||||
if isDebugEnv := os.Getenv(ansiterm.LogEnv); isDebugEnv == "1" {
|
||||
logFile, _ = os.Create("winEventHandler.log")
|
||||
}
|
||||
|
||||
logger = &logrus.Logger{
|
||||
Out: logFile,
|
||||
Formatter: new(logrus.TextFormatter),
|
||||
Level: logrus.DebugLevel,
|
||||
func WithLogf(f func(string, ...interface{})) Option {
|
||||
return func(w *windowsAnsiEventHandler) {
|
||||
w.logf = f
|
||||
}
|
||||
}
|
||||
|
||||
func CreateWinEventHandler(fd uintptr, file *os.File, opts ...Option) ansiterm.AnsiEventHandler {
|
||||
infoReset, err := GetConsoleScreenBufferInfo(fd)
|
||||
if err != nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
return &windowsAnsiEventHandler{
|
||||
h := &windowsAnsiEventHandler{
|
||||
fd: fd,
|
||||
file: file,
|
||||
infoReset: infoReset,
|
||||
attributes: infoReset.Attributes,
|
||||
}
|
||||
for _, o := range opts {
|
||||
o(h)
|
||||
}
|
||||
|
||||
if isDebugEnv := os.Getenv(ansiterm.LogEnv); isDebugEnv == "1" {
|
||||
logFile, _ := os.Create("winEventHandler.log")
|
||||
logger := log.New(logFile, "", log.LstdFlags)
|
||||
if h.logf != nil {
|
||||
l := h.logf
|
||||
h.logf = func(s string, v ...interface{}) {
|
||||
l(s, v...)
|
||||
logger.Printf(s, v...)
|
||||
}
|
||||
} else {
|
||||
h.logf = logger.Printf
|
||||
}
|
||||
}
|
||||
|
||||
if h.logf == nil {
|
||||
h.logf = func(string, ...interface{}) {}
|
||||
}
|
||||
|
||||
return h
|
||||
}
|
||||
|
||||
type scrollRegion struct {
|
||||
|
@ -96,7 +113,7 @@ func (h *windowsAnsiEventHandler) simulateLF(includeCR bool) (bool, error) {
|
|||
if err := h.Flush(); err != nil {
|
||||
return false, err
|
||||
}
|
||||
logger.Info("Simulating LF inside scroll region")
|
||||
h.logf("Simulating LF inside scroll region")
|
||||
if err := h.scrollUp(1); err != nil {
|
||||
return false, err
|
||||
}
|
||||
|
@ -119,7 +136,7 @@ func (h *windowsAnsiEventHandler) simulateLF(includeCR bool) (bool, error) {
|
|||
} else {
|
||||
// The cursor is at the bottom of the screen but outside the scroll
|
||||
// region. Skip the LF.
|
||||
logger.Info("Simulating LF outside scroll region")
|
||||
h.logf("Simulating LF outside scroll region")
|
||||
if includeCR {
|
||||
if err := h.Flush(); err != nil {
|
||||
return false, err
|
||||
|
@ -151,7 +168,7 @@ func (h *windowsAnsiEventHandler) executeLF() error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Info("Resetting cursor position for LF without CR")
|
||||
h.logf("Resetting cursor position for LF without CR")
|
||||
if err := SetConsoleCursorPosition(h.fd, pos); err != nil {
|
||||
return err
|
||||
}
|
||||
|
@ -186,7 +203,7 @@ func (h *windowsAnsiEventHandler) Print(b byte) error {
|
|||
func (h *windowsAnsiEventHandler) Execute(b byte) error {
|
||||
switch b {
|
||||
case ansiterm.ANSI_TAB:
|
||||
logger.Info("Execute(TAB)")
|
||||
h.logf("Execute(TAB)")
|
||||
// Move to the next tab stop, but preserve auto-wrap if already set.
|
||||
if !h.wrapNext {
|
||||
pos, info, err := h.getCurrentInfo()
|
||||
|
@ -269,7 +286,7 @@ func (h *windowsAnsiEventHandler) CUU(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("CUU: [%v]", []string{strconv.Itoa(param)})
|
||||
h.logf("CUU: [%v]", []string{strconv.Itoa(param)})
|
||||
h.clearWrap()
|
||||
return h.moveCursorVertical(-param)
|
||||
}
|
||||
|
@ -278,7 +295,7 @@ func (h *windowsAnsiEventHandler) CUD(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("CUD: [%v]", []string{strconv.Itoa(param)})
|
||||
h.logf("CUD: [%v]", []string{strconv.Itoa(param)})
|
||||
h.clearWrap()
|
||||
return h.moveCursorVertical(param)
|
||||
}
|
||||
|
@ -287,7 +304,7 @@ func (h *windowsAnsiEventHandler) CUF(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("CUF: [%v]", []string{strconv.Itoa(param)})
|
||||
h.logf("CUF: [%v]", []string{strconv.Itoa(param)})
|
||||
h.clearWrap()
|
||||
return h.moveCursorHorizontal(param)
|
||||
}
|
||||
|
@ -296,7 +313,7 @@ func (h *windowsAnsiEventHandler) CUB(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("CUB: [%v]", []string{strconv.Itoa(param)})
|
||||
h.logf("CUB: [%v]", []string{strconv.Itoa(param)})
|
||||
h.clearWrap()
|
||||
return h.moveCursorHorizontal(-param)
|
||||
}
|
||||
|
@ -305,7 +322,7 @@ func (h *windowsAnsiEventHandler) CNL(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("CNL: [%v]", []string{strconv.Itoa(param)})
|
||||
h.logf("CNL: [%v]", []string{strconv.Itoa(param)})
|
||||
h.clearWrap()
|
||||
return h.moveCursorLine(param)
|
||||
}
|
||||
|
@ -314,7 +331,7 @@ func (h *windowsAnsiEventHandler) CPL(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("CPL: [%v]", []string{strconv.Itoa(param)})
|
||||
h.logf("CPL: [%v]", []string{strconv.Itoa(param)})
|
||||
h.clearWrap()
|
||||
return h.moveCursorLine(-param)
|
||||
}
|
||||
|
@ -323,7 +340,7 @@ func (h *windowsAnsiEventHandler) CHA(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("CHA: [%v]", []string{strconv.Itoa(param)})
|
||||
h.logf("CHA: [%v]", []string{strconv.Itoa(param)})
|
||||
h.clearWrap()
|
||||
return h.moveCursorColumn(param)
|
||||
}
|
||||
|
@ -332,7 +349,7 @@ func (h *windowsAnsiEventHandler) VPA(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("VPA: [[%d]]", param)
|
||||
h.logf("VPA: [[%d]]", param)
|
||||
h.clearWrap()
|
||||
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||
if err != nil {
|
||||
|
@ -348,7 +365,7 @@ func (h *windowsAnsiEventHandler) CUP(row int, col int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("CUP: [[%d %d]]", row, col)
|
||||
h.logf("CUP: [[%d %d]]", row, col)
|
||||
h.clearWrap()
|
||||
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||
if err != nil {
|
||||
|
@ -364,7 +381,7 @@ func (h *windowsAnsiEventHandler) HVP(row int, col int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("HVP: [[%d %d]]", row, col)
|
||||
h.logf("HVP: [[%d %d]]", row, col)
|
||||
h.clearWrap()
|
||||
return h.CUP(row, col)
|
||||
}
|
||||
|
@ -373,7 +390,7 @@ func (h *windowsAnsiEventHandler) DECTCEM(visible bool) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("DECTCEM: [%v]", []string{strconv.FormatBool(visible)})
|
||||
h.logf("DECTCEM: [%v]", []string{strconv.FormatBool(visible)})
|
||||
h.clearWrap()
|
||||
return nil
|
||||
}
|
||||
|
@ -382,7 +399,7 @@ func (h *windowsAnsiEventHandler) DECOM(enable bool) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("DECOM: [%v]", []string{strconv.FormatBool(enable)})
|
||||
h.logf("DECOM: [%v]", []string{strconv.FormatBool(enable)})
|
||||
h.clearWrap()
|
||||
h.originMode = enable
|
||||
return h.CUP(1, 1)
|
||||
|
@ -392,7 +409,7 @@ func (h *windowsAnsiEventHandler) DECCOLM(use132 bool) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("DECCOLM: [%v]", []string{strconv.FormatBool(use132)})
|
||||
h.logf("DECCOLM: [%v]", []string{strconv.FormatBool(use132)})
|
||||
h.clearWrap()
|
||||
if err := h.ED(2); err != nil {
|
||||
return err
|
||||
|
@ -407,7 +424,7 @@ func (h *windowsAnsiEventHandler) DECCOLM(use132 bool) error {
|
|||
}
|
||||
if info.Size.X < targetWidth {
|
||||
if err := SetConsoleScreenBufferSize(h.fd, COORD{targetWidth, info.Size.Y}); err != nil {
|
||||
logger.Info("set buffer failed:", err)
|
||||
h.logf("set buffer failed: %v", err)
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
@ -415,12 +432,12 @@ func (h *windowsAnsiEventHandler) DECCOLM(use132 bool) error {
|
|||
window.Left = 0
|
||||
window.Right = targetWidth - 1
|
||||
if err := SetConsoleWindowInfo(h.fd, true, window); err != nil {
|
||||
logger.Info("set window failed:", err)
|
||||
h.logf("set window failed: %v", err)
|
||||
return err
|
||||
}
|
||||
if info.Size.X > targetWidth {
|
||||
if err := SetConsoleScreenBufferSize(h.fd, COORD{targetWidth, info.Size.Y}); err != nil {
|
||||
logger.Info("set buffer failed:", err)
|
||||
h.logf("set buffer failed: %v", err)
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
@ -431,7 +448,7 @@ func (h *windowsAnsiEventHandler) ED(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("ED: [%v]", []string{strconv.Itoa(param)})
|
||||
h.logf("ED: [%v]", []string{strconv.Itoa(param)})
|
||||
h.clearWrap()
|
||||
|
||||
// [J -- Erases from the cursor to the end of the screen, including the cursor position.
|
||||
|
@ -490,7 +507,7 @@ func (h *windowsAnsiEventHandler) EL(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("EL: [%v]", strconv.Itoa(param))
|
||||
h.logf("EL: [%v]", strconv.Itoa(param))
|
||||
h.clearWrap()
|
||||
|
||||
// [K -- Erases from the cursor to the end of the line, including the cursor position.
|
||||
|
@ -531,7 +548,7 @@ func (h *windowsAnsiEventHandler) IL(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("IL: [%v]", strconv.Itoa(param))
|
||||
h.logf("IL: [%v]", strconv.Itoa(param))
|
||||
h.clearWrap()
|
||||
return h.insertLines(param)
|
||||
}
|
||||
|
@ -540,7 +557,7 @@ func (h *windowsAnsiEventHandler) DL(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("DL: [%v]", strconv.Itoa(param))
|
||||
h.logf("DL: [%v]", strconv.Itoa(param))
|
||||
h.clearWrap()
|
||||
return h.deleteLines(param)
|
||||
}
|
||||
|
@ -549,7 +566,7 @@ func (h *windowsAnsiEventHandler) ICH(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("ICH: [%v]", strconv.Itoa(param))
|
||||
h.logf("ICH: [%v]", strconv.Itoa(param))
|
||||
h.clearWrap()
|
||||
return h.insertCharacters(param)
|
||||
}
|
||||
|
@ -558,7 +575,7 @@ func (h *windowsAnsiEventHandler) DCH(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("DCH: [%v]", strconv.Itoa(param))
|
||||
h.logf("DCH: [%v]", strconv.Itoa(param))
|
||||
h.clearWrap()
|
||||
return h.deleteCharacters(param)
|
||||
}
|
||||
|
@ -572,7 +589,7 @@ func (h *windowsAnsiEventHandler) SGR(params []int) error {
|
|||
strings = append(strings, strconv.Itoa(v))
|
||||
}
|
||||
|
||||
logger.Infof("SGR: [%v]", strings)
|
||||
h.logf("SGR: [%v]", strings)
|
||||
|
||||
if len(params) <= 0 {
|
||||
h.attributes = h.infoReset.Attributes
|
||||
|
@ -606,7 +623,7 @@ func (h *windowsAnsiEventHandler) SU(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("SU: [%v]", []string{strconv.Itoa(param)})
|
||||
h.logf("SU: [%v]", []string{strconv.Itoa(param)})
|
||||
h.clearWrap()
|
||||
return h.scrollUp(param)
|
||||
}
|
||||
|
@ -615,13 +632,13 @@ func (h *windowsAnsiEventHandler) SD(param int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("SD: [%v]", []string{strconv.Itoa(param)})
|
||||
h.logf("SD: [%v]", []string{strconv.Itoa(param)})
|
||||
h.clearWrap()
|
||||
return h.scrollDown(param)
|
||||
}
|
||||
|
||||
func (h *windowsAnsiEventHandler) DA(params []string) error {
|
||||
logger.Infof("DA: [%v]", params)
|
||||
h.logf("DA: [%v]", params)
|
||||
// DA cannot be implemented because it must send data on the VT100 input stream,
|
||||
// which is not available to go-ansiterm.
|
||||
return nil
|
||||
|
@ -631,7 +648,7 @@ func (h *windowsAnsiEventHandler) DECSTBM(top int, bottom int) error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Infof("DECSTBM: [%d, %d]", top, bottom)
|
||||
h.logf("DECSTBM: [%d, %d]", top, bottom)
|
||||
|
||||
// Windows is 0 indexed, Linux is 1 indexed
|
||||
h.sr.top = int16(top - 1)
|
||||
|
@ -646,7 +663,7 @@ func (h *windowsAnsiEventHandler) RI() error {
|
|||
if err := h.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
logger.Info("RI: []")
|
||||
h.logf("RI: []")
|
||||
h.clearWrap()
|
||||
|
||||
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||
|
@ -663,21 +680,21 @@ func (h *windowsAnsiEventHandler) RI() error {
|
|||
}
|
||||
|
||||
func (h *windowsAnsiEventHandler) IND() error {
|
||||
logger.Info("IND: []")
|
||||
h.logf("IND: []")
|
||||
return h.executeLF()
|
||||
}
|
||||
|
||||
func (h *windowsAnsiEventHandler) Flush() error {
|
||||
h.curInfo = nil
|
||||
if h.buffer.Len() > 0 {
|
||||
logger.Infof("Flush: [%s]", h.buffer.Bytes())
|
||||
h.logf("Flush: [%s]", h.buffer.Bytes())
|
||||
if _, err := h.buffer.WriteTo(h.file); err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
||||
if h.wrapNext && !h.drewMarginByte {
|
||||
logger.Infof("Flush: drawing margin byte '%c'", h.marginByte)
|
||||
h.logf("Flush: drawing margin byte '%c'", h.marginByte)
|
||||
|
||||
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||
if err != nil {
|
||||
|
|
|
@ -303,7 +303,7 @@ func FileInfoFromHeader(hdr *tar.Header) (name string, size int64, fileInfo *win
|
|||
if err != nil {
|
||||
return "", 0, nil, err
|
||||
}
|
||||
fileInfo.FileAttributes = uintptr(attr)
|
||||
fileInfo.FileAttributes = uint32(attr)
|
||||
} else {
|
||||
if hdr.Typeflag == tar.TypeDir {
|
||||
fileInfo.FileAttributes |= syscall.FILE_ATTRIBUTE_DIRECTORY
|
||||
|
|
|
@ -16,7 +16,6 @@ import (
|
|||
//sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort
|
||||
//sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus
|
||||
//sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes
|
||||
//sys timeBeginPeriod(period uint32) (n int32) = winmm.timeBeginPeriod
|
||||
|
||||
type atomicBool int32
|
||||
|
||||
|
@ -153,8 +152,6 @@ func (f *win32File) prepareIo() (*ioOperation, error) {
|
|||
|
||||
// ioCompletionProcessor processes completed async IOs forever
|
||||
func ioCompletionProcessor(h syscall.Handle) {
|
||||
// Set the timer resolution to 1. This fixes a performance regression in golang 1.6.
|
||||
timeBeginPeriod(1)
|
||||
for {
|
||||
var bytes uint32
|
||||
var key uintptr
|
||||
|
|
|
@ -20,7 +20,8 @@ const (
|
|||
// FileBasicInfo contains file access time and file attributes information.
|
||||
type FileBasicInfo struct {
|
||||
CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime
|
||||
FileAttributes uintptr // includes padding
|
||||
FileAttributes uint32
|
||||
pad uint32 // padding
|
||||
}
|
||||
|
||||
// GetFileBasicInfo retrieves times and attributes for a file.
|
||||
|
|
|
@ -15,13 +15,13 @@ import (
|
|||
//sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe
|
||||
//sys createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateNamedPipeW
|
||||
//sys createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateFileW
|
||||
//sys waitNamedPipe(name string, timeout uint32) (err error) = WaitNamedPipeW
|
||||
//sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo
|
||||
//sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW
|
||||
//sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc
|
||||
|
||||
const (
|
||||
cERROR_PIPE_BUSY = syscall.Errno(231)
|
||||
cERROR_NO_DATA = syscall.Errno(232)
|
||||
cERROR_PIPE_CONNECTED = syscall.Errno(535)
|
||||
cERROR_SEM_TIMEOUT = syscall.Errno(121)
|
||||
|
||||
|
@ -120,6 +120,11 @@ func (f *win32MessageBytePipe) Read(b []byte) (int, error) {
|
|||
// zero-byte message, ensure that all future Read() calls
|
||||
// also return EOF.
|
||||
f.readEOF = true
|
||||
} else if err == syscall.ERROR_MORE_DATA {
|
||||
// ERROR_MORE_DATA indicates that the pipe's read mode is message mode
|
||||
// and the message still has more bytes. Treat this as a success, since
|
||||
// this package presents all named pipes as byte streams.
|
||||
err = nil
|
||||
}
|
||||
return n, err
|
||||
}
|
||||
|
@ -133,12 +138,14 @@ func (s pipeAddress) String() string {
|
|||
}
|
||||
|
||||
// DialPipe connects to a named pipe by path, timing out if the connection
|
||||
// takes longer than the specified duration. If timeout is nil, then the timeout
|
||||
// is the default timeout established by the pipe server.
|
||||
// takes longer than the specified duration. If timeout is nil, then we use
|
||||
// a default timeout of 5 seconds. (We do not use WaitNamedPipe.)
|
||||
func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
|
||||
var absTimeout time.Time
|
||||
if timeout != nil {
|
||||
absTimeout = time.Now().Add(*timeout)
|
||||
} else {
|
||||
absTimeout = time.Now().Add(time.Second * 2)
|
||||
}
|
||||
var err error
|
||||
var h syscall.Handle
|
||||
|
@ -147,22 +154,13 @@ func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
|
|||
if err != cERROR_PIPE_BUSY {
|
||||
break
|
||||
}
|
||||
now := time.Now()
|
||||
var ms uint32
|
||||
if absTimeout.IsZero() {
|
||||
ms = cNMPWAIT_USE_DEFAULT_WAIT
|
||||
} else if now.After(absTimeout) {
|
||||
ms = cNMPWAIT_NOWAIT
|
||||
} else {
|
||||
ms = uint32(absTimeout.Sub(now).Nanoseconds() / 1000 / 1000)
|
||||
}
|
||||
err = waitNamedPipe(path, ms)
|
||||
if err != nil {
|
||||
if err == cERROR_SEM_TIMEOUT {
|
||||
if time.Now().After(absTimeout) {
|
||||
return nil, ErrTimeout
|
||||
}
|
||||
break
|
||||
}
|
||||
|
||||
// Wait 10 msec and try again. This is a rather simplistic
|
||||
// view, as we always try each 10 milliseconds.
|
||||
time.Sleep(time.Millisecond * 10)
|
||||
}
|
||||
if err != nil {
|
||||
return nil, &os.PathError{Op: "open", Path: path, Err: err}
|
||||
|
@ -174,16 +172,6 @@ func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
|
|||
return nil, err
|
||||
}
|
||||
|
||||
var state uint32
|
||||
err = getNamedPipeHandleState(h, &state, nil, nil, nil, nil, 0)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if state&cPIPE_READMODE_MESSAGE != 0 {
|
||||
return nil, &os.PathError{Op: "open", Path: path, Err: errors.New("message readmode pipes not supported")}
|
||||
}
|
||||
|
||||
f, err := makeWin32File(h)
|
||||
if err != nil {
|
||||
syscall.Close(h)
|
||||
|
@ -254,20 +242,18 @@ func (l *win32PipeListener) makeServerPipe() (*win32File, error) {
|
|||
return f, nil
|
||||
}
|
||||
|
||||
func (l *win32PipeListener) listenerRoutine() {
|
||||
closed := false
|
||||
for !closed {
|
||||
select {
|
||||
case <-l.closeCh:
|
||||
closed = true
|
||||
case responseCh := <-l.acceptCh:
|
||||
func (l *win32PipeListener) makeConnectedServerPipe() (*win32File, error) {
|
||||
p, err := l.makeServerPipe()
|
||||
if err == nil {
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// Wait for the client to connect.
|
||||
ch := make(chan error)
|
||||
go func(p *win32File) {
|
||||
ch <- connectPipe(p)
|
||||
}(p)
|
||||
|
||||
select {
|
||||
case err = <-ch:
|
||||
if err != nil {
|
||||
|
@ -282,10 +268,31 @@ func (l *win32PipeListener) listenerRoutine() {
|
|||
if err == nil || err == ErrFileClosed {
|
||||
err = ErrPipeListenerClosed
|
||||
}
|
||||
}
|
||||
return p, err
|
||||
}
|
||||
|
||||
func (l *win32PipeListener) listenerRoutine() {
|
||||
closed := false
|
||||
for !closed {
|
||||
select {
|
||||
case <-l.closeCh:
|
||||
closed = true
|
||||
case responseCh := <-l.acceptCh:
|
||||
var (
|
||||
p *win32File
|
||||
err error
|
||||
)
|
||||
for {
|
||||
p, err = l.makeConnectedServerPipe()
|
||||
// If the connection was immediately closed by the client, try
|
||||
// again.
|
||||
if err != cERROR_NO_DATA {
|
||||
break
|
||||
}
|
||||
}
|
||||
responseCh <- acceptResponse{p, err}
|
||||
closed = err == ErrPipeListenerClosed
|
||||
}
|
||||
}
|
||||
syscall.Close(l.firstHandle)
|
||||
|
@ -334,13 +341,23 @@ func ListenPipe(path string, c *PipeConfig) (net.Listener, error) {
|
|||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Immediately open and then close a client handle so that the named pipe is
|
||||
// created but not currently accepting connections.
|
||||
// Create a client handle and connect it. This results in the pipe
|
||||
// instance always existing, so that clients see ERROR_PIPE_BUSY
|
||||
// rather than ERROR_FILE_NOT_FOUND. This ties the first instance
|
||||
// up so that no other instances can be used. This would have been
|
||||
// cleaner if the Win32 API matched CreateFile with ConnectNamedPipe
|
||||
// instead of CreateNamedPipe. (Apparently created named pipes are
|
||||
// considered to be in listening state regardless of whether any
|
||||
// active calls to ConnectNamedPipe are outstanding.)
|
||||
h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
|
||||
if err != nil {
|
||||
syscall.Close(h)
|
||||
return nil, err
|
||||
}
|
||||
// Close the client handle. The server side of the instance will
|
||||
// still be busy, leading to ERROR_PIPE_BUSY instead of
|
||||
// ERROR_NOT_FOUND, as long as we don't close the server handle,
|
||||
// or disconnect the client with DisconnectNamedPipe.
|
||||
syscall.Close(h2)
|
||||
l := &win32PipeListener{
|
||||
firstHandle: h,
|
||||
|
|
|
@ -38,14 +38,12 @@ func errnoErr(e syscall.Errno) error {
|
|||
|
||||
var (
|
||||
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
|
||||
modwinmm = windows.NewLazySystemDLL("winmm.dll")
|
||||
modadvapi32 = windows.NewLazySystemDLL("advapi32.dll")
|
||||
|
||||
procCancelIoEx = modkernel32.NewProc("CancelIoEx")
|
||||
procCreateIoCompletionPort = modkernel32.NewProc("CreateIoCompletionPort")
|
||||
procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus")
|
||||
procSetFileCompletionNotificationModes = modkernel32.NewProc("SetFileCompletionNotificationModes")
|
||||
proctimeBeginPeriod = modwinmm.NewProc("timeBeginPeriod")
|
||||
procConnectNamedPipe = modkernel32.NewProc("ConnectNamedPipe")
|
||||
procCreateNamedPipeW = modkernel32.NewProc("CreateNamedPipeW")
|
||||
procCreateFileW = modkernel32.NewProc("CreateFileW")
|
||||
|
@ -122,12 +120,6 @@ func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err erro
|
|||
return
|
||||
}
|
||||
|
||||
func timeBeginPeriod(period uint32) (n int32) {
|
||||
r0, _, _ := syscall.Syscall(proctimeBeginPeriod.Addr(), 1, uintptr(period), 0, 0)
|
||||
n = int32(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0)
|
||||
if r1 == 0 {
|
||||
|
|
|
@ -1,12 +1,41 @@
|
|||
# hcsshim
|
||||
|
||||
This package supports launching Windows Server containers from Go. It is
|
||||
primarily used in the [Docker Engine](https://github.com/docker/docker) project,
|
||||
but it can be freely used by other projects as well.
|
||||
[](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master)
|
||||
|
||||
This project has adopted the [Microsoft Open Source Code of
|
||||
Conduct](https://opensource.microsoft.com/codeofconduct/). For more information
|
||||
see the [Code of Conduct
|
||||
FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact
|
||||
[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional
|
||||
questions or comments.
|
||||
This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
|
||||
|
||||
It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well.
|
||||
|
||||
## Contributing
|
||||
|
||||
This project welcomes contributions and suggestions. Most contributions require you to agree to a
|
||||
Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us
|
||||
the rights to use your contribution. For details, visit https://cla.microsoft.com.
|
||||
|
||||
When you submit a pull request, a CLA-bot will automatically determine whether you need to provide
|
||||
a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions
|
||||
provided by the bot. You will only need to do this once across all repos using our CLA.
|
||||
|
||||
This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/).
|
||||
For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or
|
||||
contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments.
|
||||
|
||||
## Dependencies
|
||||
|
||||
This project requires Golang 1.9 or newer to build.
|
||||
|
||||
For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements).
|
||||
|
||||
## Reporting Security Issues
|
||||
|
||||
Security issues and bugs should be reported privately, via email, to the Microsoft Security
|
||||
Response Center (MSRC) at [secure@microsoft.com](mailto:secure@microsoft.com). You should
|
||||
receive a response within 24 hours. If for some reason you do not, please follow up via
|
||||
email to ensure we received your original message. Further information, including the
|
||||
[MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in
|
||||
the [Security TechCenter](https://technet.microsoft.com/en-us/security/default).
|
||||
|
||||
For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet
|
||||
|
||||
---------------
|
||||
Copyright (c) 2018 Microsoft Corp. All rights reserved.
|
||||
|
|
|
@ -1,28 +0,0 @@
|
|||
package hcsshim
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
// ActivateLayer will find the layer with the given id and mount it's filesystem.
|
||||
// For a read/write layer, the mounted filesystem will appear as a volume on the
|
||||
// host, while a read-only layer is generally expected to be a no-op.
|
||||
// An activated layer must later be deactivated via DeactivateLayer.
|
||||
func ActivateLayer(info DriverInfo, id string) error {
|
||||
title := "hcsshim::ActivateLayer "
|
||||
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
|
||||
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = activateLayer(&infop, id)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" - succeeded id=%s flavour=%d", id, info.Flavour)
|
||||
return nil
|
||||
}
|
|
@ -1,794 +1,192 @@
|
|||
package hcsshim
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"os"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/hcs"
|
||||
"github.com/Microsoft/hcsshim/internal/mergemaps"
|
||||
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||
)
|
||||
|
||||
var (
|
||||
defaultTimeout = time.Minute * 4
|
||||
)
|
||||
|
||||
const (
|
||||
pendingUpdatesQuery = `{ "PropertyTypes" : ["PendingUpdates"]}`
|
||||
statisticsQuery = `{ "PropertyTypes" : ["Statistics"]}`
|
||||
processListQuery = `{ "PropertyTypes" : ["ProcessList"]}`
|
||||
mappedVirtualDiskQuery = `{ "PropertyTypes" : ["MappedVirtualDisk"]}`
|
||||
)
|
||||
|
||||
type container struct {
|
||||
handleLock sync.RWMutex
|
||||
handle hcsSystem
|
||||
id string
|
||||
callbackNumber uintptr
|
||||
}
|
||||
|
||||
// ContainerProperties holds the properties for a container and the processes running in that container
|
||||
type ContainerProperties struct {
|
||||
ID string `json:"Id"`
|
||||
Name string
|
||||
SystemType string
|
||||
Owner string
|
||||
SiloGUID string `json:"SiloGuid,omitempty"`
|
||||
RuntimeID string `json:"RuntimeId,omitempty"`
|
||||
IsRuntimeTemplate bool `json:",omitempty"`
|
||||
RuntimeImagePath string `json:",omitempty"`
|
||||
Stopped bool `json:",omitempty"`
|
||||
ExitType string `json:",omitempty"`
|
||||
AreUpdatesPending bool `json:",omitempty"`
|
||||
ObRoot string `json:",omitempty"`
|
||||
Statistics Statistics `json:",omitempty"`
|
||||
ProcessList []ProcessListItem `json:",omitempty"`
|
||||
MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
|
||||
}
|
||||
type ContainerProperties = schema1.ContainerProperties
|
||||
|
||||
// MemoryStats holds the memory statistics for a container
|
||||
type MemoryStats struct {
|
||||
UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"`
|
||||
UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
|
||||
UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
|
||||
}
|
||||
type MemoryStats = schema1.MemoryStats
|
||||
|
||||
// ProcessorStats holds the processor statistics for a container
|
||||
type ProcessorStats struct {
|
||||
TotalRuntime100ns uint64 `json:",omitempty"`
|
||||
RuntimeUser100ns uint64 `json:",omitempty"`
|
||||
RuntimeKernel100ns uint64 `json:",omitempty"`
|
||||
}
|
||||
type ProcessorStats = schema1.ProcessorStats
|
||||
|
||||
// StorageStats holds the storage statistics for a container
|
||||
type StorageStats struct {
|
||||
ReadCountNormalized uint64 `json:",omitempty"`
|
||||
ReadSizeBytes uint64 `json:",omitempty"`
|
||||
WriteCountNormalized uint64 `json:",omitempty"`
|
||||
WriteSizeBytes uint64 `json:",omitempty"`
|
||||
}
|
||||
type StorageStats = schema1.StorageStats
|
||||
|
||||
// NetworkStats holds the network statistics for a container
|
||||
type NetworkStats struct {
|
||||
BytesReceived uint64 `json:",omitempty"`
|
||||
BytesSent uint64 `json:",omitempty"`
|
||||
PacketsReceived uint64 `json:",omitempty"`
|
||||
PacketsSent uint64 `json:",omitempty"`
|
||||
DroppedPacketsIncoming uint64 `json:",omitempty"`
|
||||
DroppedPacketsOutgoing uint64 `json:",omitempty"`
|
||||
EndpointId string `json:",omitempty"`
|
||||
InstanceId string `json:",omitempty"`
|
||||
}
|
||||
type NetworkStats = schema1.NetworkStats
|
||||
|
||||
// Statistics is the structure returned by a statistics call on a container
|
||||
type Statistics struct {
|
||||
Timestamp time.Time `json:",omitempty"`
|
||||
ContainerStartTime time.Time `json:",omitempty"`
|
||||
Uptime100ns uint64 `json:",omitempty"`
|
||||
Memory MemoryStats `json:",omitempty"`
|
||||
Processor ProcessorStats `json:",omitempty"`
|
||||
Storage StorageStats `json:",omitempty"`
|
||||
Network []NetworkStats `json:",omitempty"`
|
||||
}
|
||||
type Statistics = schema1.Statistics
|
||||
|
||||
// ProcessList is the structure of an item returned by a ProcessList call on a container
|
||||
type ProcessListItem struct {
|
||||
CreateTimestamp time.Time `json:",omitempty"`
|
||||
ImageName string `json:",omitempty"`
|
||||
KernelTime100ns uint64 `json:",omitempty"`
|
||||
MemoryCommitBytes uint64 `json:",omitempty"`
|
||||
MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"`
|
||||
MemoryWorkingSetSharedBytes uint64 `json:",omitempty"`
|
||||
ProcessId uint32 `json:",omitempty"`
|
||||
UserTime100ns uint64 `json:",omitempty"`
|
||||
}
|
||||
type ProcessListItem = schema1.ProcessListItem
|
||||
|
||||
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
|
||||
type MappedVirtualDiskController struct {
|
||||
MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
|
||||
}
|
||||
type MappedVirtualDiskController = schema1.MappedVirtualDiskController
|
||||
|
||||
// Type of Request Support in ModifySystem
|
||||
type RequestType string
|
||||
type RequestType = schema1.RequestType
|
||||
|
||||
// Type of Resource Support in ModifySystem
|
||||
type ResourceType string
|
||||
type ResourceType = schema1.ResourceType
|
||||
|
||||
// RequestType const
|
||||
const (
|
||||
Add RequestType = "Add"
|
||||
Remove RequestType = "Remove"
|
||||
Network ResourceType = "Network"
|
||||
Add = schema1.Add
|
||||
Remove = schema1.Remove
|
||||
Network = schema1.Network
|
||||
)
|
||||
|
||||
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
|
||||
// Supported resource types are Network and Request Types are Add/Remove
|
||||
type ResourceModificationRequestResponse struct {
|
||||
Resource ResourceType `json:"ResourceType"`
|
||||
Data interface{} `json:"Settings"`
|
||||
Request RequestType `json:"RequestType,omitempty"`
|
||||
type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
|
||||
|
||||
type container struct {
|
||||
system *hcs.System
|
||||
}
|
||||
|
||||
// createContainerAdditionalJSON is read from the environment at initialisation
|
||||
// createComputeSystemAdditionalJSON is read from the environment at initialisation
|
||||
// time. It allows an environment variable to define additional JSON which
|
||||
// is merged in the CreateContainer call to HCS.
|
||||
var createContainerAdditionalJSON string
|
||||
// is merged in the CreateComputeSystem call to HCS.
|
||||
var createContainerAdditionalJSON []byte
|
||||
|
||||
func init() {
|
||||
createContainerAdditionalJSON = os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON")
|
||||
createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON"))
|
||||
}
|
||||
|
||||
// CreateContainer creates a new container with the given configuration but does not start it.
|
||||
func CreateContainer(id string, c *ContainerConfig) (Container, error) {
|
||||
return createContainerWithJSON(id, c, "")
|
||||
fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
|
||||
}
|
||||
|
||||
// CreateContainerWithJSON creates a new container with the given configuration but does not start it.
|
||||
// It is identical to CreateContainer except that optional additional JSON can be merged before passing to HCS.
|
||||
func CreateContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) {
|
||||
return createContainerWithJSON(id, c, additionalJSON)
|
||||
}
|
||||
|
||||
func createContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) {
|
||||
operation := "CreateContainer"
|
||||
title := "HCSShim::" + operation
|
||||
|
||||
container := &container{
|
||||
id: id,
|
||||
}
|
||||
|
||||
configurationb, err := json.Marshal(c)
|
||||
system, err := hcs.CreateComputeSystem(id, fullConfig)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
configuration := string(configurationb)
|
||||
logrus.Debugf(title+" id=%s config=%s", id, configuration)
|
||||
|
||||
// Merge any additional JSON. Priority is given to what is passed in explicitly,
|
||||
// falling back to what's set in the environment.
|
||||
if additionalJSON == "" && createContainerAdditionalJSON != "" {
|
||||
additionalJSON = createContainerAdditionalJSON
|
||||
}
|
||||
if additionalJSON != "" {
|
||||
configurationMap := map[string]interface{}{}
|
||||
if err := json.Unmarshal([]byte(configuration), &configurationMap); err != nil {
|
||||
return nil, fmt.Errorf("failed to unmarshal %s: %s", configuration, err)
|
||||
}
|
||||
|
||||
additionalMap := map[string]interface{}{}
|
||||
if err := json.Unmarshal([]byte(additionalJSON), &additionalMap); err != nil {
|
||||
return nil, fmt.Errorf("failed to unmarshal %s: %s", additionalJSON, err)
|
||||
}
|
||||
|
||||
mergedMap := mergeMaps(additionalMap, configurationMap)
|
||||
mergedJSON, err := json.Marshal(mergedMap)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to marshal merged configuration map %+v: %s", mergedMap, err)
|
||||
}
|
||||
|
||||
configuration = string(mergedJSON)
|
||||
logrus.Debugf(title+" id=%s merged config=%s", id, configuration)
|
||||
}
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
identity syscall.Handle
|
||||
)
|
||||
createError := hcsCreateComputeSystem(id, configuration, identity, &container.handle, &resultp)
|
||||
|
||||
if createError == nil || IsPending(createError) {
|
||||
if err := container.registerCallback(); err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
}
|
||||
}
|
||||
|
||||
err = processAsyncHcsResult(createError, resultp, container.callbackNumber, hcsNotificationSystemCreateCompleted, &defaultTimeout)
|
||||
if err != nil {
|
||||
return nil, makeContainerError(container, operation, configuration, err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s handle=%d", id, container.handle)
|
||||
return container, nil
|
||||
}
|
||||
|
||||
// mergeMaps recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
|
||||
// in ToMap are overwritten. Values in fromMap are added to ToMap.
|
||||
// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
|
||||
func mergeMaps(fromMap, ToMap interface{}) interface{} {
|
||||
switch fromMap := fromMap.(type) {
|
||||
case map[string]interface{}:
|
||||
ToMap, ok := ToMap.(map[string]interface{})
|
||||
if !ok {
|
||||
return fromMap
|
||||
}
|
||||
for keyToMap, valueToMap := range ToMap {
|
||||
if valueFromMap, ok := fromMap[keyToMap]; ok {
|
||||
fromMap[keyToMap] = mergeMaps(valueFromMap, valueToMap)
|
||||
} else {
|
||||
fromMap[keyToMap] = valueToMap
|
||||
}
|
||||
}
|
||||
case nil:
|
||||
// merge(nil, map[string]interface{...}) -> map[string]interface{...}
|
||||
ToMap, ok := ToMap.(map[string]interface{})
|
||||
if ok {
|
||||
return ToMap
|
||||
}
|
||||
}
|
||||
return fromMap
|
||||
return &container{system}, err
|
||||
}
|
||||
|
||||
// OpenContainer opens an existing container by ID.
|
||||
func OpenContainer(id string) (Container, error) {
|
||||
operation := "OpenContainer"
|
||||
title := "HCSShim::" + operation
|
||||
logrus.Debugf(title+" id=%s", id)
|
||||
|
||||
container := &container{
|
||||
id: id,
|
||||
}
|
||||
|
||||
var (
|
||||
handle hcsSystem
|
||||
resultp *uint16
|
||||
)
|
||||
err := hcsOpenComputeSystem(id, &handle, &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
system, err := hcs.OpenComputeSystem(id)
|
||||
if err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
return nil, err
|
||||
}
|
||||
|
||||
container.handle = handle
|
||||
|
||||
if err := container.registerCallback(); err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle)
|
||||
return container, nil
|
||||
return &container{system}, err
|
||||
}
|
||||
|
||||
// GetContainers gets a list of the containers on the system that match the query
|
||||
func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
|
||||
operation := "GetContainers"
|
||||
title := "HCSShim::" + operation
|
||||
|
||||
queryb, err := json.Marshal(q)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
query := string(queryb)
|
||||
logrus.Debugf(title+" query=%s", query)
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
computeSystemsp *uint16
|
||||
)
|
||||
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if computeSystemsp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
computeSystemsRaw := convertAndFreeCoTaskMemBytes(computeSystemsp)
|
||||
computeSystems := []ContainerProperties{}
|
||||
if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
logrus.Debugf(title + " succeeded")
|
||||
return computeSystems, nil
|
||||
return hcs.GetComputeSystems(q)
|
||||
}
|
||||
|
||||
// Start synchronously starts the container.
|
||||
func (container *container) Start() error {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "Start"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
return convertSystemError(container.system.Start(), container)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
err := hcsStartComputeSystem(container.handle, "", &resultp)
|
||||
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemStartCompleted, &defaultTimeout)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
}
|
||||
|
||||
// Shutdown requests a container shutdown, if IsPending() on the error returned is true,
|
||||
// it may not actually be shut down until Wait() succeeds.
|
||||
// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
|
||||
func (container *container) Shutdown() error {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "Shutdown"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
return convertSystemError(container.system.Shutdown(), container)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
err := hcsShutdownComputeSystem(container.handle, "", &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
}
|
||||
|
||||
// Terminate requests a container terminate, if IsPending() on the error returned is true,
|
||||
// it may not actually be shut down until Wait() succeeds.
|
||||
// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
|
||||
func (container *container) Terminate() error {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "Terminate"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
return convertSystemError(container.system.Terminate(), container)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
err := hcsTerminateComputeSystem(container.handle, "", &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
}
|
||||
|
||||
// Wait synchronously waits for the container to shutdown or terminate.
|
||||
// Waits synchronously waits for the container to shutdown or terminate.
|
||||
func (container *container) Wait() error {
|
||||
operation := "Wait"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, nil)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
return convertSystemError(container.system.Wait(), container)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
|
||||
// returns false if timeout occurs.
|
||||
func (container *container) WaitTimeout(t time.Duration) error {
|
||||
return convertSystemError(container.system.WaitTimeout(t), container)
|
||||
}
|
||||
|
||||
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse.
|
||||
// If the timeout expires, IsTimeout(err) == true
|
||||
func (container *container) WaitTimeout(timeout time.Duration) error {
|
||||
operation := "WaitTimeout"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, &timeout)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
// Pause pauses the execution of a container.
|
||||
func (container *container) Pause() error {
|
||||
return convertSystemError(container.system.Pause(), container)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
}
|
||||
|
||||
func (container *container) properties(query string) (*ContainerProperties, error) {
|
||||
var (
|
||||
resultp *uint16
|
||||
propertiesp *uint16
|
||||
)
|
||||
err := hcsGetComputeSystemProperties(container.handle, query, &propertiesp, &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if propertiesp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp)
|
||||
properties := &ContainerProperties{}
|
||||
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return properties, nil
|
||||
// Resume resumes the execution of a container.
|
||||
func (container *container) Resume() error {
|
||||
return convertSystemError(container.system.Resume(), container)
|
||||
}
|
||||
|
||||
// HasPendingUpdates returns true if the container has updates pending to install
|
||||
func (container *container) HasPendingUpdates() (bool, error) {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "HasPendingUpdates"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return false, makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
return false, nil
|
||||
}
|
||||
|
||||
properties, err := container.properties(pendingUpdatesQuery)
|
||||
if err != nil {
|
||||
return false, makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return properties.AreUpdatesPending, nil
|
||||
}
|
||||
|
||||
// Statistics returns statistics for the container
|
||||
// Statistics returns statistics for the container. This is a legacy v1 call
|
||||
func (container *container) Statistics() (Statistics, error) {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "Statistics"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return Statistics{}, makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
properties, err := container.properties(statisticsQuery)
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
|
||||
if err != nil {
|
||||
return Statistics{}, makeContainerError(container, operation, "", err)
|
||||
return Statistics{}, convertSystemError(err, container)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return properties.Statistics, nil
|
||||
}
|
||||
|
||||
// ProcessList returns an array of ProcessListItems for the container
|
||||
// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
|
||||
func (container *container) ProcessList() ([]ProcessListItem, error) {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "ProcessList"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
properties, err := container.properties(processListQuery)
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
|
||||
if err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return properties.ProcessList, nil
|
||||
}
|
||||
|
||||
// MappedVirtualDisks returns a map of the controllers and the disks mapped
|
||||
// to a container.
|
||||
//
|
||||
// Example of JSON returned by the query.
|
||||
//{
|
||||
// "Id":"1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3_svm",
|
||||
// "SystemType":"Container",
|
||||
// "RuntimeOsType":"Linux",
|
||||
// "RuntimeId":"00000000-0000-0000-0000-000000000000",
|
||||
// "State":"Running",
|
||||
// "MappedVirtualDiskControllers":{
|
||||
// "0":{
|
||||
// "MappedVirtualDisks":{
|
||||
// "2":{
|
||||
// "HostPath":"C:\\lcow\\lcow\\scratch\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3.vhdx",
|
||||
// "ContainerPath":"/mnt/gcs/LinuxServiceVM/scratch",
|
||||
// "Lun":2,
|
||||
// "CreateInUtilityVM":true
|
||||
// },
|
||||
// "3":{
|
||||
// "HostPath":"C:\\lcow\\lcow\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3\\sandbox.vhdx",
|
||||
// "Lun":3,
|
||||
// "CreateInUtilityVM":true,
|
||||
// "AttachOnly":true
|
||||
// }
|
||||
// }
|
||||
// }
|
||||
// }
|
||||
//}
|
||||
// This is a legacy v1 call
|
||||
func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "MappedVirtualDiskList"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
properties, err := container.properties(mappedVirtualDiskQuery)
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
|
||||
if err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return properties.MappedVirtualDiskControllers, nil
|
||||
}
|
||||
|
||||
// Pause pauses the execution of the container. This feature is not enabled in TP5.
|
||||
func (container *container) Pause() error {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "Pause"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
err := hcsPauseComputeSystem(container.handle, "", &resultp)
|
||||
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemPauseCompleted, &defaultTimeout)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
}
|
||||
|
||||
// Resume resumes the execution of the container. This feature is not enabled in TP5.
|
||||
func (container *container) Resume() error {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "Resume"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
err := hcsResumeComputeSystem(container.handle, "", &resultp)
|
||||
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemResumeCompleted, &defaultTimeout)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
}
|
||||
|
||||
// CreateProcess launches a new process within the container.
|
||||
func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "CreateProcess"
|
||||
title := "HCSShim::Container::" + operation
|
||||
var (
|
||||
processInfo hcsProcessInformation
|
||||
processHandle hcsProcess
|
||||
resultp *uint16
|
||||
)
|
||||
|
||||
if container.handle == 0 {
|
||||
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
// If we are not emulating a console, ignore any console size passed to us
|
||||
if !c.EmulateConsole {
|
||||
c.ConsoleSize[0] = 0
|
||||
c.ConsoleSize[1] = 0
|
||||
}
|
||||
|
||||
configurationb, err := json.Marshal(c)
|
||||
p, err := container.system.CreateProcess(c)
|
||||
if err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
|
||||
configuration := string(configurationb)
|
||||
logrus.Debugf(title+" id=%s config=%s", container.id, configuration)
|
||||
|
||||
err = hcsCreateProcess(container.handle, configuration, &processInfo, &processHandle, &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
if err != nil {
|
||||
return nil, makeContainerError(container, operation, configuration, err)
|
||||
}
|
||||
|
||||
process := &process{
|
||||
handle: processHandle,
|
||||
processID: int(processInfo.ProcessId),
|
||||
container: container,
|
||||
cachedPipes: &cachedPipes{
|
||||
stdIn: processInfo.StdInput,
|
||||
stdOut: processInfo.StdOutput,
|
||||
stdErr: processInfo.StdError,
|
||||
},
|
||||
}
|
||||
|
||||
if err := process.registerCallback(); err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s processid=%d", container.id, process.processID)
|
||||
return process, nil
|
||||
return &process{p}, nil
|
||||
}
|
||||
|
||||
// OpenProcess gets an interface to an existing process within the container.
|
||||
func (container *container) OpenProcess(pid int) (Process, error) {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "OpenProcess"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s, processid=%d", container.id, pid)
|
||||
var (
|
||||
processHandle hcsProcess
|
||||
resultp *uint16
|
||||
)
|
||||
|
||||
if container.handle == 0 {
|
||||
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
err := hcsOpenProcess(container.handle, uint32(pid), &processHandle, &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
p, err := container.system.OpenProcess(pid)
|
||||
if err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
|
||||
process := &process{
|
||||
handle: processHandle,
|
||||
processID: pid,
|
||||
container: container,
|
||||
}
|
||||
|
||||
if err := process.registerCallback(); err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s processid=%s", container.id, process.processID)
|
||||
return process, nil
|
||||
return &process{p}, nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the container but does not terminate or wait for it.
|
||||
func (container *container) Close() error {
|
||||
container.handleLock.Lock()
|
||||
defer container.handleLock.Unlock()
|
||||
operation := "Close"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
// Don't double free this
|
||||
if container.handle == 0 {
|
||||
return nil
|
||||
return convertSystemError(container.system.Close(), container)
|
||||
}
|
||||
|
||||
if err := container.unregisterCallback(); err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
if err := hcsCloseComputeSystem(container.handle); err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
container.handle = 0
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
}
|
||||
|
||||
func (container *container) registerCallback() error {
|
||||
context := ¬ifcationWatcherContext{
|
||||
channels: newChannels(),
|
||||
}
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackNumber := nextCallback
|
||||
nextCallback++
|
||||
callbackMap[callbackNumber] = context
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
var callbackHandle hcsCallback
|
||||
err := hcsRegisterComputeSystemCallback(container.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
context.handle = callbackHandle
|
||||
container.callbackNumber = callbackNumber
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (container *container) unregisterCallback() error {
|
||||
callbackNumber := container.callbackNumber
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
handle := context.handle
|
||||
|
||||
if handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
// hcsUnregisterComputeSystemCallback has its own syncronization
|
||||
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||
err := hcsUnregisterComputeSystemCallback(handle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
closeChannels(context.channels)
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackMap[callbackNumber] = nil
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
handle = 0
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Modifies the System by sending a request to HCS
|
||||
// Modify the System
|
||||
func (container *container) Modify(config *ResourceModificationRequestResponse) error {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "Modify"
|
||||
title := "HCSShim::Container::" + operation
|
||||
|
||||
if container.handle == 0 {
|
||||
return makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
requestJSON, err := json.Marshal(config)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
requestString := string(requestJSON)
|
||||
logrus.Debugf(title+" id=%s request=%s", container.id, requestString)
|
||||
|
||||
var resultp *uint16
|
||||
err = hcsModifyComputeSystem(container.handle, requestString, &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
return convertSystemError(container.system.Modify(config), container)
|
||||
}
|
||||
|
|
|
@ -1,27 +0,0 @@
|
|||
package hcsshim
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
// CreateLayer creates a new, empty, read-only layer on the filesystem based on
|
||||
// the parent layer provided.
|
||||
func CreateLayer(info DriverInfo, id, parent string) error {
|
||||
title := "hcsshim::CreateLayer "
|
||||
logrus.Debugf(title+"Flavour %d ID %s parent %s", info.Flavour, id, parent)
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = createLayer(&infop, id, parent)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "id=%s parent=%s flavour=%d", id, parent, info.Flavour)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" - succeeded id=%s parent=%s flavour=%d", id, parent, info.Flavour)
|
||||
return nil
|
||||
}
|
|
@ -1,35 +0,0 @@
|
|||
package hcsshim
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
// CreateSandboxLayer creates and populates new read-write layer for use by a container.
|
||||
// This requires both the id of the direct parent layer, as well as the full list
|
||||
// of paths to all parent layers up to the base (and including the direct parent
|
||||
// whose id was provided).
|
||||
func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
|
||||
title := "hcsshim::CreateSandboxLayer "
|
||||
logrus.Debugf(title+"layerId %s parentId %s", layerId, parentId)
|
||||
|
||||
// Generate layer descriptors
|
||||
layers, err := layerPathsToDescriptors(parentLayerPaths)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = createSandboxLayer(&infop, layerId, parentId, layers)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "layerId=%s parentId=%s", layerId, parentId)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+"- succeeded layerId=%s parentId=%s", layerId, parentId)
|
||||
return nil
|
||||
}
|
|
@ -1,26 +0,0 @@
|
|||
package hcsshim
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
// DeactivateLayer will dismount a layer that was mounted via ActivateLayer.
|
||||
func DeactivateLayer(info DriverInfo, id string) error {
|
||||
title := "hcsshim::DeactivateLayer "
|
||||
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = deactivateLayer(&infop, id)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id)
|
||||
return nil
|
||||
}
|
|
@ -1,27 +0,0 @@
|
|||
package hcsshim
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
// DestroyLayer will remove the on-disk files representing the layer with the given
|
||||
// id, including that layer's containing folder, if any.
|
||||
func DestroyLayer(info DriverInfo, id string) error {
|
||||
title := "hcsshim::DestroyLayer "
|
||||
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = destroyLayer(&infop, id)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id)
|
||||
return nil
|
||||
}
|
|
@ -1,83 +1,91 @@
|
|||
package hcsshim
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/hcs"
|
||||
"github.com/Microsoft/hcsshim/internal/hcserror"
|
||||
)
|
||||
|
||||
var (
|
||||
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
|
||||
ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
|
||||
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist
|
||||
ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist
|
||||
|
||||
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||
ErrElementNotFound = syscall.Errno(0x490)
|
||||
ErrElementNotFound = hcs.ErrElementNotFound
|
||||
|
||||
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||
ErrNotSupported = syscall.Errno(0x32)
|
||||
ErrNotSupported = hcs.ErrNotSupported
|
||||
|
||||
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
|
||||
// decimal -2147024883 / hex 0x8007000d
|
||||
ErrInvalidData = syscall.Errno(0xd)
|
||||
ErrInvalidData = hcs.ErrInvalidData
|
||||
|
||||
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
|
||||
ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
|
||||
ErrHandleClose = hcs.ErrHandleClose
|
||||
|
||||
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
|
||||
ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
|
||||
ErrAlreadyClosed = hcs.ErrAlreadyClosed
|
||||
|
||||
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
|
||||
ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
|
||||
ErrInvalidNotificationType = hcs.ErrInvalidNotificationType
|
||||
|
||||
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
|
||||
ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
|
||||
ErrInvalidProcessState = hcs.ErrInvalidProcessState
|
||||
|
||||
// ErrTimeout is an error encountered when waiting on a notification times out
|
||||
ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
|
||||
ErrTimeout = hcs.ErrTimeout
|
||||
|
||||
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
|
||||
// a different expected notification
|
||||
ErrUnexpectedContainerExit = errors.New("unexpected container exit")
|
||||
ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit
|
||||
|
||||
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
|
||||
// is lost while waiting for a notification
|
||||
ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
|
||||
ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort
|
||||
|
||||
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
|
||||
ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
|
||||
ErrUnexpectedValue = hcs.ErrUnexpectedValue
|
||||
|
||||
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
|
||||
ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
|
||||
ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped
|
||||
|
||||
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
|
||||
ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
|
||||
ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending
|
||||
|
||||
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
|
||||
ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
|
||||
ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState
|
||||
|
||||
// ErrProcNotFound is an error encountered when the the process cannot be found
|
||||
ErrProcNotFound = syscall.Errno(0x7f)
|
||||
ErrProcNotFound = hcs.ErrProcNotFound
|
||||
|
||||
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
|
||||
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
|
||||
ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
|
||||
ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied
|
||||
|
||||
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
|
||||
ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
|
||||
ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON
|
||||
|
||||
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
|
||||
ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
|
||||
ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage
|
||||
|
||||
// ErrNotSupported is an error encountered when hcs doesn't support the request
|
||||
ErrPlatformNotSupported = errors.New("unsupported platform request")
|
||||
ErrPlatformNotSupported = hcs.ErrPlatformNotSupported
|
||||
)
|
||||
|
||||
type EndpointNotFoundError = hns.EndpointNotFoundError
|
||||
type NetworkNotFoundError = hns.NetworkNotFoundError
|
||||
|
||||
// ProcessError is an error encountered in HCS during an operation on a Process object
|
||||
type ProcessError struct {
|
||||
Process *process
|
||||
Operation string
|
||||
ExtraInfo string
|
||||
Err error
|
||||
Events []hcs.ErrorEvent
|
||||
}
|
||||
|
||||
// ContainerError is an error encountered in HCS during an operation on a Container object
|
||||
|
@ -86,6 +94,7 @@ type ContainerError struct {
|
|||
Operation string
|
||||
ExtraInfo string
|
||||
Err error
|
||||
Events []hcs.ErrorEvent
|
||||
}
|
||||
|
||||
func (e *ContainerError) Error() string {
|
||||
|
@ -97,7 +106,7 @@ func (e *ContainerError) Error() string {
|
|||
return "unexpected nil container for error: " + e.Err.Error()
|
||||
}
|
||||
|
||||
s := "container " + e.Container.id
|
||||
s := "container " + e.Container.system.ID()
|
||||
|
||||
if e.Operation != "" {
|
||||
s += " encountered an error during " + e.Operation
|
||||
|
@ -107,11 +116,15 @@ func (e *ContainerError) Error() string {
|
|||
case nil:
|
||||
break
|
||||
case syscall.Errno:
|
||||
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err))
|
||||
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
|
||||
default:
|
||||
s += fmt.Sprintf(": %s", e.Err.Error())
|
||||
}
|
||||
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
|
||||
if e.ExtraInfo != "" {
|
||||
s += " extra info: " + e.ExtraInfo
|
||||
}
|
||||
|
@ -137,12 +150,7 @@ func (e *ProcessError) Error() string {
|
|||
return "Unexpected nil process for error: " + e.Err.Error()
|
||||
}
|
||||
|
||||
s := fmt.Sprintf("process %d", e.Process.processID)
|
||||
|
||||
if e.Process.container != nil {
|
||||
s += " in container " + e.Process.container.id
|
||||
}
|
||||
|
||||
s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID())
|
||||
if e.Operation != "" {
|
||||
s += " encountered an error during " + e.Operation
|
||||
}
|
||||
|
@ -151,11 +159,15 @@ func (e *ProcessError) Error() string {
|
|||
case nil:
|
||||
break
|
||||
case syscall.Errno:
|
||||
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err))
|
||||
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
|
||||
default:
|
||||
s += fmt.Sprintf(": %s", e.Err.Error())
|
||||
}
|
||||
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
|
||||
return s
|
||||
}
|
||||
|
||||
|
@ -173,31 +185,31 @@ func makeProcessError(process *process, operation string, extraInfo string, err
|
|||
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||
func IsNotExist(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrComputeSystemDoesNotExist ||
|
||||
err == ErrElementNotFound ||
|
||||
err == ErrProcNotFound
|
||||
if _, ok := err.(EndpointNotFoundError); ok {
|
||||
return true
|
||||
}
|
||||
if _, ok := err.(NetworkNotFoundError); ok {
|
||||
return true
|
||||
}
|
||||
return hcs.IsNotExist(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
|
||||
// already closed by a call to the Close() method.
|
||||
func IsAlreadyClosed(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrAlreadyClosed
|
||||
return hcs.IsAlreadyClosed(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsPending returns a boolean indicating whether the error is that
|
||||
// the requested operation is being completed in the background.
|
||||
func IsPending(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrVmcomputeOperationPending
|
||||
return hcs.IsPending(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsTimeout returns a boolean indicating whether the error is caused by
|
||||
// a timeout waiting for the operation to complete.
|
||||
func IsTimeout(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrTimeout
|
||||
return hcs.IsTimeout(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
|
||||
|
@ -206,10 +218,7 @@ func IsTimeout(err error) bool {
|
|||
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||
func IsAlreadyStopped(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrVmcomputeAlreadyStopped ||
|
||||
err == ErrElementNotFound ||
|
||||
err == ErrProcNotFound
|
||||
return hcs.IsAlreadyStopped(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsNotSupported returns a boolean indicating whether the error is caused by
|
||||
|
@ -218,12 +227,7 @@ func IsAlreadyStopped(err error) bool {
|
|||
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
|
||||
// is thrown from the Platform
|
||||
func IsNotSupported(err error) bool {
|
||||
err = getInnerError(err)
|
||||
// If Platform doesn't recognize or support the request sent, below errors are seen
|
||||
return err == ErrVmcomputeInvalidJSON ||
|
||||
err == ErrInvalidData ||
|
||||
err == ErrNotSupported ||
|
||||
err == ErrVmcomputeUnknownMessage
|
||||
return hcs.IsNotSupported(getInnerError(err))
|
||||
}
|
||||
|
||||
func getInnerError(err error) error {
|
||||
|
@ -237,3 +241,17 @@ func getInnerError(err error) error {
|
|||
}
|
||||
return err
|
||||
}
|
||||
|
||||
func convertSystemError(err error, c *container) error {
|
||||
if serr, ok := err.(*hcs.SystemError); ok {
|
||||
return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events}
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
func convertProcessError(err error, p *process) error {
|
||||
if perr, ok := err.(*hcs.ProcessError); ok {
|
||||
return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events}
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
|
|
@ -1,26 +0,0 @@
|
|||
package hcsshim
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
// ExpandSandboxSize expands the size of a layer to at least size bytes.
|
||||
func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error {
|
||||
title := "hcsshim::ExpandSandboxSize "
|
||||
logrus.Debugf(title+"layerId=%s size=%d", layerId, size)
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = expandSandboxSize(&infop, layerId, size)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "layerId=%s size=%d", layerId, size)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+"- succeeded layerId=%s size=%d", layerId, size)
|
||||
return nil
|
||||
}
|
|
@ -1,156 +0,0 @@
|
|||
package hcsshim
|
||||
|
||||
import (
|
||||
"io"
|
||||
"io/ioutil"
|
||||
"os"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/go-winio"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// ExportLayer will create a folder at exportFolderPath and fill that folder with
|
||||
// the transport format version of the layer identified by layerId. This transport
|
||||
// format includes any metadata required for later importing the layer (using
|
||||
// ImportLayer), and requires the full list of parent layer paths in order to
|
||||
// perform the export.
|
||||
func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error {
|
||||
title := "hcsshim::ExportLayer "
|
||||
logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerId, exportFolderPath)
|
||||
|
||||
// Generate layer descriptors
|
||||
layers, err := layerPathsToDescriptors(parentLayerPaths)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = exportLayer(&infop, layerId, exportFolderPath, layers)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerId, info.Flavour, exportFolderPath)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerId, exportFolderPath)
|
||||
return nil
|
||||
}
|
||||
|
||||
type LayerReader interface {
|
||||
Next() (string, int64, *winio.FileBasicInfo, error)
|
||||
Read(b []byte) (int, error)
|
||||
Close() error
|
||||
}
|
||||
|
||||
// FilterLayerReader provides an interface for extracting the contents of an on-disk layer.
|
||||
type FilterLayerReader struct {
|
||||
context uintptr
|
||||
}
|
||||
|
||||
// Next reads the next available file from a layer, ensuring that parent directories are always read
|
||||
// before child files and directories.
|
||||
//
|
||||
// Next returns the file's relative path, size, and basic file metadata. Read() should be used to
|
||||
// extract a Win32 backup stream with the remainder of the metadata and the data.
|
||||
func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error) {
|
||||
var fileNamep *uint16
|
||||
fileInfo := &winio.FileBasicInfo{}
|
||||
var deleted uint32
|
||||
var fileSize int64
|
||||
err := exportLayerNext(r.context, &fileNamep, fileInfo, &fileSize, &deleted)
|
||||
if err != nil {
|
||||
if err == syscall.ERROR_NO_MORE_FILES {
|
||||
err = io.EOF
|
||||
} else {
|
||||
err = makeError(err, "ExportLayerNext", "")
|
||||
}
|
||||
return "", 0, nil, err
|
||||
}
|
||||
fileName := convertAndFreeCoTaskMemString(fileNamep)
|
||||
if deleted != 0 {
|
||||
fileInfo = nil
|
||||
}
|
||||
if fileName[0] == '\\' {
|
||||
fileName = fileName[1:]
|
||||
}
|
||||
return fileName, fileSize, fileInfo, nil
|
||||
}
|
||||
|
||||
// Read reads from the current file's Win32 backup stream.
|
||||
func (r *FilterLayerReader) Read(b []byte) (int, error) {
|
||||
var bytesRead uint32
|
||||
err := exportLayerRead(r.context, b, &bytesRead)
|
||||
if err != nil {
|
||||
return 0, makeError(err, "ExportLayerRead", "")
|
||||
}
|
||||
if bytesRead == 0 {
|
||||
return 0, io.EOF
|
||||
}
|
||||
return int(bytesRead), nil
|
||||
}
|
||||
|
||||
// Close frees resources associated with the layer reader. It will return an
|
||||
// error if there was an error while reading the layer or of the layer was not
|
||||
// completely read.
|
||||
func (r *FilterLayerReader) Close() (err error) {
|
||||
if r.context != 0 {
|
||||
err = exportLayerEnd(r.context)
|
||||
if err != nil {
|
||||
err = makeError(err, "ExportLayerEnd", "")
|
||||
}
|
||||
r.context = 0
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer.
|
||||
// The caller must have taken the SeBackupPrivilege privilege
|
||||
// to call this and any methods on the resulting LayerReader.
|
||||
func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) {
|
||||
if procExportLayerBegin.Find() != nil {
|
||||
// The new layer reader is not available on this Windows build. Fall back to the
|
||||
// legacy export code path.
|
||||
path, err := ioutil.TempDir("", "hcs")
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
err = ExportLayer(info, layerID, path, parentLayerPaths)
|
||||
if err != nil {
|
||||
os.RemoveAll(path)
|
||||
return nil, err
|
||||
}
|
||||
return &legacyLayerReaderWrapper{newLegacyLayerReader(path)}, nil
|
||||
}
|
||||
|
||||
layers, err := layerPathsToDescriptors(parentLayerPaths)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
r := &FilterLayerReader{}
|
||||
err = exportLayerBegin(&infop, layerID, layers, &r.context)
|
||||
if err != nil {
|
||||
return nil, makeError(err, "ExportLayerBegin", "")
|
||||
}
|
||||
return r, err
|
||||
}
|
||||
|
||||
type legacyLayerReaderWrapper struct {
|
||||
*legacyLayerReader
|
||||
}
|
||||
|
||||
func (r *legacyLayerReaderWrapper) Close() error {
|
||||
err := r.legacyLayerReader.Close()
|
||||
os.RemoveAll(r.root)
|
||||
return err
|
||||
}
|
|
@ -1,19 +0,0 @@
|
|||
package hcsshim
|
||||
|
||||
import (
|
||||
"crypto/sha1"
|
||||
"fmt"
|
||||
)
|
||||
|
||||
type GUID [16]byte
|
||||
|
||||
func NewGUID(source string) *GUID {
|
||||
h := sha1.Sum([]byte(source))
|
||||
var g GUID
|
||||
copy(g[0:], h[0:16])
|
||||
return &g
|
||||
}
|
||||
|
||||
func (g *GUID) ToString() string {
|
||||
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
|
||||
}
|
|
@ -4,80 +4,20 @@
|
|||
package hcsshim
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/hcserror"
|
||||
)
|
||||
|
||||
//go:generate go run mksyscall_windows.go -output zhcsshim.go hcsshim.go
|
||||
//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go
|
||||
|
||||
//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree
|
||||
//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId
|
||||
|
||||
//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer?
|
||||
//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer?
|
||||
//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer?
|
||||
//sys createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer?
|
||||
//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize?
|
||||
//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer?
|
||||
//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer?
|
||||
//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer?
|
||||
//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath?
|
||||
//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages?
|
||||
//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer?
|
||||
//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists?
|
||||
//sys nameToGuid(name string, guid *GUID) (hr error) = vmcompute.NameToGuid?
|
||||
//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer?
|
||||
//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer?
|
||||
//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage?
|
||||
//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage?
|
||||
|
||||
//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin?
|
||||
//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext?
|
||||
//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite?
|
||||
//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd?
|
||||
|
||||
//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin?
|
||||
//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext?
|
||||
//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead?
|
||||
//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd?
|
||||
|
||||
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
|
||||
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
|
||||
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
|
||||
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
|
||||
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
|
||||
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
|
||||
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
|
||||
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
|
||||
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
|
||||
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
|
||||
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
|
||||
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
|
||||
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
|
||||
|
||||
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
|
||||
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
|
||||
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
|
||||
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
|
||||
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
|
||||
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
|
||||
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
|
||||
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
|
||||
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
|
||||
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
|
||||
|
||||
//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings?
|
||||
|
||||
//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
|
||||
|
||||
const (
|
||||
// Specific user-visible exit codes
|
||||
WaitErrExecFailed = 32767
|
||||
|
||||
ERROR_GEN_FAILURE = syscall.Errno(31)
|
||||
ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE
|
||||
ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115)
|
||||
WSAEINVAL = syscall.Errno(10022)
|
||||
|
||||
|
@ -85,82 +25,4 @@ const (
|
|||
TimeoutInfinite = 0xFFFFFFFF
|
||||
)
|
||||
|
||||
type HcsError struct {
|
||||
title string
|
||||
rest string
|
||||
Err error
|
||||
}
|
||||
|
||||
type hcsSystem syscall.Handle
|
||||
type hcsProcess syscall.Handle
|
||||
type hcsCallback syscall.Handle
|
||||
|
||||
type hcsProcessInformation struct {
|
||||
ProcessId uint32
|
||||
Reserved uint32
|
||||
StdInput syscall.Handle
|
||||
StdOutput syscall.Handle
|
||||
StdError syscall.Handle
|
||||
}
|
||||
|
||||
func makeError(err error, title, rest string) error {
|
||||
// Pass through DLL errors directly since they do not originate from HCS.
|
||||
if _, ok := err.(*syscall.DLLError); ok {
|
||||
return err
|
||||
}
|
||||
return &HcsError{title, rest, err}
|
||||
}
|
||||
|
||||
func makeErrorf(err error, title, format string, a ...interface{}) error {
|
||||
return makeError(err, title, fmt.Sprintf(format, a...))
|
||||
}
|
||||
|
||||
func win32FromError(err error) uint32 {
|
||||
if herr, ok := err.(*HcsError); ok {
|
||||
return win32FromError(herr.Err)
|
||||
}
|
||||
if code, ok := err.(syscall.Errno); ok {
|
||||
return uint32(code)
|
||||
}
|
||||
return uint32(ERROR_GEN_FAILURE)
|
||||
}
|
||||
|
||||
func win32FromHresult(hr uintptr) uintptr {
|
||||
if hr&0x1fff0000 == 0x00070000 {
|
||||
return hr & 0xffff
|
||||
}
|
||||
return hr
|
||||
}
|
||||
|
||||
func (e *HcsError) Error() string {
|
||||
s := e.title
|
||||
if len(s) > 0 && s[len(s)-1] != ' ' {
|
||||
s += " "
|
||||
}
|
||||
s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err))
|
||||
if e.rest != "" {
|
||||
if e.rest[0] != ' ' {
|
||||
s += " "
|
||||
}
|
||||
s += e.rest
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
func convertAndFreeCoTaskMemString(buffer *uint16) string {
|
||||
str := syscall.UTF16ToString((*[1 << 30]uint16)(unsafe.Pointer(buffer))[:])
|
||||
coTaskMemFree(unsafe.Pointer(buffer))
|
||||
return str
|
||||
}
|
||||
|
||||
func convertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
|
||||
return []byte(convertAndFreeCoTaskMemString(buffer))
|
||||
}
|
||||
|
||||
func processHcsResult(err error, resultp *uint16) error {
|
||||
if resultp != nil {
|
||||
result := convertAndFreeCoTaskMemString(resultp)
|
||||
logrus.Debugf("Result: %s", result)
|
||||
}
|
||||
return err
|
||||
}
|
||||
type HcsError = hcserror.HcsError
|
||||
|
|
|
@ -1,30 +1,14 @@
|
|||
package hcsshim
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"net"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
// HNSEndpoint represents a network endpoint in HNS
|
||||
type HNSEndpoint struct {
|
||||
Id string `json:"ID,omitempty"`
|
||||
Name string `json:",omitempty"`
|
||||
VirtualNetwork string `json:",omitempty"`
|
||||
VirtualNetworkName string `json:",omitempty"`
|
||||
Policies []json.RawMessage `json:",omitempty"`
|
||||
MacAddress string `json:",omitempty"`
|
||||
IPAddress net.IP `json:",omitempty"`
|
||||
DNSSuffix string `json:",omitempty"`
|
||||
DNSServerList string `json:",omitempty"`
|
||||
GatewayAddress string `json:",omitempty"`
|
||||
EnableInternalDNS bool `json:",omitempty"`
|
||||
DisableICC bool `json:",omitempty"`
|
||||
PrefixLength uint8 `json:",omitempty"`
|
||||
IsRemoteEndpoint bool `json:",omitempty"`
|
||||
}
|
||||
type HNSEndpoint = hns.HNSEndpoint
|
||||
|
||||
// Namespace represents a Compartment.
|
||||
type Namespace = hns.Namespace
|
||||
|
||||
//SystemType represents the type of the system on which actions are done
|
||||
type SystemType string
|
||||
|
@ -38,39 +22,19 @@ const (
|
|||
|
||||
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
|
||||
// Supported resource types are Network and Request Types are Add/Remove
|
||||
type EndpointAttachDetachRequest struct {
|
||||
ContainerID string `json:"ContainerId,omitempty"`
|
||||
SystemType SystemType `json:"SystemType"`
|
||||
CompartmentID uint16 `json:"CompartmentId,omitempty"`
|
||||
VirtualNICName string `json:"VirtualNicName,omitempty"`
|
||||
}
|
||||
type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest
|
||||
|
||||
// EndpointResquestResponse is object to get the endpoint request response
|
||||
type EndpointResquestResponse struct {
|
||||
Success bool
|
||||
Error string
|
||||
}
|
||||
type EndpointResquestResponse = hns.EndpointResquestResponse
|
||||
|
||||
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
|
||||
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
|
||||
endpoint := &HNSEndpoint{}
|
||||
err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return endpoint, nil
|
||||
return hns.HNSEndpointRequest(method, path, request)
|
||||
}
|
||||
|
||||
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
|
||||
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
|
||||
var endpoint []HNSEndpoint
|
||||
err := hnsCall("GET", "/endpoints/", "", &endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return endpoint, nil
|
||||
return hns.HNSListEndpointRequest()
|
||||
}
|
||||
|
||||
// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
|
||||
|
@ -121,198 +85,10 @@ func modifyNetworkEndpoint(containerID string, endpointID string, request Reques
|
|||
|
||||
// GetHNSEndpointByID get the Endpoint by ID
|
||||
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
|
||||
return HNSEndpointRequest("GET", endpointID, "")
|
||||
return hns.GetHNSEndpointByID(endpointID)
|
||||
}
|
||||
|
||||
// GetHNSEndpointByName gets the endpoint filtered by Name
|
||||
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
|
||||
hnsResponse, err := HNSListEndpointRequest()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
for _, hnsEndpoint := range hnsResponse {
|
||||
if hnsEndpoint.Name == endpointName {
|
||||
return &hnsEndpoint, nil
|
||||
}
|
||||
}
|
||||
return nil, fmt.Errorf("Endpoint %v not found", endpointName)
|
||||
}
|
||||
|
||||
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
|
||||
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
|
||||
operation := "Create"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
jsonString, err := json.Marshal(endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return HNSEndpointRequest("POST", "", string(jsonString))
|
||||
}
|
||||
|
||||
// Delete Endpoint by sending EndpointRequest to HNS
|
||||
func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
|
||||
operation := "Delete"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
return HNSEndpointRequest("DELETE", endpoint.Id, "")
|
||||
}
|
||||
|
||||
// Update Endpoint
|
||||
func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
|
||||
operation := "Update"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
jsonString, err := json.Marshal(endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
|
||||
|
||||
return endpoint, err
|
||||
}
|
||||
|
||||
// ContainerHotAttach attaches an endpoint to a running container
|
||||
func (endpoint *HNSEndpoint) ContainerHotAttach(containerID string) error {
|
||||
operation := "ContainerHotAttach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)
|
||||
|
||||
return modifyNetworkEndpoint(containerID, endpoint.Id, Add)
|
||||
}
|
||||
|
||||
// ContainerHotDetach detaches an endpoint from a running container
|
||||
func (endpoint *HNSEndpoint) ContainerHotDetach(containerID string) error {
|
||||
operation := "ContainerHotDetach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)
|
||||
|
||||
return modifyNetworkEndpoint(containerID, endpoint.Id, Remove)
|
||||
}
|
||||
|
||||
// ApplyACLPolicy applies Acl Policy on the Endpoint
|
||||
func (endpoint *HNSEndpoint) ApplyACLPolicy(policy *ACLPolicy) error {
|
||||
operation := "ApplyACLPolicy"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
jsonString, err := json.Marshal(policy)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
endpoint.Policies[0] = jsonString
|
||||
_, err = endpoint.Update()
|
||||
return err
|
||||
}
|
||||
|
||||
// ContainerAttach attaches an endpoint to container
|
||||
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
|
||||
operation := "ContainerAttach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
ContainerID: containerID,
|
||||
CompartmentID: compartmentID,
|
||||
SystemType: ContainerType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// ContainerDetach detaches an endpoint from container
|
||||
func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
|
||||
operation := "ContainerDetach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
ContainerID: containerID,
|
||||
SystemType: ContainerType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// HostAttach attaches a nic on the host
|
||||
func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
|
||||
operation := "HostAttach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
CompartmentID: compartmentID,
|
||||
SystemType: HostType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
|
||||
}
|
||||
|
||||
// HostDetach detaches a nic on the host
|
||||
func (endpoint *HNSEndpoint) HostDetach() error {
|
||||
operation := "HostDetach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
SystemType: HostType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// VirtualMachineNICAttach attaches a endpoint to a virtual machine
|
||||
func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
|
||||
operation := "VirtualMachineNicAttach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
VirtualNICName: virtualMachineNICName,
|
||||
SystemType: VirtualMachineType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// VirtualMachineNICDetach detaches a endpoint from a virtual machine
|
||||
func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
|
||||
operation := "VirtualMachineNicDetach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
SystemType: VirtualMachineType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
return hns.GetHNSEndpointByName(endpointName)
|
||||
}
|
||||
|
|
|
@ -0,0 +1,16 @@
|
|||
package hcsshim
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
type HNSGlobals = hns.HNSGlobals
|
||||
type HNSVersion = hns.HNSVersion
|
||||
|
||||
var (
|
||||
HNSVersion1803 = hns.HNSVersion1803
|
||||
)
|
||||
|
||||
func GetHNSGlobals() (*HNSGlobals, error) {
|
||||
return hns.GetHNSGlobals()
|
||||
}
|
|
@ -1,142 +1,36 @@
|
|||
package hcsshim
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"net"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
// Subnet is assoicated with a network and represents a list
|
||||
// of subnets available to the network
|
||||
type Subnet struct {
|
||||
AddressPrefix string `json:",omitempty"`
|
||||
GatewayAddress string `json:",omitempty"`
|
||||
Policies []json.RawMessage `json:",omitempty"`
|
||||
}
|
||||
type Subnet = hns.Subnet
|
||||
|
||||
// MacPool is assoicated with a network and represents a list
|
||||
// of macaddresses available to the network
|
||||
type MacPool struct {
|
||||
StartMacAddress string `json:",omitempty"`
|
||||
EndMacAddress string `json:",omitempty"`
|
||||
}
|
||||
type MacPool = hns.MacPool
|
||||
|
||||
// HNSNetwork represents a network in HNS
|
||||
type HNSNetwork struct {
|
||||
Id string `json:"ID,omitempty"`
|
||||
Name string `json:",omitempty"`
|
||||
Type string `json:",omitempty"`
|
||||
NetworkAdapterName string `json:",omitempty"`
|
||||
SourceMac string `json:",omitempty"`
|
||||
Policies []json.RawMessage `json:",omitempty"`
|
||||
MacPools []MacPool `json:",omitempty"`
|
||||
Subnets []Subnet `json:",omitempty"`
|
||||
DNSSuffix string `json:",omitempty"`
|
||||
DNSServerList string `json:",omitempty"`
|
||||
DNSServerCompartment uint32 `json:",omitempty"`
|
||||
ManagementIP string `json:",omitempty"`
|
||||
AutomaticDNS bool `json:",omitempty"`
|
||||
}
|
||||
|
||||
type hnsNetworkResponse struct {
|
||||
Success bool
|
||||
Error string
|
||||
Output HNSNetwork
|
||||
}
|
||||
|
||||
type hnsResponse struct {
|
||||
Success bool
|
||||
Error string
|
||||
Output json.RawMessage
|
||||
}
|
||||
type HNSNetwork = hns.HNSNetwork
|
||||
|
||||
// HNSNetworkRequest makes a call into HNS to update/query a single network
|
||||
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
|
||||
var network HNSNetwork
|
||||
err := hnsCall(method, "/networks/"+path, request, &network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return &network, nil
|
||||
return hns.HNSNetworkRequest(method, path, request)
|
||||
}
|
||||
|
||||
// HNSListNetworkRequest makes a HNS call to query the list of available networks
|
||||
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
|
||||
var network []HNSNetwork
|
||||
err := hnsCall(method, "/networks/"+path, request, &network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return network, nil
|
||||
return hns.HNSListNetworkRequest(method, path, request)
|
||||
}
|
||||
|
||||
// GetHNSNetworkByID
|
||||
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
|
||||
return HNSNetworkRequest("GET", networkID, "")
|
||||
return hns.GetHNSNetworkByID(networkID)
|
||||
}
|
||||
|
||||
// GetHNSNetworkName filtered by Name
|
||||
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
|
||||
hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
for _, hnsnetwork := range hsnnetworks {
|
||||
if hnsnetwork.Name == networkName {
|
||||
return &hnsnetwork, nil
|
||||
}
|
||||
}
|
||||
return nil, fmt.Errorf("Network %v not found", networkName)
|
||||
}
|
||||
|
||||
// Create Network by sending NetworkRequest to HNS.
|
||||
func (network *HNSNetwork) Create() (*HNSNetwork, error) {
|
||||
operation := "Create"
|
||||
title := "HCSShim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s", network.Id)
|
||||
|
||||
jsonString, err := json.Marshal(network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return HNSNetworkRequest("POST", "", string(jsonString))
|
||||
}
|
||||
|
||||
// Delete Network by sending NetworkRequest to HNS
|
||||
func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
|
||||
operation := "Delete"
|
||||
title := "HCSShim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s", network.Id)
|
||||
|
||||
return HNSNetworkRequest("DELETE", network.Id, "")
|
||||
}
|
||||
|
||||
// Creates an endpoint on the Network.
|
||||
func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
|
||||
return &HNSEndpoint{
|
||||
VirtualNetwork: network.Id,
|
||||
IPAddress: ipAddress,
|
||||
MacAddress: string(macAddress),
|
||||
}
|
||||
}
|
||||
|
||||
func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
|
||||
operation := "CreateEndpoint"
|
||||
title := "HCSShim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
|
||||
|
||||
endpoint.VirtualNetwork = network.Id
|
||||
return endpoint.Create()
|
||||
}
|
||||
|
||||
func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
|
||||
operation := "CreateRemoteEndpoint"
|
||||
title := "HCSShim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s", network.Id)
|
||||
endpoint.IsRemoteEndpoint = true
|
||||
return network.CreateEndpoint(endpoint)
|
||||
return hns.GetHNSNetworkByName(networkName)
|
||||
}
|
||||
|
|
|
@ -1,95 +1,57 @@
|
|||
package hcsshim
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
// Type of Request Support in ModifySystem
|
||||
type PolicyType string
|
||||
type PolicyType = hns.PolicyType
|
||||
|
||||
// RequestType const
|
||||
const (
|
||||
Nat PolicyType = "NAT"
|
||||
ACL PolicyType = "ACL"
|
||||
PA PolicyType = "PA"
|
||||
VLAN PolicyType = "VLAN"
|
||||
VSID PolicyType = "VSID"
|
||||
VNet PolicyType = "VNET"
|
||||
L2Driver PolicyType = "L2Driver"
|
||||
Isolation PolicyType = "Isolation"
|
||||
QOS PolicyType = "QOS"
|
||||
OutboundNat PolicyType = "OutBoundNAT"
|
||||
ExternalLoadBalancer PolicyType = "ELB"
|
||||
Route PolicyType = "ROUTE"
|
||||
Nat = hns.Nat
|
||||
ACL = hns.ACL
|
||||
PA = hns.PA
|
||||
VLAN = hns.VLAN
|
||||
VSID = hns.VSID
|
||||
VNet = hns.VNet
|
||||
L2Driver = hns.L2Driver
|
||||
Isolation = hns.Isolation
|
||||
QOS = hns.QOS
|
||||
OutboundNat = hns.OutboundNat
|
||||
ExternalLoadBalancer = hns.ExternalLoadBalancer
|
||||
Route = hns.Route
|
||||
)
|
||||
|
||||
type NatPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
Protocol string
|
||||
InternalPort uint16
|
||||
ExternalPort uint16
|
||||
}
|
||||
type NatPolicy = hns.NatPolicy
|
||||
|
||||
type QosPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
MaximumOutgoingBandwidthInBytes uint64
|
||||
}
|
||||
type QosPolicy = hns.QosPolicy
|
||||
|
||||
type IsolationPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
VLAN uint
|
||||
VSID uint
|
||||
InDefaultIsolation bool
|
||||
}
|
||||
type IsolationPolicy = hns.IsolationPolicy
|
||||
|
||||
type VlanPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
VLAN uint
|
||||
}
|
||||
type VlanPolicy = hns.VlanPolicy
|
||||
|
||||
type VsidPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
VSID uint
|
||||
}
|
||||
type VsidPolicy = hns.VsidPolicy
|
||||
|
||||
type PaPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
PA string `json:"PA"`
|
||||
}
|
||||
type PaPolicy = hns.PaPolicy
|
||||
|
||||
type OutboundNatPolicy struct {
|
||||
Policy
|
||||
VIP string `json:"VIP,omitempty"`
|
||||
Exceptions []string `json:"ExceptionList,omitempty"`
|
||||
}
|
||||
type OutboundNatPolicy = hns.OutboundNatPolicy
|
||||
|
||||
type ActionType string
|
||||
type DirectionType string
|
||||
type RuleType string
|
||||
type ActionType = hns.ActionType
|
||||
type DirectionType = hns.DirectionType
|
||||
type RuleType = hns.RuleType
|
||||
|
||||
const (
|
||||
Allow ActionType = "Allow"
|
||||
Block ActionType = "Block"
|
||||
Allow = hns.Allow
|
||||
Block = hns.Block
|
||||
|
||||
In DirectionType = "In"
|
||||
Out DirectionType = "Out"
|
||||
In = hns.In
|
||||
Out = hns.Out
|
||||
|
||||
Host RuleType = "Host"
|
||||
Switch RuleType = "Switch"
|
||||
Host = hns.Host
|
||||
Switch = hns.Switch
|
||||
)
|
||||
|
||||
type ACLPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
Protocol uint16
|
||||
InternalPort uint16
|
||||
Action ActionType
|
||||
Direction DirectionType
|
||||
LocalAddress string
|
||||
RemoteAddress string
|
||||
LocalPort uint16
|
||||
RemotePort uint16
|
||||
RuleType RuleType `json:"RuleType,omitempty"`
|
||||
type ACLPolicy = hns.ACLPolicy
|
||||
|
||||
Priority uint16
|
||||
ServiceName string
|
||||
}
|
||||
|
||||
type Policy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
}
|
||||
type Policy = hns.Policy
|
||||
|
|
|
@ -1,196 +1,47 @@
|
|||
package hcsshim
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
// RoutePolicy is a structure defining schema for Route based Policy
|
||||
type RoutePolicy struct {
|
||||
Policy
|
||||
DestinationPrefix string `json:"DestinationPrefix,omitempty"`
|
||||
NextHop string `json:"NextHop,omitempty"`
|
||||
EncapEnabled bool `json:"NeedEncap,omitempty"`
|
||||
}
|
||||
type RoutePolicy = hns.RoutePolicy
|
||||
|
||||
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
|
||||
type ELBPolicy struct {
|
||||
LBPolicy
|
||||
SourceVIP string `json:"SourceVIP,omitempty"`
|
||||
VIPs []string `json:"VIPs,omitempty"`
|
||||
ILB bool `json:"ILB,omitempty"`
|
||||
}
|
||||
type ELBPolicy = hns.ELBPolicy
|
||||
|
||||
// LBPolicy is a structure defining schema for LoadBalancing based Policy
|
||||
type LBPolicy struct {
|
||||
Policy
|
||||
Protocol uint16 `json:"Protocol,omitempty"`
|
||||
InternalPort uint16
|
||||
ExternalPort uint16
|
||||
}
|
||||
type LBPolicy = hns.LBPolicy
|
||||
|
||||
// PolicyList is a structure defining schema for Policy list request
|
||||
type PolicyList struct {
|
||||
ID string `json:"ID,omitempty"`
|
||||
EndpointReferences []string `json:"References,omitempty"`
|
||||
Policies []json.RawMessage `json:"Policies,omitempty"`
|
||||
}
|
||||
type PolicyList = hns.PolicyList
|
||||
|
||||
// HNSPolicyListRequest makes a call into HNS to update/query a single network
|
||||
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
|
||||
var policy PolicyList
|
||||
err := hnsCall(method, "/policylists/"+path, request, &policy)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return &policy, nil
|
||||
return hns.HNSPolicyListRequest(method, path, request)
|
||||
}
|
||||
|
||||
// HNSListPolicyListRequest gets all the policy list
|
||||
func HNSListPolicyListRequest() ([]PolicyList, error) {
|
||||
var plist []PolicyList
|
||||
err := hnsCall("GET", "/policylists/", "", &plist)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return plist, nil
|
||||
return hns.HNSListPolicyListRequest()
|
||||
}
|
||||
|
||||
// PolicyListRequest makes a HNS call to modify/query a network policy list
|
||||
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
|
||||
policylist := &PolicyList{}
|
||||
err := hnsCall(method, "/policylists/"+path, request, &policylist)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return policylist, nil
|
||||
return hns.PolicyListRequest(method, path, request)
|
||||
}
|
||||
|
||||
// GetPolicyListByID get the policy list by ID
|
||||
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
|
||||
return PolicyListRequest("GET", policyListID, "")
|
||||
}
|
||||
|
||||
// Create PolicyList by sending PolicyListRequest to HNS.
|
||||
func (policylist *PolicyList) Create() (*PolicyList, error) {
|
||||
operation := "Create"
|
||||
title := "HCSShim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s", policylist.ID)
|
||||
jsonString, err := json.Marshal(policylist)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return PolicyListRequest("POST", "", string(jsonString))
|
||||
}
|
||||
|
||||
// Delete deletes PolicyList
|
||||
func (policylist *PolicyList) Delete() (*PolicyList, error) {
|
||||
operation := "Delete"
|
||||
title := "HCSShim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s", policylist.ID)
|
||||
|
||||
return PolicyListRequest("DELETE", policylist.ID, "")
|
||||
}
|
||||
|
||||
// AddEndpoint add an endpoint to a Policy List
|
||||
func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
|
||||
operation := "AddEndpoint"
|
||||
title := "HCSShim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
|
||||
|
||||
_, err := policylist.Delete()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// Add Endpoint to the Existing List
|
||||
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||
|
||||
return policylist.Create()
|
||||
}
|
||||
|
||||
// RemoveEndpoint removes an endpoint from the Policy List
|
||||
func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
|
||||
operation := "RemoveEndpoint"
|
||||
title := "HCSShim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
|
||||
|
||||
_, err := policylist.Delete()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
elementToRemove := "/endpoints/" + endpoint.Id
|
||||
|
||||
var references []string
|
||||
|
||||
for _, endpointReference := range policylist.EndpointReferences {
|
||||
if endpointReference == elementToRemove {
|
||||
continue
|
||||
}
|
||||
references = append(references, endpointReference)
|
||||
}
|
||||
policylist.EndpointReferences = references
|
||||
return policylist.Create()
|
||||
return hns.GetPolicyListByID(policyListID)
|
||||
}
|
||||
|
||||
// AddLoadBalancer policy list for the specified endpoints
|
||||
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
|
||||
operation := "AddLoadBalancer"
|
||||
title := "HCSShim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" Vip:%s", vip)
|
||||
|
||||
policylist := &PolicyList{}
|
||||
|
||||
elbPolicy := &ELBPolicy{
|
||||
VIPs: []string{vip},
|
||||
ILB: isILB,
|
||||
}
|
||||
elbPolicy.Type = ExternalLoadBalancer
|
||||
elbPolicy.Protocol = protocol
|
||||
elbPolicy.InternalPort = internalPort
|
||||
elbPolicy.ExternalPort = externalPort
|
||||
|
||||
for _, endpoint := range endpoints {
|
||||
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||
}
|
||||
|
||||
jsonString, err := json.Marshal(elbPolicy)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
policylist.Policies = append(policylist.Policies, jsonString)
|
||||
return policylist.Create()
|
||||
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
|
||||
return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
|
||||
}
|
||||
|
||||
// AddRoute adds route policy list for the specified endpoints
|
||||
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
|
||||
operation := "AddRoute"
|
||||
title := "HCSShim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
|
||||
|
||||
policylist := &PolicyList{}
|
||||
|
||||
rPolicy := &RoutePolicy{
|
||||
DestinationPrefix: destinationPrefix,
|
||||
NextHop: nextHop,
|
||||
EncapEnabled: encapEnabled,
|
||||
}
|
||||
rPolicy.Type = Route
|
||||
|
||||
for _, endpoint := range endpoints {
|
||||
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||
}
|
||||
|
||||
jsonString, err := json.Marshal(rPolicy)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
policylist.Policies = append(policylist.Policies, jsonString)
|
||||
return policylist.Create()
|
||||
return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled)
|
||||
}
|
||||
|
|
|
@ -0,0 +1,13 @@
|
|||
package hcsshim
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
type HNSSupportedFeatures = hns.HNSSupportedFeatures
|
||||
|
||||
type HNSAclFeatures = hns.HNSAclFeatures
|
||||
|
||||
func GetHNSSupportedFeatures() HNSSupportedFeatures {
|
||||
return hns.GetHNSSupportedFeatures()
|
||||
}
|
|
@ -1,212 +0,0 @@
|
|||
package hcsshim
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"io/ioutil"
|
||||
"os"
|
||||
"path/filepath"
|
||||
|
||||
"github.com/Microsoft/go-winio"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// ImportLayer will take the contents of the folder at importFolderPath and import
|
||||
// that into a layer with the id layerId. Note that in order to correctly populate
|
||||
// the layer and interperet the transport format, all parent layers must already
|
||||
// be present on the system at the paths provided in parentLayerPaths.
|
||||
func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error {
|
||||
title := "hcsshim::ImportLayer "
|
||||
logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerID, importFolderPath)
|
||||
|
||||
// Generate layer descriptors
|
||||
layers, err := layerPathsToDescriptors(parentLayerPaths)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = importLayer(&infop, layerID, importFolderPath, layers)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerID, info.Flavour, importFolderPath)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerID, importFolderPath)
|
||||
return nil
|
||||
}
|
||||
|
||||
// LayerWriter is an interface that supports writing a new container image layer.
|
||||
type LayerWriter interface {
|
||||
// Add adds a file to the layer with given metadata.
|
||||
Add(name string, fileInfo *winio.FileBasicInfo) error
|
||||
// AddLink adds a hard link to the layer. The target must already have been added.
|
||||
AddLink(name string, target string) error
|
||||
// Remove removes a file that was present in a parent layer from the layer.
|
||||
Remove(name string) error
|
||||
// Write writes data to the current file. The data must be in the format of a Win32
|
||||
// backup stream.
|
||||
Write(b []byte) (int, error)
|
||||
// Close finishes the layer writing process and releases any resources.
|
||||
Close() error
|
||||
}
|
||||
|
||||
// FilterLayerWriter provides an interface to write the contents of a layer to the file system.
|
||||
type FilterLayerWriter struct {
|
||||
context uintptr
|
||||
}
|
||||
|
||||
// Add adds a file or directory to the layer. The file's parent directory must have already been added.
|
||||
//
|
||||
// name contains the file's relative path. fileInfo contains file times and file attributes; the rest
|
||||
// of the file metadata and the file data must be written as a Win32 backup stream to the Write() method.
|
||||
// winio.BackupStreamWriter can be used to facilitate this.
|
||||
func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error {
|
||||
if name[0] != '\\' {
|
||||
name = `\` + name
|
||||
}
|
||||
err := importLayerNext(w.context, name, fileInfo)
|
||||
if err != nil {
|
||||
return makeError(err, "ImportLayerNext", "")
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// AddLink adds a hard link to the layer. The target of the link must have already been added.
|
||||
func (w *FilterLayerWriter) AddLink(name string, target string) error {
|
||||
return errors.New("hard links not yet supported")
|
||||
}
|
||||
|
||||
// Remove removes a file from the layer. The file must have been present in the parent layer.
|
||||
//
|
||||
// name contains the file's relative path.
|
||||
func (w *FilterLayerWriter) Remove(name string) error {
|
||||
if name[0] != '\\' {
|
||||
name = `\` + name
|
||||
}
|
||||
err := importLayerNext(w.context, name, nil)
|
||||
if err != nil {
|
||||
return makeError(err, "ImportLayerNext", "")
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// Write writes more backup stream data to the current file.
|
||||
func (w *FilterLayerWriter) Write(b []byte) (int, error) {
|
||||
err := importLayerWrite(w.context, b)
|
||||
if err != nil {
|
||||
err = makeError(err, "ImportLayerWrite", "")
|
||||
return 0, err
|
||||
}
|
||||
return len(b), err
|
||||
}
|
||||
|
||||
// Close completes the layer write operation. The error must be checked to ensure that the
|
||||
// operation was successful.
|
||||
func (w *FilterLayerWriter) Close() (err error) {
|
||||
if w.context != 0 {
|
||||
err = importLayerEnd(w.context)
|
||||
if err != nil {
|
||||
err = makeError(err, "ImportLayerEnd", "")
|
||||
}
|
||||
w.context = 0
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
type legacyLayerWriterWrapper struct {
|
||||
*legacyLayerWriter
|
||||
info DriverInfo
|
||||
layerID string
|
||||
path string
|
||||
parentLayerPaths []string
|
||||
}
|
||||
|
||||
func (r *legacyLayerWriterWrapper) Close() error {
|
||||
defer os.RemoveAll(r.root)
|
||||
err := r.legacyLayerWriter.Close()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Use the original path here because ImportLayer does not support long paths for the source in TP5.
|
||||
// But do use a long path for the destination to work around another bug with directories
|
||||
// with MAX_PATH - 12 < length < MAX_PATH.
|
||||
info := r.info
|
||||
fullPath, err := makeLongAbsPath(filepath.Join(info.HomeDir, r.layerID))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
info.HomeDir = ""
|
||||
if err = ImportLayer(info, fullPath, r.path, r.parentLayerPaths); err != nil {
|
||||
return err
|
||||
}
|
||||
// Add any hard links that were collected.
|
||||
for _, lnk := range r.PendingLinks {
|
||||
if err = os.Remove(lnk.Path); err != nil && !os.IsNotExist(err) {
|
||||
return err
|
||||
}
|
||||
if err = os.Link(lnk.Target, lnk.Path); err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
// Prepare the utility VM for use if one is present in the layer.
|
||||
if r.HasUtilityVM {
|
||||
err = ProcessUtilityVMImage(filepath.Join(fullPath, "UtilityVM"))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// NewLayerWriter returns a new layer writer for creating a layer on disk.
|
||||
// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges
|
||||
// to call this and any methods on the resulting LayerWriter.
|
||||
func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) {
|
||||
if len(parentLayerPaths) == 0 {
|
||||
// This is a base layer. It gets imported differently.
|
||||
return &baseLayerWriter{
|
||||
root: filepath.Join(info.HomeDir, layerID),
|
||||
}, nil
|
||||
}
|
||||
|
||||
if procImportLayerBegin.Find() != nil {
|
||||
// The new layer reader is not available on this Windows build. Fall back to the
|
||||
// legacy export code path.
|
||||
path, err := ioutil.TempDir("", "hcs")
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &legacyLayerWriterWrapper{
|
||||
legacyLayerWriter: newLegacyLayerWriter(path, parentLayerPaths, filepath.Join(info.HomeDir, layerID)),
|
||||
info: info,
|
||||
layerID: layerID,
|
||||
path: path,
|
||||
parentLayerPaths: parentLayerPaths,
|
||||
}, nil
|
||||
}
|
||||
layers, err := layerPathsToDescriptors(parentLayerPaths)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
w := &FilterLayerWriter{}
|
||||
err = importLayerBegin(&infop, layerID, layers, &w.context)
|
||||
if err != nil {
|
||||
return nil, makeError(err, "ImportLayerStart", "")
|
||||
}
|
||||
return w, nil
|
||||
}
|
|
@ -1,105 +1,32 @@
|
|||
package hcsshim
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"io"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||
)
|
||||
|
||||
// ProcessConfig is used as both the input of Container.CreateProcess
|
||||
// and to convert the parameters to JSON for passing onto the HCS
|
||||
type ProcessConfig struct {
|
||||
ApplicationName string `json:",omitempty"`
|
||||
CommandLine string `json:",omitempty"`
|
||||
CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows
|
||||
User string `json:",omitempty"`
|
||||
WorkingDirectory string `json:",omitempty"`
|
||||
Environment map[string]string `json:",omitempty"`
|
||||
EmulateConsole bool `json:",omitempty"`
|
||||
CreateStdInPipe bool `json:",omitempty"`
|
||||
CreateStdOutPipe bool `json:",omitempty"`
|
||||
CreateStdErrPipe bool `json:",omitempty"`
|
||||
ConsoleSize [2]uint `json:",omitempty"`
|
||||
CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows
|
||||
OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows
|
||||
}
|
||||
type ProcessConfig = schema1.ProcessConfig
|
||||
|
||||
type Layer struct {
|
||||
ID string
|
||||
Path string
|
||||
}
|
||||
type Layer = schema1.Layer
|
||||
type MappedDir = schema1.MappedDir
|
||||
type MappedPipe = schema1.MappedPipe
|
||||
type HvRuntime = schema1.HvRuntime
|
||||
type MappedVirtualDisk = schema1.MappedVirtualDisk
|
||||
|
||||
type MappedDir struct {
|
||||
HostPath string
|
||||
ContainerPath string
|
||||
ReadOnly bool
|
||||
BandwidthMaximum uint64
|
||||
IOPSMaximum uint64
|
||||
}
|
||||
|
||||
type MappedPipe struct {
|
||||
HostPath string
|
||||
ContainerPipeName string
|
||||
}
|
||||
|
||||
type HvRuntime struct {
|
||||
ImagePath string `json:",omitempty"`
|
||||
SkipTemplate bool `json:",omitempty"`
|
||||
LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
|
||||
LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
|
||||
LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
|
||||
BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
|
||||
WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD
|
||||
}
|
||||
|
||||
type MappedVirtualDisk struct {
|
||||
HostPath string `json:",omitempty"` // Path to VHD on the host
|
||||
ContainerPath string // Platform-specific mount point path in the container
|
||||
CreateInUtilityVM bool `json:",omitempty"`
|
||||
ReadOnly bool `json:",omitempty"`
|
||||
Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
|
||||
AttachOnly bool `json:",omitempty:`
|
||||
}
|
||||
// AssignedDevice represents a device that has been directly assigned to a container
|
||||
//
|
||||
// NOTE: Support added in RS5
|
||||
type AssignedDevice = schema1.AssignedDevice
|
||||
|
||||
// ContainerConfig is used as both the input of CreateContainer
|
||||
// and to convert the parameters to JSON for passing onto the HCS
|
||||
type ContainerConfig struct {
|
||||
SystemType string // HCS requires this to be hard-coded to "Container"
|
||||
Name string // Name of the container. We use the docker ID.
|
||||
Owner string `json:",omitempty"` // The management platform that created this container
|
||||
VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
|
||||
IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows
|
||||
LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID
|
||||
Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
|
||||
Credentials string `json:",omitempty"` // Credentials information
|
||||
ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container.
|
||||
ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
|
||||
ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
|
||||
StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS
|
||||
StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
|
||||
StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
|
||||
MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes
|
||||
HostName string `json:",omitempty"` // Hostname
|
||||
MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts)
|
||||
MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes
|
||||
HvPartition bool // True if it a Hyper-V Container
|
||||
NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
|
||||
EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container
|
||||
HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
|
||||
Servicing bool `json:",omitempty"` // True if this container is for servicing
|
||||
AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution
|
||||
DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
|
||||
ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
|
||||
TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
|
||||
MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
|
||||
}
|
||||
type ContainerConfig = schema1.ContainerConfig
|
||||
|
||||
type ComputeSystemQuery struct {
|
||||
IDs []string `json:"Ids,omitempty"`
|
||||
Types []string `json:",omitempty"`
|
||||
Names []string `json:",omitempty"`
|
||||
Owners []string `json:",omitempty"`
|
||||
}
|
||||
type ComputeSystemQuery = schema1.ComputeSystemQuery
|
||||
|
||||
// Container represents a created (but not necessarily running) container.
|
||||
type Container interface {
|
||||
|
|
85
vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
generated
vendored
Normal file
85
vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
generated
vendored
Normal file
|
@ -0,0 +1,85 @@
|
|||
package guestrequest
|
||||
|
||||
import "github.com/Microsoft/hcsshim/internal/schema2"
|
||||
|
||||
// Arguably, many of these (at least CombinedLayers) should have been generated
|
||||
// by swagger.
|
||||
//
|
||||
// This will also change package name due to an inbound breaking change.
|
||||
|
||||
// This class is used by a modify request to add or remove a combined layers
|
||||
// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath
|
||||
// using the specified layers as the parent content. Ignores property ScratchPath
|
||||
// since the container path is already the scratch path. For linux, the GCS unions
|
||||
// the specified layers and ScratchPath together, placing the resulting union
|
||||
// filesystem at ContainerRootPath.
|
||||
type CombinedLayers struct {
|
||||
ContainerRootPath string `json:"ContainerRootPath,omitempty"`
|
||||
Layers []hcsschema.Layer `json:"Layers,omitempty"`
|
||||
ScratchPath string `json:"ScratchPath,omitempty"`
|
||||
}
|
||||
|
||||
// Defines the schema for hosted settings passed to GCS and/or OpenGCS
|
||||
|
||||
// SCSI. Scratch space for remote file-system commands, or R/W layer for containers
|
||||
type LCOWMappedVirtualDisk struct {
|
||||
MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM
|
||||
Lun uint8 `json:"Lun,omitempty"`
|
||||
Controller uint8 `json:"Controller,omitempty"`
|
||||
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||
}
|
||||
|
||||
type WCOWMappedVirtualDisk struct {
|
||||
ContainerPath string `json:"ContainerPath,omitempty"`
|
||||
Lun int32 `json:"Lun,omitempty"`
|
||||
}
|
||||
|
||||
type LCOWMappedDirectory struct {
|
||||
MountPath string `json:"MountPath,omitempty"`
|
||||
Port int32 `json:"Port,omitempty"`
|
||||
ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported)
|
||||
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||
}
|
||||
|
||||
// Read-only layers over VPMem
|
||||
type LCOWMappedVPMemDevice struct {
|
||||
DeviceNumber uint32 `json:"DeviceNumber,omitempty"`
|
||||
MountPath string `json:"MountPath,omitempty"` // /tmp/pN
|
||||
}
|
||||
|
||||
type ResourceType string
|
||||
|
||||
const (
|
||||
// These are constants for v2 schema modify guest requests.
|
||||
ResourceTypeMappedDirectory ResourceType = "MappedDirectory"
|
||||
ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk"
|
||||
ResourceTypeNetwork ResourceType = "Network"
|
||||
ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace"
|
||||
ResourceTypeCombinedLayers ResourceType = "CombinedLayers"
|
||||
ResourceTypeVPMemDevice ResourceType = "VPMemDevice"
|
||||
)
|
||||
|
||||
// GuestRequest is for modify commands passed to the guest.
|
||||
type GuestRequest struct {
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
ResourceType ResourceType `json:"ResourceType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
type NetworkModifyRequest struct {
|
||||
AdapterId string `json:"AdapterId,omitempty"`
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
type RS4NetworkModifyRequest struct {
|
||||
AdapterInstanceId string `json:"AdapterInstanceId,omitempty"`
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
// SignalProcessOptions is the options passed to either WCOW or LCOW
|
||||
// to signal a given process.
|
||||
type SignalProcessOptions struct {
|
||||
Signal int `json:,omitempty`
|
||||
}
|
|
@ -0,0 +1,69 @@
|
|||
package guid
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"io"
|
||||
"strconv"
|
||||
"strings"
|
||||
)
|
||||
|
||||
var _ = (json.Marshaler)(&GUID{})
|
||||
var _ = (json.Unmarshaler)(&GUID{})
|
||||
|
||||
type GUID [16]byte
|
||||
|
||||
func New() GUID {
|
||||
g := GUID{}
|
||||
_, err := io.ReadFull(rand.Reader, g[:])
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
return g
|
||||
}
|
||||
|
||||
func (g GUID) String() string {
|
||||
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
|
||||
}
|
||||
|
||||
func FromString(s string) GUID {
|
||||
if len(s) != 36 {
|
||||
panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
|
||||
}
|
||||
if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
|
||||
panic("invalid GUID format")
|
||||
}
|
||||
indexOrder := [16]int{
|
||||
0, 2, 4, 6,
|
||||
9, 11,
|
||||
14, 16,
|
||||
19, 21,
|
||||
24, 26, 28, 30, 32, 34,
|
||||
}
|
||||
byteOrder := [16]int{
|
||||
3, 2, 1, 0,
|
||||
5, 4,
|
||||
7, 6,
|
||||
8, 9,
|
||||
10, 11, 12, 13, 14, 15,
|
||||
}
|
||||
var g GUID
|
||||
for i, x := range indexOrder {
|
||||
b, err := strconv.ParseInt(s[x:x+2], 16, 16)
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
g[byteOrder[i]] = byte(b)
|
||||
}
|
||||
return g
|
||||
}
|
||||
|
||||
func (g GUID) MarshalJSON() ([]byte, error) {
|
||||
return json.Marshal(g.String())
|
||||
}
|
||||
|
||||
func (g *GUID) UnmarshalJSON(data []byte) error {
|
||||
*g = FromString(strings.Trim(string(data), "\""))
|
||||
return nil
|
||||
}
|
|
@ -1,8 +1,11 @@
|
|||
package hcsshim
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"sync"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
var (
|
||||
|
@ -62,7 +65,7 @@ func closeChannels(channels notificationChannels) {
|
|||
func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
|
||||
var result error
|
||||
if int32(notificationStatus) < 0 {
|
||||
result = syscall.Errno(win32FromHresult(notificationStatus))
|
||||
result = interop.Win32FromHresult(notificationStatus)
|
||||
}
|
||||
|
||||
callbackMapLock.RLock()
|
||||
|
@ -73,7 +76,13 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt
|
|||
return 0
|
||||
}
|
||||
|
||||
context.channels[notificationType] <- result
|
||||
if channel, ok := context.channels[notificationType]; ok {
|
||||
channel <- result
|
||||
} else {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"notification-type": notificationType,
|
||||
}).Warn("Received a callback of an unsupported type")
|
||||
}
|
||||
|
||||
return 0
|
||||
}
|
|
@ -1,4 +1,4 @@
|
|||
package hcsshim
|
||||
package hcs
|
||||
|
||||
import "C"
|
||||
|
|
@ -0,0 +1,284 @@
|
|||
package hcs
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"fmt"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
var (
|
||||
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
|
||||
ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
|
||||
|
||||
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||
ErrElementNotFound = syscall.Errno(0x490)
|
||||
|
||||
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||
ErrNotSupported = syscall.Errno(0x32)
|
||||
|
||||
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
|
||||
// decimal -2147024883 / hex 0x8007000d
|
||||
ErrInvalidData = syscall.Errno(0xd)
|
||||
|
||||
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
|
||||
ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
|
||||
|
||||
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
|
||||
ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
|
||||
|
||||
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
|
||||
ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
|
||||
|
||||
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
|
||||
ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
|
||||
|
||||
// ErrTimeout is an error encountered when waiting on a notification times out
|
||||
ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
|
||||
|
||||
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
|
||||
// a different expected notification
|
||||
ErrUnexpectedContainerExit = errors.New("unexpected container exit")
|
||||
|
||||
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
|
||||
// is lost while waiting for a notification
|
||||
ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
|
||||
|
||||
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
|
||||
ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
|
||||
|
||||
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
|
||||
ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
|
||||
|
||||
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
|
||||
ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
|
||||
|
||||
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
|
||||
ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
|
||||
|
||||
// ErrProcNotFound is an error encountered when the the process cannot be found
|
||||
ErrProcNotFound = syscall.Errno(0x7f)
|
||||
|
||||
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
|
||||
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
|
||||
ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
|
||||
|
||||
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
|
||||
ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
|
||||
|
||||
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
|
||||
ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
|
||||
|
||||
// ErrNotSupported is an error encountered when hcs doesn't support the request
|
||||
ErrPlatformNotSupported = errors.New("unsupported platform request")
|
||||
)
|
||||
|
||||
type ErrorEvent struct {
|
||||
Message string `json:"Message,omitempty"` // Fully formated error message
|
||||
StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form
|
||||
Provider string `json:"Provider,omitempty"`
|
||||
EventID uint16 `json:"EventId,omitempty"`
|
||||
Flags uint32 `json:"Flags,omitempty"`
|
||||
Source string `json:"Source,omitempty"`
|
||||
//Data []EventData `json:"Data,omitempty"` // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function)
|
||||
}
|
||||
|
||||
type hcsResult struct {
|
||||
Error int32
|
||||
ErrorMessage string
|
||||
ErrorEvents []ErrorEvent `json:"ErrorEvents,omitempty"`
|
||||
}
|
||||
|
||||
func (ev *ErrorEvent) String() string {
|
||||
evs := "[Event Detail: " + ev.Message
|
||||
if ev.StackTrace != "" {
|
||||
evs += " Stack Trace: " + ev.StackTrace
|
||||
}
|
||||
if ev.Provider != "" {
|
||||
evs += " Provider: " + ev.Provider
|
||||
}
|
||||
if ev.EventID != 0 {
|
||||
evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID)
|
||||
}
|
||||
if ev.Flags != 0 {
|
||||
evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags)
|
||||
}
|
||||
if ev.Source != "" {
|
||||
evs += " Source: " + ev.Source
|
||||
}
|
||||
evs += "]"
|
||||
return evs
|
||||
}
|
||||
|
||||
func processHcsResult(resultp *uint16) []ErrorEvent {
|
||||
if resultp != nil {
|
||||
resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
|
||||
logrus.WithField(logfields.JSON, resultj).
|
||||
Debug("HCS Result")
|
||||
result := &hcsResult{}
|
||||
if err := json.Unmarshal([]byte(resultj), result); err != nil {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
logfields.JSON: resultj,
|
||||
logrus.ErrorKey: err,
|
||||
}).Warning("Could not unmarshal HCS result")
|
||||
return nil
|
||||
}
|
||||
return result.ErrorEvents
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
type HcsError struct {
|
||||
Op string
|
||||
Err error
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
func (e *HcsError) Error() string {
|
||||
s := e.Op + ": " + e.Err.Error()
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
// ProcessError is an error encountered in HCS during an operation on a Process object
|
||||
type ProcessError struct {
|
||||
SystemID string
|
||||
Pid int
|
||||
Op string
|
||||
Err error
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
// SystemError is an error encountered in HCS during an operation on a Container object
|
||||
type SystemError struct {
|
||||
ID string
|
||||
Op string
|
||||
Err error
|
||||
Extra string
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
func (e *SystemError) Error() string {
|
||||
s := e.Op + " " + e.ID + ": " + e.Err.Error()
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
if e.Extra != "" {
|
||||
s += "\n(extra info: " + e.Extra + ")"
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
|
||||
// Don't double wrap errors
|
||||
if _, ok := err.(*SystemError); ok {
|
||||
return err
|
||||
}
|
||||
return &SystemError{
|
||||
ID: system.ID(),
|
||||
Op: op,
|
||||
Extra: extra,
|
||||
Err: err,
|
||||
Events: events,
|
||||
}
|
||||
}
|
||||
|
||||
func (e *ProcessError) Error() string {
|
||||
s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error())
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
|
||||
// Don't double wrap errors
|
||||
if _, ok := err.(*ProcessError); ok {
|
||||
return err
|
||||
}
|
||||
return &ProcessError{
|
||||
Pid: process.Pid(),
|
||||
SystemID: process.SystemID(),
|
||||
Op: op,
|
||||
Err: err,
|
||||
Events: events,
|
||||
}
|
||||
}
|
||||
|
||||
// IsNotExist checks if an error is caused by the Container or Process not existing.
|
||||
// Note: Currently, ErrElementNotFound can mean that a Process has either
|
||||
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||
func IsNotExist(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrComputeSystemDoesNotExist ||
|
||||
err == ErrElementNotFound ||
|
||||
err == ErrProcNotFound
|
||||
}
|
||||
|
||||
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
|
||||
// already closed by a call to the Close() method.
|
||||
func IsAlreadyClosed(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrAlreadyClosed
|
||||
}
|
||||
|
||||
// IsPending returns a boolean indicating whether the error is that
|
||||
// the requested operation is being completed in the background.
|
||||
func IsPending(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrVmcomputeOperationPending
|
||||
}
|
||||
|
||||
// IsTimeout returns a boolean indicating whether the error is caused by
|
||||
// a timeout waiting for the operation to complete.
|
||||
func IsTimeout(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrTimeout
|
||||
}
|
||||
|
||||
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
|
||||
// a Container or Process being already stopped.
|
||||
// Note: Currently, ErrElementNotFound can mean that a Process has either
|
||||
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||
func IsAlreadyStopped(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrVmcomputeAlreadyStopped ||
|
||||
err == ErrElementNotFound ||
|
||||
err == ErrProcNotFound
|
||||
}
|
||||
|
||||
// IsNotSupported returns a boolean indicating whether the error is caused by
|
||||
// unsupported platform requests
|
||||
// Note: Currently Unsupported platform requests can be mean either
|
||||
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
|
||||
// is thrown from the Platform
|
||||
func IsNotSupported(err error) bool {
|
||||
err = getInnerError(err)
|
||||
// If Platform doesn't recognize or support the request sent, below errors are seen
|
||||
return err == ErrVmcomputeInvalidJSON ||
|
||||
err == ErrInvalidData ||
|
||||
err == ErrNotSupported ||
|
||||
err == ErrVmcomputeUnknownMessage
|
||||
}
|
||||
|
||||
func getInnerError(err error) error {
|
||||
switch pe := err.(type) {
|
||||
case nil:
|
||||
return nil
|
||||
case *HcsError:
|
||||
err = pe.Err
|
||||
case *SystemError:
|
||||
err = pe.Err
|
||||
case *ProcessError:
|
||||
err = pe.Err
|
||||
}
|
||||
return err
|
||||
}
|
|
@ -0,0 +1,48 @@
|
|||
// Shim for the Host Compute Service (HCS) to manage Windows Server
|
||||
// containers and Hyper-V containers.
|
||||
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
)
|
||||
|
||||
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
|
||||
|
||||
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
|
||||
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
|
||||
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
|
||||
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
|
||||
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
|
||||
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
|
||||
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
|
||||
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
|
||||
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
|
||||
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
|
||||
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
|
||||
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
|
||||
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
|
||||
|
||||
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
|
||||
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
|
||||
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
|
||||
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
|
||||
//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
|
||||
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
|
||||
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
|
||||
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
|
||||
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
|
||||
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
|
||||
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
|
||||
|
||||
type hcsSystem syscall.Handle
|
||||
type hcsProcess syscall.Handle
|
||||
type hcsCallback syscall.Handle
|
||||
|
||||
type hcsProcessInformation struct {
|
||||
ProcessId uint32
|
||||
Reserved uint32
|
||||
StdInput syscall.Handle
|
||||
StdOutput syscall.Handle
|
||||
StdError syscall.Handle
|
||||
}
|
|
@ -0,0 +1,15 @@
|
|||
package hcs
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
func logOperationBegin(ctx logrus.Fields, msg string) {
|
||||
logrus.WithFields(ctx).Debug(msg)
|
||||
}
|
||||
|
||||
func logOperationEnd(ctx logrus.Fields, msg string, err error) {
|
||||
if err == nil {
|
||||
logrus.WithFields(ctx).Debug(msg)
|
||||
} else {
|
||||
logrus.WithFields(ctx).WithError(err).Error(msg)
|
||||
}
|
||||
}
|
|
@ -0,0 +1,465 @@
|
|||
package hcs
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"io"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/guestrequest"
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// ContainerError is an error encountered in HCS
|
||||
type Process struct {
|
||||
handleLock sync.RWMutex
|
||||
handle hcsProcess
|
||||
processID int
|
||||
system *System
|
||||
cachedPipes *cachedPipes
|
||||
callbackNumber uintptr
|
||||
|
||||
logctx logrus.Fields
|
||||
}
|
||||
|
||||
func newProcess(process hcsProcess, processID int, computeSystem *System) *Process {
|
||||
return &Process{
|
||||
handle: process,
|
||||
processID: processID,
|
||||
system: computeSystem,
|
||||
logctx: logrus.Fields{
|
||||
logfields.HCSOperation: "",
|
||||
logfields.ContainerID: computeSystem.ID(),
|
||||
logfields.ProcessID: processID,
|
||||
},
|
||||
}
|
||||
}
|
||||
|
||||
type cachedPipes struct {
|
||||
stdIn syscall.Handle
|
||||
stdOut syscall.Handle
|
||||
stdErr syscall.Handle
|
||||
}
|
||||
|
||||
type processModifyRequest struct {
|
||||
Operation string
|
||||
ConsoleSize *consoleSize `json:",omitempty"`
|
||||
CloseHandle *closeHandle `json:",omitempty"`
|
||||
}
|
||||
|
||||
type consoleSize struct {
|
||||
Height uint16
|
||||
Width uint16
|
||||
}
|
||||
|
||||
type closeHandle struct {
|
||||
Handle string
|
||||
}
|
||||
|
||||
type ProcessStatus struct {
|
||||
ProcessID uint32
|
||||
Exited bool
|
||||
ExitCode uint32
|
||||
LastWaitResult int32
|
||||
}
|
||||
|
||||
const (
|
||||
stdIn string = "StdIn"
|
||||
stdOut string = "StdOut"
|
||||
stdErr string = "StdErr"
|
||||
)
|
||||
|
||||
const (
|
||||
modifyConsoleSize string = "ConsoleSize"
|
||||
modifyCloseHandle string = "CloseHandle"
|
||||
)
|
||||
|
||||
// Pid returns the process ID of the process within the container.
|
||||
func (process *Process) Pid() int {
|
||||
return process.processID
|
||||
}
|
||||
|
||||
// SystemID returns the ID of the process's compute system.
|
||||
func (process *Process) SystemID() string {
|
||||
return process.system.ID()
|
||||
}
|
||||
|
||||
func (process *Process) logOperationBegin(operation string) {
|
||||
process.logctx[logfields.HCSOperation] = operation
|
||||
logOperationBegin(
|
||||
process.logctx,
|
||||
"hcsshim::Process - Begin Operation")
|
||||
}
|
||||
|
||||
func (process *Process) logOperationEnd(err error) {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
process.logctx,
|
||||
"hcsshim::Process - End Operation - "+result,
|
||||
err)
|
||||
process.logctx[logfields.HCSOperation] = ""
|
||||
}
|
||||
|
||||
// Signal signals the process with `options`.
|
||||
func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Signal"
|
||||
process.logOperationBegin(operation)
|
||||
defer process.logOperationEnd(err)
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
optionsb, err := json.Marshal(options)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
optionsStr := string(optionsb)
|
||||
|
||||
var resultp *uint16
|
||||
completed := false
|
||||
go syscallWatcher(process.logctx, &completed)
|
||||
err = hcsSignalProcess(process.handle, optionsStr, &resultp)
|
||||
completed = true
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Kill signals the process to terminate but does not wait for it to finish terminating.
|
||||
func (process *Process) Kill() (err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Kill"
|
||||
process.logOperationBegin(operation)
|
||||
defer process.logOperationEnd(err)
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
completed := false
|
||||
go syscallWatcher(process.logctx, &completed)
|
||||
err = hcsTerminateProcess(process.handle, &resultp)
|
||||
completed = true
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Wait waits for the process to exit.
|
||||
func (process *Process) Wait() (err error) {
|
||||
operation := "hcsshim::Process::Wait"
|
||||
process.logOperationBegin(operation)
|
||||
defer process.logOperationEnd(err)
|
||||
|
||||
err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
|
||||
// false if timeout occurs.
|
||||
func (process *Process) WaitTimeout(timeout time.Duration) (err error) {
|
||||
operation := "hcssshim::Process::WaitTimeout"
|
||||
process.logOperationBegin(operation)
|
||||
defer process.logOperationEnd(err)
|
||||
|
||||
err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// ResizeConsole resizes the console of the process.
|
||||
func (process *Process) ResizeConsole(width, height uint16) (err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::ResizeConsole"
|
||||
process.logOperationBegin(operation)
|
||||
defer process.logOperationEnd(err)
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
modifyRequest := processModifyRequest{
|
||||
Operation: modifyConsoleSize,
|
||||
ConsoleSize: &consoleSize{
|
||||
Height: height,
|
||||
Width: width,
|
||||
},
|
||||
}
|
||||
|
||||
modifyRequestb, err := json.Marshal(modifyRequest)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
modifyRequestStr := string(modifyRequestb)
|
||||
|
||||
var resultp *uint16
|
||||
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) Properties() (_ *ProcessStatus, err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Properties"
|
||||
process.logOperationBegin(operation)
|
||||
defer process.logOperationEnd(err)
|
||||
|
||||
if process.handle == 0 {
|
||||
return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
propertiesp *uint16
|
||||
)
|
||||
completed := false
|
||||
go syscallWatcher(process.logctx, &completed)
|
||||
err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
|
||||
completed = true
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
if propertiesp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
|
||||
|
||||
properties := &ProcessStatus{}
|
||||
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
|
||||
return nil, makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return properties, nil
|
||||
}
|
||||
|
||||
// ExitCode returns the exit code of the process. The process must have
|
||||
// already terminated.
|
||||
func (process *Process) ExitCode() (_ int, err error) {
|
||||
operation := "hcsshim::Process::ExitCode"
|
||||
process.logOperationBegin(operation)
|
||||
defer process.logOperationEnd(err)
|
||||
|
||||
properties, err := process.Properties()
|
||||
if err != nil {
|
||||
return 0, makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
if properties.Exited == false {
|
||||
return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
|
||||
}
|
||||
|
||||
if properties.LastWaitResult != 0 {
|
||||
return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
|
||||
}
|
||||
|
||||
return int(properties.ExitCode), nil
|
||||
}
|
||||
|
||||
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
|
||||
// these pipes does not close the underlying pipes; it should be possible to
|
||||
// call this multiple times to get multiple interfaces.
|
||||
func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Stdio"
|
||||
process.logOperationBegin(operation)
|
||||
defer process.logOperationEnd(err)
|
||||
|
||||
if process.handle == 0 {
|
||||
return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var stdIn, stdOut, stdErr syscall.Handle
|
||||
|
||||
if process.cachedPipes == nil {
|
||||
var (
|
||||
processInfo hcsProcessInformation
|
||||
resultp *uint16
|
||||
)
|
||||
err = hcsGetProcessInfo(process.handle, &processInfo, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, nil, nil, makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
|
||||
} else {
|
||||
// Use cached pipes
|
||||
stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
|
||||
|
||||
// Invalidate the cache
|
||||
process.cachedPipes = nil
|
||||
}
|
||||
|
||||
pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
|
||||
if err != nil {
|
||||
return nil, nil, nil, makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return pipes[0], pipes[1], pipes[2], nil
|
||||
}
|
||||
|
||||
// CloseStdin closes the write side of the stdin pipe so that the process is
|
||||
// notified on the read side that there is no more data in stdin.
|
||||
func (process *Process) CloseStdin() (err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::CloseStdin"
|
||||
process.logOperationBegin(operation)
|
||||
defer process.logOperationEnd(err)
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
modifyRequest := processModifyRequest{
|
||||
Operation: modifyCloseHandle,
|
||||
CloseHandle: &closeHandle{
|
||||
Handle: stdIn,
|
||||
},
|
||||
}
|
||||
|
||||
modifyRequestb, err := json.Marshal(modifyRequest)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
modifyRequestStr := string(modifyRequestb)
|
||||
|
||||
var resultp *uint16
|
||||
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the process but does not kill
|
||||
// or wait on it.
|
||||
func (process *Process) Close() (err error) {
|
||||
process.handleLock.Lock()
|
||||
defer process.handleLock.Unlock()
|
||||
|
||||
operation := "hcsshim::Process::Close"
|
||||
process.logOperationBegin(operation)
|
||||
defer process.logOperationEnd(err)
|
||||
|
||||
// Don't double free this
|
||||
if process.handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
if err = process.unregisterCallback(); err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
if err = hcsCloseProcess(process.handle); err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
process.handle = 0
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) registerCallback() error {
|
||||
context := ¬ifcationWatcherContext{
|
||||
channels: newChannels(),
|
||||
}
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackNumber := nextCallback
|
||||
nextCallback++
|
||||
callbackMap[callbackNumber] = context
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
var callbackHandle hcsCallback
|
||||
err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
context.handle = callbackHandle
|
||||
process.callbackNumber = callbackNumber
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) unregisterCallback() error {
|
||||
callbackNumber := process.callbackNumber
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
handle := context.handle
|
||||
|
||||
if handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
// hcsUnregisterProcessCallback has its own syncronization
|
||||
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||
err := hcsUnregisterProcessCallback(handle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
closeChannels(context.channels)
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackMap[callbackNumber] = nil
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
handle = 0
|
||||
|
||||
return nil
|
||||
}
|
|
@ -0,0 +1,667 @@
|
|||
package hcs
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"os"
|
||||
"strconv"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||
"github.com/Microsoft/hcsshim/internal/timeout"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// currentContainerStarts is used to limit the number of concurrent container
|
||||
// starts.
|
||||
var currentContainerStarts containerStarts
|
||||
|
||||
type containerStarts struct {
|
||||
maxParallel int
|
||||
inProgress int
|
||||
sync.Mutex
|
||||
}
|
||||
|
||||
func init() {
|
||||
mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
|
||||
if len(mpsS) > 0 {
|
||||
mpsI, err := strconv.Atoi(mpsS)
|
||||
if err != nil || mpsI < 0 {
|
||||
return
|
||||
}
|
||||
currentContainerStarts.maxParallel = mpsI
|
||||
}
|
||||
}
|
||||
|
||||
type System struct {
|
||||
handleLock sync.RWMutex
|
||||
handle hcsSystem
|
||||
id string
|
||||
callbackNumber uintptr
|
||||
|
||||
logctx logrus.Fields
|
||||
}
|
||||
|
||||
func newSystem(id string) *System {
|
||||
return &System{
|
||||
id: id,
|
||||
logctx: logrus.Fields{
|
||||
logfields.HCSOperation: "",
|
||||
logfields.ContainerID: id,
|
||||
},
|
||||
}
|
||||
}
|
||||
|
||||
func (computeSystem *System) logOperationBegin(operation string) {
|
||||
computeSystem.logctx[logfields.HCSOperation] = operation
|
||||
logOperationBegin(
|
||||
computeSystem.logctx,
|
||||
"hcsshim::ComputeSystem - Begin Operation")
|
||||
}
|
||||
|
||||
func (computeSystem *System) logOperationEnd(err error) {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
computeSystem.logctx,
|
||||
"hcsshim::ComputeSystem - End Operation - "+result,
|
||||
err)
|
||||
computeSystem.logctx[logfields.HCSOperation] = ""
|
||||
}
|
||||
|
||||
// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
|
||||
func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) {
|
||||
operation := "hcsshim::CreateComputeSystem"
|
||||
|
||||
computeSystem := newSystem(id)
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer computeSystem.logOperationEnd(err)
|
||||
|
||||
hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
hcsDocument := string(hcsDocumentB)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, hcsDocument).
|
||||
Debug("HCS ComputeSystem Document")
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
identity syscall.Handle
|
||||
)
|
||||
completed := false
|
||||
go syscallWatcher(computeSystem.logctx, &completed)
|
||||
createError := hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
|
||||
completed = true
|
||||
|
||||
if createError == nil || IsPending(createError) {
|
||||
if err = computeSystem.registerCallback(); err != nil {
|
||||
// Terminate the compute system if it still exists. We're okay to
|
||||
// ignore a failure here.
|
||||
computeSystem.Terminate()
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
}
|
||||
|
||||
events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
|
||||
if err != nil {
|
||||
if err == ErrTimeout {
|
||||
// Terminate the compute system if it still exists. We're okay to
|
||||
// ignore a failure here.
|
||||
computeSystem.Terminate()
|
||||
}
|
||||
return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
|
||||
}
|
||||
|
||||
return computeSystem, nil
|
||||
}
|
||||
|
||||
// OpenComputeSystem opens an existing compute system by ID.
|
||||
func OpenComputeSystem(id string) (_ *System, err error) {
|
||||
operation := "hcsshim::OpenComputeSystem"
|
||||
|
||||
computeSystem := newSystem(id)
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer computeSystem.logOperationEnd(err)
|
||||
|
||||
var (
|
||||
handle hcsSystem
|
||||
resultp *uint16
|
||||
)
|
||||
err = hcsOpenComputeSystem(id, &handle, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
computeSystem.handle = handle
|
||||
|
||||
if err = computeSystem.registerCallback(); err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
return computeSystem, nil
|
||||
}
|
||||
|
||||
// GetComputeSystems gets a list of the compute systems on the system that match the query
|
||||
func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) {
|
||||
operation := "hcsshim::GetComputeSystems"
|
||||
fields := logrus.Fields{
|
||||
logfields.HCSOperation: operation,
|
||||
}
|
||||
logOperationBegin(
|
||||
fields,
|
||||
"hcsshim::ComputeSystem - Begin Operation")
|
||||
|
||||
defer func() {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
fields,
|
||||
"hcsshim::ComputeSystem - End Operation - "+result,
|
||||
err)
|
||||
}()
|
||||
|
||||
queryb, err := json.Marshal(q)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
query := string(queryb)
|
||||
|
||||
logrus.WithFields(fields).
|
||||
WithField(logfields.JSON, query).
|
||||
Debug("HCS ComputeSystem Query")
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
computeSystemsp *uint16
|
||||
)
|
||||
completed := false
|
||||
go syscallWatcher(fields, &completed)
|
||||
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
|
||||
completed = true
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, &HcsError{Op: operation, Err: err, Events: events}
|
||||
}
|
||||
|
||||
if computeSystemsp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
|
||||
computeSystems := []schema1.ContainerProperties{}
|
||||
if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return computeSystems, nil
|
||||
}
|
||||
|
||||
// Start synchronously starts the computeSystem.
|
||||
func (computeSystem *System) Start() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Start"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer computeSystem.logOperationEnd(err)
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
// This is a very simple backoff-retry loop to limit the number
|
||||
// of parallel container starts if environment variable
|
||||
// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
|
||||
// It should generally only be used as a workaround to various
|
||||
// platform issues that exist between RS1 and RS4 as of Aug 2018
|
||||
if currentContainerStarts.maxParallel > 0 {
|
||||
for {
|
||||
currentContainerStarts.Lock()
|
||||
if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
|
||||
currentContainerStarts.inProgress++
|
||||
currentContainerStarts.Unlock()
|
||||
break
|
||||
}
|
||||
if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
|
||||
currentContainerStarts.Unlock()
|
||||
time.Sleep(100 * time.Millisecond)
|
||||
}
|
||||
}
|
||||
// Make sure we decrement the count when we are done.
|
||||
defer func() {
|
||||
currentContainerStarts.Lock()
|
||||
currentContainerStarts.inProgress--
|
||||
currentContainerStarts.Unlock()
|
||||
}()
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
completed := false
|
||||
go syscallWatcher(computeSystem.logctx, &completed)
|
||||
err = hcsStartComputeSystem(computeSystem.handle, "", &resultp)
|
||||
completed = true
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Start", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// ID returns the compute system's identifier.
|
||||
func (computeSystem *System) ID() string {
|
||||
return computeSystem.id
|
||||
}
|
||||
|
||||
// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
|
||||
// it may not actually be shut down until Wait() succeeds.
|
||||
func (computeSystem *System) Shutdown() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Shutdown"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer computeSystem.logOperationEnd(err)
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
completed := false
|
||||
go syscallWatcher(computeSystem.logctx, &completed)
|
||||
err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
|
||||
completed = true
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Shutdown", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
|
||||
// it may not actually be shut down until Wait() succeeds.
|
||||
func (computeSystem *System) Terminate() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Terminate"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer computeSystem.logOperationEnd(err)
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
completed := false
|
||||
go syscallWatcher(computeSystem.logctx, &completed)
|
||||
err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
|
||||
completed = true
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Terminate", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Wait synchronously waits for the compute system to shutdown or terminate.
|
||||
func (computeSystem *System) Wait() (err error) {
|
||||
operation := "hcsshim::ComputeSystem::Wait"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer computeSystem.logOperationEnd(err)
|
||||
|
||||
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Wait", "", err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
|
||||
// If the timeout expires, IsTimeout(err) == true
|
||||
func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) {
|
||||
operation := "hcsshim::ComputeSystem::WaitTimeout"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer computeSystem.logOperationEnd(err)
|
||||
|
||||
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Properties"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer computeSystem.logOperationEnd(err)
|
||||
|
||||
queryj, err := json.Marshal(schema1.PropertyQuery{types})
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
|
||||
}
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, queryj).
|
||||
Debug("HCS ComputeSystem Properties Query")
|
||||
|
||||
var resultp, propertiesp *uint16
|
||||
completed := false
|
||||
go syscallWatcher(computeSystem.logctx, &completed)
|
||||
err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
|
||||
completed = true
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, events)
|
||||
}
|
||||
|
||||
if propertiesp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
|
||||
properties := &schema1.ContainerProperties{}
|
||||
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
|
||||
}
|
||||
|
||||
return properties, nil
|
||||
}
|
||||
|
||||
// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
|
||||
func (computeSystem *System) Pause() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Pause"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer computeSystem.logOperationEnd(err)
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
completed := false
|
||||
go syscallWatcher(computeSystem.logctx, &completed)
|
||||
err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
|
||||
completed = true
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Pause", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
|
||||
func (computeSystem *System) Resume() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Resume"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer computeSystem.logOperationEnd(err)
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
completed := false
|
||||
go syscallWatcher(computeSystem.logctx, &completed)
|
||||
err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
|
||||
completed = true
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Resume", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// CreateProcess launches a new process within the computeSystem.
|
||||
func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::CreateProcess"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer computeSystem.logOperationEnd(err)
|
||||
|
||||
var (
|
||||
processInfo hcsProcessInformation
|
||||
processHandle hcsProcess
|
||||
resultp *uint16
|
||||
)
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
configurationb, err := json.Marshal(c)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
|
||||
}
|
||||
|
||||
configuration := string(configurationb)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, configuration).
|
||||
Debug("HCS ComputeSystem Process Document")
|
||||
|
||||
completed := false
|
||||
go syscallWatcher(computeSystem.logctx, &completed)
|
||||
err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
|
||||
completed = true
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
|
||||
}
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.ProcessID, processInfo.ProcessId).
|
||||
Debug("HCS ComputeSystem CreateProcess PID")
|
||||
|
||||
process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem)
|
||||
process.cachedPipes = &cachedPipes{
|
||||
stdIn: processInfo.StdInput,
|
||||
stdOut: processInfo.StdOutput,
|
||||
stdErr: processInfo.StdError,
|
||||
}
|
||||
|
||||
if err = process.registerCallback(); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
|
||||
}
|
||||
|
||||
return process, nil
|
||||
}
|
||||
|
||||
// OpenProcess gets an interface to an existing process within the computeSystem.
|
||||
func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
// Add PID for the context of this operation
|
||||
computeSystem.logctx[logfields.ProcessID] = pid
|
||||
defer delete(computeSystem.logctx, logfields.ProcessID)
|
||||
|
||||
operation := "hcsshim::ComputeSystem::OpenProcess"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer computeSystem.logOperationEnd(err)
|
||||
|
||||
var (
|
||||
processHandle hcsProcess
|
||||
resultp *uint16
|
||||
)
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
completed := false
|
||||
go syscallWatcher(computeSystem.logctx, &completed)
|
||||
err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
|
||||
completed = true
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
|
||||
}
|
||||
|
||||
process := newProcess(processHandle, pid, computeSystem)
|
||||
if err = process.registerCallback(); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
|
||||
}
|
||||
|
||||
return process, nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the compute system but does not terminate or wait for it.
|
||||
func (computeSystem *System) Close() (err error) {
|
||||
computeSystem.handleLock.Lock()
|
||||
defer computeSystem.handleLock.Unlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Close"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer computeSystem.logOperationEnd(err)
|
||||
|
||||
// Don't double free this
|
||||
if computeSystem.handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
if err = computeSystem.unregisterCallback(); err != nil {
|
||||
return makeSystemError(computeSystem, "Close", "", err, nil)
|
||||
}
|
||||
|
||||
completed := false
|
||||
go syscallWatcher(computeSystem.logctx, &completed)
|
||||
err = hcsCloseComputeSystem(computeSystem.handle)
|
||||
completed = true
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Close", "", err, nil)
|
||||
}
|
||||
|
||||
computeSystem.handle = 0
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) registerCallback() error {
|
||||
context := ¬ifcationWatcherContext{
|
||||
channels: newChannels(),
|
||||
}
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackNumber := nextCallback
|
||||
nextCallback++
|
||||
callbackMap[callbackNumber] = context
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
var callbackHandle hcsCallback
|
||||
err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
context.handle = callbackHandle
|
||||
computeSystem.callbackNumber = callbackNumber
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) unregisterCallback() error {
|
||||
callbackNumber := computeSystem.callbackNumber
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
handle := context.handle
|
||||
|
||||
if handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
// hcsUnregisterComputeSystemCallback has its own syncronization
|
||||
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||
err := hcsUnregisterComputeSystemCallback(handle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
closeChannels(context.channels)
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackMap[callbackNumber] = nil
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
handle = 0
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Modify the System by sending a request to HCS
|
||||
func (computeSystem *System) Modify(config interface{}) (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Modify"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer computeSystem.logOperationEnd(err)
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
requestJSON, err := json.Marshal(config)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
requestString := string(requestJSON)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, requestString).
|
||||
Debug("HCS ComputeSystem Modify Document")
|
||||
|
||||
var resultp *uint16
|
||||
completed := false
|
||||
go syscallWatcher(computeSystem.logctx, &completed)
|
||||
err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
|
||||
completed = true
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Modify", requestString, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
|
@ -1,4 +1,4 @@
|
|||
package hcsshim
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"io"
|
|
@ -1,4 +1,4 @@
|
|||
package hcsshim
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"time"
|
||||
|
@ -6,13 +6,13 @@ import (
|
|||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
|
||||
err = processHcsResult(err, resultp)
|
||||
func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
|
||||
events := processHcsResult(resultp)
|
||||
if IsPending(err) {
|
||||
return waitForNotification(callbackNumber, expectedNotification, timeout)
|
||||
return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
|
||||
}
|
||||
|
||||
return err
|
||||
return events, err
|
||||
}
|
||||
|
||||
func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
|
|
@ -0,0 +1,33 @@
|
|||
package hcs
|
||||
|
||||
import (
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/Microsoft/hcsshim/internal/timeout"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// syscallWatcher is used as a very simple goroutine around calls into
|
||||
// the platform. In some cases, we have seen HCS APIs not returning due to
|
||||
// various bugs, and the goroutine making the syscall ends up not returning,
|
||||
// prior to its async callback. By spinning up a syscallWatcher, it allows
|
||||
// us to at least log a warning if a syscall doesn't complete in a reasonable
|
||||
// amount of time.
|
||||
//
|
||||
// Usage is:
|
||||
//
|
||||
// completed := false
|
||||
// go syscallWatcher(context, &completed)
|
||||
// <syscall>
|
||||
// completed = true
|
||||
//
|
||||
func syscallWatcher(context logrus.Fields, syscallCompleted *bool) {
|
||||
time.Sleep(timeout.SyscallWatcher)
|
||||
if *syscallCompleted {
|
||||
return
|
||||
}
|
||||
logrus.WithFields(context).
|
||||
WithField(logfields.Timeout, timeout.SyscallWatcher).
|
||||
Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
|
||||
}
|
462
vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
generated
vendored
Normal file
462
vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
generated
vendored
Normal file
|
@ -0,0 +1,462 @@
|
|||
// Code generated mksyscall_windows.exe DO NOT EDIT
|
||||
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
var _ unsafe.Pointer
|
||||
|
||||
// Do the interface allocations only once for common
|
||||
// Errno values.
|
||||
const (
|
||||
errnoERROR_IO_PENDING = 997
|
||||
)
|
||||
|
||||
var (
|
||||
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||
)
|
||||
|
||||
// errnoErr returns common boxed Errno values, to prevent
|
||||
// allocations at runtime.
|
||||
func errnoErr(e syscall.Errno) error {
|
||||
switch e {
|
||||
case 0:
|
||||
return nil
|
||||
case errnoERROR_IO_PENDING:
|
||||
return errERROR_IO_PENDING
|
||||
}
|
||||
// TODO: add more here, after collecting data on the common
|
||||
// error values see on Windows. (perhaps when running
|
||||
// all.bat?)
|
||||
return e
|
||||
}
|
||||
|
||||
var (
|
||||
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
|
||||
|
||||
procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems")
|
||||
procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem")
|
||||
procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem")
|
||||
procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem")
|
||||
procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem")
|
||||
procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem")
|
||||
procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem")
|
||||
procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem")
|
||||
procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem")
|
||||
procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties")
|
||||
procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem")
|
||||
procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
|
||||
procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
|
||||
procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess")
|
||||
procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess")
|
||||
procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess")
|
||||
procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess")
|
||||
|
||||
procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo")
|
||||
procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties")
|
||||
procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess")
|
||||
procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties")
|
||||
procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback")
|
||||
procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
|
||||
)
|
||||
|
||||
func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(query)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
|
||||
}
|
||||
|
||||
func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(id)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
var _p1 *uint16
|
||||
_p1, hr = syscall.UTF16PtrFromString(configuration)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
|
||||
}
|
||||
|
||||
func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
if hr = procHcsCreateComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(id)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsOpenComputeSystem(_p0, computeSystem, result)
|
||||
}
|
||||
|
||||
func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
if hr = procHcsOpenComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
|
||||
if hr = procHcsCloseComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsStartComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsStartComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsShutdownComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsTerminateComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsPauseComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsPauseComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsResumeComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsResumeComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
|
||||
}
|
||||
|
||||
func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(configuration)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsModifyComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsModifyComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
|
||||
if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
|
||||
if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(processParameters)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
|
||||
}
|
||||
|
||||
func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsCreateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsOpenProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCloseProcess(process hcsProcess) (hr error) {
|
||||
if hr = procHcsCloseProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsSignalProcess(process, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
|
||||
if hr = procHcsGetProcessInfo.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetProcessProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(settings)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsModifyProcess(process, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsModifyProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsGetServiceProperties(_p0, properties, result)
|
||||
}
|
||||
|
||||
func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetServiceProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
|
||||
if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
|
||||
if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
|
@ -0,0 +1,51 @@
|
|||
package hcserror
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"syscall"
|
||||
)
|
||||
|
||||
const ERROR_GEN_FAILURE = syscall.Errno(31)
|
||||
|
||||
type HcsError struct {
|
||||
title string
|
||||
rest string
|
||||
Err error
|
||||
}
|
||||
|
||||
func (e *HcsError) Error() string {
|
||||
s := e.title
|
||||
if len(s) > 0 && s[len(s)-1] != ' ' {
|
||||
s += " "
|
||||
}
|
||||
s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err))
|
||||
if e.rest != "" {
|
||||
if e.rest[0] != ' ' {
|
||||
s += " "
|
||||
}
|
||||
s += e.rest
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
func New(err error, title, rest string) error {
|
||||
// Pass through DLL errors directly since they do not originate from HCS.
|
||||
if _, ok := err.(*syscall.DLLError); ok {
|
||||
return err
|
||||
}
|
||||
return &HcsError{title, rest, err}
|
||||
}
|
||||
|
||||
func Errorf(err error, title, format string, a ...interface{}) error {
|
||||
return New(err, title, fmt.Sprintf(format, a...))
|
||||
}
|
||||
|
||||
func Win32FromError(err error) uint32 {
|
||||
if herr, ok := err.(*HcsError); ok {
|
||||
return Win32FromError(herr.Err)
|
||||
}
|
||||
if code, ok := err.(syscall.Errno); ok {
|
||||
return uint32(code)
|
||||
}
|
||||
return uint32(ERROR_GEN_FAILURE)
|
||||
}
|
|
@ -0,0 +1,23 @@
|
|||
package hns
|
||||
|
||||
import "fmt"
|
||||
|
||||
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go
|
||||
|
||||
//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
|
||||
|
||||
type EndpointNotFoundError struct {
|
||||
EndpointName string
|
||||
}
|
||||
|
||||
func (e EndpointNotFoundError) Error() string {
|
||||
return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
|
||||
}
|
||||
|
||||
type NetworkNotFoundError struct {
|
||||
NetworkName string
|
||||
}
|
||||
|
||||
func (e NetworkNotFoundError) Error() string {
|
||||
return fmt.Sprintf("Network %s not found", e.NetworkName)
|
||||
}
|
|
@ -0,0 +1,260 @@
|
|||
package hns
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"net"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// HNSEndpoint represents a network endpoint in HNS
|
||||
type HNSEndpoint struct {
|
||||
Id string `json:"ID,omitempty"`
|
||||
Name string `json:",omitempty"`
|
||||
VirtualNetwork string `json:",omitempty"`
|
||||
VirtualNetworkName string `json:",omitempty"`
|
||||
Policies []json.RawMessage `json:",omitempty"`
|
||||
MacAddress string `json:",omitempty"`
|
||||
IPAddress net.IP `json:",omitempty"`
|
||||
DNSSuffix string `json:",omitempty"`
|
||||
DNSServerList string `json:",omitempty"`
|
||||
GatewayAddress string `json:",omitempty"`
|
||||
EnableInternalDNS bool `json:",omitempty"`
|
||||
DisableICC bool `json:",omitempty"`
|
||||
PrefixLength uint8 `json:",omitempty"`
|
||||
IsRemoteEndpoint bool `json:",omitempty"`
|
||||
Namespace *Namespace `json:",omitempty"`
|
||||
}
|
||||
|
||||
//SystemType represents the type of the system on which actions are done
|
||||
type SystemType string
|
||||
|
||||
// SystemType const
|
||||
const (
|
||||
ContainerType SystemType = "Container"
|
||||
VirtualMachineType SystemType = "VirtualMachine"
|
||||
HostType SystemType = "Host"
|
||||
)
|
||||
|
||||
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
|
||||
// Supported resource types are Network and Request Types are Add/Remove
|
||||
type EndpointAttachDetachRequest struct {
|
||||
ContainerID string `json:"ContainerId,omitempty"`
|
||||
SystemType SystemType `json:"SystemType"`
|
||||
CompartmentID uint16 `json:"CompartmentId,omitempty"`
|
||||
VirtualNICName string `json:"VirtualNicName,omitempty"`
|
||||
}
|
||||
|
||||
// EndpointResquestResponse is object to get the endpoint request response
|
||||
type EndpointResquestResponse struct {
|
||||
Success bool
|
||||
Error string
|
||||
}
|
||||
|
||||
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
|
||||
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
|
||||
endpoint := &HNSEndpoint{}
|
||||
err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return endpoint, nil
|
||||
}
|
||||
|
||||
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
|
||||
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
|
||||
var endpoint []HNSEndpoint
|
||||
err := hnsCall("GET", "/endpoints/", "", &endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return endpoint, nil
|
||||
}
|
||||
|
||||
// GetHNSEndpointByID get the Endpoint by ID
|
||||
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
|
||||
return HNSEndpointRequest("GET", endpointID, "")
|
||||
}
|
||||
|
||||
// GetHNSEndpointByName gets the endpoint filtered by Name
|
||||
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
|
||||
hnsResponse, err := HNSListEndpointRequest()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
for _, hnsEndpoint := range hnsResponse {
|
||||
if hnsEndpoint.Name == endpointName {
|
||||
return &hnsEndpoint, nil
|
||||
}
|
||||
}
|
||||
return nil, EndpointNotFoundError{EndpointName: endpointName}
|
||||
}
|
||||
|
||||
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
|
||||
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
|
||||
operation := "Create"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
jsonString, err := json.Marshal(endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return HNSEndpointRequest("POST", "", string(jsonString))
|
||||
}
|
||||
|
||||
// Delete Endpoint by sending EndpointRequest to HNS
|
||||
func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
|
||||
operation := "Delete"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
return HNSEndpointRequest("DELETE", endpoint.Id, "")
|
||||
}
|
||||
|
||||
// Update Endpoint
|
||||
func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
|
||||
operation := "Update"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
jsonString, err := json.Marshal(endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
|
||||
|
||||
return endpoint, err
|
||||
}
|
||||
|
||||
// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
|
||||
func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
|
||||
operation := "ApplyACLPolicy"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
for _, policy := range policies {
|
||||
if policy == nil {
|
||||
continue
|
||||
}
|
||||
jsonString, err := json.Marshal(policy)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
endpoint.Policies = append(endpoint.Policies, jsonString)
|
||||
}
|
||||
|
||||
_, err := endpoint.Update()
|
||||
return err
|
||||
}
|
||||
|
||||
// ContainerAttach attaches an endpoint to container
|
||||
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
|
||||
operation := "ContainerAttach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
ContainerID: containerID,
|
||||
CompartmentID: compartmentID,
|
||||
SystemType: ContainerType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// ContainerDetach detaches an endpoint from container
|
||||
func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
|
||||
operation := "ContainerDetach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
ContainerID: containerID,
|
||||
SystemType: ContainerType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// HostAttach attaches a nic on the host
|
||||
func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
|
||||
operation := "HostAttach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
CompartmentID: compartmentID,
|
||||
SystemType: HostType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
|
||||
}
|
||||
|
||||
// HostDetach detaches a nic on the host
|
||||
func (endpoint *HNSEndpoint) HostDetach() error {
|
||||
operation := "HostDetach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
SystemType: HostType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// VirtualMachineNICAttach attaches a endpoint to a virtual machine
|
||||
func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
|
||||
operation := "VirtualMachineNicAttach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
VirtualNICName: virtualMachineNICName,
|
||||
SystemType: VirtualMachineType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// VirtualMachineNICDetach detaches a endpoint from a virtual machine
|
||||
func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
|
||||
operation := "VirtualMachineNicDetach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
SystemType: VirtualMachineType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
}
|
|
@ -1,9 +1,11 @@
|
|||
package hcsshim
|
||||
package hns
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/hcserror"
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
|
@ -13,9 +15,9 @@ func hnsCall(method, path, request string, returnResponse interface{}) error {
|
|||
|
||||
err := _hnsCall(method, path, request, &responseBuffer)
|
||||
if err != nil {
|
||||
return makeError(err, "hnsCall ", "")
|
||||
return hcserror.New(err, "hnsCall ", "")
|
||||
}
|
||||
response := convertAndFreeCoTaskMemString(responseBuffer)
|
||||
response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
|
||||
|
||||
hnsresponse := &hnsResponse{}
|
||||
if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
|
|
@ -0,0 +1,28 @@
|
|||
package hns
|
||||
|
||||
type HNSGlobals struct {
|
||||
Version HNSVersion `json:"Version"`
|
||||
}
|
||||
|
||||
type HNSVersion struct {
|
||||
Major int `json:"Major"`
|
||||
Minor int `json:"Minor"`
|
||||
}
|
||||
|
||||
var (
|
||||
HNSVersion1803 = HNSVersion{Major: 7, Minor: 2}
|
||||
)
|
||||
|
||||
func GetHNSGlobals() (*HNSGlobals, error) {
|
||||
var version HNSVersion
|
||||
err := hnsCall("GET", "/globals/version", "", &version)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
globals := &HNSGlobals{
|
||||
Version: version,
|
||||
}
|
||||
|
||||
return globals, nil
|
||||
}
|
|
@ -0,0 +1,141 @@
|
|||
package hns
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"net"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// Subnet is assoicated with a network and represents a list
|
||||
// of subnets available to the network
|
||||
type Subnet struct {
|
||||
AddressPrefix string `json:",omitempty"`
|
||||
GatewayAddress string `json:",omitempty"`
|
||||
Policies []json.RawMessage `json:",omitempty"`
|
||||
}
|
||||
|
||||
// MacPool is assoicated with a network and represents a list
|
||||
// of macaddresses available to the network
|
||||
type MacPool struct {
|
||||
StartMacAddress string `json:",omitempty"`
|
||||
EndMacAddress string `json:",omitempty"`
|
||||
}
|
||||
|
||||
// HNSNetwork represents a network in HNS
|
||||
type HNSNetwork struct {
|
||||
Id string `json:"ID,omitempty"`
|
||||
Name string `json:",omitempty"`
|
||||
Type string `json:",omitempty"`
|
||||
NetworkAdapterName string `json:",omitempty"`
|
||||
SourceMac string `json:",omitempty"`
|
||||
Policies []json.RawMessage `json:",omitempty"`
|
||||
MacPools []MacPool `json:",omitempty"`
|
||||
Subnets []Subnet `json:",omitempty"`
|
||||
DNSSuffix string `json:",omitempty"`
|
||||
DNSServerList string `json:",omitempty"`
|
||||
DNSServerCompartment uint32 `json:",omitempty"`
|
||||
ManagementIP string `json:",omitempty"`
|
||||
AutomaticDNS bool `json:",omitempty"`
|
||||
}
|
||||
|
||||
type hnsNetworkResponse struct {
|
||||
Success bool
|
||||
Error string
|
||||
Output HNSNetwork
|
||||
}
|
||||
|
||||
type hnsResponse struct {
|
||||
Success bool
|
||||
Error string
|
||||
Output json.RawMessage
|
||||
}
|
||||
|
||||
// HNSNetworkRequest makes a call into HNS to update/query a single network
|
||||
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
|
||||
var network HNSNetwork
|
||||
err := hnsCall(method, "/networks/"+path, request, &network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return &network, nil
|
||||
}
|
||||
|
||||
// HNSListNetworkRequest makes a HNS call to query the list of available networks
|
||||
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
|
||||
var network []HNSNetwork
|
||||
err := hnsCall(method, "/networks/"+path, request, &network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return network, nil
|
||||
}
|
||||
|
||||
// GetHNSNetworkByID
|
||||
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
|
||||
return HNSNetworkRequest("GET", networkID, "")
|
||||
}
|
||||
|
||||
// GetHNSNetworkName filtered by Name
|
||||
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
|
||||
hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
for _, hnsnetwork := range hsnnetworks {
|
||||
if hnsnetwork.Name == networkName {
|
||||
return &hnsnetwork, nil
|
||||
}
|
||||
}
|
||||
return nil, NetworkNotFoundError{NetworkName: networkName}
|
||||
}
|
||||
|
||||
// Create Network by sending NetworkRequest to HNS.
|
||||
func (network *HNSNetwork) Create() (*HNSNetwork, error) {
|
||||
operation := "Create"
|
||||
title := "hcsshim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s", network.Id)
|
||||
|
||||
jsonString, err := json.Marshal(network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return HNSNetworkRequest("POST", "", string(jsonString))
|
||||
}
|
||||
|
||||
// Delete Network by sending NetworkRequest to HNS
|
||||
func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
|
||||
operation := "Delete"
|
||||
title := "hcsshim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s", network.Id)
|
||||
|
||||
return HNSNetworkRequest("DELETE", network.Id, "")
|
||||
}
|
||||
|
||||
// Creates an endpoint on the Network.
|
||||
func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
|
||||
return &HNSEndpoint{
|
||||
VirtualNetwork: network.Id,
|
||||
IPAddress: ipAddress,
|
||||
MacAddress: string(macAddress),
|
||||
}
|
||||
}
|
||||
|
||||
func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
|
||||
operation := "CreateEndpoint"
|
||||
title := "hcsshim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
|
||||
|
||||
endpoint.VirtualNetwork = network.Id
|
||||
return endpoint.Create()
|
||||
}
|
||||
|
||||
func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
|
||||
operation := "CreateRemoteEndpoint"
|
||||
title := "hcsshim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s", network.Id)
|
||||
endpoint.IsRemoteEndpoint = true
|
||||
return network.CreateEndpoint(endpoint)
|
||||
}
|
|
@ -0,0 +1,98 @@
|
|||
package hns
|
||||
|
||||
// Type of Request Support in ModifySystem
|
||||
type PolicyType string
|
||||
|
||||
// RequestType const
|
||||
const (
|
||||
Nat PolicyType = "NAT"
|
||||
ACL PolicyType = "ACL"
|
||||
PA PolicyType = "PA"
|
||||
VLAN PolicyType = "VLAN"
|
||||
VSID PolicyType = "VSID"
|
||||
VNet PolicyType = "VNET"
|
||||
L2Driver PolicyType = "L2Driver"
|
||||
Isolation PolicyType = "Isolation"
|
||||
QOS PolicyType = "QOS"
|
||||
OutboundNat PolicyType = "OutBoundNAT"
|
||||
ExternalLoadBalancer PolicyType = "ELB"
|
||||
Route PolicyType = "ROUTE"
|
||||
)
|
||||
|
||||
type NatPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
Protocol string
|
||||
InternalPort uint16
|
||||
ExternalPort uint16
|
||||
}
|
||||
|
||||
type QosPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
MaximumOutgoingBandwidthInBytes uint64
|
||||
}
|
||||
|
||||
type IsolationPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
VLAN uint
|
||||
VSID uint
|
||||
InDefaultIsolation bool
|
||||
}
|
||||
|
||||
type VlanPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
VLAN uint
|
||||
}
|
||||
|
||||
type VsidPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
VSID uint
|
||||
}
|
||||
|
||||
type PaPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
PA string `json:"PA"`
|
||||
}
|
||||
|
||||
type OutboundNatPolicy struct {
|
||||
Policy
|
||||
VIP string `json:"VIP,omitempty"`
|
||||
Exceptions []string `json:"ExceptionList,omitempty"`
|
||||
}
|
||||
|
||||
type ActionType string
|
||||
type DirectionType string
|
||||
type RuleType string
|
||||
|
||||
const (
|
||||
Allow ActionType = "Allow"
|
||||
Block ActionType = "Block"
|
||||
|
||||
In DirectionType = "In"
|
||||
Out DirectionType = "Out"
|
||||
|
||||
Host RuleType = "Host"
|
||||
Switch RuleType = "Switch"
|
||||
)
|
||||
|
||||
type ACLPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
Id string `json:"Id,omitempty"`
|
||||
Protocol uint16
|
||||
Protocols string `json:"Protocols,omitempty"`
|
||||
InternalPort uint16
|
||||
Action ActionType
|
||||
Direction DirectionType
|
||||
LocalAddresses string
|
||||
RemoteAddresses string
|
||||
LocalPorts string `json:"LocalPorts,omitempty"`
|
||||
LocalPort uint16
|
||||
RemotePorts string `json:"RemotePorts,omitempty"`
|
||||
RemotePort uint16
|
||||
RuleType RuleType `json:"RuleType,omitempty"`
|
||||
Priority uint16
|
||||
ServiceName string
|
||||
}
|
||||
|
||||
type Policy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
}
|
201
vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go
generated
vendored
Normal file
201
vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go
generated
vendored
Normal file
|
@ -0,0 +1,201 @@
|
|||
package hns
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// RoutePolicy is a structure defining schema for Route based Policy
|
||||
type RoutePolicy struct {
|
||||
Policy
|
||||
DestinationPrefix string `json:"DestinationPrefix,omitempty"`
|
||||
NextHop string `json:"NextHop,omitempty"`
|
||||
EncapEnabled bool `json:"NeedEncap,omitempty"`
|
||||
}
|
||||
|
||||
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
|
||||
type ELBPolicy struct {
|
||||
LBPolicy
|
||||
SourceVIP string `json:"SourceVIP,omitempty"`
|
||||
VIPs []string `json:"VIPs,omitempty"`
|
||||
ILB bool `json:"ILB,omitempty"`
|
||||
DSR bool `json:"IsDSR,omitempty"`
|
||||
}
|
||||
|
||||
// LBPolicy is a structure defining schema for LoadBalancing based Policy
|
||||
type LBPolicy struct {
|
||||
Policy
|
||||
Protocol uint16 `json:"Protocol,omitempty"`
|
||||
InternalPort uint16
|
||||
ExternalPort uint16
|
||||
}
|
||||
|
||||
// PolicyList is a structure defining schema for Policy list request
|
||||
type PolicyList struct {
|
||||
ID string `json:"ID,omitempty"`
|
||||
EndpointReferences []string `json:"References,omitempty"`
|
||||
Policies []json.RawMessage `json:"Policies,omitempty"`
|
||||
}
|
||||
|
||||
// HNSPolicyListRequest makes a call into HNS to update/query a single network
|
||||
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
|
||||
var policy PolicyList
|
||||
err := hnsCall(method, "/policylists/"+path, request, &policy)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return &policy, nil
|
||||
}
|
||||
|
||||
// HNSListPolicyListRequest gets all the policy list
|
||||
func HNSListPolicyListRequest() ([]PolicyList, error) {
|
||||
var plist []PolicyList
|
||||
err := hnsCall("GET", "/policylists/", "", &plist)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return plist, nil
|
||||
}
|
||||
|
||||
// PolicyListRequest makes a HNS call to modify/query a network policy list
|
||||
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
|
||||
policylist := &PolicyList{}
|
||||
err := hnsCall(method, "/policylists/"+path, request, &policylist)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return policylist, nil
|
||||
}
|
||||
|
||||
// GetPolicyListByID get the policy list by ID
|
||||
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
|
||||
return PolicyListRequest("GET", policyListID, "")
|
||||
}
|
||||
|
||||
// Create PolicyList by sending PolicyListRequest to HNS.
|
||||
func (policylist *PolicyList) Create() (*PolicyList, error) {
|
||||
operation := "Create"
|
||||
title := "hcsshim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s", policylist.ID)
|
||||
jsonString, err := json.Marshal(policylist)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return PolicyListRequest("POST", "", string(jsonString))
|
||||
}
|
||||
|
||||
// Delete deletes PolicyList
|
||||
func (policylist *PolicyList) Delete() (*PolicyList, error) {
|
||||
operation := "Delete"
|
||||
title := "hcsshim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s", policylist.ID)
|
||||
|
||||
return PolicyListRequest("DELETE", policylist.ID, "")
|
||||
}
|
||||
|
||||
// AddEndpoint add an endpoint to a Policy List
|
||||
func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
|
||||
operation := "AddEndpoint"
|
||||
title := "hcsshim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
|
||||
|
||||
_, err := policylist.Delete()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// Add Endpoint to the Existing List
|
||||
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||
|
||||
return policylist.Create()
|
||||
}
|
||||
|
||||
// RemoveEndpoint removes an endpoint from the Policy List
|
||||
func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
|
||||
operation := "RemoveEndpoint"
|
||||
title := "hcsshim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
|
||||
|
||||
_, err := policylist.Delete()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
elementToRemove := "/endpoints/" + endpoint.Id
|
||||
|
||||
var references []string
|
||||
|
||||
for _, endpointReference := range policylist.EndpointReferences {
|
||||
if endpointReference == elementToRemove {
|
||||
continue
|
||||
}
|
||||
references = append(references, endpointReference)
|
||||
}
|
||||
policylist.EndpointReferences = references
|
||||
return policylist.Create()
|
||||
}
|
||||
|
||||
// AddLoadBalancer policy list for the specified endpoints
|
||||
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
|
||||
operation := "AddLoadBalancer"
|
||||
title := "hcsshim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
|
||||
|
||||
policylist := &PolicyList{}
|
||||
|
||||
elbPolicy := &ELBPolicy{
|
||||
SourceVIP: sourceVIP,
|
||||
ILB: isILB,
|
||||
}
|
||||
|
||||
if len(vip) > 0 {
|
||||
elbPolicy.VIPs = []string{vip}
|
||||
}
|
||||
elbPolicy.Type = ExternalLoadBalancer
|
||||
elbPolicy.Protocol = protocol
|
||||
elbPolicy.InternalPort = internalPort
|
||||
elbPolicy.ExternalPort = externalPort
|
||||
|
||||
for _, endpoint := range endpoints {
|
||||
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||
}
|
||||
|
||||
jsonString, err := json.Marshal(elbPolicy)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
policylist.Policies = append(policylist.Policies, jsonString)
|
||||
return policylist.Create()
|
||||
}
|
||||
|
||||
// AddRoute adds route policy list for the specified endpoints
|
||||
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
|
||||
operation := "AddRoute"
|
||||
title := "hcsshim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
|
||||
|
||||
policylist := &PolicyList{}
|
||||
|
||||
rPolicy := &RoutePolicy{
|
||||
DestinationPrefix: destinationPrefix,
|
||||
NextHop: nextHop,
|
||||
EncapEnabled: encapEnabled,
|
||||
}
|
||||
rPolicy.Type = Route
|
||||
|
||||
for _, endpoint := range endpoints {
|
||||
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||
}
|
||||
|
||||
jsonString, err := json.Marshal(rPolicy)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
policylist.Policies = append(policylist.Policies, jsonString)
|
||||
return policylist.Create()
|
||||
}
|
|
@ -0,0 +1,49 @@
|
|||
package hns
|
||||
|
||||
import (
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
type HNSSupportedFeatures struct {
|
||||
Acl HNSAclFeatures `json:"ACL"`
|
||||
}
|
||||
|
||||
type HNSAclFeatures struct {
|
||||
AclAddressLists bool `json:"AclAddressLists"`
|
||||
AclNoHostRulePriority bool `json:"AclHostRulePriority"`
|
||||
AclPortRanges bool `json:"AclPortRanges"`
|
||||
AclRuleId bool `json:"AclRuleId"`
|
||||
}
|
||||
|
||||
func GetHNSSupportedFeatures() HNSSupportedFeatures {
|
||||
var hnsFeatures HNSSupportedFeatures
|
||||
|
||||
globals, err := GetHNSGlobals()
|
||||
if err != nil {
|
||||
// Expected on pre-1803 builds, all features will be false/unsupported
|
||||
logrus.Debugf("Unable to obtain HNS globals: %s", err)
|
||||
return hnsFeatures
|
||||
}
|
||||
|
||||
hnsFeatures.Acl = HNSAclFeatures{
|
||||
AclAddressLists: isHNSFeatureSupported(globals.Version, HNSVersion1803),
|
||||
AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803),
|
||||
AclPortRanges: isHNSFeatureSupported(globals.Version, HNSVersion1803),
|
||||
AclRuleId: isHNSFeatureSupported(globals.Version, HNSVersion1803),
|
||||
}
|
||||
|
||||
return hnsFeatures
|
||||
}
|
||||
|
||||
func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool {
|
||||
if currentVersion.Major < minVersionSupported.Major {
|
||||
return false
|
||||
}
|
||||
if currentVersion.Major > minVersionSupported.Major {
|
||||
return true
|
||||
}
|
||||
if currentVersion.Minor < minVersionSupported.Minor {
|
||||
return false
|
||||
}
|
||||
return true
|
||||
}
|
|
@ -0,0 +1,110 @@
|
|||
package hns
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"os"
|
||||
"path"
|
||||
"strings"
|
||||
)
|
||||
|
||||
type namespaceRequest struct {
|
||||
IsDefault bool `json:",omitempty"`
|
||||
}
|
||||
|
||||
type namespaceEndpointRequest struct {
|
||||
ID string `json:"Id"`
|
||||
}
|
||||
|
||||
type NamespaceResource struct {
|
||||
Type string
|
||||
Data json.RawMessage
|
||||
}
|
||||
|
||||
type namespaceResourceRequest struct {
|
||||
Type string
|
||||
Data interface{}
|
||||
}
|
||||
|
||||
type Namespace struct {
|
||||
ID string
|
||||
IsDefault bool `json:",omitempty"`
|
||||
ResourceList []NamespaceResource `json:",omitempty"`
|
||||
}
|
||||
|
||||
func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) {
|
||||
var err error
|
||||
hnspath := "/namespaces/"
|
||||
if id != nil {
|
||||
hnspath = path.Join(hnspath, *id)
|
||||
}
|
||||
if subpath != "" {
|
||||
hnspath = path.Join(hnspath, subpath)
|
||||
}
|
||||
var reqJSON []byte
|
||||
if request != nil {
|
||||
if reqJSON, err = json.Marshal(request); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
var ns Namespace
|
||||
err = hnsCall(method, hnspath, string(reqJSON), &ns)
|
||||
if err != nil {
|
||||
if strings.Contains(err.Error(), "Element not found.") {
|
||||
return nil, os.ErrNotExist
|
||||
}
|
||||
return nil, fmt.Errorf("%s %s: %s", method, hnspath, err)
|
||||
}
|
||||
return &ns, err
|
||||
}
|
||||
|
||||
func CreateNamespace() (string, error) {
|
||||
req := namespaceRequest{}
|
||||
ns, err := issueNamespaceRequest(nil, "POST", "", &req)
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
return ns.ID, nil
|
||||
}
|
||||
|
||||
func RemoveNamespace(id string) error {
|
||||
_, err := issueNamespaceRequest(&id, "DELETE", "", nil)
|
||||
return err
|
||||
}
|
||||
|
||||
func GetNamespaceEndpoints(id string) ([]string, error) {
|
||||
ns, err := issueNamespaceRequest(&id, "GET", "", nil)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
var endpoints []string
|
||||
for _, rsrc := range ns.ResourceList {
|
||||
if rsrc.Type == "Endpoint" {
|
||||
var endpoint namespaceEndpointRequest
|
||||
err = json.Unmarshal(rsrc.Data, &endpoint)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("unmarshal endpoint: %s", err)
|
||||
}
|
||||
endpoints = append(endpoints, endpoint.ID)
|
||||
}
|
||||
}
|
||||
return endpoints, nil
|
||||
}
|
||||
|
||||
func AddNamespaceEndpoint(id string, endpointID string) error {
|
||||
resource := namespaceResourceRequest{
|
||||
Type: "Endpoint",
|
||||
Data: namespaceEndpointRequest{endpointID},
|
||||
}
|
||||
_, err := issueNamespaceRequest(&id, "POST", "addresource", &resource)
|
||||
return err
|
||||
}
|
||||
|
||||
func RemoveNamespaceEndpoint(id string, endpointID string) error {
|
||||
resource := namespaceResourceRequest{
|
||||
Type: "Endpoint",
|
||||
Data: namespaceEndpointRequest{endpointID},
|
||||
}
|
||||
_, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource)
|
||||
return err
|
||||
}
|
74
vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go
generated
vendored
Normal file
74
vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go
generated
vendored
Normal file
|
@ -0,0 +1,74 @@
|
|||
// Code generated mksyscall_windows.exe DO NOT EDIT
|
||||
|
||||
package hns
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
var _ unsafe.Pointer
|
||||
|
||||
// Do the interface allocations only once for common
|
||||
// Errno values.
|
||||
const (
|
||||
errnoERROR_IO_PENDING = 997
|
||||
)
|
||||
|
||||
var (
|
||||
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||
)
|
||||
|
||||
// errnoErr returns common boxed Errno values, to prevent
|
||||
// allocations at runtime.
|
||||
func errnoErr(e syscall.Errno) error {
|
||||
switch e {
|
||||
case 0:
|
||||
return nil
|
||||
case errnoERROR_IO_PENDING:
|
||||
return errERROR_IO_PENDING
|
||||
}
|
||||
// TODO: add more here, after collecting data on the common
|
||||
// error values see on Windows. (perhaps when running
|
||||
// all.bat?)
|
||||
return e
|
||||
}
|
||||
|
||||
var (
|
||||
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
|
||||
|
||||
procHNSCall = modvmcompute.NewProc("HNSCall")
|
||||
)
|
||||
|
||||
func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(method)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
var _p1 *uint16
|
||||
_p1, hr = syscall.UTF16PtrFromString(path)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
var _p2 *uint16
|
||||
_p2, hr = syscall.UTF16PtrFromString(object)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return __hnsCall(_p0, _p1, _p2, response)
|
||||
}
|
||||
|
||||
func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
|
||||
if hr = procHNSCall.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
hr = interop.Win32FromHresult(r0)
|
||||
}
|
||||
return
|
||||
}
|
|
@ -0,0 +1,27 @@
|
|||
package interop
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
)
|
||||
|
||||
//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go interop.go
|
||||
|
||||
//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree
|
||||
|
||||
func ConvertAndFreeCoTaskMemString(buffer *uint16) string {
|
||||
str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:])
|
||||
coTaskMemFree(unsafe.Pointer(buffer))
|
||||
return str
|
||||
}
|
||||
|
||||
func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
|
||||
return []byte(ConvertAndFreeCoTaskMemString(buffer))
|
||||
}
|
||||
|
||||
func Win32FromHresult(hr uintptr) syscall.Errno {
|
||||
if hr&0x1fff0000 == 0x00070000 {
|
||||
return syscall.Errno(hr & 0xffff)
|
||||
}
|
||||
return syscall.Errno(hr)
|
||||
}
|
48
vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go
generated
vendored
Normal file
48
vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go
generated
vendored
Normal file
|
@ -0,0 +1,48 @@
|
|||
// Code generated by 'go generate'; DO NOT EDIT.
|
||||
|
||||
package interop
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
var _ unsafe.Pointer
|
||||
|
||||
// Do the interface allocations only once for common
|
||||
// Errno values.
|
||||
const (
|
||||
errnoERROR_IO_PENDING = 997
|
||||
)
|
||||
|
||||
var (
|
||||
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||
)
|
||||
|
||||
// errnoErr returns common boxed Errno values, to prevent
|
||||
// allocations at runtime.
|
||||
func errnoErr(e syscall.Errno) error {
|
||||
switch e {
|
||||
case 0:
|
||||
return nil
|
||||
case errnoERROR_IO_PENDING:
|
||||
return errERROR_IO_PENDING
|
||||
}
|
||||
// TODO: add more here, after collecting data on the common
|
||||
// error values see on Windows. (perhaps when running
|
||||
// all.bat?)
|
||||
return e
|
||||
}
|
||||
|
||||
var (
|
||||
modole32 = windows.NewLazySystemDLL("ole32.dll")
|
||||
|
||||
procCoTaskMemFree = modole32.NewProc("CoTaskMemFree")
|
||||
)
|
||||
|
||||
func coTaskMemFree(buffer unsafe.Pointer) {
|
||||
syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0)
|
||||
return
|
||||
}
|
|
@ -0,0 +1,37 @@
|
|||
package logfields
|
||||
|
||||
const (
|
||||
// Identifiers
|
||||
|
||||
ContainerID = "cid"
|
||||
UVMID = "uvm-id"
|
||||
ProcessID = "pid"
|
||||
|
||||
// Common Misc
|
||||
|
||||
// Timeout represents an operation timeout.
|
||||
Timeout = "timeout"
|
||||
JSON = "json"
|
||||
|
||||
// Keys/values
|
||||
|
||||
Field = "field"
|
||||
OCIAnnotation = "oci-annotation"
|
||||
Value = "value"
|
||||
|
||||
// Golang type's
|
||||
|
||||
ExpectedType = "expected-type"
|
||||
Bool = "bool"
|
||||
Uint32 = "uint32"
|
||||
Uint64 = "uint64"
|
||||
|
||||
// HCS
|
||||
|
||||
HCSOperation = "hcs-op"
|
||||
HCSOperationResult = "hcs-op-result"
|
||||
|
||||
// runhcs
|
||||
|
||||
VMShimOperation = "vmshim-op"
|
||||
)
|
|
@ -0,0 +1,24 @@
|
|||
package longpath
|
||||
|
||||
import (
|
||||
"path/filepath"
|
||||
"strings"
|
||||
)
|
||||
|
||||
// LongAbs makes a path absolute and returns it in NT long path form.
|
||||
func LongAbs(path string) (string, error) {
|
||||
if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
|
||||
return path, nil
|
||||
}
|
||||
if !filepath.IsAbs(path) {
|
||||
absPath, err := filepath.Abs(path)
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
path = absPath
|
||||
}
|
||||
if strings.HasPrefix(path, `\\`) {
|
||||
return `\\?\UNC\` + path[2:], nil
|
||||
}
|
||||
return `\\?\` + path, nil
|
||||
}
|
|
@ -0,0 +1,52 @@
|
|||
package mergemaps
|
||||
|
||||
import "encoding/json"
|
||||
|
||||
// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
|
||||
// in ToMap are overwritten. Values in fromMap are added to ToMap.
|
||||
// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
|
||||
func Merge(fromMap, ToMap interface{}) interface{} {
|
||||
switch fromMap := fromMap.(type) {
|
||||
case map[string]interface{}:
|
||||
ToMap, ok := ToMap.(map[string]interface{})
|
||||
if !ok {
|
||||
return fromMap
|
||||
}
|
||||
for keyToMap, valueToMap := range ToMap {
|
||||
if valueFromMap, ok := fromMap[keyToMap]; ok {
|
||||
fromMap[keyToMap] = Merge(valueFromMap, valueToMap)
|
||||
} else {
|
||||
fromMap[keyToMap] = valueToMap
|
||||
}
|
||||
}
|
||||
case nil:
|
||||
// merge(nil, map[string]interface{...}) -> map[string]interface{...}
|
||||
ToMap, ok := ToMap.(map[string]interface{})
|
||||
if ok {
|
||||
return ToMap
|
||||
}
|
||||
}
|
||||
return fromMap
|
||||
}
|
||||
|
||||
// MergeJSON merges the contents of a JSON string into an object representation,
|
||||
// returning a new object suitable for translating to JSON.
|
||||
func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) {
|
||||
if len(additionalJSON) == 0 {
|
||||
return object, nil
|
||||
}
|
||||
objectJSON, err := json.Marshal(object)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
var objectMap, newMap map[string]interface{}
|
||||
err = json.Unmarshal(objectJSON, &objectMap)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
err = json.Unmarshal(additionalJSON, &newMap)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return Merge(newMap, objectMap), nil
|
||||
}
|
431
vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go
generated
vendored
Normal file
431
vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go
generated
vendored
Normal file
|
@ -0,0 +1,431 @@
|
|||
package safefile
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"io"
|
||||
"os"
|
||||
"path/filepath"
|
||||
"strings"
|
||||
"syscall"
|
||||
"unicode/utf16"
|
||||
"unsafe"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/longpath"
|
||||
|
||||
winio "github.com/Microsoft/go-winio"
|
||||
)
|
||||
|
||||
//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go
|
||||
|
||||
//sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile
|
||||
//sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile
|
||||
//sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb
|
||||
//sys localAlloc(flags uint32, size int) (ptr uintptr) = kernel32.LocalAlloc
|
||||
//sys localFree(ptr uintptr) = kernel32.LocalFree
|
||||
|
||||
type ioStatusBlock struct {
|
||||
Status, Information uintptr
|
||||
}
|
||||
|
||||
type objectAttributes struct {
|
||||
Length uintptr
|
||||
RootDirectory uintptr
|
||||
ObjectName uintptr
|
||||
Attributes uintptr
|
||||
SecurityDescriptor uintptr
|
||||
SecurityQoS uintptr
|
||||
}
|
||||
|
||||
type unicodeString struct {
|
||||
Length uint16
|
||||
MaximumLength uint16
|
||||
Buffer uintptr
|
||||
}
|
||||
|
||||
type fileLinkInformation struct {
|
||||
ReplaceIfExists bool
|
||||
RootDirectory uintptr
|
||||
FileNameLength uint32
|
||||
FileName [1]uint16
|
||||
}
|
||||
|
||||
type fileDispositionInformationEx struct {
|
||||
Flags uintptr
|
||||
}
|
||||
|
||||
const (
|
||||
_FileLinkInformation = 11
|
||||
_FileDispositionInformationEx = 64
|
||||
|
||||
FILE_READ_ATTRIBUTES = 0x0080
|
||||
FILE_WRITE_ATTRIBUTES = 0x0100
|
||||
DELETE = 0x10000
|
||||
|
||||
FILE_OPEN = 1
|
||||
FILE_CREATE = 2
|
||||
|
||||
FILE_DIRECTORY_FILE = 0x00000001
|
||||
FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020
|
||||
FILE_DELETE_ON_CLOSE = 0x00001000
|
||||
FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000
|
||||
FILE_OPEN_REPARSE_POINT = 0x00200000
|
||||
|
||||
FILE_DISPOSITION_DELETE = 0x00000001
|
||||
|
||||
_OBJ_DONT_REPARSE = 0x1000
|
||||
|
||||
_STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B
|
||||
)
|
||||
|
||||
func OpenRoot(path string) (*os.File, error) {
|
||||
longpath, err := longpath.LongAbs(path)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return winio.OpenForBackup(longpath, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.OPEN_EXISTING)
|
||||
}
|
||||
|
||||
func ntRelativePath(path string) ([]uint16, error) {
|
||||
path = filepath.Clean(path)
|
||||
if strings.Contains(":", path) {
|
||||
// Since alternate data streams must follow the file they
|
||||
// are attached to, finding one here (out of order) is invalid.
|
||||
return nil, errors.New("path contains invalid character `:`")
|
||||
}
|
||||
fspath := filepath.FromSlash(path)
|
||||
if len(fspath) > 0 && fspath[0] == '\\' {
|
||||
return nil, errors.New("expected relative path")
|
||||
}
|
||||
|
||||
path16 := utf16.Encode(([]rune)(fspath))
|
||||
if len(path16) > 32767 {
|
||||
return nil, syscall.ENAMETOOLONG
|
||||
}
|
||||
|
||||
return path16, nil
|
||||
}
|
||||
|
||||
// openRelativeInternal opens a relative path from the given root, failing if
|
||||
// any of the intermediate path components are reparse points.
|
||||
func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
|
||||
var (
|
||||
h uintptr
|
||||
iosb ioStatusBlock
|
||||
oa objectAttributes
|
||||
)
|
||||
|
||||
path16, err := ntRelativePath(path)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if root == nil || root.Fd() == 0 {
|
||||
return nil, errors.New("missing root directory")
|
||||
}
|
||||
|
||||
upathBuffer := localAlloc(0, int(unsafe.Sizeof(unicodeString{}))+len(path16)*2)
|
||||
defer localFree(upathBuffer)
|
||||
|
||||
upath := (*unicodeString)(unsafe.Pointer(upathBuffer))
|
||||
upath.Length = uint16(len(path16) * 2)
|
||||
upath.MaximumLength = upath.Length
|
||||
upath.Buffer = upathBuffer + unsafe.Sizeof(*upath)
|
||||
copy((*[32768]uint16)(unsafe.Pointer(upath.Buffer))[:], path16)
|
||||
|
||||
oa.Length = unsafe.Sizeof(oa)
|
||||
oa.ObjectName = upathBuffer
|
||||
oa.RootDirectory = uintptr(root.Fd())
|
||||
oa.Attributes = _OBJ_DONT_REPARSE
|
||||
status := ntCreateFile(
|
||||
&h,
|
||||
accessMask|syscall.SYNCHRONIZE,
|
||||
&oa,
|
||||
&iosb,
|
||||
nil,
|
||||
0,
|
||||
shareFlags,
|
||||
createDisposition,
|
||||
FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags,
|
||||
nil,
|
||||
0,
|
||||
)
|
||||
if status != 0 {
|
||||
return nil, rtlNtStatusToDosError(status)
|
||||
}
|
||||
|
||||
fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path))
|
||||
if err != nil {
|
||||
syscall.Close(syscall.Handle(h))
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return os.NewFile(h, fullPath), nil
|
||||
}
|
||||
|
||||
// OpenRelative opens a relative path from the given root, failing if
|
||||
// any of the intermediate path components are reparse points.
|
||||
func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
|
||||
f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags)
|
||||
if err != nil {
|
||||
err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err}
|
||||
}
|
||||
return f, err
|
||||
}
|
||||
|
||||
// LinkRelative creates a hard link from oldname to newname (relative to oldroot
|
||||
// and newroot), failing if any of the intermediate path components are reparse
|
||||
// points.
|
||||
func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error {
|
||||
// Open the old file.
|
||||
oldf, err := openRelativeInternal(
|
||||
oldname,
|
||||
oldroot,
|
||||
syscall.FILE_WRITE_ATTRIBUTES,
|
||||
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||
FILE_OPEN,
|
||||
0,
|
||||
)
|
||||
if err != nil {
|
||||
return &os.LinkError{Op: "link", Old: filepath.Join(oldroot.Name(), oldname), New: filepath.Join(newroot.Name(), newname), Err: err}
|
||||
}
|
||||
defer oldf.Close()
|
||||
|
||||
// Open the parent of the new file.
|
||||
var parent *os.File
|
||||
parentPath := filepath.Dir(newname)
|
||||
if parentPath != "." {
|
||||
parent, err = openRelativeInternal(
|
||||
parentPath,
|
||||
newroot,
|
||||
syscall.GENERIC_READ,
|
||||
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||
FILE_OPEN,
|
||||
FILE_DIRECTORY_FILE)
|
||||
if err != nil {
|
||||
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err}
|
||||
}
|
||||
defer parent.Close()
|
||||
|
||||
fi, err := winio.GetFileBasicInfo(parent)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 {
|
||||
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: rtlNtStatusToDosError(_STATUS_REPARSE_POINT_ENCOUNTERED)}
|
||||
}
|
||||
|
||||
} else {
|
||||
parent = newroot
|
||||
}
|
||||
|
||||
// Issue an NT call to create the link. This will be safe because NT will
|
||||
// not open any more directories to create the link, so it cannot walk any
|
||||
// more reparse points.
|
||||
newbase := filepath.Base(newname)
|
||||
newbase16, err := ntRelativePath(newbase)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
size := int(unsafe.Offsetof(fileLinkInformation{}.FileName)) + len(newbase16)*2
|
||||
linkinfoBuffer := localAlloc(0, size)
|
||||
defer localFree(linkinfoBuffer)
|
||||
linkinfo := (*fileLinkInformation)(unsafe.Pointer(linkinfoBuffer))
|
||||
linkinfo.RootDirectory = parent.Fd()
|
||||
linkinfo.FileNameLength = uint32(len(newbase16) * 2)
|
||||
copy((*[32768]uint16)(unsafe.Pointer(&linkinfo.FileName[0]))[:], newbase16)
|
||||
|
||||
var iosb ioStatusBlock
|
||||
status := ntSetInformationFile(
|
||||
oldf.Fd(),
|
||||
&iosb,
|
||||
linkinfoBuffer,
|
||||
uint32(size),
|
||||
_FileLinkInformation,
|
||||
)
|
||||
if status != 0 {
|
||||
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(parent.Name(), newbase), Err: rtlNtStatusToDosError(status)}
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// deleteOnClose marks a file to be deleted when the handle is closed.
|
||||
func deleteOnClose(f *os.File) error {
|
||||
disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE}
|
||||
var iosb ioStatusBlock
|
||||
status := ntSetInformationFile(
|
||||
f.Fd(),
|
||||
&iosb,
|
||||
uintptr(unsafe.Pointer(&disposition)),
|
||||
uint32(unsafe.Sizeof(disposition)),
|
||||
_FileDispositionInformationEx,
|
||||
)
|
||||
if status != 0 {
|
||||
return rtlNtStatusToDosError(status)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// clearReadOnly clears the readonly attribute on a file.
|
||||
func clearReadOnly(f *os.File) error {
|
||||
bi, err := winio.GetFileBasicInfo(f)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if bi.FileAttributes&syscall.FILE_ATTRIBUTE_READONLY == 0 {
|
||||
return nil
|
||||
}
|
||||
sbi := winio.FileBasicInfo{
|
||||
FileAttributes: bi.FileAttributes &^ syscall.FILE_ATTRIBUTE_READONLY,
|
||||
}
|
||||
if sbi.FileAttributes == 0 {
|
||||
sbi.FileAttributes = syscall.FILE_ATTRIBUTE_NORMAL
|
||||
}
|
||||
return winio.SetFileBasicInfo(f, &sbi)
|
||||
}
|
||||
|
||||
// RemoveRelative removes a file or directory relative to a root, failing if any
|
||||
// intermediate path components are reparse points.
|
||||
func RemoveRelative(path string, root *os.File) error {
|
||||
f, err := openRelativeInternal(
|
||||
path,
|
||||
root,
|
||||
FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE,
|
||||
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||
FILE_OPEN,
|
||||
FILE_OPEN_REPARSE_POINT)
|
||||
if err == nil {
|
||||
defer f.Close()
|
||||
err = deleteOnClose(f)
|
||||
if err == syscall.ERROR_ACCESS_DENIED {
|
||||
// Maybe the file is marked readonly. Clear the bit and retry.
|
||||
clearReadOnly(f)
|
||||
err = deleteOnClose(f)
|
||||
}
|
||||
}
|
||||
if err != nil {
|
||||
return &os.PathError{Op: "remove", Path: filepath.Join(root.Name(), path), Err: err}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// RemoveAllRelative removes a directory tree relative to a root, failing if any
|
||||
// intermediate path components are reparse points.
|
||||
func RemoveAllRelative(path string, root *os.File) error {
|
||||
fi, err := LstatRelative(path, root)
|
||||
if err != nil {
|
||||
if os.IsNotExist(err) {
|
||||
return nil
|
||||
}
|
||||
return err
|
||||
}
|
||||
fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes
|
||||
if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 {
|
||||
// If this is a reparse point, it can't have children. Simple remove will do.
|
||||
err := RemoveRelative(path, root)
|
||||
if err == nil || os.IsNotExist(err) {
|
||||
return nil
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
// It is necessary to use os.Open as Readdirnames does not work with
|
||||
// OpenRelative. This is safe because the above lstatrelative fails
|
||||
// if the target is outside the root, and we know this is not a
|
||||
// symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check.
|
||||
fd, err := os.Open(filepath.Join(root.Name(), path))
|
||||
if err != nil {
|
||||
if os.IsNotExist(err) {
|
||||
// Race. It was deleted between the Lstat and Open.
|
||||
// Return nil per RemoveAll's docs.
|
||||
return nil
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
// Remove contents & return first error.
|
||||
for {
|
||||
names, err1 := fd.Readdirnames(100)
|
||||
for _, name := range names {
|
||||
err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root)
|
||||
if err == nil {
|
||||
err = err1
|
||||
}
|
||||
}
|
||||
if err1 == io.EOF {
|
||||
break
|
||||
}
|
||||
// If Readdirnames returned an error, use it.
|
||||
if err == nil {
|
||||
err = err1
|
||||
}
|
||||
if len(names) == 0 {
|
||||
break
|
||||
}
|
||||
}
|
||||
fd.Close()
|
||||
|
||||
// Remove directory.
|
||||
err1 := RemoveRelative(path, root)
|
||||
if err1 == nil || os.IsNotExist(err1) {
|
||||
return nil
|
||||
}
|
||||
if err == nil {
|
||||
err = err1
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
// MkdirRelative creates a directory relative to a root, failing if any
|
||||
// intermediate path components are reparse points.
|
||||
func MkdirRelative(path string, root *os.File) error {
|
||||
f, err := openRelativeInternal(
|
||||
path,
|
||||
root,
|
||||
0,
|
||||
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||
FILE_CREATE,
|
||||
FILE_DIRECTORY_FILE)
|
||||
if err == nil {
|
||||
f.Close()
|
||||
} else {
|
||||
err = &os.PathError{Op: "mkdir", Path: filepath.Join(root.Name(), path), Err: err}
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
// LstatRelative performs a stat operation on a file relative to a root, failing
|
||||
// if any intermediate path components are reparse points.
|
||||
func LstatRelative(path string, root *os.File) (os.FileInfo, error) {
|
||||
f, err := openRelativeInternal(
|
||||
path,
|
||||
root,
|
||||
FILE_READ_ATTRIBUTES,
|
||||
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||
FILE_OPEN,
|
||||
FILE_OPEN_REPARSE_POINT)
|
||||
if err != nil {
|
||||
return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err}
|
||||
}
|
||||
defer f.Close()
|
||||
return f.Stat()
|
||||
}
|
||||
|
||||
// EnsureNotReparsePointRelative validates that a given file (relative to a
|
||||
// root) and all intermediate path components are not a reparse points.
|
||||
func EnsureNotReparsePointRelative(path string, root *os.File) error {
|
||||
// Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT.
|
||||
f, err := OpenRelative(
|
||||
path,
|
||||
root,
|
||||
0,
|
||||
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||
FILE_OPEN,
|
||||
0)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
f.Close()
|
||||
return nil
|
||||
}
|
79
vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go
generated
vendored
Normal file
79
vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go
generated
vendored
Normal file
|
@ -0,0 +1,79 @@
|
|||
// Code generated by 'go generate'; DO NOT EDIT.
|
||||
|
||||
package safefile
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
var _ unsafe.Pointer
|
||||
|
||||
// Do the interface allocations only once for common
|
||||
// Errno values.
|
||||
const (
|
||||
errnoERROR_IO_PENDING = 997
|
||||
)
|
||||
|
||||
var (
|
||||
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||
)
|
||||
|
||||
// errnoErr returns common boxed Errno values, to prevent
|
||||
// allocations at runtime.
|
||||
func errnoErr(e syscall.Errno) error {
|
||||
switch e {
|
||||
case 0:
|
||||
return nil
|
||||
case errnoERROR_IO_PENDING:
|
||||
return errERROR_IO_PENDING
|
||||
}
|
||||
// TODO: add more here, after collecting data on the common
|
||||
// error values see on Windows. (perhaps when running
|
||||
// all.bat?)
|
||||
return e
|
||||
}
|
||||
|
||||
var (
|
||||
modntdll = windows.NewLazySystemDLL("ntdll.dll")
|
||||
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
|
||||
|
||||
procNtCreateFile = modntdll.NewProc("NtCreateFile")
|
||||
procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile")
|
||||
procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb")
|
||||
procLocalAlloc = modkernel32.NewProc("LocalAlloc")
|
||||
procLocalFree = modkernel32.NewProc("LocalFree")
|
||||
)
|
||||
|
||||
func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) {
|
||||
r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0)
|
||||
status = uint32(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) {
|
||||
r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0)
|
||||
status = uint32(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func rtlNtStatusToDosError(status uint32) (winerr error) {
|
||||
r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0)
|
||||
if r0 != 0 {
|
||||
winerr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func localAlloc(flags uint32, size int) (ptr uintptr) {
|
||||
r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0)
|
||||
ptr = uintptr(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func localFree(ptr uintptr) {
|
||||
syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0)
|
||||
return
|
||||
}
|
|
@ -0,0 +1,245 @@
|
|||
package schema1
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/schema2"
|
||||
)
|
||||
|
||||
// ProcessConfig is used as both the input of Container.CreateProcess
|
||||
// and to convert the parameters to JSON for passing onto the HCS
|
||||
type ProcessConfig struct {
|
||||
ApplicationName string `json:",omitempty"`
|
||||
CommandLine string `json:",omitempty"`
|
||||
CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows
|
||||
User string `json:",omitempty"`
|
||||
WorkingDirectory string `json:",omitempty"`
|
||||
Environment map[string]string `json:",omitempty"`
|
||||
EmulateConsole bool `json:",omitempty"`
|
||||
CreateStdInPipe bool `json:",omitempty"`
|
||||
CreateStdOutPipe bool `json:",omitempty"`
|
||||
CreateStdErrPipe bool `json:",omitempty"`
|
||||
ConsoleSize [2]uint `json:",omitempty"`
|
||||
CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows
|
||||
OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows
|
||||
}
|
||||
|
||||
type Layer struct {
|
||||
ID string
|
||||
Path string
|
||||
}
|
||||
|
||||
type MappedDir struct {
|
||||
HostPath string
|
||||
ContainerPath string
|
||||
ReadOnly bool
|
||||
BandwidthMaximum uint64
|
||||
IOPSMaximum uint64
|
||||
CreateInUtilityVM bool
|
||||
// LinuxMetadata - Support added in 1803/RS4+.
|
||||
LinuxMetadata bool `json:",omitempty"`
|
||||
}
|
||||
|
||||
type MappedPipe struct {
|
||||
HostPath string
|
||||
ContainerPipeName string
|
||||
}
|
||||
|
||||
type HvRuntime struct {
|
||||
ImagePath string `json:",omitempty"`
|
||||
SkipTemplate bool `json:",omitempty"`
|
||||
LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
|
||||
LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
|
||||
LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
|
||||
BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
|
||||
WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD
|
||||
}
|
||||
|
||||
type MappedVirtualDisk struct {
|
||||
HostPath string `json:",omitempty"` // Path to VHD on the host
|
||||
ContainerPath string // Platform-specific mount point path in the container
|
||||
CreateInUtilityVM bool `json:",omitempty"`
|
||||
ReadOnly bool `json:",omitempty"`
|
||||
Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
|
||||
AttachOnly bool `json:",omitempty:`
|
||||
}
|
||||
|
||||
// AssignedDevice represents a device that has been directly assigned to a container
|
||||
//
|
||||
// NOTE: Support added in RS5
|
||||
type AssignedDevice struct {
|
||||
// InterfaceClassGUID of the device to assign to container.
|
||||
InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"`
|
||||
}
|
||||
|
||||
// ContainerConfig is used as both the input of CreateContainer
|
||||
// and to convert the parameters to JSON for passing onto the HCS
|
||||
type ContainerConfig struct {
|
||||
SystemType string // HCS requires this to be hard-coded to "Container"
|
||||
Name string // Name of the container. We use the docker ID.
|
||||
Owner string `json:",omitempty"` // The management platform that created this container
|
||||
VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
|
||||
IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows
|
||||
LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID
|
||||
Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
|
||||
Credentials string `json:",omitempty"` // Credentials information
|
||||
ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container.
|
||||
ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
|
||||
ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
|
||||
StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS
|
||||
StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
|
||||
StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
|
||||
MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes
|
||||
HostName string `json:",omitempty"` // Hostname
|
||||
MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts)
|
||||
MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes
|
||||
HvPartition bool // True if it a Hyper-V Container
|
||||
NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
|
||||
EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container
|
||||
HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
|
||||
Servicing bool `json:",omitempty"` // True if this container is for servicing
|
||||
AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution
|
||||
DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
|
||||
ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
|
||||
TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
|
||||
MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
|
||||
AssignedDevices []AssignedDevice `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5
|
||||
}
|
||||
|
||||
type ComputeSystemQuery struct {
|
||||
IDs []string `json:"Ids,omitempty"`
|
||||
Types []string `json:",omitempty"`
|
||||
Names []string `json:",omitempty"`
|
||||
Owners []string `json:",omitempty"`
|
||||
}
|
||||
|
||||
type PropertyType string
|
||||
|
||||
const (
|
||||
PropertyTypeStatistics PropertyType = "Statistics" // V1 and V2
|
||||
PropertyTypeProcessList = "ProcessList" // V1 and V2
|
||||
PropertyTypeMappedVirtualDisk = "MappedVirtualDisk" // Not supported in V2 schema call
|
||||
PropertyTypeGuestConnection = "GuestConnection" // V1 and V2. Nil return from HCS before RS5
|
||||
)
|
||||
|
||||
type PropertyQuery struct {
|
||||
PropertyTypes []PropertyType `json:",omitempty"`
|
||||
}
|
||||
|
||||
// ContainerProperties holds the properties for a container and the processes running in that container
|
||||
type ContainerProperties struct {
|
||||
ID string `json:"Id"`
|
||||
State string
|
||||
Name string
|
||||
SystemType string
|
||||
Owner string
|
||||
SiloGUID string `json:"SiloGuid,omitempty"`
|
||||
RuntimeID string `json:"RuntimeId,omitempty"`
|
||||
IsRuntimeTemplate bool `json:",omitempty"`
|
||||
RuntimeImagePath string `json:",omitempty"`
|
||||
Stopped bool `json:",omitempty"`
|
||||
ExitType string `json:",omitempty"`
|
||||
AreUpdatesPending bool `json:",omitempty"`
|
||||
ObRoot string `json:",omitempty"`
|
||||
Statistics Statistics `json:",omitempty"`
|
||||
ProcessList []ProcessListItem `json:",omitempty"`
|
||||
MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
|
||||
GuestConnectionInfo GuestConnectionInfo `json:",omitempty"`
|
||||
}
|
||||
|
||||
// MemoryStats holds the memory statistics for a container
|
||||
type MemoryStats struct {
|
||||
UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"`
|
||||
UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
|
||||
UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
|
||||
}
|
||||
|
||||
// ProcessorStats holds the processor statistics for a container
|
||||
type ProcessorStats struct {
|
||||
TotalRuntime100ns uint64 `json:",omitempty"`
|
||||
RuntimeUser100ns uint64 `json:",omitempty"`
|
||||
RuntimeKernel100ns uint64 `json:",omitempty"`
|
||||
}
|
||||
|
||||
// StorageStats holds the storage statistics for a container
|
||||
type StorageStats struct {
|
||||
ReadCountNormalized uint64 `json:",omitempty"`
|
||||
ReadSizeBytes uint64 `json:",omitempty"`
|
||||
WriteCountNormalized uint64 `json:",omitempty"`
|
||||
WriteSizeBytes uint64 `json:",omitempty"`
|
||||
}
|
||||
|
||||
// NetworkStats holds the network statistics for a container
|
||||
type NetworkStats struct {
|
||||
BytesReceived uint64 `json:",omitempty"`
|
||||
BytesSent uint64 `json:",omitempty"`
|
||||
PacketsReceived uint64 `json:",omitempty"`
|
||||
PacketsSent uint64 `json:",omitempty"`
|
||||
DroppedPacketsIncoming uint64 `json:",omitempty"`
|
||||
DroppedPacketsOutgoing uint64 `json:",omitempty"`
|
||||
EndpointId string `json:",omitempty"`
|
||||
InstanceId string `json:",omitempty"`
|
||||
}
|
||||
|
||||
// Statistics is the structure returned by a statistics call on a container
|
||||
type Statistics struct {
|
||||
Timestamp time.Time `json:",omitempty"`
|
||||
ContainerStartTime time.Time `json:",omitempty"`
|
||||
Uptime100ns uint64 `json:",omitempty"`
|
||||
Memory MemoryStats `json:",omitempty"`
|
||||
Processor ProcessorStats `json:",omitempty"`
|
||||
Storage StorageStats `json:",omitempty"`
|
||||
Network []NetworkStats `json:",omitempty"`
|
||||
}
|
||||
|
||||
// ProcessList is the structure of an item returned by a ProcessList call on a container
|
||||
type ProcessListItem struct {
|
||||
CreateTimestamp time.Time `json:",omitempty"`
|
||||
ImageName string `json:",omitempty"`
|
||||
KernelTime100ns uint64 `json:",omitempty"`
|
||||
MemoryCommitBytes uint64 `json:",omitempty"`
|
||||
MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"`
|
||||
MemoryWorkingSetSharedBytes uint64 `json:",omitempty"`
|
||||
ProcessId uint32 `json:",omitempty"`
|
||||
UserTime100ns uint64 `json:",omitempty"`
|
||||
}
|
||||
|
||||
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
|
||||
type MappedVirtualDiskController struct {
|
||||
MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
|
||||
}
|
||||
|
||||
// GuestDefinedCapabilities is part of the GuestConnectionInfo returned by a GuestConnection call on a utility VM
|
||||
type GuestDefinedCapabilities struct {
|
||||
NamespaceAddRequestSupported bool `json:",omitempty"`
|
||||
SignalProcessSupported bool `json:",omitempty"`
|
||||
}
|
||||
|
||||
// GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM
|
||||
type GuestConnectionInfo struct {
|
||||
SupportedSchemaVersions []hcsschema.Version `json:",omitempty"`
|
||||
ProtocolVersion uint32 `json:",omitempty"`
|
||||
GuestDefinedCapabilities GuestDefinedCapabilities `json:",omitempty"`
|
||||
}
|
||||
|
||||
// Type of Request Support in ModifySystem
|
||||
type RequestType string
|
||||
|
||||
// Type of Resource Support in ModifySystem
|
||||
type ResourceType string
|
||||
|
||||
// RequestType const
|
||||
const (
|
||||
Add RequestType = "Add"
|
||||
Remove RequestType = "Remove"
|
||||
Network ResourceType = "Network"
|
||||
)
|
||||
|
||||
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
|
||||
// Supported resource types are Network and Request Types are Add/Remove
|
||||
type ResourceModificationRequestResponse struct {
|
||||
Resource ResourceType `json:"ResourceType"`
|
||||
Data interface{} `json:"Settings"`
|
||||
Request RequestType `json:"RequestType,omitempty"`
|
||||
}
|
31
vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go
generated
vendored
Normal file
31
vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go
generated
vendored
Normal file
|
@ -0,0 +1,31 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type Attachment struct {
|
||||
|
||||
Type_ string `json:"Type,omitempty"`
|
||||
|
||||
Path string `json:"Path,omitempty"`
|
||||
|
||||
IgnoreFlushes bool `json:"IgnoreFlushes,omitempty"`
|
||||
|
||||
CachingMode string `json:"CachingMode,omitempty"`
|
||||
|
||||
NoWriteHardening bool `json:"NoWriteHardening,omitempty"`
|
||||
|
||||
DisableExpansionOptimization bool `json:"DisableExpansionOptimization,omitempty"`
|
||||
|
||||
IgnoreRelativeLocator bool `json:"IgnoreRelativeLocator,omitempty"`
|
||||
|
||||
CaptureIoAttributionContext bool `json:"CaptureIoAttributionContext,omitempty"`
|
||||
|
||||
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||
}
|
|
@ -0,0 +1,13 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type Battery struct {
|
||||
}
|
19
vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go
generated
vendored
Normal file
19
vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go
generated
vendored
Normal file
|
@ -0,0 +1,19 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type CacheQueryStatsResponse struct {
|
||||
|
||||
L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"`
|
||||
|
||||
L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"`
|
||||
|
||||
L3LocalBwBytes int32 `json:"L3LocalBwBytes,omitempty"`
|
||||
}
|
|
@ -0,0 +1,27 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type Chipset struct {
|
||||
Uefi *Uefi `json:"Uefi,omitempty"`
|
||||
|
||||
IsNumLockDisabled bool `json:"IsNumLockDisabled,omitempty"`
|
||||
|
||||
BaseBoardSerialNumber string `json:"BaseBoardSerialNumber,omitempty"`
|
||||
|
||||
ChassisSerialNumber string `json:"ChassisSerialNumber,omitempty"`
|
||||
|
||||
ChassisAssetTag string `json:"ChassisAssetTag,omitempty"`
|
||||
|
||||
UseUtc bool `json:"UseUtc,omitempty"`
|
||||
|
||||
// LinuxKernelDirect - Added in v2.2 Builds >=181117
|
||||
LinuxKernelDirect *LinuxKernelDirect `json:"LinuxKernelDirect,omitempty"`
|
||||
}
|
15
vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go
generated
vendored
Normal file
15
vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go
generated
vendored
Normal file
|
@ -0,0 +1,15 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type CloseHandle struct {
|
||||
|
||||
Handle string `json:"Handle,omitempty"`
|
||||
}
|
|
@ -0,0 +1,18 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
// ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port.
|
||||
type ComPort struct {
|
||||
|
||||
NamedPipe string `json:"NamedPipe,omitempty"`
|
||||
|
||||
OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"`
|
||||
}
|
27
vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go
generated
vendored
Normal file
27
vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go
generated
vendored
Normal file
|
@ -0,0 +1,27 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type ComputeSystem struct {
|
||||
|
||||
Owner string `json:"Owner,omitempty"`
|
||||
|
||||
SchemaVersion *Version `json:"SchemaVersion,omitempty"`
|
||||
|
||||
HostingSystemId string `json:"HostingSystemId,omitempty"`
|
||||
|
||||
HostedSystem *HostedSystem `json:"HostedSystem,omitempty"`
|
||||
|
||||
Container *Container `json:"Container,omitempty"`
|
||||
|
||||
VirtualMachine *VirtualMachine `json:"VirtualMachine,omitempty"`
|
||||
|
||||
ShouldTerminateOnLastHandleClosed bool `json:"ShouldTerminateOnLastHandleClosed,omitempty"`
|
||||
}
|
72
vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go
generated
vendored
Normal file
72
vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go
generated
vendored
Normal file
|
@ -0,0 +1,72 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
import (
|
||||
"net/http"
|
||||
)
|
||||
|
||||
// contextKeys are used to identify the type of value in the context.
|
||||
// Since these are string, it is possible to get a short description of the
|
||||
// context key for logging and debugging using key.String().
|
||||
|
||||
type contextKey string
|
||||
|
||||
func (c contextKey) String() string {
|
||||
return "auth " + string(c)
|
||||
}
|
||||
|
||||
var (
|
||||
// ContextOAuth2 takes a oauth2.TokenSource as authentication for the request.
|
||||
ContextOAuth2 = contextKey("token")
|
||||
|
||||
// ContextBasicAuth takes BasicAuth as authentication for the request.
|
||||
ContextBasicAuth = contextKey("basic")
|
||||
|
||||
// ContextAccessToken takes a string oauth2 access token as authentication for the request.
|
||||
ContextAccessToken = contextKey("accesstoken")
|
||||
|
||||
// ContextAPIKey takes an APIKey as authentication for the request
|
||||
ContextAPIKey = contextKey("apikey")
|
||||
)
|
||||
|
||||
// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth
|
||||
type BasicAuth struct {
|
||||
UserName string `json:"userName,omitempty"`
|
||||
Password string `json:"password,omitempty"`
|
||||
}
|
||||
|
||||
// APIKey provides API key based authentication to a request passed via context using ContextAPIKey
|
||||
type APIKey struct {
|
||||
Key string
|
||||
Prefix string
|
||||
}
|
||||
|
||||
type Configuration struct {
|
||||
BasePath string `json:"basePath,omitempty"`
|
||||
Host string `json:"host,omitempty"`
|
||||
Scheme string `json:"scheme,omitempty"`
|
||||
DefaultHeader map[string]string `json:"defaultHeader,omitempty"`
|
||||
UserAgent string `json:"userAgent,omitempty"`
|
||||
HTTPClient *http.Client
|
||||
}
|
||||
|
||||
func NewConfiguration() *Configuration {
|
||||
cfg := &Configuration{
|
||||
BasePath: "https://localhost",
|
||||
DefaultHeader: make(map[string]string),
|
||||
UserAgent: "Swagger-Codegen/2.1.0/go",
|
||||
}
|
||||
return cfg
|
||||
}
|
||||
|
||||
func (c *Configuration) AddDefaultHeader(key string, value string) {
|
||||
c.DefaultHeader[key] = value
|
||||
}
|
17
vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go
generated
vendored
Normal file
17
vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go
generated
vendored
Normal file
|
@ -0,0 +1,17 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type ConsoleSize struct {
|
||||
|
||||
Height int32 `json:"Height,omitempty"`
|
||||
|
||||
Width int32 `json:"Width,omitempty"`
|
||||
}
|
|
@ -0,0 +1,35 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type Container struct {
|
||||
|
||||
GuestOs *GuestOs `json:"GuestOs,omitempty"`
|
||||
|
||||
Storage *Storage `json:"Storage,omitempty"`
|
||||
|
||||
MappedDirectories []MappedDirectory `json:"MappedDirectories,omitempty"`
|
||||
|
||||
MappedPipes []MappedPipe `json:"MappedPipes,omitempty"`
|
||||
|
||||
Memory *Memory `json:"Memory,omitempty"`
|
||||
|
||||
Processor *Processor `json:"Processor,omitempty"`
|
||||
|
||||
Networking *Networking `json:"Networking,omitempty"`
|
||||
|
||||
HvSocket *HvSocket `json:"HvSocket,omitempty"`
|
||||
|
||||
ContainerCredentialGuard *ContainerCredentialGuardState `json:"ContainerCredentialGuard,omitempty"`
|
||||
|
||||
RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"`
|
||||
|
||||
AssignedDevices []Device `json:"AssignedDevices,omitempty"`
|
||||
}
|
25
vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go
generated
vendored
Normal file
25
vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go
generated
vendored
Normal file
|
@ -0,0 +1,25 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type ContainerCredentialGuardState struct {
|
||||
|
||||
// Authentication cookie for calls to a Container Credential Guard instance.
|
||||
Cookie string `json:"Cookie,omitempty"`
|
||||
|
||||
// Name of the RPC endpoint of the Container Credential Guard instance.
|
||||
RpcEndpoint string `json:"RpcEndpoint,omitempty"`
|
||||
|
||||
// Transport used for the configured Container Credential Guard instance.
|
||||
Transport string `json:"Transport,omitempty"`
|
||||
|
||||
// Credential spec used for the configured Container Credential Guard instance.
|
||||
CredentialSpec string `json:"CredentialSpec,omitempty"`
|
||||
}
|
26
vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go
generated
vendored
Normal file
26
vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go
generated
vendored
Normal file
|
@ -0,0 +1,26 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
// memory usage as viewed from within the container
|
||||
type ContainerMemoryInformation struct {
|
||||
|
||||
TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"`
|
||||
|
||||
TotalUsage int32 `json:"TotalUsage,omitempty"`
|
||||
|
||||
CommittedBytes int32 `json:"CommittedBytes,omitempty"`
|
||||
|
||||
SharedCommittedBytes int32 `json:"SharedCommittedBytes,omitempty"`
|
||||
|
||||
CommitLimitBytes int32 `json:"CommitLimitBytes,omitempty"`
|
||||
|
||||
PeakCommitmentBytes int32 `json:"PeakCommitmentBytes,omitempty"`
|
||||
}
|
|
@ -0,0 +1,16 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type Device struct {
|
||||
|
||||
// The interface class guid of the device to assign to container.
|
||||
InterfaceClassGuid string `json:"InterfaceClassGuid,omitempty"`
|
||||
}
|
|
@ -0,0 +1,43 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type Devices struct {
|
||||
|
||||
ComPorts map[string]ComPort `json:"ComPorts,omitempty"`
|
||||
|
||||
Scsi map[string]Scsi `json:"Scsi,omitempty"`
|
||||
|
||||
VirtualPMem *VirtualPMemController `json:"VirtualPMem,omitempty"`
|
||||
|
||||
NetworkAdapters map[string]NetworkAdapter `json:"NetworkAdapters,omitempty"`
|
||||
|
||||
VideoMonitor *VideoMonitor `json:"VideoMonitor,omitempty"`
|
||||
|
||||
Keyboard *Keyboard `json:"Keyboard,omitempty"`
|
||||
|
||||
Mouse *Mouse `json:"Mouse,omitempty"`
|
||||
|
||||
HvSocket *HvSocket2 `json:"HvSocket,omitempty"`
|
||||
|
||||
EnhancedModeVideo *EnhancedModeVideo `json:"EnhancedModeVideo,omitempty"`
|
||||
|
||||
GuestCrashReporting *GuestCrashReporting `json:"GuestCrashReporting,omitempty"`
|
||||
|
||||
VirtualSmb *VirtualSmb `json:"VirtualSmb,omitempty"`
|
||||
|
||||
Plan9 *Plan9 `json:"Plan9,omitempty"`
|
||||
|
||||
Battery *Battery `json:"Battery,omitempty"`
|
||||
|
||||
FlexibleIov map[string]FlexibleIoDevice `json:"FlexibleIov,omitempty"`
|
||||
|
||||
SharedMemory *SharedMemoryConfiguration `json:"SharedMemory,omitempty"`
|
||||
}
|
15
vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go
generated
vendored
Normal file
15
vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go
generated
vendored
Normal file
|
@ -0,0 +1,15 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type EnhancedModeVideo struct {
|
||||
|
||||
ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"`
|
||||
}
|
19
vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go
generated
vendored
Normal file
19
vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go
generated
vendored
Normal file
|
@ -0,0 +1,19 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type FlexibleIoDevice struct {
|
||||
|
||||
EmulatorId string `json:"EmulatorId,omitempty"`
|
||||
|
||||
HostingModel string `json:"HostingModel,omitempty"`
|
||||
|
||||
Configuration []string `json:"Configuration,omitempty"`
|
||||
}
|
19
vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go
generated
vendored
Normal file
19
vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go
generated
vendored
Normal file
|
@ -0,0 +1,19 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type GuestConnection struct {
|
||||
|
||||
// Use Vsock rather than Hyper-V sockets to communicate with the guest service.
|
||||
UseVsock bool `json:"UseVsock,omitempty"`
|
||||
|
||||
// Don't disconnect the guest connection when pausing the virtual machine.
|
||||
UseConnectedSuspend bool `json:"UseConnectedSuspend,omitempty"`
|
||||
}
|
21
vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go
generated
vendored
Normal file
21
vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go
generated
vendored
Normal file
|
@ -0,0 +1,21 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
// Information about the guest.
|
||||
type GuestConnectionInfo struct {
|
||||
|
||||
// Each schema version x.y stands for the range of versions a.b where a==x and b<=y. This list comes from the SupportedSchemaVersions field in GcsCapabilities.
|
||||
SupportedSchemaVersions []Version `json:"SupportedSchemaVersions,omitempty"`
|
||||
|
||||
ProtocolVersion int32 `json:"ProtocolVersion,omitempty"`
|
||||
|
||||
GuestDefinedCapabilities *interface{} `json:"GuestDefinedCapabilities,omitempty"`
|
||||
}
|
15
vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go
generated
vendored
Normal file
15
vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go
generated
vendored
Normal file
|
@ -0,0 +1,15 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type GuestCrashReporting struct {
|
||||
|
||||
WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"`
|
||||
}
|
|
@ -0,0 +1,15 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type GuestOs struct {
|
||||
|
||||
HostName string `json:"HostName,omitempty"`
|
||||
}
|
22
vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go
generated
vendored
Normal file
22
vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go
generated
vendored
Normal file
|
@ -0,0 +1,22 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type GuestState struct {
|
||||
|
||||
// The path to an existing file uses for persistent guest state storage. An empty string indicates the system should initialize new transient, in-memory guest state.
|
||||
GuestStateFilePath string `json:"GuestStateFilePath,omitempty"`
|
||||
|
||||
// The path to an existing file for persistent runtime state storage. An empty string indicates the system should initialize new transient, in-memory runtime state.
|
||||
RuntimeStateFilePath string `json:"RuntimeStateFilePath,omitempty"`
|
||||
|
||||
// If true, the guest state and runtime state files will be used as templates to populate transient, in-memory state instead of using the files as persistent backing store.
|
||||
ForceTransientState bool `json:"ForceTransientState,omitempty"`
|
||||
}
|
17
vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go
generated
vendored
Normal file
17
vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go
generated
vendored
Normal file
|
@ -0,0 +1,17 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type HostedSystem struct {
|
||||
|
||||
SchemaVersion *Version `json:"SchemaVersion,omitempty"`
|
||||
|
||||
Container *Container `json:"Container,omitempty"`
|
||||
}
|
|
@ -0,0 +1,17 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type HvSocket struct {
|
||||
|
||||
Config *HvSocketSystemConfig `json:"Config,omitempty"`
|
||||
|
||||
EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"`
|
||||
}
|
16
vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go
generated
vendored
Normal file
16
vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go
generated
vendored
Normal file
|
@ -0,0 +1,16 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
// HvSocket configuration for a VM
|
||||
type HvSocket2 struct {
|
||||
|
||||
HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"`
|
||||
}
|
22
vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go
generated
vendored
Normal file
22
vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go
generated
vendored
Normal file
|
@ -0,0 +1,22 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type HvSocketServiceConfig struct {
|
||||
|
||||
// SDDL string that HvSocket will check before allowing a host process to bind to this specific service. If not specified, defaults to the system DefaultBindSecurityDescriptor, defined in HvSocketSystemWpConfig in V1.
|
||||
BindSecurityDescriptor string `json:"BindSecurityDescriptor,omitempty"`
|
||||
|
||||
// SDDL string that HvSocket will check before allowing a host process to connect to this specific service. If not specified, defaults to the system DefaultConnectSecurityDescriptor, defined in HvSocketSystemWpConfig in V1.
|
||||
ConnectSecurityDescriptor string `json:"ConnectSecurityDescriptor,omitempty"`
|
||||
|
||||
// If true, HvSocket will process wildcard binds for this service/system combination. Wildcard binds are secured in the registry at SOFTWARE/Microsoft/Windows NT/CurrentVersion/Virtualization/HvSocket/WildcardDescriptors
|
||||
AllowWildcardBinds bool `json:"AllowWildcardBinds,omitempty"`
|
||||
}
|
22
vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go
generated
vendored
Normal file
22
vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go
generated
vendored
Normal file
|
@ -0,0 +1,22 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
// This is the HCS Schema version of the HvSocket configuration. The VMWP version is located in Config.Devices.IC in V1.
|
||||
type HvSocketSystemConfig struct {
|
||||
|
||||
// SDDL string that HvSocket will check before allowing a host process to bind to an unlisted service for this specific container/VM (not wildcard binds).
|
||||
DefaultBindSecurityDescriptor string `json:"DefaultBindSecurityDescriptor,omitempty"`
|
||||
|
||||
// SDDL string that HvSocket will check before allowing a host process to connect to an unlisted service in the VM/container.
|
||||
DefaultConnectSecurityDescriptor string `json:"DefaultConnectSecurityDescriptor,omitempty"`
|
||||
|
||||
ServiceTable map[string]HvSocketServiceConfig `json:"ServiceTable,omitempty"`
|
||||
}
|
|
@ -0,0 +1,13 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type Keyboard struct {
|
||||
}
|
|
@ -0,0 +1,22 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type Layer struct {
|
||||
|
||||
Id string `json:"Id,omitempty"`
|
||||
|
||||
Path string `json:"Path,omitempty"`
|
||||
|
||||
PathType string `json:"PathType,omitempty"`
|
||||
|
||||
// Unspecified defaults to Enabled
|
||||
Cache string `json:"Cache,omitempty"`
|
||||
}
|
18
vendor/github.com/Microsoft/hcsshim/internal/schema2/linux_kernel_direct.go
generated
vendored
Normal file
18
vendor/github.com/Microsoft/hcsshim/internal/schema2/linux_kernel_direct.go
generated
vendored
Normal file
|
@ -0,0 +1,18 @@
|
|||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.2
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type LinuxKernelDirect struct {
|
||||
KernelFilePath string `json:"KernelFilePath,omitempty"`
|
||||
|
||||
InitRdPath string `json:"InitRdPath,omitempty"`
|
||||
|
||||
KernelCmdLine string `json:"KernelCmdLine,omitempty"`
|
||||
}
|
Some files were not shown because too many files have changed in this diff Show More
Loading…
Reference in New Issue