vendor: update everything

* If possible, update each dependency to the latest available version.

* Use releases over commit IDs and avoid vendoring branches.

Signed-off-by: Valentin Rothberg <rothberg@redhat.com>
This commit is contained in:
Valentin Rothberg 2019-01-08 14:52:57 +01:00
parent 545f244212
commit bd40dcfc2b
920 changed files with 284288 additions and 43641 deletions

View File

@ -1,107 +1,107 @@
# Note: please use releases where possible. Vendoring branches (e.g., master)
# should be avoided at all costs.
#
github.com/Azure/go-ansiterm 19f72df4d05d31cbe1c56bfc8045c96babff6c7e
# TODO: no release, can we find an alternative?
github.com/Azure/go-ansiterm d6e3b3328b783f23731bc4d058875b0371ff8109
github.com/BurntSushi/toml v0.2.0
github.com/Microsoft/go-winio 78439966b38d69bf38227fbf57ac8a6fee70f69a
github.com/Microsoft/hcsshim 43f9725307998e09f2e3816c2c0c36dc98f0c982
github.com/Microsoft/go-winio v0.4.11
github.com/Microsoft/hcsshim v0.8.3
github.com/blang/semver v3.5.0
github.com/boltdb/bolt master
github.com/buger/goterm 2f8dfbc7dbbff5dd1d391ed91482c24df243b2d3
github.com/checkpoint-restore/go-criu master
github.com/containerd/cgroups 58556f5ad8448d99a6f7bea69ea4bdb7747cfeb0
github.com/containerd/continuity master
github.com/boltdb/bolt v1.3.1
# TODO: no release, can we find an alternative?
github.com/buger/goterm c206103e1f37c0c6c5c039706305ea2aa6e8ad3b
github.com/checkpoint-restore/go-criu v3.11
github.com/containerd/cgroups 39b18af02c4120960f517a3a4c2588fabb61d02c
github.com/containerd/continuity 004b46473808b3e7a4a3049c20e4376c91eb966d
github.com/containernetworking/cni v0.7.0-alpha1
github.com/containernetworking/plugins 1562a1e60ed101aacc5e08ed9dbeba8e9f3d4ec1
github.com/containers/image f0cbc16b444d729362c78244c715b45bf4019b71
github.com/containernetworking/plugins v0.7.4
github.com/containers/image v1.3
github.com/containers/storage v1.4
github.com/containers/psgo dc0bc9fac5b715034c4310ed4d795b3182360842
github.com/containers/psgo v1.1
github.com/coreos/go-systemd v14
github.com/cri-o/ocicni 2d2983e40c242322a56c22a903785e7f83eb378c
github.com/cyphar/filepath-securejoin v0.2.1
github.com/davecgh/go-spew v1.1.0
github.com/docker/distribution 7a8efe719e55bbfaff7bc5718cdf0ed51ca821df
github.com/docker/distribution 5f6282db7d65e6d72ad7c2cc66310724a57be716
github.com/docker/docker 86f080cff0914e9694068ed78d503701667c4c00
github.com/docker/docker-credential-helpers d68f9aeca33f5fd3f08eeae5e9d175edf4e731d1
github.com/docker/go-connections 3ede32e2033de7505e6500d6c868c2b9ed9f169d
github.com/docker/docker-credential-helpers v0.6.1
github.com/docker/go-connections v0.4.0
github.com/docker/go-units v0.3.2
github.com/docker/libtrust aabc10ec26b754e797f9028f4589c5b7bd90dc20
github.com/docker/spdystream ed496381df8283605c435b86d4fdd6f4f20b8c6e
github.com/fatih/camelcase f6a740d52f961c60348ebb109adde9f4635d7540
github.com/fsnotify/fsnotify 7d7316ed6e1ed2de075aab8dfc76de5d158d66e1
github.com/ghodss/yaml 04f313413ffd65ce25f2541bfd2b2ceec5c0908c
github.com/godbus/dbus a389bdde4dd695d414e47b755e95e72b7826432c
github.com/gogo/protobuf c0656edd0d9eab7c66d1eb0c568f9039345796f7
github.com/docker/spdystream 6480d4af844c189cf5dd913db24ddd339d3a4f85
github.com/fatih/camelcase v1.0.0
github.com/fsnotify/fsnotify v1.4.7
github.com/ghodss/yaml v1.0.0
# starting with dbus 5.0.0 coreos/go-systemd doesn't compile anymore
github.com/godbus/dbus v4.1.0
github.com/golang/protobuf v1.2.0
github.com/gogo/protobuf v1.2.0
github.com/golang/glog 23def4e6c14b4da8ac2ed8007337bc5eb5007998
github.com/golang/groupcache b710c8433bd175204919eb38776e944233235d03
github.com/golang/protobuf 4bd1920723d7b7c925de087aa32e2187708897f7
github.com/google/gofuzz 44d81051d367757e1c7c6a5a86423ece9afcf63c
github.com/googleapis/gnostic 0c5108395e2debce0d731cf0287ddf7242066aba
github.com/gorilla/context v1.1
github.com/gorilla/mux v1.3.0
github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55
github.com/hashicorp/go-multierror 83588e72410abfbe4df460eeb6f30841ae47d4c4
github.com/hashicorp/golang-lru 0a025b7e63adc15a622f29b0b2c4c3848243bbf6
github.com/imdario/mergo 0.2.2
github.com/google/gofuzz 24818f796faf91cd76ec7bddd72458fbced7a6c1
github.com/gorilla/context v1.1.1
github.com/gorilla/mux v1.6.2
github.com/hashicorp/errwrap v1.0.0
github.com/hashicorp/go-multierror v1.0.0
github.com/imdario/mergo v0.3.6
github.com/json-iterator/go 1.1.5
github.com/kr/pty v1.0.0
github.com/mattn/go-runewidth v0.0.1
github.com/modern-go/concurrent 1.0.3
github.com/modern-go/reflect2 v1.0.1
github.com/mattn/go-runewidth v0.0.4
github.com/mistifyio/go-zfs v2.1.1
github.com/mtrmac/gpgme b2432428689ca58c2b8e8dea9449d3295cf96fc9
github.com/opencontainers/go-digest c9281466c8b2f606084ac71339773efd177436e7
github.com/opencontainers/image-spec v1.0.0
github.com/opencontainers/runc bbb17efcb4c0ab986407812a31ba333a7450064c
github.com/opencontainers/runtime-spec d810dbc60d8c5aeeb3d054bd1132fab2121968ce
github.com/opencontainers/runtime-tools master
github.com/opencontainers/selinux 51c6c0a5dbc675792e953298cb9871819d6f9bb8
github.com/ostreedev/ostree-go master
github.com/pkg/errors v0.8.0
github.com/pmezard/go-difflib 792786c7400a136282c1664665ae0a8db921c6c2
github.com/pquerna/ffjson d49c2bc1aa135aad0c6f4fc2056623ec78f5d5ac
github.com/opencontainers/runc v1.0.0-rc6
github.com/opencontainers/runtime-spec 1722abf79c2f8f2675f47367f827c6491472cf27
github.com/opencontainers/runtime-tools v0.8.0
github.com/opencontainers/selinux v1.0.0
github.com/ostreedev/ostree-go d0388bd827cfac6fa8eec760246eb8375674b2a0
github.com/pkg/errors v0.8.1
github.com/pmezard/go-difflib v1.0.0
github.com/pquerna/ffjson e517b90714f7c0eabe6d2e570a5886ae077d6db6
github.com/seccomp/libseccomp-golang v0.9.0
github.com/seccomp/containers-golang master
github.com/seccomp/containers-golang v0.1
# TODO: logrus.IsTerminal() is private starting with v1.1.x and requires code changes in libpod
github.com/sirupsen/logrus v1.0.0
github.com/spf13/pflag 9ff6c6923cfffbcd502984b8e0c80539a94968b7
github.com/stretchr/testify 4d4bfba8f1d1027c4fdbe371823030df51419987
github.com/syndtr/gocapability e7cb7fa329f456b3855136a2642b197bad7366ba
github.com/spf13/pflag v1.0.3
github.com/stretchr/testify v1.3.0
github.com/syndtr/gocapability d98352740cb2c55f81556b63d4a1ec64c5a319c2
github.com/tchap/go-patricia v2.2.6
github.com/ulule/deepcopier master
github.com/urfave/cli 934abfb2f102315b5794e15ebc7949e4ca253920
github.com/vbatts/tar-split v0.10.2
github.com/vishvananda/netlink master
github.com/vishvananda/netns master
github.com/xeipuuv/gojsonpointer master
github.com/xeipuuv/gojsonreference master
github.com/xeipuuv/gojsonschema master
golang.org/x/crypto 81e90905daefcd6fd217b62423c0908922eadb30
golang.org/x/net c427ad74c6d7a814201695e9ffde0c5d400a7674
golang.org/x/sys master
golang.org/x/text f72d8390a633d5dfb0cc84043294db9f6c935756
golang.org/x/time f51c12702a4d776e4c1fa9b0fabab841babae631
golang.org/x/sync master
google.golang.org/grpc v1.0.4 https://github.com/grpc/grpc-go
github.com/ulule/deepcopier ca99b135e50f526fde9cd88705f0ff2f3f95b77c
# TODO: urfave/cli is not active anymore. We should transition to another library.
github.com/urfave/cli b67dcf995b6a7b7f14fad5fcb7cc5441b05e814b
github.com/vbatts/tar-split v0.11.1
github.com/vishvananda/netlink v1.0.0
github.com/vishvananda/netns 13995c7128ccc8e51e9a6bd2b551020a27180abd
github.com/xeipuuv/gojsonpointer 4e3ac2762d5f479393488629ee9370b50873b3a6
github.com/xeipuuv/gojsonreference bd5ef7bd5415a7ac448318e64f11a24cd21e594b
github.com/xeipuuv/gojsonschema v1.1.0
golang.org/x/crypto ff983b9c42bc9fbf91556e191cc8efb585c16908 https://github.com/golang/crypto
golang.org/x/net 45ffb0cd1ba084b73e26dee67e667e1be5acce83 https://github.com/golang/net
golang.org/x/sys 7fbe1cd0fcc20051e1fcb87fbabec4a1bacaaeba https://github.com/golang/sys
golang.org/x/text e6919f6577db79269a6443b9dc46d18f2238fb5d https://github.com/golang/text
golang.org/x/time 85acf8d2951cb2a3bde7632f9ff273ef0379bcbd https://github.com/golang/time
golang.org/x/sync 37e7f081c4d4c64e13b10787722085407fe5d15f https://github.com/golang/sync
gopkg.in/cheggaaa/pb.v1 v1.0.27
gopkg.in/inf.v0 v0.9.0
gopkg.in/inf.v0 v0.9.1
gopkg.in/mgo.v2 v2
gopkg.in/square/go-jose.v2 v2.1.3
gopkg.in/yaml.v2 v2
k8s.io/api 5ce4aa0bf2f097f6021127b3d879eeda82026be8 https://github.com/kubernetes/api
k8s.io/apiextensions-apiserver 1b31e26d82f1ec2e945c560790e98f34bb5f2e63 https://github.com/kubernetes/apiextensions-apiserver
k8s.io/apimachinery 616b23029fa3dc3e0ccefd47963f5651a6543d94 https://github.com/kubernetes/apimachinery
k8s.io/apiserver 4d1163080139f1f9094baf8a3a6099e85e1867f6 https://github.com/kubernetes/apiserver
k8s.io/client-go 7cd1d3291b7d9b1e2d54d4b69eb65995eaf8888e https://github.com/kubernetes/client-go
k8s.io/kube-openapi 275e2ce91dec4c05a4094a7b1daee5560b555ac9 https://github.com/kubernetes/kube-openapi
k8s.io/utils 258e2a2fa64568210fbd6267cf1d8fd87c3cb86e https://github.com/kubernetes/utils
github.com/mrunalp/fileutils master
github.com/varlink/go master
gopkg.in/yaml.v2 v2.2.2
k8s.io/api kubernetes-1.10.13-beta.0 https://github.com/kubernetes/api
k8s.io/apimachinery kubernetes-1.10.13-beta.0 https://github.com/kubernetes/apimachinery
k8s.io/client-go kubernetes-1.10.13-beta.0 https://github.com/kubernetes/client-go
github.com/mrunalp/fileutils 7d4729fb36185a7c1719923406c9d40e54fb93c7
github.com/varlink/go e9fdc57f40123518ac513eb3443e50625ad6b434
github.com/containers/buildah e7ca330f923701dba8859f5c014d0a9a3f7f0a49
github.com/Nvveen/Gotty master
github.com/fsouza/go-dockerclient master
github.com/openshift/imagebuilder master
github.com/ulikunitz/xz v0.5.4
github.com/coreos/go-iptables 25d087f3cffd9aedc0c2b7eff25f23cbf3c20fe1
# TODO: Gotty has not been updated since 2012. Can we find replacement?
github.com/Nvveen/Gotty cd527374f1e5bff4938207604a14f2e38a9cf512
# do not go beyond the below commit as the next one requires a more recent
# docker which is in conflict with openshift/imagebuilder
github.com/fsouza/go-dockerclient 29c1814d12c072344bb91aac5d2ff719db39c523
github.com/openshift/imagebuilder 474d0f9df2cbabf006bd2b1c263a7b0789e228e0
github.com/ulikunitz/xz v0.5.5
github.com/coreos/go-iptables v0.4.0
github.com/google/shlex c34317bd91bf98fab745d77b03933cf8769299fe
github.com/pkg/profile v1.2.1
github.com/klauspost/pgzip v1.2.1
github.com/klauspost/compress v1.4.1
github.com/klauspost/cpuid v1.2.0
github.com/modern-go/reflect2 1.0.1
github.com/modern-go/concurrent 1.0.3

View File

@ -5,7 +5,7 @@ type csiEntryState struct {
}
func (csiState csiEntryState) Handle(b byte) (s state, e error) {
logger.Infof("CsiEntry::Handle %#x", b)
csiState.parser.logf("CsiEntry::Handle %#x", b)
nextState, err := csiState.baseState.Handle(b)
if nextState != nil || err != nil {
@ -25,7 +25,7 @@ func (csiState csiEntryState) Handle(b byte) (s state, e error) {
}
func (csiState csiEntryState) Transition(s state) error {
logger.Infof("CsiEntry::Transition %s --> %s", csiState.Name(), s.Name())
csiState.parser.logf("CsiEntry::Transition %s --> %s", csiState.Name(), s.Name())
csiState.baseState.Transition(s)
switch s {

View File

@ -5,7 +5,7 @@ type csiParamState struct {
}
func (csiState csiParamState) Handle(b byte) (s state, e error) {
logger.Infof("CsiParam::Handle %#x", b)
csiState.parser.logf("CsiParam::Handle %#x", b)
nextState, err := csiState.baseState.Handle(b)
if nextState != nil || err != nil {
@ -26,7 +26,7 @@ func (csiState csiParamState) Handle(b byte) (s state, e error) {
}
func (csiState csiParamState) Transition(s state) error {
logger.Infof("CsiParam::Transition %s --> %s", csiState.Name(), s.Name())
csiState.parser.logf("CsiParam::Transition %s --> %s", csiState.Name(), s.Name())
csiState.baseState.Transition(s)
switch s {

View File

@ -5,7 +5,7 @@ type escapeIntermediateState struct {
}
func (escState escapeIntermediateState) Handle(b byte) (s state, e error) {
logger.Infof("escapeIntermediateState::Handle %#x", b)
escState.parser.logf("escapeIntermediateState::Handle %#x", b)
nextState, err := escState.baseState.Handle(b)
if nextState != nil || err != nil {
return nextState, err
@ -24,7 +24,7 @@ func (escState escapeIntermediateState) Handle(b byte) (s state, e error) {
}
func (escState escapeIntermediateState) Transition(s state) error {
logger.Infof("escapeIntermediateState::Transition %s --> %s", escState.Name(), s.Name())
escState.parser.logf("escapeIntermediateState::Transition %s --> %s", escState.Name(), s.Name())
escState.baseState.Transition(s)
switch s {

View File

@ -5,7 +5,7 @@ type escapeState struct {
}
func (escState escapeState) Handle(b byte) (s state, e error) {
logger.Infof("escapeState::Handle %#x", b)
escState.parser.logf("escapeState::Handle %#x", b)
nextState, err := escState.baseState.Handle(b)
if nextState != nil || err != nil {
return nextState, err
@ -28,7 +28,7 @@ func (escState escapeState) Handle(b byte) (s state, e error) {
}
func (escState escapeState) Transition(s state) error {
logger.Infof("Escape::Transition %s --> %s", escState.Name(), s.Name())
escState.parser.logf("Escape::Transition %s --> %s", escState.Name(), s.Name())
escState.baseState.Transition(s)
switch s {

View File

@ -5,7 +5,7 @@ type oscStringState struct {
}
func (oscState oscStringState) Handle(b byte) (s state, e error) {
logger.Infof("OscString::Handle %#x", b)
oscState.parser.logf("OscString::Handle %#x", b)
nextState, err := oscState.baseState.Handle(b)
if nextState != nil || err != nil {
return nextState, err

View File

@ -2,14 +2,10 @@ package ansiterm
import (
"errors"
"io/ioutil"
"log"
"os"
"github.com/sirupsen/logrus"
)
var logger *logrus.Logger
type AnsiParser struct {
currState state
eventHandler AnsiEventHandler
@ -23,50 +19,69 @@ type AnsiParser struct {
ground state
oscString state
stateMap []state
logf func(string, ...interface{})
}
func CreateParser(initialState string, evtHandler AnsiEventHandler) *AnsiParser {
logFile := ioutil.Discard
type Option func(*AnsiParser)
if isDebugEnv := os.Getenv(LogEnv); isDebugEnv == "1" {
logFile, _ = os.Create("ansiParser.log")
func WithLogf(f func(string, ...interface{})) Option {
return func(ap *AnsiParser) {
ap.logf = f
}
}
logger = &logrus.Logger{
Out: logFile,
Formatter: new(logrus.TextFormatter),
Level: logrus.InfoLevel,
}
parser := &AnsiParser{
func CreateParser(initialState string, evtHandler AnsiEventHandler, opts ...Option) *AnsiParser {
ap := &AnsiParser{
eventHandler: evtHandler,
context: &ansiContext{},
}
parser.csiEntry = csiEntryState{baseState{name: "CsiEntry", parser: parser}}
parser.csiParam = csiParamState{baseState{name: "CsiParam", parser: parser}}
parser.dcsEntry = dcsEntryState{baseState{name: "DcsEntry", parser: parser}}
parser.escape = escapeState{baseState{name: "Escape", parser: parser}}
parser.escapeIntermediate = escapeIntermediateState{baseState{name: "EscapeIntermediate", parser: parser}}
parser.error = errorState{baseState{name: "Error", parser: parser}}
parser.ground = groundState{baseState{name: "Ground", parser: parser}}
parser.oscString = oscStringState{baseState{name: "OscString", parser: parser}}
parser.stateMap = []state{
parser.csiEntry,
parser.csiParam,
parser.dcsEntry,
parser.escape,
parser.escapeIntermediate,
parser.error,
parser.ground,
parser.oscString,
for _, o := range opts {
o(ap)
}
parser.currState = getState(initialState, parser.stateMap)
if isDebugEnv := os.Getenv(LogEnv); isDebugEnv == "1" {
logFile, _ := os.Create("ansiParser.log")
logger := log.New(logFile, "", log.LstdFlags)
if ap.logf != nil {
l := ap.logf
ap.logf = func(s string, v ...interface{}) {
l(s, v...)
logger.Printf(s, v...)
}
} else {
ap.logf = logger.Printf
}
}
logger.Infof("CreateParser: parser %p", parser)
return parser
if ap.logf == nil {
ap.logf = func(string, ...interface{}) {}
}
ap.csiEntry = csiEntryState{baseState{name: "CsiEntry", parser: ap}}
ap.csiParam = csiParamState{baseState{name: "CsiParam", parser: ap}}
ap.dcsEntry = dcsEntryState{baseState{name: "DcsEntry", parser: ap}}
ap.escape = escapeState{baseState{name: "Escape", parser: ap}}
ap.escapeIntermediate = escapeIntermediateState{baseState{name: "EscapeIntermediate", parser: ap}}
ap.error = errorState{baseState{name: "Error", parser: ap}}
ap.ground = groundState{baseState{name: "Ground", parser: ap}}
ap.oscString = oscStringState{baseState{name: "OscString", parser: ap}}
ap.stateMap = []state{
ap.csiEntry,
ap.csiParam,
ap.dcsEntry,
ap.escape,
ap.escapeIntermediate,
ap.error,
ap.ground,
ap.oscString,
}
ap.currState = getState(initialState, ap.stateMap)
ap.logf("CreateParser: parser %p", ap)
return ap
}
func getState(name string, states []state) state {
@ -97,7 +112,7 @@ func (ap *AnsiParser) handle(b byte) error {
}
if newState == nil {
logger.Warning("newState is nil")
ap.logf("WARNING: newState is nil")
return errors.New("New state of 'nil' is invalid.")
}
@ -111,23 +126,23 @@ func (ap *AnsiParser) handle(b byte) error {
}
func (ap *AnsiParser) changeState(newState state) error {
logger.Infof("ChangeState %s --> %s", ap.currState.Name(), newState.Name())
ap.logf("ChangeState %s --> %s", ap.currState.Name(), newState.Name())
// Exit old state
if err := ap.currState.Exit(); err != nil {
logger.Infof("Exit state '%s' failed with : '%v'", ap.currState.Name(), err)
ap.logf("Exit state '%s' failed with : '%v'", ap.currState.Name(), err)
return err
}
// Perform transition action
if err := ap.currState.Transition(newState); err != nil {
logger.Infof("Transition from '%s' to '%s' failed with: '%v'", ap.currState.Name(), newState.Name, err)
ap.logf("Transition from '%s' to '%s' failed with: '%v'", ap.currState.Name(), newState.Name, err)
return err
}
// Enter new state
if err := newState.Enter(); err != nil {
logger.Infof("Enter state '%s' failed with: '%v'", newState.Name(), err)
ap.logf("Enter state '%s' failed with: '%v'", newState.Name(), err)
return err
}

View File

@ -27,7 +27,6 @@ func parseParams(bytes []byte) ([]string, error) {
params = append(params, s)
}
logger.Infof("Parsed params: %v with length: %d", params, len(params))
return params, nil
}
@ -37,7 +36,6 @@ func parseCmd(context ansiContext) (string, error) {
func getInt(params []string, dflt int) int {
i := getInts(params, 1, dflt)[0]
logger.Infof("getInt: %v", i)
return i
}
@ -60,8 +58,6 @@ func getInts(params []string, minCount int, dflt int) []int {
}
}
logger.Infof("getInts: %v", ints)
return ints
}

View File

@ -1,19 +1,15 @@
package ansiterm
import (
"fmt"
)
func (ap *AnsiParser) collectParam() error {
currChar := ap.context.currentChar
logger.Infof("collectParam %#x", currChar)
ap.logf("collectParam %#x", currChar)
ap.context.paramBuffer = append(ap.context.paramBuffer, currChar)
return nil
}
func (ap *AnsiParser) collectInter() error {
currChar := ap.context.currentChar
logger.Infof("collectInter %#x", currChar)
ap.logf("collectInter %#x", currChar)
ap.context.paramBuffer = append(ap.context.interBuffer, currChar)
return nil
}
@ -21,8 +17,8 @@ func (ap *AnsiParser) collectInter() error {
func (ap *AnsiParser) escDispatch() error {
cmd, _ := parseCmd(*ap.context)
intermeds := ap.context.interBuffer
logger.Infof("escDispatch currentChar: %#x", ap.context.currentChar)
logger.Infof("escDispatch: %v(%v)", cmd, intermeds)
ap.logf("escDispatch currentChar: %#x", ap.context.currentChar)
ap.logf("escDispatch: %v(%v)", cmd, intermeds)
switch cmd {
case "D": // IND
@ -43,8 +39,9 @@ func (ap *AnsiParser) escDispatch() error {
func (ap *AnsiParser) csiDispatch() error {
cmd, _ := parseCmd(*ap.context)
params, _ := parseParams(ap.context.paramBuffer)
ap.logf("Parsed params: %v with length: %d", params, len(params))
logger.Infof("csiDispatch: %v(%v)", cmd, params)
ap.logf("csiDispatch: %v(%v)", cmd, params)
switch cmd {
case "@":
@ -102,7 +99,7 @@ func (ap *AnsiParser) csiDispatch() error {
top, bottom := ints[0], ints[1]
return ap.eventHandler.DECSTBM(top, bottom)
default:
logger.Errorf(fmt.Sprintf("Unsupported CSI command: '%s', with full context: %v", cmd, ap.context))
ap.logf("ERROR: Unsupported CSI command: '%s', with full context: %v", cmd, ap.context)
return nil
}

View File

@ -175,7 +175,7 @@ func GetStdFile(nFile int) (*os.File, uintptr) {
fd, err := syscall.GetStdHandle(nFile)
if err != nil {
panic(fmt.Errorf("Invalid standard handle indentifier: %v -- %v", nFile, err))
panic(fmt.Errorf("Invalid standard handle identifier: %v -- %v", nFile, err))
}
return file, uintptr(fd)

View File

@ -49,17 +49,22 @@ var (
const (
// Console modes
// See https://msdn.microsoft.com/en-us/library/windows/desktop/ms686033(v=vs.85).aspx.
ENABLE_PROCESSED_INPUT = 0x0001
ENABLE_LINE_INPUT = 0x0002
ENABLE_ECHO_INPUT = 0x0004
ENABLE_WINDOW_INPUT = 0x0008
ENABLE_MOUSE_INPUT = 0x0010
ENABLE_INSERT_MODE = 0x0020
ENABLE_QUICK_EDIT_MODE = 0x0040
ENABLE_EXTENDED_FLAGS = 0x0080
ENABLE_PROCESSED_INPUT = 0x0001
ENABLE_LINE_INPUT = 0x0002
ENABLE_ECHO_INPUT = 0x0004
ENABLE_WINDOW_INPUT = 0x0008
ENABLE_MOUSE_INPUT = 0x0010
ENABLE_INSERT_MODE = 0x0020
ENABLE_QUICK_EDIT_MODE = 0x0040
ENABLE_EXTENDED_FLAGS = 0x0080
ENABLE_AUTO_POSITION = 0x0100
ENABLE_VIRTUAL_TERMINAL_INPUT = 0x0200
ENABLE_PROCESSED_OUTPUT = 0x0001
ENABLE_WRAP_AT_EOL_OUTPUT = 0x0002
ENABLE_PROCESSED_OUTPUT = 0x0001
ENABLE_WRAP_AT_EOL_OUTPUT = 0x0002
ENABLE_VIRTUAL_TERMINAL_PROCESSING = 0x0004
DISABLE_NEWLINE_AUTO_RETURN = 0x0008
ENABLE_LVB_GRID_WORLDWIDE = 0x0010
// Character attributes
// Note:

View File

@ -34,7 +34,7 @@ func (h *windowsAnsiEventHandler) setCursorPosition(position COORD, window SMALL
if err != nil {
return err
}
logger.Infof("Cursor position set: (%d, %d)", position.X, position.Y)
h.logf("Cursor position set: (%d, %d)", position.X, position.Y)
return err
}

View File

@ -50,8 +50,8 @@ func (h *windowsAnsiEventHandler) insertLines(param int) error {
// scroll scrolls the provided scroll region by param lines. The scroll region is in buffer coordinates.
func (h *windowsAnsiEventHandler) scroll(param int, sr scrollRegion, info *CONSOLE_SCREEN_BUFFER_INFO) error {
logger.Infof("scroll: scrollTop: %d, scrollBottom: %d", sr.top, sr.bottom)
logger.Infof("scroll: windowTop: %d, windowBottom: %d", info.Window.Top, info.Window.Bottom)
h.logf("scroll: scrollTop: %d, scrollBottom: %d", sr.top, sr.bottom)
h.logf("scroll: windowTop: %d, windowBottom: %d", info.Window.Top, info.Window.Bottom)
// Copy from and clip to the scroll region (full buffer width)
scrollRect := SMALL_RECT{

View File

@ -4,16 +4,13 @@ package winterm
import (
"bytes"
"io/ioutil"
"log"
"os"
"strconv"
"github.com/Azure/go-ansiterm"
"github.com/sirupsen/logrus"
)
var logger *logrus.Logger
type windowsAnsiEventHandler struct {
fd uintptr
file *os.File
@ -28,32 +25,52 @@ type windowsAnsiEventHandler struct {
marginByte byte
curInfo *CONSOLE_SCREEN_BUFFER_INFO
curPos COORD
logf func(string, ...interface{})
}
func CreateWinEventHandler(fd uintptr, file *os.File) ansiterm.AnsiEventHandler {
logFile := ioutil.Discard
type Option func(*windowsAnsiEventHandler)
if isDebugEnv := os.Getenv(ansiterm.LogEnv); isDebugEnv == "1" {
logFile, _ = os.Create("winEventHandler.log")
}
logger = &logrus.Logger{
Out: logFile,
Formatter: new(logrus.TextFormatter),
Level: logrus.DebugLevel,
func WithLogf(f func(string, ...interface{})) Option {
return func(w *windowsAnsiEventHandler) {
w.logf = f
}
}
func CreateWinEventHandler(fd uintptr, file *os.File, opts ...Option) ansiterm.AnsiEventHandler {
infoReset, err := GetConsoleScreenBufferInfo(fd)
if err != nil {
return nil
}
return &windowsAnsiEventHandler{
h := &windowsAnsiEventHandler{
fd: fd,
file: file,
infoReset: infoReset,
attributes: infoReset.Attributes,
}
for _, o := range opts {
o(h)
}
if isDebugEnv := os.Getenv(ansiterm.LogEnv); isDebugEnv == "1" {
logFile, _ := os.Create("winEventHandler.log")
logger := log.New(logFile, "", log.LstdFlags)
if h.logf != nil {
l := h.logf
h.logf = func(s string, v ...interface{}) {
l(s, v...)
logger.Printf(s, v...)
}
} else {
h.logf = logger.Printf
}
}
if h.logf == nil {
h.logf = func(string, ...interface{}) {}
}
return h
}
type scrollRegion struct {
@ -96,7 +113,7 @@ func (h *windowsAnsiEventHandler) simulateLF(includeCR bool) (bool, error) {
if err := h.Flush(); err != nil {
return false, err
}
logger.Info("Simulating LF inside scroll region")
h.logf("Simulating LF inside scroll region")
if err := h.scrollUp(1); err != nil {
return false, err
}
@ -119,7 +136,7 @@ func (h *windowsAnsiEventHandler) simulateLF(includeCR bool) (bool, error) {
} else {
// The cursor is at the bottom of the screen but outside the scroll
// region. Skip the LF.
logger.Info("Simulating LF outside scroll region")
h.logf("Simulating LF outside scroll region")
if includeCR {
if err := h.Flush(); err != nil {
return false, err
@ -151,7 +168,7 @@ func (h *windowsAnsiEventHandler) executeLF() error {
if err := h.Flush(); err != nil {
return err
}
logger.Info("Resetting cursor position for LF without CR")
h.logf("Resetting cursor position for LF without CR")
if err := SetConsoleCursorPosition(h.fd, pos); err != nil {
return err
}
@ -186,7 +203,7 @@ func (h *windowsAnsiEventHandler) Print(b byte) error {
func (h *windowsAnsiEventHandler) Execute(b byte) error {
switch b {
case ansiterm.ANSI_TAB:
logger.Info("Execute(TAB)")
h.logf("Execute(TAB)")
// Move to the next tab stop, but preserve auto-wrap if already set.
if !h.wrapNext {
pos, info, err := h.getCurrentInfo()
@ -269,7 +286,7 @@ func (h *windowsAnsiEventHandler) CUU(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("CUU: [%v]", []string{strconv.Itoa(param)})
h.logf("CUU: [%v]", []string{strconv.Itoa(param)})
h.clearWrap()
return h.moveCursorVertical(-param)
}
@ -278,7 +295,7 @@ func (h *windowsAnsiEventHandler) CUD(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("CUD: [%v]", []string{strconv.Itoa(param)})
h.logf("CUD: [%v]", []string{strconv.Itoa(param)})
h.clearWrap()
return h.moveCursorVertical(param)
}
@ -287,7 +304,7 @@ func (h *windowsAnsiEventHandler) CUF(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("CUF: [%v]", []string{strconv.Itoa(param)})
h.logf("CUF: [%v]", []string{strconv.Itoa(param)})
h.clearWrap()
return h.moveCursorHorizontal(param)
}
@ -296,7 +313,7 @@ func (h *windowsAnsiEventHandler) CUB(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("CUB: [%v]", []string{strconv.Itoa(param)})
h.logf("CUB: [%v]", []string{strconv.Itoa(param)})
h.clearWrap()
return h.moveCursorHorizontal(-param)
}
@ -305,7 +322,7 @@ func (h *windowsAnsiEventHandler) CNL(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("CNL: [%v]", []string{strconv.Itoa(param)})
h.logf("CNL: [%v]", []string{strconv.Itoa(param)})
h.clearWrap()
return h.moveCursorLine(param)
}
@ -314,7 +331,7 @@ func (h *windowsAnsiEventHandler) CPL(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("CPL: [%v]", []string{strconv.Itoa(param)})
h.logf("CPL: [%v]", []string{strconv.Itoa(param)})
h.clearWrap()
return h.moveCursorLine(-param)
}
@ -323,7 +340,7 @@ func (h *windowsAnsiEventHandler) CHA(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("CHA: [%v]", []string{strconv.Itoa(param)})
h.logf("CHA: [%v]", []string{strconv.Itoa(param)})
h.clearWrap()
return h.moveCursorColumn(param)
}
@ -332,7 +349,7 @@ func (h *windowsAnsiEventHandler) VPA(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("VPA: [[%d]]", param)
h.logf("VPA: [[%d]]", param)
h.clearWrap()
info, err := GetConsoleScreenBufferInfo(h.fd)
if err != nil {
@ -348,7 +365,7 @@ func (h *windowsAnsiEventHandler) CUP(row int, col int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("CUP: [[%d %d]]", row, col)
h.logf("CUP: [[%d %d]]", row, col)
h.clearWrap()
info, err := GetConsoleScreenBufferInfo(h.fd)
if err != nil {
@ -364,7 +381,7 @@ func (h *windowsAnsiEventHandler) HVP(row int, col int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("HVP: [[%d %d]]", row, col)
h.logf("HVP: [[%d %d]]", row, col)
h.clearWrap()
return h.CUP(row, col)
}
@ -373,7 +390,7 @@ func (h *windowsAnsiEventHandler) DECTCEM(visible bool) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("DECTCEM: [%v]", []string{strconv.FormatBool(visible)})
h.logf("DECTCEM: [%v]", []string{strconv.FormatBool(visible)})
h.clearWrap()
return nil
}
@ -382,7 +399,7 @@ func (h *windowsAnsiEventHandler) DECOM(enable bool) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("DECOM: [%v]", []string{strconv.FormatBool(enable)})
h.logf("DECOM: [%v]", []string{strconv.FormatBool(enable)})
h.clearWrap()
h.originMode = enable
return h.CUP(1, 1)
@ -392,7 +409,7 @@ func (h *windowsAnsiEventHandler) DECCOLM(use132 bool) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("DECCOLM: [%v]", []string{strconv.FormatBool(use132)})
h.logf("DECCOLM: [%v]", []string{strconv.FormatBool(use132)})
h.clearWrap()
if err := h.ED(2); err != nil {
return err
@ -407,7 +424,7 @@ func (h *windowsAnsiEventHandler) DECCOLM(use132 bool) error {
}
if info.Size.X < targetWidth {
if err := SetConsoleScreenBufferSize(h.fd, COORD{targetWidth, info.Size.Y}); err != nil {
logger.Info("set buffer failed:", err)
h.logf("set buffer failed: %v", err)
return err
}
}
@ -415,12 +432,12 @@ func (h *windowsAnsiEventHandler) DECCOLM(use132 bool) error {
window.Left = 0
window.Right = targetWidth - 1
if err := SetConsoleWindowInfo(h.fd, true, window); err != nil {
logger.Info("set window failed:", err)
h.logf("set window failed: %v", err)
return err
}
if info.Size.X > targetWidth {
if err := SetConsoleScreenBufferSize(h.fd, COORD{targetWidth, info.Size.Y}); err != nil {
logger.Info("set buffer failed:", err)
h.logf("set buffer failed: %v", err)
return err
}
}
@ -431,7 +448,7 @@ func (h *windowsAnsiEventHandler) ED(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("ED: [%v]", []string{strconv.Itoa(param)})
h.logf("ED: [%v]", []string{strconv.Itoa(param)})
h.clearWrap()
// [J -- Erases from the cursor to the end of the screen, including the cursor position.
@ -490,7 +507,7 @@ func (h *windowsAnsiEventHandler) EL(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("EL: [%v]", strconv.Itoa(param))
h.logf("EL: [%v]", strconv.Itoa(param))
h.clearWrap()
// [K -- Erases from the cursor to the end of the line, including the cursor position.
@ -531,7 +548,7 @@ func (h *windowsAnsiEventHandler) IL(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("IL: [%v]", strconv.Itoa(param))
h.logf("IL: [%v]", strconv.Itoa(param))
h.clearWrap()
return h.insertLines(param)
}
@ -540,7 +557,7 @@ func (h *windowsAnsiEventHandler) DL(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("DL: [%v]", strconv.Itoa(param))
h.logf("DL: [%v]", strconv.Itoa(param))
h.clearWrap()
return h.deleteLines(param)
}
@ -549,7 +566,7 @@ func (h *windowsAnsiEventHandler) ICH(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("ICH: [%v]", strconv.Itoa(param))
h.logf("ICH: [%v]", strconv.Itoa(param))
h.clearWrap()
return h.insertCharacters(param)
}
@ -558,7 +575,7 @@ func (h *windowsAnsiEventHandler) DCH(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("DCH: [%v]", strconv.Itoa(param))
h.logf("DCH: [%v]", strconv.Itoa(param))
h.clearWrap()
return h.deleteCharacters(param)
}
@ -572,7 +589,7 @@ func (h *windowsAnsiEventHandler) SGR(params []int) error {
strings = append(strings, strconv.Itoa(v))
}
logger.Infof("SGR: [%v]", strings)
h.logf("SGR: [%v]", strings)
if len(params) <= 0 {
h.attributes = h.infoReset.Attributes
@ -606,7 +623,7 @@ func (h *windowsAnsiEventHandler) SU(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("SU: [%v]", []string{strconv.Itoa(param)})
h.logf("SU: [%v]", []string{strconv.Itoa(param)})
h.clearWrap()
return h.scrollUp(param)
}
@ -615,13 +632,13 @@ func (h *windowsAnsiEventHandler) SD(param int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("SD: [%v]", []string{strconv.Itoa(param)})
h.logf("SD: [%v]", []string{strconv.Itoa(param)})
h.clearWrap()
return h.scrollDown(param)
}
func (h *windowsAnsiEventHandler) DA(params []string) error {
logger.Infof("DA: [%v]", params)
h.logf("DA: [%v]", params)
// DA cannot be implemented because it must send data on the VT100 input stream,
// which is not available to go-ansiterm.
return nil
@ -631,7 +648,7 @@ func (h *windowsAnsiEventHandler) DECSTBM(top int, bottom int) error {
if err := h.Flush(); err != nil {
return err
}
logger.Infof("DECSTBM: [%d, %d]", top, bottom)
h.logf("DECSTBM: [%d, %d]", top, bottom)
// Windows is 0 indexed, Linux is 1 indexed
h.sr.top = int16(top - 1)
@ -646,7 +663,7 @@ func (h *windowsAnsiEventHandler) RI() error {
if err := h.Flush(); err != nil {
return err
}
logger.Info("RI: []")
h.logf("RI: []")
h.clearWrap()
info, err := GetConsoleScreenBufferInfo(h.fd)
@ -663,21 +680,21 @@ func (h *windowsAnsiEventHandler) RI() error {
}
func (h *windowsAnsiEventHandler) IND() error {
logger.Info("IND: []")
h.logf("IND: []")
return h.executeLF()
}
func (h *windowsAnsiEventHandler) Flush() error {
h.curInfo = nil
if h.buffer.Len() > 0 {
logger.Infof("Flush: [%s]", h.buffer.Bytes())
h.logf("Flush: [%s]", h.buffer.Bytes())
if _, err := h.buffer.WriteTo(h.file); err != nil {
return err
}
}
if h.wrapNext && !h.drewMarginByte {
logger.Infof("Flush: drawing margin byte '%c'", h.marginByte)
h.logf("Flush: drawing margin byte '%c'", h.marginByte)
info, err := GetConsoleScreenBufferInfo(h.fd)
if err != nil {

View File

@ -303,7 +303,7 @@ func FileInfoFromHeader(hdr *tar.Header) (name string, size int64, fileInfo *win
if err != nil {
return "", 0, nil, err
}
fileInfo.FileAttributes = uintptr(attr)
fileInfo.FileAttributes = uint32(attr)
} else {
if hdr.Typeflag == tar.TypeDir {
fileInfo.FileAttributes |= syscall.FILE_ATTRIBUTE_DIRECTORY

View File

@ -1,137 +1,137 @@
package winio
import (
"bytes"
"encoding/binary"
"errors"
)
type fileFullEaInformation struct {
NextEntryOffset uint32
Flags uint8
NameLength uint8
ValueLength uint16
}
var (
fileFullEaInformationSize = binary.Size(&fileFullEaInformation{})
errInvalidEaBuffer = errors.New("invalid extended attribute buffer")
errEaNameTooLarge = errors.New("extended attribute name too large")
errEaValueTooLarge = errors.New("extended attribute value too large")
)
// ExtendedAttribute represents a single Windows EA.
type ExtendedAttribute struct {
Name string
Value []byte
Flags uint8
}
func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) {
var info fileFullEaInformation
err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info)
if err != nil {
err = errInvalidEaBuffer
return
}
nameOffset := fileFullEaInformationSize
nameLen := int(info.NameLength)
valueOffset := nameOffset + int(info.NameLength) + 1
valueLen := int(info.ValueLength)
nextOffset := int(info.NextEntryOffset)
if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) {
err = errInvalidEaBuffer
return
}
ea.Name = string(b[nameOffset : nameOffset+nameLen])
ea.Value = b[valueOffset : valueOffset+valueLen]
ea.Flags = info.Flags
if info.NextEntryOffset != 0 {
nb = b[info.NextEntryOffset:]
}
return
}
// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION
// buffer retrieved from BackupRead, ZwQueryEaFile, etc.
func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) {
for len(b) != 0 {
ea, nb, err := parseEa(b)
if err != nil {
return nil, err
}
eas = append(eas, ea)
b = nb
}
return
}
func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error {
if int(uint8(len(ea.Name))) != len(ea.Name) {
return errEaNameTooLarge
}
if int(uint16(len(ea.Value))) != len(ea.Value) {
return errEaValueTooLarge
}
entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value))
withPadding := (entrySize + 3) &^ 3
nextOffset := uint32(0)
if !last {
nextOffset = withPadding
}
info := fileFullEaInformation{
NextEntryOffset: nextOffset,
Flags: ea.Flags,
NameLength: uint8(len(ea.Name)),
ValueLength: uint16(len(ea.Value)),
}
err := binary.Write(buf, binary.LittleEndian, &info)
if err != nil {
return err
}
_, err = buf.Write([]byte(ea.Name))
if err != nil {
return err
}
err = buf.WriteByte(0)
if err != nil {
return err
}
_, err = buf.Write(ea.Value)
if err != nil {
return err
}
_, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize])
if err != nil {
return err
}
return nil
}
// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION
// buffer for use with BackupWrite, ZwSetEaFile, etc.
func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) {
var buf bytes.Buffer
for i := range eas {
last := false
if i == len(eas)-1 {
last = true
}
err := writeEa(&buf, &eas[i], last)
if err != nil {
return nil, err
}
}
return buf.Bytes(), nil
}
package winio
import (
"bytes"
"encoding/binary"
"errors"
)
type fileFullEaInformation struct {
NextEntryOffset uint32
Flags uint8
NameLength uint8
ValueLength uint16
}
var (
fileFullEaInformationSize = binary.Size(&fileFullEaInformation{})
errInvalidEaBuffer = errors.New("invalid extended attribute buffer")
errEaNameTooLarge = errors.New("extended attribute name too large")
errEaValueTooLarge = errors.New("extended attribute value too large")
)
// ExtendedAttribute represents a single Windows EA.
type ExtendedAttribute struct {
Name string
Value []byte
Flags uint8
}
func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) {
var info fileFullEaInformation
err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info)
if err != nil {
err = errInvalidEaBuffer
return
}
nameOffset := fileFullEaInformationSize
nameLen := int(info.NameLength)
valueOffset := nameOffset + int(info.NameLength) + 1
valueLen := int(info.ValueLength)
nextOffset := int(info.NextEntryOffset)
if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) {
err = errInvalidEaBuffer
return
}
ea.Name = string(b[nameOffset : nameOffset+nameLen])
ea.Value = b[valueOffset : valueOffset+valueLen]
ea.Flags = info.Flags
if info.NextEntryOffset != 0 {
nb = b[info.NextEntryOffset:]
}
return
}
// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION
// buffer retrieved from BackupRead, ZwQueryEaFile, etc.
func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) {
for len(b) != 0 {
ea, nb, err := parseEa(b)
if err != nil {
return nil, err
}
eas = append(eas, ea)
b = nb
}
return
}
func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error {
if int(uint8(len(ea.Name))) != len(ea.Name) {
return errEaNameTooLarge
}
if int(uint16(len(ea.Value))) != len(ea.Value) {
return errEaValueTooLarge
}
entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value))
withPadding := (entrySize + 3) &^ 3
nextOffset := uint32(0)
if !last {
nextOffset = withPadding
}
info := fileFullEaInformation{
NextEntryOffset: nextOffset,
Flags: ea.Flags,
NameLength: uint8(len(ea.Name)),
ValueLength: uint16(len(ea.Value)),
}
err := binary.Write(buf, binary.LittleEndian, &info)
if err != nil {
return err
}
_, err = buf.Write([]byte(ea.Name))
if err != nil {
return err
}
err = buf.WriteByte(0)
if err != nil {
return err
}
_, err = buf.Write(ea.Value)
if err != nil {
return err
}
_, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize])
if err != nil {
return err
}
return nil
}
// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION
// buffer for use with BackupWrite, ZwSetEaFile, etc.
func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) {
var buf bytes.Buffer
for i := range eas {
last := false
if i == len(eas)-1 {
last = true
}
err := writeEa(&buf, &eas[i], last)
if err != nil {
return nil, err
}
}
return buf.Bytes(), nil
}

View File

@ -16,7 +16,6 @@ import (
//sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort
//sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus
//sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes
//sys timeBeginPeriod(period uint32) (n int32) = winmm.timeBeginPeriod
type atomicBool int32
@ -153,8 +152,6 @@ func (f *win32File) prepareIo() (*ioOperation, error) {
// ioCompletionProcessor processes completed async IOs forever
func ioCompletionProcessor(h syscall.Handle) {
// Set the timer resolution to 1. This fixes a performance regression in golang 1.6.
timeBeginPeriod(1)
for {
var bytes uint32
var key uintptr

View File

@ -20,7 +20,8 @@ const (
// FileBasicInfo contains file access time and file attributes information.
type FileBasicInfo struct {
CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime
FileAttributes uintptr // includes padding
FileAttributes uint32
pad uint32 // padding
}
// GetFileBasicInfo retrieves times and attributes for a file.

View File

@ -15,13 +15,13 @@ import (
//sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe
//sys createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateNamedPipeW
//sys createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateFileW
//sys waitNamedPipe(name string, timeout uint32) (err error) = WaitNamedPipeW
//sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo
//sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW
//sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc
const (
cERROR_PIPE_BUSY = syscall.Errno(231)
cERROR_NO_DATA = syscall.Errno(232)
cERROR_PIPE_CONNECTED = syscall.Errno(535)
cERROR_SEM_TIMEOUT = syscall.Errno(121)
@ -120,6 +120,11 @@ func (f *win32MessageBytePipe) Read(b []byte) (int, error) {
// zero-byte message, ensure that all future Read() calls
// also return EOF.
f.readEOF = true
} else if err == syscall.ERROR_MORE_DATA {
// ERROR_MORE_DATA indicates that the pipe's read mode is message mode
// and the message still has more bytes. Treat this as a success, since
// this package presents all named pipes as byte streams.
err = nil
}
return n, err
}
@ -133,12 +138,14 @@ func (s pipeAddress) String() string {
}
// DialPipe connects to a named pipe by path, timing out if the connection
// takes longer than the specified duration. If timeout is nil, then the timeout
// is the default timeout established by the pipe server.
// takes longer than the specified duration. If timeout is nil, then we use
// a default timeout of 5 seconds. (We do not use WaitNamedPipe.)
func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
var absTimeout time.Time
if timeout != nil {
absTimeout = time.Now().Add(*timeout)
} else {
absTimeout = time.Now().Add(time.Second * 2)
}
var err error
var h syscall.Handle
@ -147,22 +154,13 @@ func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
if err != cERROR_PIPE_BUSY {
break
}
now := time.Now()
var ms uint32
if absTimeout.IsZero() {
ms = cNMPWAIT_USE_DEFAULT_WAIT
} else if now.After(absTimeout) {
ms = cNMPWAIT_NOWAIT
} else {
ms = uint32(absTimeout.Sub(now).Nanoseconds() / 1000 / 1000)
}
err = waitNamedPipe(path, ms)
if err != nil {
if err == cERROR_SEM_TIMEOUT {
return nil, ErrTimeout
}
break
if time.Now().After(absTimeout) {
return nil, ErrTimeout
}
// Wait 10 msec and try again. This is a rather simplistic
// view, as we always try each 10 milliseconds.
time.Sleep(time.Millisecond * 10)
}
if err != nil {
return nil, &os.PathError{Op: "open", Path: path, Err: err}
@ -174,16 +172,6 @@ func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
return nil, err
}
var state uint32
err = getNamedPipeHandleState(h, &state, nil, nil, nil, nil, 0)
if err != nil {
return nil, err
}
if state&cPIPE_READMODE_MESSAGE != 0 {
return nil, &os.PathError{Op: "open", Path: path, Err: errors.New("message readmode pipes not supported")}
}
f, err := makeWin32File(h)
if err != nil {
syscall.Close(h)
@ -254,6 +242,36 @@ func (l *win32PipeListener) makeServerPipe() (*win32File, error) {
return f, nil
}
func (l *win32PipeListener) makeConnectedServerPipe() (*win32File, error) {
p, err := l.makeServerPipe()
if err != nil {
return nil, err
}
// Wait for the client to connect.
ch := make(chan error)
go func(p *win32File) {
ch <- connectPipe(p)
}(p)
select {
case err = <-ch:
if err != nil {
p.Close()
p = nil
}
case <-l.closeCh:
// Abort the connect request by closing the handle.
p.Close()
p = nil
err = <-ch
if err == nil || err == ErrFileClosed {
err = ErrPipeListenerClosed
}
}
return p, err
}
func (l *win32PipeListener) listenerRoutine() {
closed := false
for !closed {
@ -261,31 +279,20 @@ func (l *win32PipeListener) listenerRoutine() {
case <-l.closeCh:
closed = true
case responseCh := <-l.acceptCh:
p, err := l.makeServerPipe()
if err == nil {
// Wait for the client to connect.
ch := make(chan error)
go func(p *win32File) {
ch <- connectPipe(p)
}(p)
select {
case err = <-ch:
if err != nil {
p.Close()
p = nil
}
case <-l.closeCh:
// Abort the connect request by closing the handle.
p.Close()
p = nil
err = <-ch
if err == nil || err == ErrFileClosed {
err = ErrPipeListenerClosed
}
closed = true
var (
p *win32File
err error
)
for {
p, err = l.makeConnectedServerPipe()
// If the connection was immediately closed by the client, try
// again.
if err != cERROR_NO_DATA {
break
}
}
responseCh <- acceptResponse{p, err}
closed = err == ErrPipeListenerClosed
}
}
syscall.Close(l.firstHandle)
@ -334,13 +341,23 @@ func ListenPipe(path string, c *PipeConfig) (net.Listener, error) {
if err != nil {
return nil, err
}
// Immediately open and then close a client handle so that the named pipe is
// created but not currently accepting connections.
// Create a client handle and connect it. This results in the pipe
// instance always existing, so that clients see ERROR_PIPE_BUSY
// rather than ERROR_FILE_NOT_FOUND. This ties the first instance
// up so that no other instances can be used. This would have been
// cleaner if the Win32 API matched CreateFile with ConnectNamedPipe
// instead of CreateNamedPipe. (Apparently created named pipes are
// considered to be in listening state regardless of whether any
// active calls to ConnectNamedPipe are outstanding.)
h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
if err != nil {
syscall.Close(h)
return nil, err
}
// Close the client handle. The server side of the instance will
// still be busy, leading to ERROR_PIPE_BUSY instead of
// ERROR_NOT_FOUND, as long as we don't close the server handle,
// or disconnect the client with DisconnectNamedPipe.
syscall.Close(h2)
l := &win32PipeListener{
firstHandle: h,

View File

@ -38,14 +38,12 @@ func errnoErr(e syscall.Errno) error {
var (
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
modwinmm = windows.NewLazySystemDLL("winmm.dll")
modadvapi32 = windows.NewLazySystemDLL("advapi32.dll")
procCancelIoEx = modkernel32.NewProc("CancelIoEx")
procCreateIoCompletionPort = modkernel32.NewProc("CreateIoCompletionPort")
procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus")
procSetFileCompletionNotificationModes = modkernel32.NewProc("SetFileCompletionNotificationModes")
proctimeBeginPeriod = modwinmm.NewProc("timeBeginPeriod")
procConnectNamedPipe = modkernel32.NewProc("ConnectNamedPipe")
procCreateNamedPipeW = modkernel32.NewProc("CreateNamedPipeW")
procCreateFileW = modkernel32.NewProc("CreateFileW")
@ -122,12 +120,6 @@ func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err erro
return
}
func timeBeginPeriod(period uint32) (n int32) {
r0, _, _ := syscall.Syscall(proctimeBeginPeriod.Addr(), 1, uintptr(period), 0, 0)
n = int32(r0)
return
}
func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) {
r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0)
if r1 == 0 {

View File

@ -1,12 +1,41 @@
# hcsshim
This package supports launching Windows Server containers from Go. It is
primarily used in the [Docker Engine](https://github.com/docker/docker) project,
but it can be freely used by other projects as well.
[![Build status](https://ci.appveyor.com/api/projects/status/nbcw28mnkqml0loa/branch/master?svg=true)](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master)
This project has adopted the [Microsoft Open Source Code of
Conduct](https://opensource.microsoft.com/codeofconduct/). For more information
see the [Code of Conduct
FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact
[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional
questions or comments.
This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well.
## Contributing
This project welcomes contributions and suggestions. Most contributions require you to agree to a
Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us
the rights to use your contribution. For details, visit https://cla.microsoft.com.
When you submit a pull request, a CLA-bot will automatically determine whether you need to provide
a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions
provided by the bot. You will only need to do this once across all repos using our CLA.
This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/).
For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or
contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments.
## Dependencies
This project requires Golang 1.9 or newer to build.
For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements).
## Reporting Security Issues
Security issues and bugs should be reported privately, via email, to the Microsoft Security
Response Center (MSRC) at [secure@microsoft.com](mailto:secure@microsoft.com). You should
receive a response within 24 hours. If for some reason you do not, please follow up via
email to ensure we received your original message. Further information, including the
[MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in
the [Security TechCenter](https://technet.microsoft.com/en-us/security/default).
For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet
---------------
Copyright (c) 2018 Microsoft Corp. All rights reserved.

View File

@ -1,28 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// ActivateLayer will find the layer with the given id and mount it's filesystem.
// For a read/write layer, the mounted filesystem will appear as a volume on the
// host, while a read-only layer is generally expected to be a no-op.
// An activated layer must later be deactivated via DeactivateLayer.
func ActivateLayer(info DriverInfo, id string) error {
title := "hcsshim::ActivateLayer "
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = activateLayer(&infop, id)
if err != nil {
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
logrus.Error(err)
return err
}
logrus.Debugf(title+" - succeeded id=%s flavour=%d", id, info.Flavour)
return nil
}

View File

@ -1,794 +1,192 @@
package hcsshim
import (
"encoding/json"
"fmt"
"os"
"sync"
"syscall"
"time"
"github.com/sirupsen/logrus"
"github.com/Microsoft/hcsshim/internal/hcs"
"github.com/Microsoft/hcsshim/internal/mergemaps"
"github.com/Microsoft/hcsshim/internal/schema1"
)
var (
defaultTimeout = time.Minute * 4
)
const (
pendingUpdatesQuery = `{ "PropertyTypes" : ["PendingUpdates"]}`
statisticsQuery = `{ "PropertyTypes" : ["Statistics"]}`
processListQuery = `{ "PropertyTypes" : ["ProcessList"]}`
mappedVirtualDiskQuery = `{ "PropertyTypes" : ["MappedVirtualDisk"]}`
)
type container struct {
handleLock sync.RWMutex
handle hcsSystem
id string
callbackNumber uintptr
}
// ContainerProperties holds the properties for a container and the processes running in that container
type ContainerProperties struct {
ID string `json:"Id"`
Name string
SystemType string
Owner string
SiloGUID string `json:"SiloGuid,omitempty"`
RuntimeID string `json:"RuntimeId,omitempty"`
IsRuntimeTemplate bool `json:",omitempty"`
RuntimeImagePath string `json:",omitempty"`
Stopped bool `json:",omitempty"`
ExitType string `json:",omitempty"`
AreUpdatesPending bool `json:",omitempty"`
ObRoot string `json:",omitempty"`
Statistics Statistics `json:",omitempty"`
ProcessList []ProcessListItem `json:",omitempty"`
MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
}
type ContainerProperties = schema1.ContainerProperties
// MemoryStats holds the memory statistics for a container
type MemoryStats struct {
UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"`
UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
}
type MemoryStats = schema1.MemoryStats
// ProcessorStats holds the processor statistics for a container
type ProcessorStats struct {
TotalRuntime100ns uint64 `json:",omitempty"`
RuntimeUser100ns uint64 `json:",omitempty"`
RuntimeKernel100ns uint64 `json:",omitempty"`
}
type ProcessorStats = schema1.ProcessorStats
// StorageStats holds the storage statistics for a container
type StorageStats struct {
ReadCountNormalized uint64 `json:",omitempty"`
ReadSizeBytes uint64 `json:",omitempty"`
WriteCountNormalized uint64 `json:",omitempty"`
WriteSizeBytes uint64 `json:",omitempty"`
}
type StorageStats = schema1.StorageStats
// NetworkStats holds the network statistics for a container
type NetworkStats struct {
BytesReceived uint64 `json:",omitempty"`
BytesSent uint64 `json:",omitempty"`
PacketsReceived uint64 `json:",omitempty"`
PacketsSent uint64 `json:",omitempty"`
DroppedPacketsIncoming uint64 `json:",omitempty"`
DroppedPacketsOutgoing uint64 `json:",omitempty"`
EndpointId string `json:",omitempty"`
InstanceId string `json:",omitempty"`
}
type NetworkStats = schema1.NetworkStats
// Statistics is the structure returned by a statistics call on a container
type Statistics struct {
Timestamp time.Time `json:",omitempty"`
ContainerStartTime time.Time `json:",omitempty"`
Uptime100ns uint64 `json:",omitempty"`
Memory MemoryStats `json:",omitempty"`
Processor ProcessorStats `json:",omitempty"`
Storage StorageStats `json:",omitempty"`
Network []NetworkStats `json:",omitempty"`
}
type Statistics = schema1.Statistics
// ProcessList is the structure of an item returned by a ProcessList call on a container
type ProcessListItem struct {
CreateTimestamp time.Time `json:",omitempty"`
ImageName string `json:",omitempty"`
KernelTime100ns uint64 `json:",omitempty"`
MemoryCommitBytes uint64 `json:",omitempty"`
MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"`
MemoryWorkingSetSharedBytes uint64 `json:",omitempty"`
ProcessId uint32 `json:",omitempty"`
UserTime100ns uint64 `json:",omitempty"`
}
type ProcessListItem = schema1.ProcessListItem
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
type MappedVirtualDiskController struct {
MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
}
type MappedVirtualDiskController = schema1.MappedVirtualDiskController
// Type of Request Support in ModifySystem
type RequestType string
type RequestType = schema1.RequestType
// Type of Resource Support in ModifySystem
type ResourceType string
type ResourceType = schema1.ResourceType
// RequestType const
const (
Add RequestType = "Add"
Remove RequestType = "Remove"
Network ResourceType = "Network"
Add = schema1.Add
Remove = schema1.Remove
Network = schema1.Network
)
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type ResourceModificationRequestResponse struct {
Resource ResourceType `json:"ResourceType"`
Data interface{} `json:"Settings"`
Request RequestType `json:"RequestType,omitempty"`
type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
type container struct {
system *hcs.System
}
// createContainerAdditionalJSON is read from the environment at initialisation
// createComputeSystemAdditionalJSON is read from the environment at initialisation
// time. It allows an environment variable to define additional JSON which
// is merged in the CreateContainer call to HCS.
var createContainerAdditionalJSON string
// is merged in the CreateComputeSystem call to HCS.
var createContainerAdditionalJSON []byte
func init() {
createContainerAdditionalJSON = os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON")
createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON"))
}
// CreateContainer creates a new container with the given configuration but does not start it.
func CreateContainer(id string, c *ContainerConfig) (Container, error) {
return createContainerWithJSON(id, c, "")
}
// CreateContainerWithJSON creates a new container with the given configuration but does not start it.
// It is identical to CreateContainer except that optional additional JSON can be merged before passing to HCS.
func CreateContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) {
return createContainerWithJSON(id, c, additionalJSON)
}
func createContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) {
operation := "CreateContainer"
title := "HCSShim::" + operation
container := &container{
id: id,
fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON)
if err != nil {
return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
}
configurationb, err := json.Marshal(c)
system, err := hcs.CreateComputeSystem(id, fullConfig)
if err != nil {
return nil, err
}
configuration := string(configurationb)
logrus.Debugf(title+" id=%s config=%s", id, configuration)
// Merge any additional JSON. Priority is given to what is passed in explicitly,
// falling back to what's set in the environment.
if additionalJSON == "" && createContainerAdditionalJSON != "" {
additionalJSON = createContainerAdditionalJSON
}
if additionalJSON != "" {
configurationMap := map[string]interface{}{}
if err := json.Unmarshal([]byte(configuration), &configurationMap); err != nil {
return nil, fmt.Errorf("failed to unmarshal %s: %s", configuration, err)
}
additionalMap := map[string]interface{}{}
if err := json.Unmarshal([]byte(additionalJSON), &additionalMap); err != nil {
return nil, fmt.Errorf("failed to unmarshal %s: %s", additionalJSON, err)
}
mergedMap := mergeMaps(additionalMap, configurationMap)
mergedJSON, err := json.Marshal(mergedMap)
if err != nil {
return nil, fmt.Errorf("failed to marshal merged configuration map %+v: %s", mergedMap, err)
}
configuration = string(mergedJSON)
logrus.Debugf(title+" id=%s merged config=%s", id, configuration)
}
var (
resultp *uint16
identity syscall.Handle
)
createError := hcsCreateComputeSystem(id, configuration, identity, &container.handle, &resultp)
if createError == nil || IsPending(createError) {
if err := container.registerCallback(); err != nil {
return nil, makeContainerError(container, operation, "", err)
}
}
err = processAsyncHcsResult(createError, resultp, container.callbackNumber, hcsNotificationSystemCreateCompleted, &defaultTimeout)
if err != nil {
return nil, makeContainerError(container, operation, configuration, err)
}
logrus.Debugf(title+" succeeded id=%s handle=%d", id, container.handle)
return container, nil
}
// mergeMaps recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
// in ToMap are overwritten. Values in fromMap are added to ToMap.
// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
func mergeMaps(fromMap, ToMap interface{}) interface{} {
switch fromMap := fromMap.(type) {
case map[string]interface{}:
ToMap, ok := ToMap.(map[string]interface{})
if !ok {
return fromMap
}
for keyToMap, valueToMap := range ToMap {
if valueFromMap, ok := fromMap[keyToMap]; ok {
fromMap[keyToMap] = mergeMaps(valueFromMap, valueToMap)
} else {
fromMap[keyToMap] = valueToMap
}
}
case nil:
// merge(nil, map[string]interface{...}) -> map[string]interface{...}
ToMap, ok := ToMap.(map[string]interface{})
if ok {
return ToMap
}
}
return fromMap
return &container{system}, err
}
// OpenContainer opens an existing container by ID.
func OpenContainer(id string) (Container, error) {
operation := "OpenContainer"
title := "HCSShim::" + operation
logrus.Debugf(title+" id=%s", id)
container := &container{
id: id,
}
var (
handle hcsSystem
resultp *uint16
)
err := hcsOpenComputeSystem(id, &handle, &resultp)
err = processHcsResult(err, resultp)
system, err := hcs.OpenComputeSystem(id)
if err != nil {
return nil, makeContainerError(container, operation, "", err)
return nil, err
}
container.handle = handle
if err := container.registerCallback(); err != nil {
return nil, makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle)
return container, nil
return &container{system}, err
}
// GetContainers gets a list of the containers on the system that match the query
func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
operation := "GetContainers"
title := "HCSShim::" + operation
queryb, err := json.Marshal(q)
if err != nil {
return nil, err
}
query := string(queryb)
logrus.Debugf(title+" query=%s", query)
var (
resultp *uint16
computeSystemsp *uint16
)
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return nil, err
}
if computeSystemsp == nil {
return nil, ErrUnexpectedValue
}
computeSystemsRaw := convertAndFreeCoTaskMemBytes(computeSystemsp)
computeSystems := []ContainerProperties{}
if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
return nil, err
}
logrus.Debugf(title + " succeeded")
return computeSystems, nil
return hcs.GetComputeSystems(q)
}
// Start synchronously starts the container.
func (container *container) Start() error {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Start"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsStartComputeSystem(container.handle, "", &resultp)
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemStartCompleted, &defaultTimeout)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
return convertSystemError(container.system.Start(), container)
}
// Shutdown requests a container shutdown, if IsPending() on the error returned is true,
// it may not actually be shut down until Wait() succeeds.
// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
func (container *container) Shutdown() error {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Shutdown"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsShutdownComputeSystem(container.handle, "", &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
return convertSystemError(container.system.Shutdown(), container)
}
// Terminate requests a container terminate, if IsPending() on the error returned is true,
// it may not actually be shut down until Wait() succeeds.
// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
func (container *container) Terminate() error {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Terminate"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsTerminateComputeSystem(container.handle, "", &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
return convertSystemError(container.system.Terminate(), container)
}
// Wait synchronously waits for the container to shutdown or terminate.
// Waits synchronously waits for the container to shutdown or terminate.
func (container *container) Wait() error {
operation := "Wait"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, nil)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
return convertSystemError(container.system.Wait(), container)
}
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse.
// If the timeout expires, IsTimeout(err) == true
func (container *container) WaitTimeout(timeout time.Duration) error {
operation := "WaitTimeout"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, &timeout)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
// returns false if timeout occurs.
func (container *container) WaitTimeout(t time.Duration) error {
return convertSystemError(container.system.WaitTimeout(t), container)
}
func (container *container) properties(query string) (*ContainerProperties, error) {
var (
resultp *uint16
propertiesp *uint16
)
err := hcsGetComputeSystemProperties(container.handle, query, &propertiesp, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return nil, err
}
// Pause pauses the execution of a container.
func (container *container) Pause() error {
return convertSystemError(container.system.Pause(), container)
}
if propertiesp == nil {
return nil, ErrUnexpectedValue
}
propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp)
properties := &ContainerProperties{}
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
return nil, err
}
return properties, nil
// Resume resumes the execution of a container.
func (container *container) Resume() error {
return convertSystemError(container.system.Resume(), container)
}
// HasPendingUpdates returns true if the container has updates pending to install
func (container *container) HasPendingUpdates() (bool, error) {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "HasPendingUpdates"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return false, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
properties, err := container.properties(pendingUpdatesQuery)
if err != nil {
return false, makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return properties.AreUpdatesPending, nil
return false, nil
}
// Statistics returns statistics for the container
// Statistics returns statistics for the container. This is a legacy v1 call
func (container *container) Statistics() (Statistics, error) {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Statistics"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return Statistics{}, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
properties, err := container.properties(statisticsQuery)
properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
if err != nil {
return Statistics{}, makeContainerError(container, operation, "", err)
return Statistics{}, convertSystemError(err, container)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return properties.Statistics, nil
}
// ProcessList returns an array of ProcessListItems for the container
// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
func (container *container) ProcessList() ([]ProcessListItem, error) {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "ProcessList"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
properties, err := container.properties(processListQuery)
properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
if err != nil {
return nil, makeContainerError(container, operation, "", err)
return nil, convertSystemError(err, container)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return properties.ProcessList, nil
}
// MappedVirtualDisks returns a map of the controllers and the disks mapped
// to a container.
//
// Example of JSON returned by the query.
//{
// "Id":"1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3_svm",
// "SystemType":"Container",
// "RuntimeOsType":"Linux",
// "RuntimeId":"00000000-0000-0000-0000-000000000000",
// "State":"Running",
// "MappedVirtualDiskControllers":{
// "0":{
// "MappedVirtualDisks":{
// "2":{
// "HostPath":"C:\\lcow\\lcow\\scratch\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3.vhdx",
// "ContainerPath":"/mnt/gcs/LinuxServiceVM/scratch",
// "Lun":2,
// "CreateInUtilityVM":true
// },
// "3":{
// "HostPath":"C:\\lcow\\lcow\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3\\sandbox.vhdx",
// "Lun":3,
// "CreateInUtilityVM":true,
// "AttachOnly":true
// }
// }
// }
// }
//}
// This is a legacy v1 call
func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "MappedVirtualDiskList"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
properties, err := container.properties(mappedVirtualDiskQuery)
properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
if err != nil {
return nil, makeContainerError(container, operation, "", err)
return nil, convertSystemError(err, container)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return properties.MappedVirtualDiskControllers, nil
}
// Pause pauses the execution of the container. This feature is not enabled in TP5.
func (container *container) Pause() error {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Pause"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsPauseComputeSystem(container.handle, "", &resultp)
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemPauseCompleted, &defaultTimeout)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
}
// Resume resumes the execution of the container. This feature is not enabled in TP5.
func (container *container) Resume() error {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Resume"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsResumeComputeSystem(container.handle, "", &resultp)
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemResumeCompleted, &defaultTimeout)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
}
// CreateProcess launches a new process within the container.
func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "CreateProcess"
title := "HCSShim::Container::" + operation
var (
processInfo hcsProcessInformation
processHandle hcsProcess
resultp *uint16
)
if container.handle == 0 {
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
// If we are not emulating a console, ignore any console size passed to us
if !c.EmulateConsole {
c.ConsoleSize[0] = 0
c.ConsoleSize[1] = 0
}
configurationb, err := json.Marshal(c)
p, err := container.system.CreateProcess(c)
if err != nil {
return nil, makeContainerError(container, operation, "", err)
return nil, convertSystemError(err, container)
}
configuration := string(configurationb)
logrus.Debugf(title+" id=%s config=%s", container.id, configuration)
err = hcsCreateProcess(container.handle, configuration, &processInfo, &processHandle, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return nil, makeContainerError(container, operation, configuration, err)
}
process := &process{
handle: processHandle,
processID: int(processInfo.ProcessId),
container: container,
cachedPipes: &cachedPipes{
stdIn: processInfo.StdInput,
stdOut: processInfo.StdOutput,
stdErr: processInfo.StdError,
},
}
if err := process.registerCallback(); err != nil {
return nil, makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s processid=%d", container.id, process.processID)
return process, nil
return &process{p}, nil
}
// OpenProcess gets an interface to an existing process within the container.
func (container *container) OpenProcess(pid int) (Process, error) {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "OpenProcess"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s, processid=%d", container.id, pid)
var (
processHandle hcsProcess
resultp *uint16
)
if container.handle == 0 {
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
err := hcsOpenProcess(container.handle, uint32(pid), &processHandle, &resultp)
err = processHcsResult(err, resultp)
p, err := container.system.OpenProcess(pid)
if err != nil {
return nil, makeContainerError(container, operation, "", err)
return nil, convertSystemError(err, container)
}
process := &process{
handle: processHandle,
processID: pid,
container: container,
}
if err := process.registerCallback(); err != nil {
return nil, makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s processid=%s", container.id, process.processID)
return process, nil
return &process{p}, nil
}
// Close cleans up any state associated with the container but does not terminate or wait for it.
func (container *container) Close() error {
container.handleLock.Lock()
defer container.handleLock.Unlock()
operation := "Close"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
// Don't double free this
if container.handle == 0 {
return nil
}
if err := container.unregisterCallback(); err != nil {
return makeContainerError(container, operation, "", err)
}
if err := hcsCloseComputeSystem(container.handle); err != nil {
return makeContainerError(container, operation, "", err)
}
container.handle = 0
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
return convertSystemError(container.system.Close(), container)
}
func (container *container) registerCallback() error {
context := &notifcationWatcherContext{
channels: newChannels(),
}
callbackMapLock.Lock()
callbackNumber := nextCallback
nextCallback++
callbackMap[callbackNumber] = context
callbackMapLock.Unlock()
var callbackHandle hcsCallback
err := hcsRegisterComputeSystemCallback(container.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
if err != nil {
return err
}
context.handle = callbackHandle
container.callbackNumber = callbackNumber
return nil
}
func (container *container) unregisterCallback() error {
callbackNumber := container.callbackNumber
callbackMapLock.RLock()
context := callbackMap[callbackNumber]
callbackMapLock.RUnlock()
if context == nil {
return nil
}
handle := context.handle
if handle == 0 {
return nil
}
// hcsUnregisterComputeSystemCallback has its own syncronization
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
err := hcsUnregisterComputeSystemCallback(handle)
if err != nil {
return err
}
closeChannels(context.channels)
callbackMapLock.Lock()
callbackMap[callbackNumber] = nil
callbackMapLock.Unlock()
handle = 0
return nil
}
// Modifies the System by sending a request to HCS
// Modify the System
func (container *container) Modify(config *ResourceModificationRequestResponse) error {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Modify"
title := "HCSShim::Container::" + operation
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
requestJSON, err := json.Marshal(config)
if err != nil {
return err
}
requestString := string(requestJSON)
logrus.Debugf(title+" id=%s request=%s", container.id, requestString)
var resultp *uint16
err = hcsModifyComputeSystem(container.handle, requestString, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
return convertSystemError(container.system.Modify(config), container)
}

View File

@ -1,27 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// CreateLayer creates a new, empty, read-only layer on the filesystem based on
// the parent layer provided.
func CreateLayer(info DriverInfo, id, parent string) error {
title := "hcsshim::CreateLayer "
logrus.Debugf(title+"Flavour %d ID %s parent %s", info.Flavour, id, parent)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = createLayer(&infop, id, parent)
if err != nil {
err = makeErrorf(err, title, "id=%s parent=%s flavour=%d", id, parent, info.Flavour)
logrus.Error(err)
return err
}
logrus.Debugf(title+" - succeeded id=%s parent=%s flavour=%d", id, parent, info.Flavour)
return nil
}

View File

@ -1,35 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// CreateSandboxLayer creates and populates new read-write layer for use by a container.
// This requires both the id of the direct parent layer, as well as the full list
// of paths to all parent layers up to the base (and including the direct parent
// whose id was provided).
func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
title := "hcsshim::CreateSandboxLayer "
logrus.Debugf(title+"layerId %s parentId %s", layerId, parentId)
// Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return err
}
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = createSandboxLayer(&infop, layerId, parentId, layers)
if err != nil {
err = makeErrorf(err, title, "layerId=%s parentId=%s", layerId, parentId)
logrus.Error(err)
return err
}
logrus.Debugf(title+"- succeeded layerId=%s parentId=%s", layerId, parentId)
return nil
}

View File

@ -1,26 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// DeactivateLayer will dismount a layer that was mounted via ActivateLayer.
func DeactivateLayer(info DriverInfo, id string) error {
title := "hcsshim::DeactivateLayer "
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = deactivateLayer(&infop, id)
if err != nil {
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id)
return nil
}

View File

@ -1,27 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// DestroyLayer will remove the on-disk files representing the layer with the given
// id, including that layer's containing folder, if any.
func DestroyLayer(info DriverInfo, id string) error {
title := "hcsshim::DestroyLayer "
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = destroyLayer(&infop, id)
if err != nil {
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id)
return nil
}

View File

@ -1,83 +1,91 @@
package hcsshim
import (
"errors"
"fmt"
"syscall"
"github.com/Microsoft/hcsshim/internal/hns"
"github.com/Microsoft/hcsshim/internal/hcs"
"github.com/Microsoft/hcsshim/internal/hcserror"
)
var (
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist
ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist
// ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrElementNotFound = syscall.Errno(0x490)
ErrElementNotFound = hcs.ErrElementNotFound
// ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrNotSupported = syscall.Errno(0x32)
ErrNotSupported = hcs.ErrNotSupported
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
// decimal -2147024883 / hex 0x8007000d
ErrInvalidData = syscall.Errno(0xd)
ErrInvalidData = hcs.ErrInvalidData
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
ErrHandleClose = hcs.ErrHandleClose
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
ErrAlreadyClosed = hcs.ErrAlreadyClosed
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
ErrInvalidNotificationType = hcs.ErrInvalidNotificationType
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
ErrInvalidProcessState = hcs.ErrInvalidProcessState
// ErrTimeout is an error encountered when waiting on a notification times out
ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
ErrTimeout = hcs.ErrTimeout
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
// a different expected notification
ErrUnexpectedContainerExit = errors.New("unexpected container exit")
ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
// is lost while waiting for a notification
ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
ErrUnexpectedValue = hcs.ErrUnexpectedValue
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState
// ErrProcNotFound is an error encountered when the the process cannot be found
ErrProcNotFound = syscall.Errno(0x7f)
ErrProcNotFound = hcs.ErrProcNotFound
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage
// ErrNotSupported is an error encountered when hcs doesn't support the request
ErrPlatformNotSupported = errors.New("unsupported platform request")
ErrPlatformNotSupported = hcs.ErrPlatformNotSupported
)
type EndpointNotFoundError = hns.EndpointNotFoundError
type NetworkNotFoundError = hns.NetworkNotFoundError
// ProcessError is an error encountered in HCS during an operation on a Process object
type ProcessError struct {
Process *process
Operation string
ExtraInfo string
Err error
Events []hcs.ErrorEvent
}
// ContainerError is an error encountered in HCS during an operation on a Container object
@ -86,6 +94,7 @@ type ContainerError struct {
Operation string
ExtraInfo string
Err error
Events []hcs.ErrorEvent
}
func (e *ContainerError) Error() string {
@ -97,7 +106,7 @@ func (e *ContainerError) Error() string {
return "unexpected nil container for error: " + e.Err.Error()
}
s := "container " + e.Container.id
s := "container " + e.Container.system.ID()
if e.Operation != "" {
s += " encountered an error during " + e.Operation
@ -107,11 +116,15 @@ func (e *ContainerError) Error() string {
case nil:
break
case syscall.Errno:
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err))
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
default:
s += fmt.Sprintf(": %s", e.Err.Error())
}
for _, ev := range e.Events {
s += "\n" + ev.String()
}
if e.ExtraInfo != "" {
s += " extra info: " + e.ExtraInfo
}
@ -137,12 +150,7 @@ func (e *ProcessError) Error() string {
return "Unexpected nil process for error: " + e.Err.Error()
}
s := fmt.Sprintf("process %d", e.Process.processID)
if e.Process.container != nil {
s += " in container " + e.Process.container.id
}
s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID())
if e.Operation != "" {
s += " encountered an error during " + e.Operation
}
@ -151,11 +159,15 @@ func (e *ProcessError) Error() string {
case nil:
break
case syscall.Errno:
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err))
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
default:
s += fmt.Sprintf(": %s", e.Err.Error())
}
for _, ev := range e.Events {
s += "\n" + ev.String()
}
return s
}
@ -173,31 +185,31 @@ func makeProcessError(process *process, operation string, extraInfo string, err
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsNotExist(err error) bool {
err = getInnerError(err)
return err == ErrComputeSystemDoesNotExist ||
err == ErrElementNotFound ||
err == ErrProcNotFound
if _, ok := err.(EndpointNotFoundError); ok {
return true
}
if _, ok := err.(NetworkNotFoundError); ok {
return true
}
return hcs.IsNotExist(getInnerError(err))
}
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
// already closed by a call to the Close() method.
func IsAlreadyClosed(err error) bool {
err = getInnerError(err)
return err == ErrAlreadyClosed
return hcs.IsAlreadyClosed(getInnerError(err))
}
// IsPending returns a boolean indicating whether the error is that
// the requested operation is being completed in the background.
func IsPending(err error) bool {
err = getInnerError(err)
return err == ErrVmcomputeOperationPending
return hcs.IsPending(getInnerError(err))
}
// IsTimeout returns a boolean indicating whether the error is caused by
// a timeout waiting for the operation to complete.
func IsTimeout(err error) bool {
err = getInnerError(err)
return err == ErrTimeout
return hcs.IsTimeout(getInnerError(err))
}
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
@ -206,10 +218,7 @@ func IsTimeout(err error) bool {
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsAlreadyStopped(err error) bool {
err = getInnerError(err)
return err == ErrVmcomputeAlreadyStopped ||
err == ErrElementNotFound ||
err == ErrProcNotFound
return hcs.IsAlreadyStopped(getInnerError(err))
}
// IsNotSupported returns a boolean indicating whether the error is caused by
@ -218,12 +227,7 @@ func IsAlreadyStopped(err error) bool {
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
// is thrown from the Platform
func IsNotSupported(err error) bool {
err = getInnerError(err)
// If Platform doesn't recognize or support the request sent, below errors are seen
return err == ErrVmcomputeInvalidJSON ||
err == ErrInvalidData ||
err == ErrNotSupported ||
err == ErrVmcomputeUnknownMessage
return hcs.IsNotSupported(getInnerError(err))
}
func getInnerError(err error) error {
@ -237,3 +241,17 @@ func getInnerError(err error) error {
}
return err
}
func convertSystemError(err error, c *container) error {
if serr, ok := err.(*hcs.SystemError); ok {
return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events}
}
return err
}
func convertProcessError(err error, p *process) error {
if perr, ok := err.(*hcs.ProcessError); ok {
return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events}
}
return err
}

View File

@ -1,26 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// ExpandSandboxSize expands the size of a layer to at least size bytes.
func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error {
title := "hcsshim::ExpandSandboxSize "
logrus.Debugf(title+"layerId=%s size=%d", layerId, size)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = expandSandboxSize(&infop, layerId, size)
if err != nil {
err = makeErrorf(err, title, "layerId=%s size=%d", layerId, size)
logrus.Error(err)
return err
}
logrus.Debugf(title+"- succeeded layerId=%s size=%d", layerId, size)
return nil
}

View File

@ -1,156 +0,0 @@
package hcsshim
import (
"io"
"io/ioutil"
"os"
"syscall"
"github.com/Microsoft/go-winio"
"github.com/sirupsen/logrus"
)
// ExportLayer will create a folder at exportFolderPath and fill that folder with
// the transport format version of the layer identified by layerId. This transport
// format includes any metadata required for later importing the layer (using
// ImportLayer), and requires the full list of parent layer paths in order to
// perform the export.
func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error {
title := "hcsshim::ExportLayer "
logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerId, exportFolderPath)
// Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return err
}
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = exportLayer(&infop, layerId, exportFolderPath, layers)
if err != nil {
err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerId, info.Flavour, exportFolderPath)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerId, exportFolderPath)
return nil
}
type LayerReader interface {
Next() (string, int64, *winio.FileBasicInfo, error)
Read(b []byte) (int, error)
Close() error
}
// FilterLayerReader provides an interface for extracting the contents of an on-disk layer.
type FilterLayerReader struct {
context uintptr
}
// Next reads the next available file from a layer, ensuring that parent directories are always read
// before child files and directories.
//
// Next returns the file's relative path, size, and basic file metadata. Read() should be used to
// extract a Win32 backup stream with the remainder of the metadata and the data.
func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error) {
var fileNamep *uint16
fileInfo := &winio.FileBasicInfo{}
var deleted uint32
var fileSize int64
err := exportLayerNext(r.context, &fileNamep, fileInfo, &fileSize, &deleted)
if err != nil {
if err == syscall.ERROR_NO_MORE_FILES {
err = io.EOF
} else {
err = makeError(err, "ExportLayerNext", "")
}
return "", 0, nil, err
}
fileName := convertAndFreeCoTaskMemString(fileNamep)
if deleted != 0 {
fileInfo = nil
}
if fileName[0] == '\\' {
fileName = fileName[1:]
}
return fileName, fileSize, fileInfo, nil
}
// Read reads from the current file's Win32 backup stream.
func (r *FilterLayerReader) Read(b []byte) (int, error) {
var bytesRead uint32
err := exportLayerRead(r.context, b, &bytesRead)
if err != nil {
return 0, makeError(err, "ExportLayerRead", "")
}
if bytesRead == 0 {
return 0, io.EOF
}
return int(bytesRead), nil
}
// Close frees resources associated with the layer reader. It will return an
// error if there was an error while reading the layer or of the layer was not
// completely read.
func (r *FilterLayerReader) Close() (err error) {
if r.context != 0 {
err = exportLayerEnd(r.context)
if err != nil {
err = makeError(err, "ExportLayerEnd", "")
}
r.context = 0
}
return
}
// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer.
// The caller must have taken the SeBackupPrivilege privilege
// to call this and any methods on the resulting LayerReader.
func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) {
if procExportLayerBegin.Find() != nil {
// The new layer reader is not available on this Windows build. Fall back to the
// legacy export code path.
path, err := ioutil.TempDir("", "hcs")
if err != nil {
return nil, err
}
err = ExportLayer(info, layerID, path, parentLayerPaths)
if err != nil {
os.RemoveAll(path)
return nil, err
}
return &legacyLayerReaderWrapper{newLegacyLayerReader(path)}, nil
}
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return nil, err
}
infop, err := convertDriverInfo(info)
if err != nil {
return nil, err
}
r := &FilterLayerReader{}
err = exportLayerBegin(&infop, layerID, layers, &r.context)
if err != nil {
return nil, makeError(err, "ExportLayerBegin", "")
}
return r, err
}
type legacyLayerReaderWrapper struct {
*legacyLayerReader
}
func (r *legacyLayerReaderWrapper) Close() error {
err := r.legacyLayerReader.Close()
os.RemoveAll(r.root)
return err
}

View File

@ -1,19 +0,0 @@
package hcsshim
import (
"crypto/sha1"
"fmt"
)
type GUID [16]byte
func NewGUID(source string) *GUID {
h := sha1.Sum([]byte(source))
var g GUID
copy(g[0:], h[0:16])
return &g
}
func (g *GUID) ToString() string {
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
}

View File

@ -4,80 +4,20 @@
package hcsshim
import (
"fmt"
"syscall"
"unsafe"
"github.com/sirupsen/logrus"
"github.com/Microsoft/hcsshim/internal/hcserror"
)
//go:generate go run mksyscall_windows.go -output zhcsshim.go hcsshim.go
//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go
//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree
//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId
//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer?
//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer?
//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer?
//sys createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer?
//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize?
//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer?
//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer?
//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer?
//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath?
//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages?
//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer?
//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists?
//sys nameToGuid(name string, guid *GUID) (hr error) = vmcompute.NameToGuid?
//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer?
//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer?
//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage?
//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage?
//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin?
//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext?
//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite?
//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd?
//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin?
//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext?
//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead?
//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd?
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings?
//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
const (
// Specific user-visible exit codes
WaitErrExecFailed = 32767
ERROR_GEN_FAILURE = syscall.Errno(31)
ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE
ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115)
WSAEINVAL = syscall.Errno(10022)
@ -85,82 +25,4 @@ const (
TimeoutInfinite = 0xFFFFFFFF
)
type HcsError struct {
title string
rest string
Err error
}
type hcsSystem syscall.Handle
type hcsProcess syscall.Handle
type hcsCallback syscall.Handle
type hcsProcessInformation struct {
ProcessId uint32
Reserved uint32
StdInput syscall.Handle
StdOutput syscall.Handle
StdError syscall.Handle
}
func makeError(err error, title, rest string) error {
// Pass through DLL errors directly since they do not originate from HCS.
if _, ok := err.(*syscall.DLLError); ok {
return err
}
return &HcsError{title, rest, err}
}
func makeErrorf(err error, title, format string, a ...interface{}) error {
return makeError(err, title, fmt.Sprintf(format, a...))
}
func win32FromError(err error) uint32 {
if herr, ok := err.(*HcsError); ok {
return win32FromError(herr.Err)
}
if code, ok := err.(syscall.Errno); ok {
return uint32(code)
}
return uint32(ERROR_GEN_FAILURE)
}
func win32FromHresult(hr uintptr) uintptr {
if hr&0x1fff0000 == 0x00070000 {
return hr & 0xffff
}
return hr
}
func (e *HcsError) Error() string {
s := e.title
if len(s) > 0 && s[len(s)-1] != ' ' {
s += " "
}
s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err))
if e.rest != "" {
if e.rest[0] != ' ' {
s += " "
}
s += e.rest
}
return s
}
func convertAndFreeCoTaskMemString(buffer *uint16) string {
str := syscall.UTF16ToString((*[1 << 30]uint16)(unsafe.Pointer(buffer))[:])
coTaskMemFree(unsafe.Pointer(buffer))
return str
}
func convertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
return []byte(convertAndFreeCoTaskMemString(buffer))
}
func processHcsResult(err error, resultp *uint16) error {
if resultp != nil {
result := convertAndFreeCoTaskMemString(resultp)
logrus.Debugf("Result: %s", result)
}
return err
}
type HcsError = hcserror.HcsError

View File

@ -1,318 +1,94 @@
package hcsshim
import (
"encoding/json"
"fmt"
"net"
"github.com/sirupsen/logrus"
)
// HNSEndpoint represents a network endpoint in HNS
type HNSEndpoint struct {
Id string `json:"ID,omitempty"`
Name string `json:",omitempty"`
VirtualNetwork string `json:",omitempty"`
VirtualNetworkName string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
MacAddress string `json:",omitempty"`
IPAddress net.IP `json:",omitempty"`
DNSSuffix string `json:",omitempty"`
DNSServerList string `json:",omitempty"`
GatewayAddress string `json:",omitempty"`
EnableInternalDNS bool `json:",omitempty"`
DisableICC bool `json:",omitempty"`
PrefixLength uint8 `json:",omitempty"`
IsRemoteEndpoint bool `json:",omitempty"`
}
//SystemType represents the type of the system on which actions are done
type SystemType string
// SystemType const
const (
ContainerType SystemType = "Container"
VirtualMachineType SystemType = "VirtualMachine"
HostType SystemType = "Host"
)
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type EndpointAttachDetachRequest struct {
ContainerID string `json:"ContainerId,omitempty"`
SystemType SystemType `json:"SystemType"`
CompartmentID uint16 `json:"CompartmentId,omitempty"`
VirtualNICName string `json:"VirtualNicName,omitempty"`
}
// EndpointResquestResponse is object to get the endpoint request response
type EndpointResquestResponse struct {
Success bool
Error string
}
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
endpoint := &HNSEndpoint{}
err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
if err != nil {
return nil, err
}
return endpoint, nil
}
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
var endpoint []HNSEndpoint
err := hnsCall("GET", "/endpoints/", "", &endpoint)
if err != nil {
return nil, err
}
return endpoint, nil
}
// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
func HotAttachEndpoint(containerID string, endpointID string) error {
return modifyNetworkEndpoint(containerID, endpointID, Add)
}
// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
func HotDetachEndpoint(containerID string, endpointID string) error {
return modifyNetworkEndpoint(containerID, endpointID, Remove)
}
// ModifyContainer corresponding to the container id, by sending a request
func modifyContainer(id string, request *ResourceModificationRequestResponse) error {
container, err := OpenContainer(id)
if err != nil {
if IsNotExist(err) {
return ErrComputeSystemDoesNotExist
}
return getInnerError(err)
}
defer container.Close()
err = container.Modify(request)
if err != nil {
if IsNotSupported(err) {
return ErrPlatformNotSupported
}
return getInnerError(err)
}
return nil
}
func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error {
requestMessage := &ResourceModificationRequestResponse{
Resource: Network,
Request: request,
Data: endpointID,
}
err := modifyContainer(containerID, requestMessage)
if err != nil {
return err
}
return nil
}
// GetHNSEndpointByID get the Endpoint by ID
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
return HNSEndpointRequest("GET", endpointID, "")
}
// GetHNSEndpointByName gets the endpoint filtered by Name
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
hnsResponse, err := HNSListEndpointRequest()
if err != nil {
return nil, err
}
for _, hnsEndpoint := range hnsResponse {
if hnsEndpoint.Name == endpointName {
return &hnsEndpoint, nil
}
}
return nil, fmt.Errorf("Endpoint %v not found", endpointName)
}
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
operation := "Create"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(endpoint)
if err != nil {
return nil, err
}
return HNSEndpointRequest("POST", "", string(jsonString))
}
// Delete Endpoint by sending EndpointRequest to HNS
func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
operation := "Delete"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
return HNSEndpointRequest("DELETE", endpoint.Id, "")
}
// Update Endpoint
func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
operation := "Update"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(endpoint)
if err != nil {
return nil, err
}
err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
return endpoint, err
}
// ContainerHotAttach attaches an endpoint to a running container
func (endpoint *HNSEndpoint) ContainerHotAttach(containerID string) error {
operation := "ContainerHotAttach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)
return modifyNetworkEndpoint(containerID, endpoint.Id, Add)
}
// ContainerHotDetach detaches an endpoint from a running container
func (endpoint *HNSEndpoint) ContainerHotDetach(containerID string) error {
operation := "ContainerHotDetach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)
return modifyNetworkEndpoint(containerID, endpoint.Id, Remove)
}
// ApplyACLPolicy applies Acl Policy on the Endpoint
func (endpoint *HNSEndpoint) ApplyACLPolicy(policy *ACLPolicy) error {
operation := "ApplyACLPolicy"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(policy)
if err != nil {
return err
}
endpoint.Policies[0] = jsonString
_, err = endpoint.Update()
return err
}
// ContainerAttach attaches an endpoint to container
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
operation := "ContainerAttach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
ContainerID: containerID,
CompartmentID: compartmentID,
SystemType: ContainerType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// ContainerDetach detaches an endpoint from container
func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
operation := "ContainerDetach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
ContainerID: containerID,
SystemType: ContainerType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
// HostAttach attaches a nic on the host
func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
operation := "HostAttach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
CompartmentID: compartmentID,
SystemType: HostType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// HostDetach detaches a nic on the host
func (endpoint *HNSEndpoint) HostDetach() error {
operation := "HostDetach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
SystemType: HostType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
// VirtualMachineNICAttach attaches a endpoint to a virtual machine
func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
operation := "VirtualMachineNicAttach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
VirtualNICName: virtualMachineNICName,
SystemType: VirtualMachineType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// VirtualMachineNICDetach detaches a endpoint from a virtual machine
func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
operation := "VirtualMachineNicDetach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
SystemType: VirtualMachineType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
// HNSEndpoint represents a network endpoint in HNS
type HNSEndpoint = hns.HNSEndpoint
// Namespace represents a Compartment.
type Namespace = hns.Namespace
//SystemType represents the type of the system on which actions are done
type SystemType string
// SystemType const
const (
ContainerType SystemType = "Container"
VirtualMachineType SystemType = "VirtualMachine"
HostType SystemType = "Host"
)
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest
// EndpointResquestResponse is object to get the endpoint request response
type EndpointResquestResponse = hns.EndpointResquestResponse
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
return hns.HNSEndpointRequest(method, path, request)
}
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
return hns.HNSListEndpointRequest()
}
// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
func HotAttachEndpoint(containerID string, endpointID string) error {
return modifyNetworkEndpoint(containerID, endpointID, Add)
}
// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
func HotDetachEndpoint(containerID string, endpointID string) error {
return modifyNetworkEndpoint(containerID, endpointID, Remove)
}
// ModifyContainer corresponding to the container id, by sending a request
func modifyContainer(id string, request *ResourceModificationRequestResponse) error {
container, err := OpenContainer(id)
if err != nil {
if IsNotExist(err) {
return ErrComputeSystemDoesNotExist
}
return getInnerError(err)
}
defer container.Close()
err = container.Modify(request)
if err != nil {
if IsNotSupported(err) {
return ErrPlatformNotSupported
}
return getInnerError(err)
}
return nil
}
func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error {
requestMessage := &ResourceModificationRequestResponse{
Resource: Network,
Request: request,
Data: endpointID,
}
err := modifyContainer(containerID, requestMessage)
if err != nil {
return err
}
return nil
}
// GetHNSEndpointByID get the Endpoint by ID
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
return hns.GetHNSEndpointByID(endpointID)
}
// GetHNSEndpointByName gets the endpoint filtered by Name
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
return hns.GetHNSEndpointByName(endpointName)
}

16
vendor/github.com/Microsoft/hcsshim/hnsglobals.go generated vendored Normal file
View File

@ -0,0 +1,16 @@
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
type HNSGlobals = hns.HNSGlobals
type HNSVersion = hns.HNSVersion
var (
HNSVersion1803 = hns.HNSVersion1803
)
func GetHNSGlobals() (*HNSGlobals, error) {
return hns.GetHNSGlobals()
}

View File

@ -1,142 +1,36 @@
package hcsshim
import (
"encoding/json"
"fmt"
"net"
"github.com/sirupsen/logrus"
)
// Subnet is assoicated with a network and represents a list
// of subnets available to the network
type Subnet struct {
AddressPrefix string `json:",omitempty"`
GatewayAddress string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
}
// MacPool is assoicated with a network and represents a list
// of macaddresses available to the network
type MacPool struct {
StartMacAddress string `json:",omitempty"`
EndMacAddress string `json:",omitempty"`
}
// HNSNetwork represents a network in HNS
type HNSNetwork struct {
Id string `json:"ID,omitempty"`
Name string `json:",omitempty"`
Type string `json:",omitempty"`
NetworkAdapterName string `json:",omitempty"`
SourceMac string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
MacPools []MacPool `json:",omitempty"`
Subnets []Subnet `json:",omitempty"`
DNSSuffix string `json:",omitempty"`
DNSServerList string `json:",omitempty"`
DNSServerCompartment uint32 `json:",omitempty"`
ManagementIP string `json:",omitempty"`
AutomaticDNS bool `json:",omitempty"`
}
type hnsNetworkResponse struct {
Success bool
Error string
Output HNSNetwork
}
type hnsResponse struct {
Success bool
Error string
Output json.RawMessage
}
// HNSNetworkRequest makes a call into HNS to update/query a single network
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
var network HNSNetwork
err := hnsCall(method, "/networks/"+path, request, &network)
if err != nil {
return nil, err
}
return &network, nil
}
// HNSListNetworkRequest makes a HNS call to query the list of available networks
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
var network []HNSNetwork
err := hnsCall(method, "/networks/"+path, request, &network)
if err != nil {
return nil, err
}
return network, nil
}
// GetHNSNetworkByID
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
return HNSNetworkRequest("GET", networkID, "")
}
// GetHNSNetworkName filtered by Name
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
if err != nil {
return nil, err
}
for _, hnsnetwork := range hsnnetworks {
if hnsnetwork.Name == networkName {
return &hnsnetwork, nil
}
}
return nil, fmt.Errorf("Network %v not found", networkName)
}
// Create Network by sending NetworkRequest to HNS.
func (network *HNSNetwork) Create() (*HNSNetwork, error) {
operation := "Create"
title := "HCSShim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
jsonString, err := json.Marshal(network)
if err != nil {
return nil, err
}
return HNSNetworkRequest("POST", "", string(jsonString))
}
// Delete Network by sending NetworkRequest to HNS
func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
operation := "Delete"
title := "HCSShim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
return HNSNetworkRequest("DELETE", network.Id, "")
}
// Creates an endpoint on the Network.
func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
return &HNSEndpoint{
VirtualNetwork: network.Id,
IPAddress: ipAddress,
MacAddress: string(macAddress),
}
}
func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
operation := "CreateEndpoint"
title := "HCSShim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
endpoint.VirtualNetwork = network.Id
return endpoint.Create()
}
func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
operation := "CreateRemoteEndpoint"
title := "HCSShim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
endpoint.IsRemoteEndpoint = true
return network.CreateEndpoint(endpoint)
}
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
// Subnet is assoicated with a network and represents a list
// of subnets available to the network
type Subnet = hns.Subnet
// MacPool is assoicated with a network and represents a list
// of macaddresses available to the network
type MacPool = hns.MacPool
// HNSNetwork represents a network in HNS
type HNSNetwork = hns.HNSNetwork
// HNSNetworkRequest makes a call into HNS to update/query a single network
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
return hns.HNSNetworkRequest(method, path, request)
}
// HNSListNetworkRequest makes a HNS call to query the list of available networks
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
return hns.HNSListNetworkRequest(method, path, request)
}
// GetHNSNetworkByID
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
return hns.GetHNSNetworkByID(networkID)
}
// GetHNSNetworkName filtered by Name
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
return hns.GetHNSNetworkByName(networkName)
}

View File

@ -1,95 +1,57 @@
package hcsshim
// Type of Request Support in ModifySystem
type PolicyType string
// RequestType const
const (
Nat PolicyType = "NAT"
ACL PolicyType = "ACL"
PA PolicyType = "PA"
VLAN PolicyType = "VLAN"
VSID PolicyType = "VSID"
VNet PolicyType = "VNET"
L2Driver PolicyType = "L2Driver"
Isolation PolicyType = "Isolation"
QOS PolicyType = "QOS"
OutboundNat PolicyType = "OutBoundNAT"
ExternalLoadBalancer PolicyType = "ELB"
Route PolicyType = "ROUTE"
)
type NatPolicy struct {
Type PolicyType `json:"Type"`
Protocol string
InternalPort uint16
ExternalPort uint16
}
type QosPolicy struct {
Type PolicyType `json:"Type"`
MaximumOutgoingBandwidthInBytes uint64
}
type IsolationPolicy struct {
Type PolicyType `json:"Type"`
VLAN uint
VSID uint
InDefaultIsolation bool
}
type VlanPolicy struct {
Type PolicyType `json:"Type"`
VLAN uint
}
type VsidPolicy struct {
Type PolicyType `json:"Type"`
VSID uint
}
type PaPolicy struct {
Type PolicyType `json:"Type"`
PA string `json:"PA"`
}
type OutboundNatPolicy struct {
Policy
VIP string `json:"VIP,omitempty"`
Exceptions []string `json:"ExceptionList,omitempty"`
}
type ActionType string
type DirectionType string
type RuleType string
const (
Allow ActionType = "Allow"
Block ActionType = "Block"
In DirectionType = "In"
Out DirectionType = "Out"
Host RuleType = "Host"
Switch RuleType = "Switch"
)
type ACLPolicy struct {
Type PolicyType `json:"Type"`
Protocol uint16
InternalPort uint16
Action ActionType
Direction DirectionType
LocalAddress string
RemoteAddress string
LocalPort uint16
RemotePort uint16
RuleType RuleType `json:"RuleType,omitempty"`
Priority uint16
ServiceName string
}
type Policy struct {
Type PolicyType `json:"Type"`
}
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
// Type of Request Support in ModifySystem
type PolicyType = hns.PolicyType
// RequestType const
const (
Nat = hns.Nat
ACL = hns.ACL
PA = hns.PA
VLAN = hns.VLAN
VSID = hns.VSID
VNet = hns.VNet
L2Driver = hns.L2Driver
Isolation = hns.Isolation
QOS = hns.QOS
OutboundNat = hns.OutboundNat
ExternalLoadBalancer = hns.ExternalLoadBalancer
Route = hns.Route
)
type NatPolicy = hns.NatPolicy
type QosPolicy = hns.QosPolicy
type IsolationPolicy = hns.IsolationPolicy
type VlanPolicy = hns.VlanPolicy
type VsidPolicy = hns.VsidPolicy
type PaPolicy = hns.PaPolicy
type OutboundNatPolicy = hns.OutboundNatPolicy
type ActionType = hns.ActionType
type DirectionType = hns.DirectionType
type RuleType = hns.RuleType
const (
Allow = hns.Allow
Block = hns.Block
In = hns.In
Out = hns.Out
Host = hns.Host
Switch = hns.Switch
)
type ACLPolicy = hns.ACLPolicy
type Policy = hns.Policy

View File

@ -1,196 +1,47 @@
package hcsshim
import (
"encoding/json"
"github.com/sirupsen/logrus"
)
// RoutePolicy is a structure defining schema for Route based Policy
type RoutePolicy struct {
Policy
DestinationPrefix string `json:"DestinationPrefix,omitempty"`
NextHop string `json:"NextHop,omitempty"`
EncapEnabled bool `json:"NeedEncap,omitempty"`
}
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
type ELBPolicy struct {
LBPolicy
SourceVIP string `json:"SourceVIP,omitempty"`
VIPs []string `json:"VIPs,omitempty"`
ILB bool `json:"ILB,omitempty"`
}
// LBPolicy is a structure defining schema for LoadBalancing based Policy
type LBPolicy struct {
Policy
Protocol uint16 `json:"Protocol,omitempty"`
InternalPort uint16
ExternalPort uint16
}
// PolicyList is a structure defining schema for Policy list request
type PolicyList struct {
ID string `json:"ID,omitempty"`
EndpointReferences []string `json:"References,omitempty"`
Policies []json.RawMessage `json:"Policies,omitempty"`
}
// HNSPolicyListRequest makes a call into HNS to update/query a single network
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
var policy PolicyList
err := hnsCall(method, "/policylists/"+path, request, &policy)
if err != nil {
return nil, err
}
return &policy, nil
}
// HNSListPolicyListRequest gets all the policy list
func HNSListPolicyListRequest() ([]PolicyList, error) {
var plist []PolicyList
err := hnsCall("GET", "/policylists/", "", &plist)
if err != nil {
return nil, err
}
return plist, nil
}
// PolicyListRequest makes a HNS call to modify/query a network policy list
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
policylist := &PolicyList{}
err := hnsCall(method, "/policylists/"+path, request, &policylist)
if err != nil {
return nil, err
}
return policylist, nil
}
// GetPolicyListByID get the policy list by ID
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
return PolicyListRequest("GET", policyListID, "")
}
// Create PolicyList by sending PolicyListRequest to HNS.
func (policylist *PolicyList) Create() (*PolicyList, error) {
operation := "Create"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" id=%s", policylist.ID)
jsonString, err := json.Marshal(policylist)
if err != nil {
return nil, err
}
return PolicyListRequest("POST", "", string(jsonString))
}
// Delete deletes PolicyList
func (policylist *PolicyList) Delete() (*PolicyList, error) {
operation := "Delete"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" id=%s", policylist.ID)
return PolicyListRequest("DELETE", policylist.ID, "")
}
// AddEndpoint add an endpoint to a Policy List
func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
operation := "AddEndpoint"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
_, err := policylist.Delete()
if err != nil {
return nil, err
}
// Add Endpoint to the Existing List
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
return policylist.Create()
}
// RemoveEndpoint removes an endpoint from the Policy List
func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
operation := "RemoveEndpoint"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
_, err := policylist.Delete()
if err != nil {
return nil, err
}
elementToRemove := "/endpoints/" + endpoint.Id
var references []string
for _, endpointReference := range policylist.EndpointReferences {
if endpointReference == elementToRemove {
continue
}
references = append(references, endpointReference)
}
policylist.EndpointReferences = references
return policylist.Create()
}
// AddLoadBalancer policy list for the specified endpoints
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
operation := "AddLoadBalancer"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" Vip:%s", vip)
policylist := &PolicyList{}
elbPolicy := &ELBPolicy{
VIPs: []string{vip},
ILB: isILB,
}
elbPolicy.Type = ExternalLoadBalancer
elbPolicy.Protocol = protocol
elbPolicy.InternalPort = internalPort
elbPolicy.ExternalPort = externalPort
for _, endpoint := range endpoints {
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
}
jsonString, err := json.Marshal(elbPolicy)
if err != nil {
return nil, err
}
policylist.Policies = append(policylist.Policies, jsonString)
return policylist.Create()
}
// AddRoute adds route policy list for the specified endpoints
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
operation := "AddRoute"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
policylist := &PolicyList{}
rPolicy := &RoutePolicy{
DestinationPrefix: destinationPrefix,
NextHop: nextHop,
EncapEnabled: encapEnabled,
}
rPolicy.Type = Route
for _, endpoint := range endpoints {
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
}
jsonString, err := json.Marshal(rPolicy)
if err != nil {
return nil, err
}
policylist.Policies = append(policylist.Policies, jsonString)
return policylist.Create()
}
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
// RoutePolicy is a structure defining schema for Route based Policy
type RoutePolicy = hns.RoutePolicy
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
type ELBPolicy = hns.ELBPolicy
// LBPolicy is a structure defining schema for LoadBalancing based Policy
type LBPolicy = hns.LBPolicy
// PolicyList is a structure defining schema for Policy list request
type PolicyList = hns.PolicyList
// HNSPolicyListRequest makes a call into HNS to update/query a single network
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
return hns.HNSPolicyListRequest(method, path, request)
}
// HNSListPolicyListRequest gets all the policy list
func HNSListPolicyListRequest() ([]PolicyList, error) {
return hns.HNSListPolicyListRequest()
}
// PolicyListRequest makes a HNS call to modify/query a network policy list
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
return hns.PolicyListRequest(method, path, request)
}
// GetPolicyListByID get the policy list by ID
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
return hns.GetPolicyListByID(policyListID)
}
// AddLoadBalancer policy list for the specified endpoints
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
}
// AddRoute adds route policy list for the specified endpoints
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled)
}

13
vendor/github.com/Microsoft/hcsshim/hnssupport.go generated vendored Normal file
View File

@ -0,0 +1,13 @@
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
type HNSSupportedFeatures = hns.HNSSupportedFeatures
type HNSAclFeatures = hns.HNSAclFeatures
func GetHNSSupportedFeatures() HNSSupportedFeatures {
return hns.GetHNSSupportedFeatures()
}

View File

@ -1,212 +0,0 @@
package hcsshim
import (
"errors"
"io/ioutil"
"os"
"path/filepath"
"github.com/Microsoft/go-winio"
"github.com/sirupsen/logrus"
)
// ImportLayer will take the contents of the folder at importFolderPath and import
// that into a layer with the id layerId. Note that in order to correctly populate
// the layer and interperet the transport format, all parent layers must already
// be present on the system at the paths provided in parentLayerPaths.
func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error {
title := "hcsshim::ImportLayer "
logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerID, importFolderPath)
// Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return err
}
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = importLayer(&infop, layerID, importFolderPath, layers)
if err != nil {
err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerID, info.Flavour, importFolderPath)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerID, importFolderPath)
return nil
}
// LayerWriter is an interface that supports writing a new container image layer.
type LayerWriter interface {
// Add adds a file to the layer with given metadata.
Add(name string, fileInfo *winio.FileBasicInfo) error
// AddLink adds a hard link to the layer. The target must already have been added.
AddLink(name string, target string) error
// Remove removes a file that was present in a parent layer from the layer.
Remove(name string) error
// Write writes data to the current file. The data must be in the format of a Win32
// backup stream.
Write(b []byte) (int, error)
// Close finishes the layer writing process and releases any resources.
Close() error
}
// FilterLayerWriter provides an interface to write the contents of a layer to the file system.
type FilterLayerWriter struct {
context uintptr
}
// Add adds a file or directory to the layer. The file's parent directory must have already been added.
//
// name contains the file's relative path. fileInfo contains file times and file attributes; the rest
// of the file metadata and the file data must be written as a Win32 backup stream to the Write() method.
// winio.BackupStreamWriter can be used to facilitate this.
func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error {
if name[0] != '\\' {
name = `\` + name
}
err := importLayerNext(w.context, name, fileInfo)
if err != nil {
return makeError(err, "ImportLayerNext", "")
}
return nil
}
// AddLink adds a hard link to the layer. The target of the link must have already been added.
func (w *FilterLayerWriter) AddLink(name string, target string) error {
return errors.New("hard links not yet supported")
}
// Remove removes a file from the layer. The file must have been present in the parent layer.
//
// name contains the file's relative path.
func (w *FilterLayerWriter) Remove(name string) error {
if name[0] != '\\' {
name = `\` + name
}
err := importLayerNext(w.context, name, nil)
if err != nil {
return makeError(err, "ImportLayerNext", "")
}
return nil
}
// Write writes more backup stream data to the current file.
func (w *FilterLayerWriter) Write(b []byte) (int, error) {
err := importLayerWrite(w.context, b)
if err != nil {
err = makeError(err, "ImportLayerWrite", "")
return 0, err
}
return len(b), err
}
// Close completes the layer write operation. The error must be checked to ensure that the
// operation was successful.
func (w *FilterLayerWriter) Close() (err error) {
if w.context != 0 {
err = importLayerEnd(w.context)
if err != nil {
err = makeError(err, "ImportLayerEnd", "")
}
w.context = 0
}
return
}
type legacyLayerWriterWrapper struct {
*legacyLayerWriter
info DriverInfo
layerID string
path string
parentLayerPaths []string
}
func (r *legacyLayerWriterWrapper) Close() error {
defer os.RemoveAll(r.root)
err := r.legacyLayerWriter.Close()
if err != nil {
return err
}
// Use the original path here because ImportLayer does not support long paths for the source in TP5.
// But do use a long path for the destination to work around another bug with directories
// with MAX_PATH - 12 < length < MAX_PATH.
info := r.info
fullPath, err := makeLongAbsPath(filepath.Join(info.HomeDir, r.layerID))
if err != nil {
return err
}
info.HomeDir = ""
if err = ImportLayer(info, fullPath, r.path, r.parentLayerPaths); err != nil {
return err
}
// Add any hard links that were collected.
for _, lnk := range r.PendingLinks {
if err = os.Remove(lnk.Path); err != nil && !os.IsNotExist(err) {
return err
}
if err = os.Link(lnk.Target, lnk.Path); err != nil {
return err
}
}
// Prepare the utility VM for use if one is present in the layer.
if r.HasUtilityVM {
err = ProcessUtilityVMImage(filepath.Join(fullPath, "UtilityVM"))
if err != nil {
return err
}
}
return nil
}
// NewLayerWriter returns a new layer writer for creating a layer on disk.
// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges
// to call this and any methods on the resulting LayerWriter.
func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) {
if len(parentLayerPaths) == 0 {
// This is a base layer. It gets imported differently.
return &baseLayerWriter{
root: filepath.Join(info.HomeDir, layerID),
}, nil
}
if procImportLayerBegin.Find() != nil {
// The new layer reader is not available on this Windows build. Fall back to the
// legacy export code path.
path, err := ioutil.TempDir("", "hcs")
if err != nil {
return nil, err
}
return &legacyLayerWriterWrapper{
legacyLayerWriter: newLegacyLayerWriter(path, parentLayerPaths, filepath.Join(info.HomeDir, layerID)),
info: info,
layerID: layerID,
path: path,
parentLayerPaths: parentLayerPaths,
}, nil
}
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return nil, err
}
infop, err := convertDriverInfo(info)
if err != nil {
return nil, err
}
w := &FilterLayerWriter{}
err = importLayerBegin(&infop, layerID, layers, &w.context)
if err != nil {
return nil, makeError(err, "ImportLayerStart", "")
}
return w, nil
}

View File

@ -1,105 +1,32 @@
package hcsshim
import (
"encoding/json"
"io"
"time"
"github.com/Microsoft/hcsshim/internal/schema1"
)
// ProcessConfig is used as both the input of Container.CreateProcess
// and to convert the parameters to JSON for passing onto the HCS
type ProcessConfig struct {
ApplicationName string `json:",omitempty"`
CommandLine string `json:",omitempty"`
CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows
User string `json:",omitempty"`
WorkingDirectory string `json:",omitempty"`
Environment map[string]string `json:",omitempty"`
EmulateConsole bool `json:",omitempty"`
CreateStdInPipe bool `json:",omitempty"`
CreateStdOutPipe bool `json:",omitempty"`
CreateStdErrPipe bool `json:",omitempty"`
ConsoleSize [2]uint `json:",omitempty"`
CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows
OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows
}
type ProcessConfig = schema1.ProcessConfig
type Layer struct {
ID string
Path string
}
type Layer = schema1.Layer
type MappedDir = schema1.MappedDir
type MappedPipe = schema1.MappedPipe
type HvRuntime = schema1.HvRuntime
type MappedVirtualDisk = schema1.MappedVirtualDisk
type MappedDir struct {
HostPath string
ContainerPath string
ReadOnly bool
BandwidthMaximum uint64
IOPSMaximum uint64
}
type MappedPipe struct {
HostPath string
ContainerPipeName string
}
type HvRuntime struct {
ImagePath string `json:",omitempty"`
SkipTemplate bool `json:",omitempty"`
LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD
}
type MappedVirtualDisk struct {
HostPath string `json:",omitempty"` // Path to VHD on the host
ContainerPath string // Platform-specific mount point path in the container
CreateInUtilityVM bool `json:",omitempty"`
ReadOnly bool `json:",omitempty"`
Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
AttachOnly bool `json:",omitempty:`
}
// AssignedDevice represents a device that has been directly assigned to a container
//
// NOTE: Support added in RS5
type AssignedDevice = schema1.AssignedDevice
// ContainerConfig is used as both the input of CreateContainer
// and to convert the parameters to JSON for passing onto the HCS
type ContainerConfig struct {
SystemType string // HCS requires this to be hard-coded to "Container"
Name string // Name of the container. We use the docker ID.
Owner string `json:",omitempty"` // The management platform that created this container
VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows
LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID
Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
Credentials string `json:",omitempty"` // Credentials information
ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container.
ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS
StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes
HostName string `json:",omitempty"` // Hostname
MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts)
MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes
HvPartition bool // True if it a Hyper-V Container
NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container
HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
Servicing bool `json:",omitempty"` // True if this container is for servicing
AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution
DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
}
type ContainerConfig = schema1.ContainerConfig
type ComputeSystemQuery struct {
IDs []string `json:"Ids,omitempty"`
Types []string `json:",omitempty"`
Names []string `json:",omitempty"`
Owners []string `json:",omitempty"`
}
type ComputeSystemQuery = schema1.ComputeSystemQuery
// Container represents a created (but not necessarily running) container.
type Container interface {

View File

@ -0,0 +1,85 @@
package guestrequest
import "github.com/Microsoft/hcsshim/internal/schema2"
// Arguably, many of these (at least CombinedLayers) should have been generated
// by swagger.
//
// This will also change package name due to an inbound breaking change.
// This class is used by a modify request to add or remove a combined layers
// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath
// using the specified layers as the parent content. Ignores property ScratchPath
// since the container path is already the scratch path. For linux, the GCS unions
// the specified layers and ScratchPath together, placing the resulting union
// filesystem at ContainerRootPath.
type CombinedLayers struct {
ContainerRootPath string `json:"ContainerRootPath,omitempty"`
Layers []hcsschema.Layer `json:"Layers,omitempty"`
ScratchPath string `json:"ScratchPath,omitempty"`
}
// Defines the schema for hosted settings passed to GCS and/or OpenGCS
// SCSI. Scratch space for remote file-system commands, or R/W layer for containers
type LCOWMappedVirtualDisk struct {
MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM
Lun uint8 `json:"Lun,omitempty"`
Controller uint8 `json:"Controller,omitempty"`
ReadOnly bool `json:"ReadOnly,omitempty"`
}
type WCOWMappedVirtualDisk struct {
ContainerPath string `json:"ContainerPath,omitempty"`
Lun int32 `json:"Lun,omitempty"`
}
type LCOWMappedDirectory struct {
MountPath string `json:"MountPath,omitempty"`
Port int32 `json:"Port,omitempty"`
ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported)
ReadOnly bool `json:"ReadOnly,omitempty"`
}
// Read-only layers over VPMem
type LCOWMappedVPMemDevice struct {
DeviceNumber uint32 `json:"DeviceNumber,omitempty"`
MountPath string `json:"MountPath,omitempty"` // /tmp/pN
}
type ResourceType string
const (
// These are constants for v2 schema modify guest requests.
ResourceTypeMappedDirectory ResourceType = "MappedDirectory"
ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk"
ResourceTypeNetwork ResourceType = "Network"
ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace"
ResourceTypeCombinedLayers ResourceType = "CombinedLayers"
ResourceTypeVPMemDevice ResourceType = "VPMemDevice"
)
// GuestRequest is for modify commands passed to the guest.
type GuestRequest struct {
RequestType string `json:"RequestType,omitempty"`
ResourceType ResourceType `json:"ResourceType,omitempty"`
Settings interface{} `json:"Settings,omitempty"`
}
type NetworkModifyRequest struct {
AdapterId string `json:"AdapterId,omitempty"`
RequestType string `json:"RequestType,omitempty"`
Settings interface{} `json:"Settings,omitempty"`
}
type RS4NetworkModifyRequest struct {
AdapterInstanceId string `json:"AdapterInstanceId,omitempty"`
RequestType string `json:"RequestType,omitempty"`
Settings interface{} `json:"Settings,omitempty"`
}
// SignalProcessOptions is the options passed to either WCOW or LCOW
// to signal a given process.
type SignalProcessOptions struct {
Signal int `json:,omitempty`
}

View File

@ -0,0 +1,69 @@
package guid
import (
"crypto/rand"
"encoding/json"
"fmt"
"io"
"strconv"
"strings"
)
var _ = (json.Marshaler)(&GUID{})
var _ = (json.Unmarshaler)(&GUID{})
type GUID [16]byte
func New() GUID {
g := GUID{}
_, err := io.ReadFull(rand.Reader, g[:])
if err != nil {
panic(err)
}
return g
}
func (g GUID) String() string {
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
}
func FromString(s string) GUID {
if len(s) != 36 {
panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
}
if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
panic("invalid GUID format")
}
indexOrder := [16]int{
0, 2, 4, 6,
9, 11,
14, 16,
19, 21,
24, 26, 28, 30, 32, 34,
}
byteOrder := [16]int{
3, 2, 1, 0,
5, 4,
7, 6,
8, 9,
10, 11, 12, 13, 14, 15,
}
var g GUID
for i, x := range indexOrder {
b, err := strconv.ParseInt(s[x:x+2], 16, 16)
if err != nil {
panic(err)
}
g[byteOrder[i]] = byte(b)
}
return g
}
func (g GUID) MarshalJSON() ([]byte, error) {
return json.Marshal(g.String())
}
func (g *GUID) UnmarshalJSON(data []byte) error {
*g = FromString(strings.Trim(string(data), "\""))
return nil
}

View File

@ -1,8 +1,11 @@
package hcsshim
package hcs
import (
"sync"
"syscall"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
var (
@ -62,7 +65,7 @@ func closeChannels(channels notificationChannels) {
func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
var result error
if int32(notificationStatus) < 0 {
result = syscall.Errno(win32FromHresult(notificationStatus))
result = interop.Win32FromHresult(notificationStatus)
}
callbackMapLock.RLock()
@ -73,7 +76,13 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt
return 0
}
context.channels[notificationType] <- result
if channel, ok := context.channels[notificationType]; ok {
channel <- result
} else {
logrus.WithFields(logrus.Fields{
"notification-type": notificationType,
}).Warn("Received a callback of an unsupported type")
}
return 0
}

View File

@ -1,4 +1,4 @@
package hcsshim
package hcs
import "C"

View File

@ -0,0 +1,284 @@
package hcs
import (
"encoding/json"
"errors"
"fmt"
"syscall"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/Microsoft/hcsshim/internal/logfields"
"github.com/sirupsen/logrus"
)
var (
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
// ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrElementNotFound = syscall.Errno(0x490)
// ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrNotSupported = syscall.Errno(0x32)
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
// decimal -2147024883 / hex 0x8007000d
ErrInvalidData = syscall.Errno(0xd)
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
// ErrTimeout is an error encountered when waiting on a notification times out
ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
// a different expected notification
ErrUnexpectedContainerExit = errors.New("unexpected container exit")
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
// is lost while waiting for a notification
ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
// ErrProcNotFound is an error encountered when the the process cannot be found
ErrProcNotFound = syscall.Errno(0x7f)
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
// ErrNotSupported is an error encountered when hcs doesn't support the request
ErrPlatformNotSupported = errors.New("unsupported platform request")
)
type ErrorEvent struct {
Message string `json:"Message,omitempty"` // Fully formated error message
StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form
Provider string `json:"Provider,omitempty"`
EventID uint16 `json:"EventId,omitempty"`
Flags uint32 `json:"Flags,omitempty"`
Source string `json:"Source,omitempty"`
//Data []EventData `json:"Data,omitempty"` // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function)
}
type hcsResult struct {
Error int32
ErrorMessage string
ErrorEvents []ErrorEvent `json:"ErrorEvents,omitempty"`
}
func (ev *ErrorEvent) String() string {
evs := "[Event Detail: " + ev.Message
if ev.StackTrace != "" {
evs += " Stack Trace: " + ev.StackTrace
}
if ev.Provider != "" {
evs += " Provider: " + ev.Provider
}
if ev.EventID != 0 {
evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID)
}
if ev.Flags != 0 {
evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags)
}
if ev.Source != "" {
evs += " Source: " + ev.Source
}
evs += "]"
return evs
}
func processHcsResult(resultp *uint16) []ErrorEvent {
if resultp != nil {
resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
logrus.WithField(logfields.JSON, resultj).
Debug("HCS Result")
result := &hcsResult{}
if err := json.Unmarshal([]byte(resultj), result); err != nil {
logrus.WithFields(logrus.Fields{
logfields.JSON: resultj,
logrus.ErrorKey: err,
}).Warning("Could not unmarshal HCS result")
return nil
}
return result.ErrorEvents
}
return nil
}
type HcsError struct {
Op string
Err error
Events []ErrorEvent
}
func (e *HcsError) Error() string {
s := e.Op + ": " + e.Err.Error()
for _, ev := range e.Events {
s += "\n" + ev.String()
}
return s
}
// ProcessError is an error encountered in HCS during an operation on a Process object
type ProcessError struct {
SystemID string
Pid int
Op string
Err error
Events []ErrorEvent
}
// SystemError is an error encountered in HCS during an operation on a Container object
type SystemError struct {
ID string
Op string
Err error
Extra string
Events []ErrorEvent
}
func (e *SystemError) Error() string {
s := e.Op + " " + e.ID + ": " + e.Err.Error()
for _, ev := range e.Events {
s += "\n" + ev.String()
}
if e.Extra != "" {
s += "\n(extra info: " + e.Extra + ")"
}
return s
}
func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
// Don't double wrap errors
if _, ok := err.(*SystemError); ok {
return err
}
return &SystemError{
ID: system.ID(),
Op: op,
Extra: extra,
Err: err,
Events: events,
}
}
func (e *ProcessError) Error() string {
s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error())
for _, ev := range e.Events {
s += "\n" + ev.String()
}
return s
}
func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
// Don't double wrap errors
if _, ok := err.(*ProcessError); ok {
return err
}
return &ProcessError{
Pid: process.Pid(),
SystemID: process.SystemID(),
Op: op,
Err: err,
Events: events,
}
}
// IsNotExist checks if an error is caused by the Container or Process not existing.
// Note: Currently, ErrElementNotFound can mean that a Process has either
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsNotExist(err error) bool {
err = getInnerError(err)
return err == ErrComputeSystemDoesNotExist ||
err == ErrElementNotFound ||
err == ErrProcNotFound
}
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
// already closed by a call to the Close() method.
func IsAlreadyClosed(err error) bool {
err = getInnerError(err)
return err == ErrAlreadyClosed
}
// IsPending returns a boolean indicating whether the error is that
// the requested operation is being completed in the background.
func IsPending(err error) bool {
err = getInnerError(err)
return err == ErrVmcomputeOperationPending
}
// IsTimeout returns a boolean indicating whether the error is caused by
// a timeout waiting for the operation to complete.
func IsTimeout(err error) bool {
err = getInnerError(err)
return err == ErrTimeout
}
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
// a Container or Process being already stopped.
// Note: Currently, ErrElementNotFound can mean that a Process has either
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsAlreadyStopped(err error) bool {
err = getInnerError(err)
return err == ErrVmcomputeAlreadyStopped ||
err == ErrElementNotFound ||
err == ErrProcNotFound
}
// IsNotSupported returns a boolean indicating whether the error is caused by
// unsupported platform requests
// Note: Currently Unsupported platform requests can be mean either
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
// is thrown from the Platform
func IsNotSupported(err error) bool {
err = getInnerError(err)
// If Platform doesn't recognize or support the request sent, below errors are seen
return err == ErrVmcomputeInvalidJSON ||
err == ErrInvalidData ||
err == ErrNotSupported ||
err == ErrVmcomputeUnknownMessage
}
func getInnerError(err error) error {
switch pe := err.(type) {
case nil:
return nil
case *HcsError:
err = pe.Err
case *SystemError:
err = pe.Err
case *ProcessError:
err = pe.Err
}
return err
}

View File

@ -0,0 +1,48 @@
// Shim for the Host Compute Service (HCS) to manage Windows Server
// containers and Hyper-V containers.
package hcs
import (
"syscall"
)
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
type hcsSystem syscall.Handle
type hcsProcess syscall.Handle
type hcsCallback syscall.Handle
type hcsProcessInformation struct {
ProcessId uint32
Reserved uint32
StdInput syscall.Handle
StdOutput syscall.Handle
StdError syscall.Handle
}

View File

@ -0,0 +1,15 @@
package hcs
import "github.com/sirupsen/logrus"
func logOperationBegin(ctx logrus.Fields, msg string) {
logrus.WithFields(ctx).Debug(msg)
}
func logOperationEnd(ctx logrus.Fields, msg string, err error) {
if err == nil {
logrus.WithFields(ctx).Debug(msg)
} else {
logrus.WithFields(ctx).WithError(err).Error(msg)
}
}

View File

@ -0,0 +1,465 @@
package hcs
import (
"encoding/json"
"io"
"sync"
"syscall"
"time"
"github.com/Microsoft/hcsshim/internal/guestrequest"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/Microsoft/hcsshim/internal/logfields"
"github.com/sirupsen/logrus"
)
// ContainerError is an error encountered in HCS
type Process struct {
handleLock sync.RWMutex
handle hcsProcess
processID int
system *System
cachedPipes *cachedPipes
callbackNumber uintptr
logctx logrus.Fields
}
func newProcess(process hcsProcess, processID int, computeSystem *System) *Process {
return &Process{
handle: process,
processID: processID,
system: computeSystem,
logctx: logrus.Fields{
logfields.HCSOperation: "",
logfields.ContainerID: computeSystem.ID(),
logfields.ProcessID: processID,
},
}
}
type cachedPipes struct {
stdIn syscall.Handle
stdOut syscall.Handle
stdErr syscall.Handle
}
type processModifyRequest struct {
Operation string
ConsoleSize *consoleSize `json:",omitempty"`
CloseHandle *closeHandle `json:",omitempty"`
}
type consoleSize struct {
Height uint16
Width uint16
}
type closeHandle struct {
Handle string
}
type ProcessStatus struct {
ProcessID uint32
Exited bool
ExitCode uint32
LastWaitResult int32
}
const (
stdIn string = "StdIn"
stdOut string = "StdOut"
stdErr string = "StdErr"
)
const (
modifyConsoleSize string = "ConsoleSize"
modifyCloseHandle string = "CloseHandle"
)
// Pid returns the process ID of the process within the container.
func (process *Process) Pid() int {
return process.processID
}
// SystemID returns the ID of the process's compute system.
func (process *Process) SystemID() string {
return process.system.ID()
}
func (process *Process) logOperationBegin(operation string) {
process.logctx[logfields.HCSOperation] = operation
logOperationBegin(
process.logctx,
"hcsshim::Process - Begin Operation")
}
func (process *Process) logOperationEnd(err error) {
var result string
if err == nil {
result = "Success"
} else {
result = "Error"
}
logOperationEnd(
process.logctx,
"hcsshim::Process - End Operation - "+result,
err)
process.logctx[logfields.HCSOperation] = ""
}
// Signal signals the process with `options`.
func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "hcsshim::Process::Signal"
process.logOperationBegin(operation)
defer process.logOperationEnd(err)
if process.handle == 0 {
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
optionsb, err := json.Marshal(options)
if err != nil {
return err
}
optionsStr := string(optionsb)
var resultp *uint16
completed := false
go syscallWatcher(process.logctx, &completed)
err = hcsSignalProcess(process.handle, optionsStr, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return makeProcessError(process, operation, err, events)
}
return nil
}
// Kill signals the process to terminate but does not wait for it to finish terminating.
func (process *Process) Kill() (err error) {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "hcsshim::Process::Kill"
process.logOperationBegin(operation)
defer process.logOperationEnd(err)
if process.handle == 0 {
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
var resultp *uint16
completed := false
go syscallWatcher(process.logctx, &completed)
err = hcsTerminateProcess(process.handle, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return makeProcessError(process, operation, err, events)
}
return nil
}
// Wait waits for the process to exit.
func (process *Process) Wait() (err error) {
operation := "hcsshim::Process::Wait"
process.logOperationBegin(operation)
defer process.logOperationEnd(err)
err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
if err != nil {
return makeProcessError(process, operation, err, nil)
}
return nil
}
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
// false if timeout occurs.
func (process *Process) WaitTimeout(timeout time.Duration) (err error) {
operation := "hcssshim::Process::WaitTimeout"
process.logOperationBegin(operation)
defer process.logOperationEnd(err)
err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
if err != nil {
return makeProcessError(process, operation, err, nil)
}
return nil
}
// ResizeConsole resizes the console of the process.
func (process *Process) ResizeConsole(width, height uint16) (err error) {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "hcsshim::Process::ResizeConsole"
process.logOperationBegin(operation)
defer process.logOperationEnd(err)
if process.handle == 0 {
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
modifyRequest := processModifyRequest{
Operation: modifyConsoleSize,
ConsoleSize: &consoleSize{
Height: height,
Width: width,
},
}
modifyRequestb, err := json.Marshal(modifyRequest)
if err != nil {
return err
}
modifyRequestStr := string(modifyRequestb)
var resultp *uint16
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeProcessError(process, operation, err, events)
}
return nil
}
func (process *Process) Properties() (_ *ProcessStatus, err error) {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "hcsshim::Process::Properties"
process.logOperationBegin(operation)
defer process.logOperationEnd(err)
if process.handle == 0 {
return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
var (
resultp *uint16
propertiesp *uint16
)
completed := false
go syscallWatcher(process.logctx, &completed)
err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return nil, makeProcessError(process, operation, err, events)
}
if propertiesp == nil {
return nil, ErrUnexpectedValue
}
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
properties := &ProcessStatus{}
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
return nil, makeProcessError(process, operation, err, nil)
}
return properties, nil
}
// ExitCode returns the exit code of the process. The process must have
// already terminated.
func (process *Process) ExitCode() (_ int, err error) {
operation := "hcsshim::Process::ExitCode"
process.logOperationBegin(operation)
defer process.logOperationEnd(err)
properties, err := process.Properties()
if err != nil {
return 0, makeProcessError(process, operation, err, nil)
}
if properties.Exited == false {
return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
}
if properties.LastWaitResult != 0 {
return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
}
return int(properties.ExitCode), nil
}
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
// these pipes does not close the underlying pipes; it should be possible to
// call this multiple times to get multiple interfaces.
func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "hcsshim::Process::Stdio"
process.logOperationBegin(operation)
defer process.logOperationEnd(err)
if process.handle == 0 {
return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
var stdIn, stdOut, stdErr syscall.Handle
if process.cachedPipes == nil {
var (
processInfo hcsProcessInformation
resultp *uint16
)
err = hcsGetProcessInfo(process.handle, &processInfo, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, nil, nil, makeProcessError(process, operation, err, events)
}
stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
} else {
// Use cached pipes
stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
// Invalidate the cache
process.cachedPipes = nil
}
pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
if err != nil {
return nil, nil, nil, makeProcessError(process, operation, err, nil)
}
return pipes[0], pipes[1], pipes[2], nil
}
// CloseStdin closes the write side of the stdin pipe so that the process is
// notified on the read side that there is no more data in stdin.
func (process *Process) CloseStdin() (err error) {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "hcsshim::Process::CloseStdin"
process.logOperationBegin(operation)
defer process.logOperationEnd(err)
if process.handle == 0 {
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
modifyRequest := processModifyRequest{
Operation: modifyCloseHandle,
CloseHandle: &closeHandle{
Handle: stdIn,
},
}
modifyRequestb, err := json.Marshal(modifyRequest)
if err != nil {
return err
}
modifyRequestStr := string(modifyRequestb)
var resultp *uint16
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeProcessError(process, operation, err, events)
}
return nil
}
// Close cleans up any state associated with the process but does not kill
// or wait on it.
func (process *Process) Close() (err error) {
process.handleLock.Lock()
defer process.handleLock.Unlock()
operation := "hcsshim::Process::Close"
process.logOperationBegin(operation)
defer process.logOperationEnd(err)
// Don't double free this
if process.handle == 0 {
return nil
}
if err = process.unregisterCallback(); err != nil {
return makeProcessError(process, operation, err, nil)
}
if err = hcsCloseProcess(process.handle); err != nil {
return makeProcessError(process, operation, err, nil)
}
process.handle = 0
return nil
}
func (process *Process) registerCallback() error {
context := &notifcationWatcherContext{
channels: newChannels(),
}
callbackMapLock.Lock()
callbackNumber := nextCallback
nextCallback++
callbackMap[callbackNumber] = context
callbackMapLock.Unlock()
var callbackHandle hcsCallback
err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
if err != nil {
return err
}
context.handle = callbackHandle
process.callbackNumber = callbackNumber
return nil
}
func (process *Process) unregisterCallback() error {
callbackNumber := process.callbackNumber
callbackMapLock.RLock()
context := callbackMap[callbackNumber]
callbackMapLock.RUnlock()
if context == nil {
return nil
}
handle := context.handle
if handle == 0 {
return nil
}
// hcsUnregisterProcessCallback has its own syncronization
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
err := hcsUnregisterProcessCallback(handle)
if err != nil {
return err
}
closeChannels(context.channels)
callbackMapLock.Lock()
callbackMap[callbackNumber] = nil
callbackMapLock.Unlock()
handle = 0
return nil
}

View File

@ -0,0 +1,667 @@
package hcs
import (
"encoding/json"
"os"
"strconv"
"sync"
"syscall"
"time"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/Microsoft/hcsshim/internal/logfields"
"github.com/Microsoft/hcsshim/internal/schema1"
"github.com/Microsoft/hcsshim/internal/timeout"
"github.com/sirupsen/logrus"
)
// currentContainerStarts is used to limit the number of concurrent container
// starts.
var currentContainerStarts containerStarts
type containerStarts struct {
maxParallel int
inProgress int
sync.Mutex
}
func init() {
mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
if len(mpsS) > 0 {
mpsI, err := strconv.Atoi(mpsS)
if err != nil || mpsI < 0 {
return
}
currentContainerStarts.maxParallel = mpsI
}
}
type System struct {
handleLock sync.RWMutex
handle hcsSystem
id string
callbackNumber uintptr
logctx logrus.Fields
}
func newSystem(id string) *System {
return &System{
id: id,
logctx: logrus.Fields{
logfields.HCSOperation: "",
logfields.ContainerID: id,
},
}
}
func (computeSystem *System) logOperationBegin(operation string) {
computeSystem.logctx[logfields.HCSOperation] = operation
logOperationBegin(
computeSystem.logctx,
"hcsshim::ComputeSystem - Begin Operation")
}
func (computeSystem *System) logOperationEnd(err error) {
var result string
if err == nil {
result = "Success"
} else {
result = "Error"
}
logOperationEnd(
computeSystem.logctx,
"hcsshim::ComputeSystem - End Operation - "+result,
err)
computeSystem.logctx[logfields.HCSOperation] = ""
}
// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) {
operation := "hcsshim::CreateComputeSystem"
computeSystem := newSystem(id)
computeSystem.logOperationBegin(operation)
defer computeSystem.logOperationEnd(err)
hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
if err != nil {
return nil, err
}
hcsDocument := string(hcsDocumentB)
logrus.WithFields(computeSystem.logctx).
WithField(logfields.JSON, hcsDocument).
Debug("HCS ComputeSystem Document")
var (
resultp *uint16
identity syscall.Handle
)
completed := false
go syscallWatcher(computeSystem.logctx, &completed)
createError := hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
completed = true
if createError == nil || IsPending(createError) {
if err = computeSystem.registerCallback(); err != nil {
// Terminate the compute system if it still exists. We're okay to
// ignore a failure here.
computeSystem.Terminate()
return nil, makeSystemError(computeSystem, operation, "", err, nil)
}
}
events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
if err != nil {
if err == ErrTimeout {
// Terminate the compute system if it still exists. We're okay to
// ignore a failure here.
computeSystem.Terminate()
}
return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
}
return computeSystem, nil
}
// OpenComputeSystem opens an existing compute system by ID.
func OpenComputeSystem(id string) (_ *System, err error) {
operation := "hcsshim::OpenComputeSystem"
computeSystem := newSystem(id)
computeSystem.logOperationBegin(operation)
defer computeSystem.logOperationEnd(err)
var (
handle hcsSystem
resultp *uint16
)
err = hcsOpenComputeSystem(id, &handle, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, operation, "", err, events)
}
computeSystem.handle = handle
if err = computeSystem.registerCallback(); err != nil {
return nil, makeSystemError(computeSystem, operation, "", err, nil)
}
return computeSystem, nil
}
// GetComputeSystems gets a list of the compute systems on the system that match the query
func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) {
operation := "hcsshim::GetComputeSystems"
fields := logrus.Fields{
logfields.HCSOperation: operation,
}
logOperationBegin(
fields,
"hcsshim::ComputeSystem - Begin Operation")
defer func() {
var result string
if err == nil {
result = "Success"
} else {
result = "Error"
}
logOperationEnd(
fields,
"hcsshim::ComputeSystem - End Operation - "+result,
err)
}()
queryb, err := json.Marshal(q)
if err != nil {
return nil, err
}
query := string(queryb)
logrus.WithFields(fields).
WithField(logfields.JSON, query).
Debug("HCS ComputeSystem Query")
var (
resultp *uint16
computeSystemsp *uint16
)
completed := false
go syscallWatcher(fields, &completed)
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return nil, &HcsError{Op: operation, Err: err, Events: events}
}
if computeSystemsp == nil {
return nil, ErrUnexpectedValue
}
computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
computeSystems := []schema1.ContainerProperties{}
if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
return nil, err
}
return computeSystems, nil
}
// Start synchronously starts the computeSystem.
func (computeSystem *System) Start() (err error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
operation := "hcsshim::ComputeSystem::Start"
computeSystem.logOperationBegin(operation)
defer computeSystem.logOperationEnd(err)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
}
// This is a very simple backoff-retry loop to limit the number
// of parallel container starts if environment variable
// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
// It should generally only be used as a workaround to various
// platform issues that exist between RS1 and RS4 as of Aug 2018
if currentContainerStarts.maxParallel > 0 {
for {
currentContainerStarts.Lock()
if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
currentContainerStarts.inProgress++
currentContainerStarts.Unlock()
break
}
if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
currentContainerStarts.Unlock()
time.Sleep(100 * time.Millisecond)
}
}
// Make sure we decrement the count when we are done.
defer func() {
currentContainerStarts.Lock()
currentContainerStarts.inProgress--
currentContainerStarts.Unlock()
}()
}
var resultp *uint16
completed := false
go syscallWatcher(computeSystem.logctx, &completed)
err = hcsStartComputeSystem(computeSystem.handle, "", &resultp)
completed = true
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
if err != nil {
return makeSystemError(computeSystem, "Start", "", err, events)
}
return nil
}
// ID returns the compute system's identifier.
func (computeSystem *System) ID() string {
return computeSystem.id
}
// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
// it may not actually be shut down until Wait() succeeds.
func (computeSystem *System) Shutdown() (err error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
operation := "hcsshim::ComputeSystem::Shutdown"
computeSystem.logOperationBegin(operation)
defer computeSystem.logOperationEnd(err)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
completed := false
go syscallWatcher(computeSystem.logctx, &completed)
err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return makeSystemError(computeSystem, "Shutdown", "", err, events)
}
return nil
}
// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
// it may not actually be shut down until Wait() succeeds.
func (computeSystem *System) Terminate() (err error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
operation := "hcsshim::ComputeSystem::Terminate"
computeSystem.logOperationBegin(operation)
defer computeSystem.logOperationEnd(err)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
completed := false
go syscallWatcher(computeSystem.logctx, &completed)
err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return makeSystemError(computeSystem, "Terminate", "", err, events)
}
return nil
}
// Wait synchronously waits for the compute system to shutdown or terminate.
func (computeSystem *System) Wait() (err error) {
operation := "hcsshim::ComputeSystem::Wait"
computeSystem.logOperationBegin(operation)
defer computeSystem.logOperationEnd(err)
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
if err != nil {
return makeSystemError(computeSystem, "Wait", "", err, nil)
}
return nil
}
// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
// If the timeout expires, IsTimeout(err) == true
func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) {
operation := "hcsshim::ComputeSystem::WaitTimeout"
computeSystem.logOperationBegin(operation)
defer computeSystem.logOperationEnd(err)
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
if err != nil {
return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
}
return nil
}
func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
operation := "hcsshim::ComputeSystem::Properties"
computeSystem.logOperationBegin(operation)
defer computeSystem.logOperationEnd(err)
queryj, err := json.Marshal(schema1.PropertyQuery{types})
if err != nil {
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
}
logrus.WithFields(computeSystem.logctx).
WithField(logfields.JSON, queryj).
Debug("HCS ComputeSystem Properties Query")
var resultp, propertiesp *uint16
completed := false
go syscallWatcher(computeSystem.logctx, &completed)
err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, "Properties", "", err, events)
}
if propertiesp == nil {
return nil, ErrUnexpectedValue
}
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
properties := &schema1.ContainerProperties{}
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
}
return properties, nil
}
// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
func (computeSystem *System) Pause() (err error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
operation := "hcsshim::ComputeSystem::Pause"
computeSystem.logOperationBegin(operation)
defer computeSystem.logOperationEnd(err)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
completed := false
go syscallWatcher(computeSystem.logctx, &completed)
err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
completed = true
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
if err != nil {
return makeSystemError(computeSystem, "Pause", "", err, events)
}
return nil
}
// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
func (computeSystem *System) Resume() (err error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
operation := "hcsshim::ComputeSystem::Resume"
computeSystem.logOperationBegin(operation)
defer computeSystem.logOperationEnd(err)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
completed := false
go syscallWatcher(computeSystem.logctx, &completed)
err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
completed = true
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
if err != nil {
return makeSystemError(computeSystem, "Resume", "", err, events)
}
return nil
}
// CreateProcess launches a new process within the computeSystem.
func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
operation := "hcsshim::ComputeSystem::CreateProcess"
computeSystem.logOperationBegin(operation)
defer computeSystem.logOperationEnd(err)
var (
processInfo hcsProcessInformation
processHandle hcsProcess
resultp *uint16
)
if computeSystem.handle == 0 {
return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
}
configurationb, err := json.Marshal(c)
if err != nil {
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
}
configuration := string(configurationb)
logrus.WithFields(computeSystem.logctx).
WithField(logfields.JSON, configuration).
Debug("HCS ComputeSystem Process Document")
completed := false
go syscallWatcher(computeSystem.logctx, &completed)
err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
}
logrus.WithFields(computeSystem.logctx).
WithField(logfields.ProcessID, processInfo.ProcessId).
Debug("HCS ComputeSystem CreateProcess PID")
process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem)
process.cachedPipes = &cachedPipes{
stdIn: processInfo.StdInput,
stdOut: processInfo.StdOutput,
stdErr: processInfo.StdError,
}
if err = process.registerCallback(); err != nil {
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
}
return process, nil
}
// OpenProcess gets an interface to an existing process within the computeSystem.
func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
// Add PID for the context of this operation
computeSystem.logctx[logfields.ProcessID] = pid
defer delete(computeSystem.logctx, logfields.ProcessID)
operation := "hcsshim::ComputeSystem::OpenProcess"
computeSystem.logOperationBegin(operation)
defer computeSystem.logOperationEnd(err)
var (
processHandle hcsProcess
resultp *uint16
)
if computeSystem.handle == 0 {
return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
}
completed := false
go syscallWatcher(computeSystem.logctx, &completed)
err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
}
process := newProcess(processHandle, pid, computeSystem)
if err = process.registerCallback(); err != nil {
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
}
return process, nil
}
// Close cleans up any state associated with the compute system but does not terminate or wait for it.
func (computeSystem *System) Close() (err error) {
computeSystem.handleLock.Lock()
defer computeSystem.handleLock.Unlock()
operation := "hcsshim::ComputeSystem::Close"
computeSystem.logOperationBegin(operation)
defer computeSystem.logOperationEnd(err)
// Don't double free this
if computeSystem.handle == 0 {
return nil
}
if err = computeSystem.unregisterCallback(); err != nil {
return makeSystemError(computeSystem, "Close", "", err, nil)
}
completed := false
go syscallWatcher(computeSystem.logctx, &completed)
err = hcsCloseComputeSystem(computeSystem.handle)
completed = true
if err != nil {
return makeSystemError(computeSystem, "Close", "", err, nil)
}
computeSystem.handle = 0
return nil
}
func (computeSystem *System) registerCallback() error {
context := &notifcationWatcherContext{
channels: newChannels(),
}
callbackMapLock.Lock()
callbackNumber := nextCallback
nextCallback++
callbackMap[callbackNumber] = context
callbackMapLock.Unlock()
var callbackHandle hcsCallback
err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
if err != nil {
return err
}
context.handle = callbackHandle
computeSystem.callbackNumber = callbackNumber
return nil
}
func (computeSystem *System) unregisterCallback() error {
callbackNumber := computeSystem.callbackNumber
callbackMapLock.RLock()
context := callbackMap[callbackNumber]
callbackMapLock.RUnlock()
if context == nil {
return nil
}
handle := context.handle
if handle == 0 {
return nil
}
// hcsUnregisterComputeSystemCallback has its own syncronization
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
err := hcsUnregisterComputeSystemCallback(handle)
if err != nil {
return err
}
closeChannels(context.channels)
callbackMapLock.Lock()
callbackMap[callbackNumber] = nil
callbackMapLock.Unlock()
handle = 0
return nil
}
// Modify the System by sending a request to HCS
func (computeSystem *System) Modify(config interface{}) (err error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
operation := "hcsshim::ComputeSystem::Modify"
computeSystem.logOperationBegin(operation)
defer computeSystem.logOperationEnd(err)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
}
requestJSON, err := json.Marshal(config)
if err != nil {
return err
}
requestString := string(requestJSON)
logrus.WithFields(computeSystem.logctx).
WithField(logfields.JSON, requestString).
Debug("HCS ComputeSystem Modify Document")
var resultp *uint16
completed := false
go syscallWatcher(computeSystem.logctx, &completed)
err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return makeSystemError(computeSystem, "Modify", requestString, err, events)
}
return nil
}

View File

@ -1,4 +1,4 @@
package hcsshim
package hcs
import (
"io"

View File

@ -1,4 +1,4 @@
package hcsshim
package hcs
import (
"time"
@ -6,13 +6,13 @@ import (
"github.com/sirupsen/logrus"
)
func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
err = processHcsResult(err, resultp)
func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
events := processHcsResult(resultp)
if IsPending(err) {
return waitForNotification(callbackNumber, expectedNotification, timeout)
return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
}
return err
return events, err
}
func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {

View File

@ -0,0 +1,33 @@
package hcs
import (
"time"
"github.com/Microsoft/hcsshim/internal/logfields"
"github.com/Microsoft/hcsshim/internal/timeout"
"github.com/sirupsen/logrus"
)
// syscallWatcher is used as a very simple goroutine around calls into
// the platform. In some cases, we have seen HCS APIs not returning due to
// various bugs, and the goroutine making the syscall ends up not returning,
// prior to its async callback. By spinning up a syscallWatcher, it allows
// us to at least log a warning if a syscall doesn't complete in a reasonable
// amount of time.
//
// Usage is:
//
// completed := false
// go syscallWatcher(context, &completed)
// <syscall>
// completed = true
//
func syscallWatcher(context logrus.Fields, syscallCompleted *bool) {
time.Sleep(timeout.SyscallWatcher)
if *syscallCompleted {
return
}
logrus.WithFields(context).
WithField(logfields.Timeout, timeout.SyscallWatcher).
Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
}

View File

@ -0,0 +1,462 @@
// Code generated mksyscall_windows.exe DO NOT EDIT
package hcs
import (
"syscall"
"unsafe"
"github.com/Microsoft/hcsshim/internal/interop"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems")
procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem")
procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem")
procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem")
procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem")
procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem")
procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem")
procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem")
procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem")
procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties")
procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem")
procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess")
procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess")
procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess")
procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess")
procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo")
procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties")
procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess")
procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties")
procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback")
procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
)
func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(query)
if hr != nil {
return
}
return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
}
func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(configuration)
if hr != nil {
return
}
return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
}
func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
if hr = procHcsCreateComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _hcsOpenComputeSystem(_p0, computeSystem, result)
}
func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
if hr = procHcsOpenComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
if hr = procHcsCloseComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsStartComputeSystem(computeSystem, _p0, result)
}
func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsStartComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsShutdownComputeSystem(computeSystem, _p0, result)
}
func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsTerminateComputeSystem(computeSystem, _p0, result)
}
func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsPauseComputeSystem(computeSystem, _p0, result)
}
func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsPauseComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsResumeComputeSystem(computeSystem, _p0, result)
}
func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsResumeComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
if hr != nil {
return
}
return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
}
func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(configuration)
if hr != nil {
return
}
return _hcsModifyComputeSystem(computeSystem, _p0, result)
}
func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
if hr = procHcsModifyComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(processParameters)
if hr != nil {
return
}
return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
}
func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
if hr = procHcsCreateProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
if hr = procHcsOpenProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCloseProcess(process hcsProcess) (hr error) {
if hr = procHcsCloseProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
if hr = procHcsTerminateProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsSignalProcess(process, _p0, result)
}
func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) {
if hr = procHcsTerminateProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
if hr = procHcsGetProcessInfo.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
if hr = procHcsGetProcessProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(settings)
if hr != nil {
return
}
return _hcsModifyProcess(process, _p0, result)
}
func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
if hr = procHcsModifyProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
if hr != nil {
return
}
return _hcsGetServiceProperties(_p0, properties, result)
}
func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
if hr = procHcsGetServiceProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}

View File

@ -0,0 +1,51 @@
package hcserror
import (
"fmt"
"syscall"
)
const ERROR_GEN_FAILURE = syscall.Errno(31)
type HcsError struct {
title string
rest string
Err error
}
func (e *HcsError) Error() string {
s := e.title
if len(s) > 0 && s[len(s)-1] != ' ' {
s += " "
}
s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err))
if e.rest != "" {
if e.rest[0] != ' ' {
s += " "
}
s += e.rest
}
return s
}
func New(err error, title, rest string) error {
// Pass through DLL errors directly since they do not originate from HCS.
if _, ok := err.(*syscall.DLLError); ok {
return err
}
return &HcsError{title, rest, err}
}
func Errorf(err error, title, format string, a ...interface{}) error {
return New(err, title, fmt.Sprintf(format, a...))
}
func Win32FromError(err error) uint32 {
if herr, ok := err.(*HcsError); ok {
return Win32FromError(herr.Err)
}
if code, ok := err.(syscall.Errno); ok {
return uint32(code)
}
return uint32(ERROR_GEN_FAILURE)
}

View File

@ -0,0 +1,23 @@
package hns
import "fmt"
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go
//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
type EndpointNotFoundError struct {
EndpointName string
}
func (e EndpointNotFoundError) Error() string {
return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
}
type NetworkNotFoundError struct {
NetworkName string
}
func (e NetworkNotFoundError) Error() string {
return fmt.Sprintf("Network %s not found", e.NetworkName)
}

View File

@ -0,0 +1,260 @@
package hns
import (
"encoding/json"
"net"
"github.com/sirupsen/logrus"
)
// HNSEndpoint represents a network endpoint in HNS
type HNSEndpoint struct {
Id string `json:"ID,omitempty"`
Name string `json:",omitempty"`
VirtualNetwork string `json:",omitempty"`
VirtualNetworkName string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
MacAddress string `json:",omitempty"`
IPAddress net.IP `json:",omitempty"`
DNSSuffix string `json:",omitempty"`
DNSServerList string `json:",omitempty"`
GatewayAddress string `json:",omitempty"`
EnableInternalDNS bool `json:",omitempty"`
DisableICC bool `json:",omitempty"`
PrefixLength uint8 `json:",omitempty"`
IsRemoteEndpoint bool `json:",omitempty"`
Namespace *Namespace `json:",omitempty"`
}
//SystemType represents the type of the system on which actions are done
type SystemType string
// SystemType const
const (
ContainerType SystemType = "Container"
VirtualMachineType SystemType = "VirtualMachine"
HostType SystemType = "Host"
)
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type EndpointAttachDetachRequest struct {
ContainerID string `json:"ContainerId,omitempty"`
SystemType SystemType `json:"SystemType"`
CompartmentID uint16 `json:"CompartmentId,omitempty"`
VirtualNICName string `json:"VirtualNicName,omitempty"`
}
// EndpointResquestResponse is object to get the endpoint request response
type EndpointResquestResponse struct {
Success bool
Error string
}
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
endpoint := &HNSEndpoint{}
err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
if err != nil {
return nil, err
}
return endpoint, nil
}
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
var endpoint []HNSEndpoint
err := hnsCall("GET", "/endpoints/", "", &endpoint)
if err != nil {
return nil, err
}
return endpoint, nil
}
// GetHNSEndpointByID get the Endpoint by ID
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
return HNSEndpointRequest("GET", endpointID, "")
}
// GetHNSEndpointByName gets the endpoint filtered by Name
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
hnsResponse, err := HNSListEndpointRequest()
if err != nil {
return nil, err
}
for _, hnsEndpoint := range hnsResponse {
if hnsEndpoint.Name == endpointName {
return &hnsEndpoint, nil
}
}
return nil, EndpointNotFoundError{EndpointName: endpointName}
}
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
operation := "Create"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(endpoint)
if err != nil {
return nil, err
}
return HNSEndpointRequest("POST", "", string(jsonString))
}
// Delete Endpoint by sending EndpointRequest to HNS
func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
operation := "Delete"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
return HNSEndpointRequest("DELETE", endpoint.Id, "")
}
// Update Endpoint
func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
operation := "Update"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(endpoint)
if err != nil {
return nil, err
}
err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
return endpoint, err
}
// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
operation := "ApplyACLPolicy"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
for _, policy := range policies {
if policy == nil {
continue
}
jsonString, err := json.Marshal(policy)
if err != nil {
return err
}
endpoint.Policies = append(endpoint.Policies, jsonString)
}
_, err := endpoint.Update()
return err
}
// ContainerAttach attaches an endpoint to container
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
operation := "ContainerAttach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
ContainerID: containerID,
CompartmentID: compartmentID,
SystemType: ContainerType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// ContainerDetach detaches an endpoint from container
func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
operation := "ContainerDetach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
ContainerID: containerID,
SystemType: ContainerType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
// HostAttach attaches a nic on the host
func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
operation := "HostAttach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
CompartmentID: compartmentID,
SystemType: HostType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// HostDetach detaches a nic on the host
func (endpoint *HNSEndpoint) HostDetach() error {
operation := "HostDetach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
SystemType: HostType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
// VirtualMachineNICAttach attaches a endpoint to a virtual machine
func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
operation := "VirtualMachineNicAttach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
VirtualNICName: virtualMachineNICName,
SystemType: VirtualMachineType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// VirtualMachineNICDetach detaches a endpoint from a virtual machine
func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
operation := "VirtualMachineNicDetach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
SystemType: VirtualMachineType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}

View File

@ -1,9 +1,11 @@
package hcsshim
package hns
import (
"encoding/json"
"fmt"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
@ -13,9 +15,9 @@ func hnsCall(method, path, request string, returnResponse interface{}) error {
err := _hnsCall(method, path, request, &responseBuffer)
if err != nil {
return makeError(err, "hnsCall ", "")
return hcserror.New(err, "hnsCall ", "")
}
response := convertAndFreeCoTaskMemString(responseBuffer)
response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
hnsresponse := &hnsResponse{}
if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {

View File

@ -0,0 +1,28 @@
package hns
type HNSGlobals struct {
Version HNSVersion `json:"Version"`
}
type HNSVersion struct {
Major int `json:"Major"`
Minor int `json:"Minor"`
}
var (
HNSVersion1803 = HNSVersion{Major: 7, Minor: 2}
)
func GetHNSGlobals() (*HNSGlobals, error) {
var version HNSVersion
err := hnsCall("GET", "/globals/version", "", &version)
if err != nil {
return nil, err
}
globals := &HNSGlobals{
Version: version,
}
return globals, nil
}

View File

@ -0,0 +1,141 @@
package hns
import (
"encoding/json"
"net"
"github.com/sirupsen/logrus"
)
// Subnet is assoicated with a network and represents a list
// of subnets available to the network
type Subnet struct {
AddressPrefix string `json:",omitempty"`
GatewayAddress string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
}
// MacPool is assoicated with a network and represents a list
// of macaddresses available to the network
type MacPool struct {
StartMacAddress string `json:",omitempty"`
EndMacAddress string `json:",omitempty"`
}
// HNSNetwork represents a network in HNS
type HNSNetwork struct {
Id string `json:"ID,omitempty"`
Name string `json:",omitempty"`
Type string `json:",omitempty"`
NetworkAdapterName string `json:",omitempty"`
SourceMac string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
MacPools []MacPool `json:",omitempty"`
Subnets []Subnet `json:",omitempty"`
DNSSuffix string `json:",omitempty"`
DNSServerList string `json:",omitempty"`
DNSServerCompartment uint32 `json:",omitempty"`
ManagementIP string `json:",omitempty"`
AutomaticDNS bool `json:",omitempty"`
}
type hnsNetworkResponse struct {
Success bool
Error string
Output HNSNetwork
}
type hnsResponse struct {
Success bool
Error string
Output json.RawMessage
}
// HNSNetworkRequest makes a call into HNS to update/query a single network
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
var network HNSNetwork
err := hnsCall(method, "/networks/"+path, request, &network)
if err != nil {
return nil, err
}
return &network, nil
}
// HNSListNetworkRequest makes a HNS call to query the list of available networks
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
var network []HNSNetwork
err := hnsCall(method, "/networks/"+path, request, &network)
if err != nil {
return nil, err
}
return network, nil
}
// GetHNSNetworkByID
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
return HNSNetworkRequest("GET", networkID, "")
}
// GetHNSNetworkName filtered by Name
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
if err != nil {
return nil, err
}
for _, hnsnetwork := range hsnnetworks {
if hnsnetwork.Name == networkName {
return &hnsnetwork, nil
}
}
return nil, NetworkNotFoundError{NetworkName: networkName}
}
// Create Network by sending NetworkRequest to HNS.
func (network *HNSNetwork) Create() (*HNSNetwork, error) {
operation := "Create"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
jsonString, err := json.Marshal(network)
if err != nil {
return nil, err
}
return HNSNetworkRequest("POST", "", string(jsonString))
}
// Delete Network by sending NetworkRequest to HNS
func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
operation := "Delete"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
return HNSNetworkRequest("DELETE", network.Id, "")
}
// Creates an endpoint on the Network.
func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
return &HNSEndpoint{
VirtualNetwork: network.Id,
IPAddress: ipAddress,
MacAddress: string(macAddress),
}
}
func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
operation := "CreateEndpoint"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
endpoint.VirtualNetwork = network.Id
return endpoint.Create()
}
func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
operation := "CreateRemoteEndpoint"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
endpoint.IsRemoteEndpoint = true
return network.CreateEndpoint(endpoint)
}

View File

@ -0,0 +1,98 @@
package hns
// Type of Request Support in ModifySystem
type PolicyType string
// RequestType const
const (
Nat PolicyType = "NAT"
ACL PolicyType = "ACL"
PA PolicyType = "PA"
VLAN PolicyType = "VLAN"
VSID PolicyType = "VSID"
VNet PolicyType = "VNET"
L2Driver PolicyType = "L2Driver"
Isolation PolicyType = "Isolation"
QOS PolicyType = "QOS"
OutboundNat PolicyType = "OutBoundNAT"
ExternalLoadBalancer PolicyType = "ELB"
Route PolicyType = "ROUTE"
)
type NatPolicy struct {
Type PolicyType `json:"Type"`
Protocol string
InternalPort uint16
ExternalPort uint16
}
type QosPolicy struct {
Type PolicyType `json:"Type"`
MaximumOutgoingBandwidthInBytes uint64
}
type IsolationPolicy struct {
Type PolicyType `json:"Type"`
VLAN uint
VSID uint
InDefaultIsolation bool
}
type VlanPolicy struct {
Type PolicyType `json:"Type"`
VLAN uint
}
type VsidPolicy struct {
Type PolicyType `json:"Type"`
VSID uint
}
type PaPolicy struct {
Type PolicyType `json:"Type"`
PA string `json:"PA"`
}
type OutboundNatPolicy struct {
Policy
VIP string `json:"VIP,omitempty"`
Exceptions []string `json:"ExceptionList,omitempty"`
}
type ActionType string
type DirectionType string
type RuleType string
const (
Allow ActionType = "Allow"
Block ActionType = "Block"
In DirectionType = "In"
Out DirectionType = "Out"
Host RuleType = "Host"
Switch RuleType = "Switch"
)
type ACLPolicy struct {
Type PolicyType `json:"Type"`
Id string `json:"Id,omitempty"`
Protocol uint16
Protocols string `json:"Protocols,omitempty"`
InternalPort uint16
Action ActionType
Direction DirectionType
LocalAddresses string
RemoteAddresses string
LocalPorts string `json:"LocalPorts,omitempty"`
LocalPort uint16
RemotePorts string `json:"RemotePorts,omitempty"`
RemotePort uint16
RuleType RuleType `json:"RuleType,omitempty"`
Priority uint16
ServiceName string
}
type Policy struct {
Type PolicyType `json:"Type"`
}

View File

@ -0,0 +1,201 @@
package hns
import (
"encoding/json"
"github.com/sirupsen/logrus"
)
// RoutePolicy is a structure defining schema for Route based Policy
type RoutePolicy struct {
Policy
DestinationPrefix string `json:"DestinationPrefix,omitempty"`
NextHop string `json:"NextHop,omitempty"`
EncapEnabled bool `json:"NeedEncap,omitempty"`
}
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
type ELBPolicy struct {
LBPolicy
SourceVIP string `json:"SourceVIP,omitempty"`
VIPs []string `json:"VIPs,omitempty"`
ILB bool `json:"ILB,omitempty"`
DSR bool `json:"IsDSR,omitempty"`
}
// LBPolicy is a structure defining schema for LoadBalancing based Policy
type LBPolicy struct {
Policy
Protocol uint16 `json:"Protocol,omitempty"`
InternalPort uint16
ExternalPort uint16
}
// PolicyList is a structure defining schema for Policy list request
type PolicyList struct {
ID string `json:"ID,omitempty"`
EndpointReferences []string `json:"References,omitempty"`
Policies []json.RawMessage `json:"Policies,omitempty"`
}
// HNSPolicyListRequest makes a call into HNS to update/query a single network
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
var policy PolicyList
err := hnsCall(method, "/policylists/"+path, request, &policy)
if err != nil {
return nil, err
}
return &policy, nil
}
// HNSListPolicyListRequest gets all the policy list
func HNSListPolicyListRequest() ([]PolicyList, error) {
var plist []PolicyList
err := hnsCall("GET", "/policylists/", "", &plist)
if err != nil {
return nil, err
}
return plist, nil
}
// PolicyListRequest makes a HNS call to modify/query a network policy list
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
policylist := &PolicyList{}
err := hnsCall(method, "/policylists/"+path, request, &policylist)
if err != nil {
return nil, err
}
return policylist, nil
}
// GetPolicyListByID get the policy list by ID
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
return PolicyListRequest("GET", policyListID, "")
}
// Create PolicyList by sending PolicyListRequest to HNS.
func (policylist *PolicyList) Create() (*PolicyList, error) {
operation := "Create"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s", policylist.ID)
jsonString, err := json.Marshal(policylist)
if err != nil {
return nil, err
}
return PolicyListRequest("POST", "", string(jsonString))
}
// Delete deletes PolicyList
func (policylist *PolicyList) Delete() (*PolicyList, error) {
operation := "Delete"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s", policylist.ID)
return PolicyListRequest("DELETE", policylist.ID, "")
}
// AddEndpoint add an endpoint to a Policy List
func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
operation := "AddEndpoint"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
_, err := policylist.Delete()
if err != nil {
return nil, err
}
// Add Endpoint to the Existing List
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
return policylist.Create()
}
// RemoveEndpoint removes an endpoint from the Policy List
func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
operation := "RemoveEndpoint"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
_, err := policylist.Delete()
if err != nil {
return nil, err
}
elementToRemove := "/endpoints/" + endpoint.Id
var references []string
for _, endpointReference := range policylist.EndpointReferences {
if endpointReference == elementToRemove {
continue
}
references = append(references, endpointReference)
}
policylist.EndpointReferences = references
return policylist.Create()
}
// AddLoadBalancer policy list for the specified endpoints
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
operation := "AddLoadBalancer"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
policylist := &PolicyList{}
elbPolicy := &ELBPolicy{
SourceVIP: sourceVIP,
ILB: isILB,
}
if len(vip) > 0 {
elbPolicy.VIPs = []string{vip}
}
elbPolicy.Type = ExternalLoadBalancer
elbPolicy.Protocol = protocol
elbPolicy.InternalPort = internalPort
elbPolicy.ExternalPort = externalPort
for _, endpoint := range endpoints {
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
}
jsonString, err := json.Marshal(elbPolicy)
if err != nil {
return nil, err
}
policylist.Policies = append(policylist.Policies, jsonString)
return policylist.Create()
}
// AddRoute adds route policy list for the specified endpoints
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
operation := "AddRoute"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
policylist := &PolicyList{}
rPolicy := &RoutePolicy{
DestinationPrefix: destinationPrefix,
NextHop: nextHop,
EncapEnabled: encapEnabled,
}
rPolicy.Type = Route
for _, endpoint := range endpoints {
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
}
jsonString, err := json.Marshal(rPolicy)
if err != nil {
return nil, err
}
policylist.Policies = append(policylist.Policies, jsonString)
return policylist.Create()
}

View File

@ -0,0 +1,49 @@
package hns
import (
"github.com/sirupsen/logrus"
)
type HNSSupportedFeatures struct {
Acl HNSAclFeatures `json:"ACL"`
}
type HNSAclFeatures struct {
AclAddressLists bool `json:"AclAddressLists"`
AclNoHostRulePriority bool `json:"AclHostRulePriority"`
AclPortRanges bool `json:"AclPortRanges"`
AclRuleId bool `json:"AclRuleId"`
}
func GetHNSSupportedFeatures() HNSSupportedFeatures {
var hnsFeatures HNSSupportedFeatures
globals, err := GetHNSGlobals()
if err != nil {
// Expected on pre-1803 builds, all features will be false/unsupported
logrus.Debugf("Unable to obtain HNS globals: %s", err)
return hnsFeatures
}
hnsFeatures.Acl = HNSAclFeatures{
AclAddressLists: isHNSFeatureSupported(globals.Version, HNSVersion1803),
AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803),
AclPortRanges: isHNSFeatureSupported(globals.Version, HNSVersion1803),
AclRuleId: isHNSFeatureSupported(globals.Version, HNSVersion1803),
}
return hnsFeatures
}
func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool {
if currentVersion.Major < minVersionSupported.Major {
return false
}
if currentVersion.Major > minVersionSupported.Major {
return true
}
if currentVersion.Minor < minVersionSupported.Minor {
return false
}
return true
}

View File

@ -0,0 +1,110 @@
package hns
import (
"encoding/json"
"fmt"
"os"
"path"
"strings"
)
type namespaceRequest struct {
IsDefault bool `json:",omitempty"`
}
type namespaceEndpointRequest struct {
ID string `json:"Id"`
}
type NamespaceResource struct {
Type string
Data json.RawMessage
}
type namespaceResourceRequest struct {
Type string
Data interface{}
}
type Namespace struct {
ID string
IsDefault bool `json:",omitempty"`
ResourceList []NamespaceResource `json:",omitempty"`
}
func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) {
var err error
hnspath := "/namespaces/"
if id != nil {
hnspath = path.Join(hnspath, *id)
}
if subpath != "" {
hnspath = path.Join(hnspath, subpath)
}
var reqJSON []byte
if request != nil {
if reqJSON, err = json.Marshal(request); err != nil {
return nil, err
}
}
var ns Namespace
err = hnsCall(method, hnspath, string(reqJSON), &ns)
if err != nil {
if strings.Contains(err.Error(), "Element not found.") {
return nil, os.ErrNotExist
}
return nil, fmt.Errorf("%s %s: %s", method, hnspath, err)
}
return &ns, err
}
func CreateNamespace() (string, error) {
req := namespaceRequest{}
ns, err := issueNamespaceRequest(nil, "POST", "", &req)
if err != nil {
return "", err
}
return ns.ID, nil
}
func RemoveNamespace(id string) error {
_, err := issueNamespaceRequest(&id, "DELETE", "", nil)
return err
}
func GetNamespaceEndpoints(id string) ([]string, error) {
ns, err := issueNamespaceRequest(&id, "GET", "", nil)
if err != nil {
return nil, err
}
var endpoints []string
for _, rsrc := range ns.ResourceList {
if rsrc.Type == "Endpoint" {
var endpoint namespaceEndpointRequest
err = json.Unmarshal(rsrc.Data, &endpoint)
if err != nil {
return nil, fmt.Errorf("unmarshal endpoint: %s", err)
}
endpoints = append(endpoints, endpoint.ID)
}
}
return endpoints, nil
}
func AddNamespaceEndpoint(id string, endpointID string) error {
resource := namespaceResourceRequest{
Type: "Endpoint",
Data: namespaceEndpointRequest{endpointID},
}
_, err := issueNamespaceRequest(&id, "POST", "addresource", &resource)
return err
}
func RemoveNamespaceEndpoint(id string, endpointID string) error {
resource := namespaceResourceRequest{
Type: "Endpoint",
Data: namespaceEndpointRequest{endpointID},
}
_, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource)
return err
}

View File

@ -0,0 +1,74 @@
// Code generated mksyscall_windows.exe DO NOT EDIT
package hns
import (
"syscall"
"unsafe"
"github.com/Microsoft/hcsshim/internal/interop"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
procHNSCall = modvmcompute.NewProc("HNSCall")
)
func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(method)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
var _p2 *uint16
_p2, hr = syscall.UTF16PtrFromString(object)
if hr != nil {
return
}
return __hnsCall(_p0, _p1, _p2, response)
}
func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
if hr = procHNSCall.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}

View File

@ -0,0 +1,27 @@
package interop
import (
"syscall"
"unsafe"
)
//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go interop.go
//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree
func ConvertAndFreeCoTaskMemString(buffer *uint16) string {
str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:])
coTaskMemFree(unsafe.Pointer(buffer))
return str
}
func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
return []byte(ConvertAndFreeCoTaskMemString(buffer))
}
func Win32FromHresult(hr uintptr) syscall.Errno {
if hr&0x1fff0000 == 0x00070000 {
return syscall.Errno(hr & 0xffff)
}
return syscall.Errno(hr)
}

View File

@ -0,0 +1,48 @@
// Code generated by 'go generate'; DO NOT EDIT.
package interop
import (
"syscall"
"unsafe"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modole32 = windows.NewLazySystemDLL("ole32.dll")
procCoTaskMemFree = modole32.NewProc("CoTaskMemFree")
)
func coTaskMemFree(buffer unsafe.Pointer) {
syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0)
return
}

View File

@ -0,0 +1,37 @@
package logfields
const (
// Identifiers
ContainerID = "cid"
UVMID = "uvm-id"
ProcessID = "pid"
// Common Misc
// Timeout represents an operation timeout.
Timeout = "timeout"
JSON = "json"
// Keys/values
Field = "field"
OCIAnnotation = "oci-annotation"
Value = "value"
// Golang type's
ExpectedType = "expected-type"
Bool = "bool"
Uint32 = "uint32"
Uint64 = "uint64"
// HCS
HCSOperation = "hcs-op"
HCSOperationResult = "hcs-op-result"
// runhcs
VMShimOperation = "vmshim-op"
)

View File

@ -0,0 +1,24 @@
package longpath
import (
"path/filepath"
"strings"
)
// LongAbs makes a path absolute and returns it in NT long path form.
func LongAbs(path string) (string, error) {
if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
return path, nil
}
if !filepath.IsAbs(path) {
absPath, err := filepath.Abs(path)
if err != nil {
return "", err
}
path = absPath
}
if strings.HasPrefix(path, `\\`) {
return `\\?\UNC\` + path[2:], nil
}
return `\\?\` + path, nil
}

View File

@ -0,0 +1,52 @@
package mergemaps
import "encoding/json"
// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
// in ToMap are overwritten. Values in fromMap are added to ToMap.
// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
func Merge(fromMap, ToMap interface{}) interface{} {
switch fromMap := fromMap.(type) {
case map[string]interface{}:
ToMap, ok := ToMap.(map[string]interface{})
if !ok {
return fromMap
}
for keyToMap, valueToMap := range ToMap {
if valueFromMap, ok := fromMap[keyToMap]; ok {
fromMap[keyToMap] = Merge(valueFromMap, valueToMap)
} else {
fromMap[keyToMap] = valueToMap
}
}
case nil:
// merge(nil, map[string]interface{...}) -> map[string]interface{...}
ToMap, ok := ToMap.(map[string]interface{})
if ok {
return ToMap
}
}
return fromMap
}
// MergeJSON merges the contents of a JSON string into an object representation,
// returning a new object suitable for translating to JSON.
func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) {
if len(additionalJSON) == 0 {
return object, nil
}
objectJSON, err := json.Marshal(object)
if err != nil {
return nil, err
}
var objectMap, newMap map[string]interface{}
err = json.Unmarshal(objectJSON, &objectMap)
if err != nil {
return nil, err
}
err = json.Unmarshal(additionalJSON, &newMap)
if err != nil {
return nil, err
}
return Merge(newMap, objectMap), nil
}

View File

@ -0,0 +1,431 @@
package safefile
import (
"errors"
"io"
"os"
"path/filepath"
"strings"
"syscall"
"unicode/utf16"
"unsafe"
"github.com/Microsoft/hcsshim/internal/longpath"
winio "github.com/Microsoft/go-winio"
)
//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go
//sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile
//sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile
//sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb
//sys localAlloc(flags uint32, size int) (ptr uintptr) = kernel32.LocalAlloc
//sys localFree(ptr uintptr) = kernel32.LocalFree
type ioStatusBlock struct {
Status, Information uintptr
}
type objectAttributes struct {
Length uintptr
RootDirectory uintptr
ObjectName uintptr
Attributes uintptr
SecurityDescriptor uintptr
SecurityQoS uintptr
}
type unicodeString struct {
Length uint16
MaximumLength uint16
Buffer uintptr
}
type fileLinkInformation struct {
ReplaceIfExists bool
RootDirectory uintptr
FileNameLength uint32
FileName [1]uint16
}
type fileDispositionInformationEx struct {
Flags uintptr
}
const (
_FileLinkInformation = 11
_FileDispositionInformationEx = 64
FILE_READ_ATTRIBUTES = 0x0080
FILE_WRITE_ATTRIBUTES = 0x0100
DELETE = 0x10000
FILE_OPEN = 1
FILE_CREATE = 2
FILE_DIRECTORY_FILE = 0x00000001
FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020
FILE_DELETE_ON_CLOSE = 0x00001000
FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000
FILE_OPEN_REPARSE_POINT = 0x00200000
FILE_DISPOSITION_DELETE = 0x00000001
_OBJ_DONT_REPARSE = 0x1000
_STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B
)
func OpenRoot(path string) (*os.File, error) {
longpath, err := longpath.LongAbs(path)
if err != nil {
return nil, err
}
return winio.OpenForBackup(longpath, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.OPEN_EXISTING)
}
func ntRelativePath(path string) ([]uint16, error) {
path = filepath.Clean(path)
if strings.Contains(":", path) {
// Since alternate data streams must follow the file they
// are attached to, finding one here (out of order) is invalid.
return nil, errors.New("path contains invalid character `:`")
}
fspath := filepath.FromSlash(path)
if len(fspath) > 0 && fspath[0] == '\\' {
return nil, errors.New("expected relative path")
}
path16 := utf16.Encode(([]rune)(fspath))
if len(path16) > 32767 {
return nil, syscall.ENAMETOOLONG
}
return path16, nil
}
// openRelativeInternal opens a relative path from the given root, failing if
// any of the intermediate path components are reparse points.
func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
var (
h uintptr
iosb ioStatusBlock
oa objectAttributes
)
path16, err := ntRelativePath(path)
if err != nil {
return nil, err
}
if root == nil || root.Fd() == 0 {
return nil, errors.New("missing root directory")
}
upathBuffer := localAlloc(0, int(unsafe.Sizeof(unicodeString{}))+len(path16)*2)
defer localFree(upathBuffer)
upath := (*unicodeString)(unsafe.Pointer(upathBuffer))
upath.Length = uint16(len(path16) * 2)
upath.MaximumLength = upath.Length
upath.Buffer = upathBuffer + unsafe.Sizeof(*upath)
copy((*[32768]uint16)(unsafe.Pointer(upath.Buffer))[:], path16)
oa.Length = unsafe.Sizeof(oa)
oa.ObjectName = upathBuffer
oa.RootDirectory = uintptr(root.Fd())
oa.Attributes = _OBJ_DONT_REPARSE
status := ntCreateFile(
&h,
accessMask|syscall.SYNCHRONIZE,
&oa,
&iosb,
nil,
0,
shareFlags,
createDisposition,
FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags,
nil,
0,
)
if status != 0 {
return nil, rtlNtStatusToDosError(status)
}
fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path))
if err != nil {
syscall.Close(syscall.Handle(h))
return nil, err
}
return os.NewFile(h, fullPath), nil
}
// OpenRelative opens a relative path from the given root, failing if
// any of the intermediate path components are reparse points.
func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags)
if err != nil {
err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err}
}
return f, err
}
// LinkRelative creates a hard link from oldname to newname (relative to oldroot
// and newroot), failing if any of the intermediate path components are reparse
// points.
func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error {
// Open the old file.
oldf, err := openRelativeInternal(
oldname,
oldroot,
syscall.FILE_WRITE_ATTRIBUTES,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
FILE_OPEN,
0,
)
if err != nil {
return &os.LinkError{Op: "link", Old: filepath.Join(oldroot.Name(), oldname), New: filepath.Join(newroot.Name(), newname), Err: err}
}
defer oldf.Close()
// Open the parent of the new file.
var parent *os.File
parentPath := filepath.Dir(newname)
if parentPath != "." {
parent, err = openRelativeInternal(
parentPath,
newroot,
syscall.GENERIC_READ,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
FILE_OPEN,
FILE_DIRECTORY_FILE)
if err != nil {
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err}
}
defer parent.Close()
fi, err := winio.GetFileBasicInfo(parent)
if err != nil {
return err
}
if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 {
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: rtlNtStatusToDosError(_STATUS_REPARSE_POINT_ENCOUNTERED)}
}
} else {
parent = newroot
}
// Issue an NT call to create the link. This will be safe because NT will
// not open any more directories to create the link, so it cannot walk any
// more reparse points.
newbase := filepath.Base(newname)
newbase16, err := ntRelativePath(newbase)
if err != nil {
return err
}
size := int(unsafe.Offsetof(fileLinkInformation{}.FileName)) + len(newbase16)*2
linkinfoBuffer := localAlloc(0, size)
defer localFree(linkinfoBuffer)
linkinfo := (*fileLinkInformation)(unsafe.Pointer(linkinfoBuffer))
linkinfo.RootDirectory = parent.Fd()
linkinfo.FileNameLength = uint32(len(newbase16) * 2)
copy((*[32768]uint16)(unsafe.Pointer(&linkinfo.FileName[0]))[:], newbase16)
var iosb ioStatusBlock
status := ntSetInformationFile(
oldf.Fd(),
&iosb,
linkinfoBuffer,
uint32(size),
_FileLinkInformation,
)
if status != 0 {
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(parent.Name(), newbase), Err: rtlNtStatusToDosError(status)}
}
return nil
}
// deleteOnClose marks a file to be deleted when the handle is closed.
func deleteOnClose(f *os.File) error {
disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE}
var iosb ioStatusBlock
status := ntSetInformationFile(
f.Fd(),
&iosb,
uintptr(unsafe.Pointer(&disposition)),
uint32(unsafe.Sizeof(disposition)),
_FileDispositionInformationEx,
)
if status != 0 {
return rtlNtStatusToDosError(status)
}
return nil
}
// clearReadOnly clears the readonly attribute on a file.
func clearReadOnly(f *os.File) error {
bi, err := winio.GetFileBasicInfo(f)
if err != nil {
return err
}
if bi.FileAttributes&syscall.FILE_ATTRIBUTE_READONLY == 0 {
return nil
}
sbi := winio.FileBasicInfo{
FileAttributes: bi.FileAttributes &^ syscall.FILE_ATTRIBUTE_READONLY,
}
if sbi.FileAttributes == 0 {
sbi.FileAttributes = syscall.FILE_ATTRIBUTE_NORMAL
}
return winio.SetFileBasicInfo(f, &sbi)
}
// RemoveRelative removes a file or directory relative to a root, failing if any
// intermediate path components are reparse points.
func RemoveRelative(path string, root *os.File) error {
f, err := openRelativeInternal(
path,
root,
FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
FILE_OPEN,
FILE_OPEN_REPARSE_POINT)
if err == nil {
defer f.Close()
err = deleteOnClose(f)
if err == syscall.ERROR_ACCESS_DENIED {
// Maybe the file is marked readonly. Clear the bit and retry.
clearReadOnly(f)
err = deleteOnClose(f)
}
}
if err != nil {
return &os.PathError{Op: "remove", Path: filepath.Join(root.Name(), path), Err: err}
}
return nil
}
// RemoveAllRelative removes a directory tree relative to a root, failing if any
// intermediate path components are reparse points.
func RemoveAllRelative(path string, root *os.File) error {
fi, err := LstatRelative(path, root)
if err != nil {
if os.IsNotExist(err) {
return nil
}
return err
}
fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes
if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 {
// If this is a reparse point, it can't have children. Simple remove will do.
err := RemoveRelative(path, root)
if err == nil || os.IsNotExist(err) {
return nil
}
return err
}
// It is necessary to use os.Open as Readdirnames does not work with
// OpenRelative. This is safe because the above lstatrelative fails
// if the target is outside the root, and we know this is not a
// symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check.
fd, err := os.Open(filepath.Join(root.Name(), path))
if err != nil {
if os.IsNotExist(err) {
// Race. It was deleted between the Lstat and Open.
// Return nil per RemoveAll's docs.
return nil
}
return err
}
// Remove contents & return first error.
for {
names, err1 := fd.Readdirnames(100)
for _, name := range names {
err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root)
if err == nil {
err = err1
}
}
if err1 == io.EOF {
break
}
// If Readdirnames returned an error, use it.
if err == nil {
err = err1
}
if len(names) == 0 {
break
}
}
fd.Close()
// Remove directory.
err1 := RemoveRelative(path, root)
if err1 == nil || os.IsNotExist(err1) {
return nil
}
if err == nil {
err = err1
}
return err
}
// MkdirRelative creates a directory relative to a root, failing if any
// intermediate path components are reparse points.
func MkdirRelative(path string, root *os.File) error {
f, err := openRelativeInternal(
path,
root,
0,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
FILE_CREATE,
FILE_DIRECTORY_FILE)
if err == nil {
f.Close()
} else {
err = &os.PathError{Op: "mkdir", Path: filepath.Join(root.Name(), path), Err: err}
}
return err
}
// LstatRelative performs a stat operation on a file relative to a root, failing
// if any intermediate path components are reparse points.
func LstatRelative(path string, root *os.File) (os.FileInfo, error) {
f, err := openRelativeInternal(
path,
root,
FILE_READ_ATTRIBUTES,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
FILE_OPEN,
FILE_OPEN_REPARSE_POINT)
if err != nil {
return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err}
}
defer f.Close()
return f.Stat()
}
// EnsureNotReparsePointRelative validates that a given file (relative to a
// root) and all intermediate path components are not a reparse points.
func EnsureNotReparsePointRelative(path string, root *os.File) error {
// Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT.
f, err := OpenRelative(
path,
root,
0,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
FILE_OPEN,
0)
if err != nil {
return err
}
f.Close()
return nil
}

View File

@ -0,0 +1,79 @@
// Code generated by 'go generate'; DO NOT EDIT.
package safefile
import (
"syscall"
"unsafe"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modntdll = windows.NewLazySystemDLL("ntdll.dll")
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
procNtCreateFile = modntdll.NewProc("NtCreateFile")
procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile")
procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb")
procLocalAlloc = modkernel32.NewProc("LocalAlloc")
procLocalFree = modkernel32.NewProc("LocalFree")
)
func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) {
r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0)
status = uint32(r0)
return
}
func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) {
r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0)
status = uint32(r0)
return
}
func rtlNtStatusToDosError(status uint32) (winerr error) {
r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0)
if r0 != 0 {
winerr = syscall.Errno(r0)
}
return
}
func localAlloc(flags uint32, size int) (ptr uintptr) {
r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0)
ptr = uintptr(r0)
return
}
func localFree(ptr uintptr) {
syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0)
return
}

View File

@ -0,0 +1,245 @@
package schema1
import (
"encoding/json"
"time"
"github.com/Microsoft/hcsshim/internal/schema2"
)
// ProcessConfig is used as both the input of Container.CreateProcess
// and to convert the parameters to JSON for passing onto the HCS
type ProcessConfig struct {
ApplicationName string `json:",omitempty"`
CommandLine string `json:",omitempty"`
CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows
User string `json:",omitempty"`
WorkingDirectory string `json:",omitempty"`
Environment map[string]string `json:",omitempty"`
EmulateConsole bool `json:",omitempty"`
CreateStdInPipe bool `json:",omitempty"`
CreateStdOutPipe bool `json:",omitempty"`
CreateStdErrPipe bool `json:",omitempty"`
ConsoleSize [2]uint `json:",omitempty"`
CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows
OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows
}
type Layer struct {
ID string
Path string
}
type MappedDir struct {
HostPath string
ContainerPath string
ReadOnly bool
BandwidthMaximum uint64
IOPSMaximum uint64
CreateInUtilityVM bool
// LinuxMetadata - Support added in 1803/RS4+.
LinuxMetadata bool `json:",omitempty"`
}
type MappedPipe struct {
HostPath string
ContainerPipeName string
}
type HvRuntime struct {
ImagePath string `json:",omitempty"`
SkipTemplate bool `json:",omitempty"`
LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD
}
type MappedVirtualDisk struct {
HostPath string `json:",omitempty"` // Path to VHD on the host
ContainerPath string // Platform-specific mount point path in the container
CreateInUtilityVM bool `json:",omitempty"`
ReadOnly bool `json:",omitempty"`
Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
AttachOnly bool `json:",omitempty:`
}
// AssignedDevice represents a device that has been directly assigned to a container
//
// NOTE: Support added in RS5
type AssignedDevice struct {
// InterfaceClassGUID of the device to assign to container.
InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"`
}
// ContainerConfig is used as both the input of CreateContainer
// and to convert the parameters to JSON for passing onto the HCS
type ContainerConfig struct {
SystemType string // HCS requires this to be hard-coded to "Container"
Name string // Name of the container. We use the docker ID.
Owner string `json:",omitempty"` // The management platform that created this container
VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows
LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID
Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
Credentials string `json:",omitempty"` // Credentials information
ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container.
ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS
StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes
HostName string `json:",omitempty"` // Hostname
MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts)
MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes
HvPartition bool // True if it a Hyper-V Container
NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container
HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
Servicing bool `json:",omitempty"` // True if this container is for servicing
AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution
DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
AssignedDevices []AssignedDevice `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5
}
type ComputeSystemQuery struct {
IDs []string `json:"Ids,omitempty"`
Types []string `json:",omitempty"`
Names []string `json:",omitempty"`
Owners []string `json:",omitempty"`
}
type PropertyType string
const (
PropertyTypeStatistics PropertyType = "Statistics" // V1 and V2
PropertyTypeProcessList = "ProcessList" // V1 and V2
PropertyTypeMappedVirtualDisk = "MappedVirtualDisk" // Not supported in V2 schema call
PropertyTypeGuestConnection = "GuestConnection" // V1 and V2. Nil return from HCS before RS5
)
type PropertyQuery struct {
PropertyTypes []PropertyType `json:",omitempty"`
}
// ContainerProperties holds the properties for a container and the processes running in that container
type ContainerProperties struct {
ID string `json:"Id"`
State string
Name string
SystemType string
Owner string
SiloGUID string `json:"SiloGuid,omitempty"`
RuntimeID string `json:"RuntimeId,omitempty"`
IsRuntimeTemplate bool `json:",omitempty"`
RuntimeImagePath string `json:",omitempty"`
Stopped bool `json:",omitempty"`
ExitType string `json:",omitempty"`
AreUpdatesPending bool `json:",omitempty"`
ObRoot string `json:",omitempty"`
Statistics Statistics `json:",omitempty"`
ProcessList []ProcessListItem `json:",omitempty"`
MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
GuestConnectionInfo GuestConnectionInfo `json:",omitempty"`
}
// MemoryStats holds the memory statistics for a container
type MemoryStats struct {
UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"`
UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
}
// ProcessorStats holds the processor statistics for a container
type ProcessorStats struct {
TotalRuntime100ns uint64 `json:",omitempty"`
RuntimeUser100ns uint64 `json:",omitempty"`
RuntimeKernel100ns uint64 `json:",omitempty"`
}
// StorageStats holds the storage statistics for a container
type StorageStats struct {
ReadCountNormalized uint64 `json:",omitempty"`
ReadSizeBytes uint64 `json:",omitempty"`
WriteCountNormalized uint64 `json:",omitempty"`
WriteSizeBytes uint64 `json:",omitempty"`
}
// NetworkStats holds the network statistics for a container
type NetworkStats struct {
BytesReceived uint64 `json:",omitempty"`
BytesSent uint64 `json:",omitempty"`
PacketsReceived uint64 `json:",omitempty"`
PacketsSent uint64 `json:",omitempty"`
DroppedPacketsIncoming uint64 `json:",omitempty"`
DroppedPacketsOutgoing uint64 `json:",omitempty"`
EndpointId string `json:",omitempty"`
InstanceId string `json:",omitempty"`
}
// Statistics is the structure returned by a statistics call on a container
type Statistics struct {
Timestamp time.Time `json:",omitempty"`
ContainerStartTime time.Time `json:",omitempty"`
Uptime100ns uint64 `json:",omitempty"`
Memory MemoryStats `json:",omitempty"`
Processor ProcessorStats `json:",omitempty"`
Storage StorageStats `json:",omitempty"`
Network []NetworkStats `json:",omitempty"`
}
// ProcessList is the structure of an item returned by a ProcessList call on a container
type ProcessListItem struct {
CreateTimestamp time.Time `json:",omitempty"`
ImageName string `json:",omitempty"`
KernelTime100ns uint64 `json:",omitempty"`
MemoryCommitBytes uint64 `json:",omitempty"`
MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"`
MemoryWorkingSetSharedBytes uint64 `json:",omitempty"`
ProcessId uint32 `json:",omitempty"`
UserTime100ns uint64 `json:",omitempty"`
}
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
type MappedVirtualDiskController struct {
MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
}
// GuestDefinedCapabilities is part of the GuestConnectionInfo returned by a GuestConnection call on a utility VM
type GuestDefinedCapabilities struct {
NamespaceAddRequestSupported bool `json:",omitempty"`
SignalProcessSupported bool `json:",omitempty"`
}
// GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM
type GuestConnectionInfo struct {
SupportedSchemaVersions []hcsschema.Version `json:",omitempty"`
ProtocolVersion uint32 `json:",omitempty"`
GuestDefinedCapabilities GuestDefinedCapabilities `json:",omitempty"`
}
// Type of Request Support in ModifySystem
type RequestType string
// Type of Resource Support in ModifySystem
type ResourceType string
// RequestType const
const (
Add RequestType = "Add"
Remove RequestType = "Remove"
Network ResourceType = "Network"
)
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type ResourceModificationRequestResponse struct {
Resource ResourceType `json:"ResourceType"`
Data interface{} `json:"Settings"`
Request RequestType `json:"RequestType,omitempty"`
}

View File

@ -0,0 +1,31 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type Attachment struct {
Type_ string `json:"Type,omitempty"`
Path string `json:"Path,omitempty"`
IgnoreFlushes bool `json:"IgnoreFlushes,omitempty"`
CachingMode string `json:"CachingMode,omitempty"`
NoWriteHardening bool `json:"NoWriteHardening,omitempty"`
DisableExpansionOptimization bool `json:"DisableExpansionOptimization,omitempty"`
IgnoreRelativeLocator bool `json:"IgnoreRelativeLocator,omitempty"`
CaptureIoAttributionContext bool `json:"CaptureIoAttributionContext,omitempty"`
ReadOnly bool `json:"ReadOnly,omitempty"`
}

View File

@ -0,0 +1,13 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type Battery struct {
}

View File

@ -0,0 +1,19 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type CacheQueryStatsResponse struct {
L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"`
L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"`
L3LocalBwBytes int32 `json:"L3LocalBwBytes,omitempty"`
}

View File

@ -0,0 +1,27 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type Chipset struct {
Uefi *Uefi `json:"Uefi,omitempty"`
IsNumLockDisabled bool `json:"IsNumLockDisabled,omitempty"`
BaseBoardSerialNumber string `json:"BaseBoardSerialNumber,omitempty"`
ChassisSerialNumber string `json:"ChassisSerialNumber,omitempty"`
ChassisAssetTag string `json:"ChassisAssetTag,omitempty"`
UseUtc bool `json:"UseUtc,omitempty"`
// LinuxKernelDirect - Added in v2.2 Builds >=181117
LinuxKernelDirect *LinuxKernelDirect `json:"LinuxKernelDirect,omitempty"`
}

View File

@ -0,0 +1,15 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type CloseHandle struct {
Handle string `json:"Handle,omitempty"`
}

View File

@ -0,0 +1,18 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
// ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port.
type ComPort struct {
NamedPipe string `json:"NamedPipe,omitempty"`
OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"`
}

View File

@ -0,0 +1,27 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type ComputeSystem struct {
Owner string `json:"Owner,omitempty"`
SchemaVersion *Version `json:"SchemaVersion,omitempty"`
HostingSystemId string `json:"HostingSystemId,omitempty"`
HostedSystem *HostedSystem `json:"HostedSystem,omitempty"`
Container *Container `json:"Container,omitempty"`
VirtualMachine *VirtualMachine `json:"VirtualMachine,omitempty"`
ShouldTerminateOnLastHandleClosed bool `json:"ShouldTerminateOnLastHandleClosed,omitempty"`
}

View File

@ -0,0 +1,72 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
import (
"net/http"
)
// contextKeys are used to identify the type of value in the context.
// Since these are string, it is possible to get a short description of the
// context key for logging and debugging using key.String().
type contextKey string
func (c contextKey) String() string {
return "auth " + string(c)
}
var (
// ContextOAuth2 takes a oauth2.TokenSource as authentication for the request.
ContextOAuth2 = contextKey("token")
// ContextBasicAuth takes BasicAuth as authentication for the request.
ContextBasicAuth = contextKey("basic")
// ContextAccessToken takes a string oauth2 access token as authentication for the request.
ContextAccessToken = contextKey("accesstoken")
// ContextAPIKey takes an APIKey as authentication for the request
ContextAPIKey = contextKey("apikey")
)
// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth
type BasicAuth struct {
UserName string `json:"userName,omitempty"`
Password string `json:"password,omitempty"`
}
// APIKey provides API key based authentication to a request passed via context using ContextAPIKey
type APIKey struct {
Key string
Prefix string
}
type Configuration struct {
BasePath string `json:"basePath,omitempty"`
Host string `json:"host,omitempty"`
Scheme string `json:"scheme,omitempty"`
DefaultHeader map[string]string `json:"defaultHeader,omitempty"`
UserAgent string `json:"userAgent,omitempty"`
HTTPClient *http.Client
}
func NewConfiguration() *Configuration {
cfg := &Configuration{
BasePath: "https://localhost",
DefaultHeader: make(map[string]string),
UserAgent: "Swagger-Codegen/2.1.0/go",
}
return cfg
}
func (c *Configuration) AddDefaultHeader(key string, value string) {
c.DefaultHeader[key] = value
}

View File

@ -0,0 +1,17 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type ConsoleSize struct {
Height int32 `json:"Height,omitempty"`
Width int32 `json:"Width,omitempty"`
}

View File

@ -0,0 +1,35 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type Container struct {
GuestOs *GuestOs `json:"GuestOs,omitempty"`
Storage *Storage `json:"Storage,omitempty"`
MappedDirectories []MappedDirectory `json:"MappedDirectories,omitempty"`
MappedPipes []MappedPipe `json:"MappedPipes,omitempty"`
Memory *Memory `json:"Memory,omitempty"`
Processor *Processor `json:"Processor,omitempty"`
Networking *Networking `json:"Networking,omitempty"`
HvSocket *HvSocket `json:"HvSocket,omitempty"`
ContainerCredentialGuard *ContainerCredentialGuardState `json:"ContainerCredentialGuard,omitempty"`
RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"`
AssignedDevices []Device `json:"AssignedDevices,omitempty"`
}

View File

@ -0,0 +1,25 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type ContainerCredentialGuardState struct {
// Authentication cookie for calls to a Container Credential Guard instance.
Cookie string `json:"Cookie,omitempty"`
// Name of the RPC endpoint of the Container Credential Guard instance.
RpcEndpoint string `json:"RpcEndpoint,omitempty"`
// Transport used for the configured Container Credential Guard instance.
Transport string `json:"Transport,omitempty"`
// Credential spec used for the configured Container Credential Guard instance.
CredentialSpec string `json:"CredentialSpec,omitempty"`
}

View File

@ -0,0 +1,26 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
// memory usage as viewed from within the container
type ContainerMemoryInformation struct {
TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"`
TotalUsage int32 `json:"TotalUsage,omitempty"`
CommittedBytes int32 `json:"CommittedBytes,omitempty"`
SharedCommittedBytes int32 `json:"SharedCommittedBytes,omitempty"`
CommitLimitBytes int32 `json:"CommitLimitBytes,omitempty"`
PeakCommitmentBytes int32 `json:"PeakCommitmentBytes,omitempty"`
}

View File

@ -0,0 +1,16 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type Device struct {
// The interface class guid of the device to assign to container.
InterfaceClassGuid string `json:"InterfaceClassGuid,omitempty"`
}

View File

@ -0,0 +1,43 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type Devices struct {
ComPorts map[string]ComPort `json:"ComPorts,omitempty"`
Scsi map[string]Scsi `json:"Scsi,omitempty"`
VirtualPMem *VirtualPMemController `json:"VirtualPMem,omitempty"`
NetworkAdapters map[string]NetworkAdapter `json:"NetworkAdapters,omitempty"`
VideoMonitor *VideoMonitor `json:"VideoMonitor,omitempty"`
Keyboard *Keyboard `json:"Keyboard,omitempty"`
Mouse *Mouse `json:"Mouse,omitempty"`
HvSocket *HvSocket2 `json:"HvSocket,omitempty"`
EnhancedModeVideo *EnhancedModeVideo `json:"EnhancedModeVideo,omitempty"`
GuestCrashReporting *GuestCrashReporting `json:"GuestCrashReporting,omitempty"`
VirtualSmb *VirtualSmb `json:"VirtualSmb,omitempty"`
Plan9 *Plan9 `json:"Plan9,omitempty"`
Battery *Battery `json:"Battery,omitempty"`
FlexibleIov map[string]FlexibleIoDevice `json:"FlexibleIov,omitempty"`
SharedMemory *SharedMemoryConfiguration `json:"SharedMemory,omitempty"`
}

View File

@ -0,0 +1,15 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type EnhancedModeVideo struct {
ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"`
}

View File

@ -0,0 +1,19 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type FlexibleIoDevice struct {
EmulatorId string `json:"EmulatorId,omitempty"`
HostingModel string `json:"HostingModel,omitempty"`
Configuration []string `json:"Configuration,omitempty"`
}

View File

@ -0,0 +1,19 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type GuestConnection struct {
// Use Vsock rather than Hyper-V sockets to communicate with the guest service.
UseVsock bool `json:"UseVsock,omitempty"`
// Don't disconnect the guest connection when pausing the virtual machine.
UseConnectedSuspend bool `json:"UseConnectedSuspend,omitempty"`
}

View File

@ -0,0 +1,21 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
// Information about the guest.
type GuestConnectionInfo struct {
// Each schema version x.y stands for the range of versions a.b where a==x and b<=y. This list comes from the SupportedSchemaVersions field in GcsCapabilities.
SupportedSchemaVersions []Version `json:"SupportedSchemaVersions,omitempty"`
ProtocolVersion int32 `json:"ProtocolVersion,omitempty"`
GuestDefinedCapabilities *interface{} `json:"GuestDefinedCapabilities,omitempty"`
}

View File

@ -0,0 +1,15 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type GuestCrashReporting struct {
WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"`
}

View File

@ -0,0 +1,15 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type GuestOs struct {
HostName string `json:"HostName,omitempty"`
}

View File

@ -0,0 +1,22 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type GuestState struct {
// The path to an existing file uses for persistent guest state storage. An empty string indicates the system should initialize new transient, in-memory guest state.
GuestStateFilePath string `json:"GuestStateFilePath,omitempty"`
// The path to an existing file for persistent runtime state storage. An empty string indicates the system should initialize new transient, in-memory runtime state.
RuntimeStateFilePath string `json:"RuntimeStateFilePath,omitempty"`
// If true, the guest state and runtime state files will be used as templates to populate transient, in-memory state instead of using the files as persistent backing store.
ForceTransientState bool `json:"ForceTransientState,omitempty"`
}

View File

@ -0,0 +1,17 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type HostedSystem struct {
SchemaVersion *Version `json:"SchemaVersion,omitempty"`
Container *Container `json:"Container,omitempty"`
}

View File

@ -0,0 +1,17 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type HvSocket struct {
Config *HvSocketSystemConfig `json:"Config,omitempty"`
EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"`
}

View File

@ -0,0 +1,16 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
// HvSocket configuration for a VM
type HvSocket2 struct {
HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"`
}

View File

@ -0,0 +1,22 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type HvSocketServiceConfig struct {
// SDDL string that HvSocket will check before allowing a host process to bind to this specific service. If not specified, defaults to the system DefaultBindSecurityDescriptor, defined in HvSocketSystemWpConfig in V1.
BindSecurityDescriptor string `json:"BindSecurityDescriptor,omitempty"`
// SDDL string that HvSocket will check before allowing a host process to connect to this specific service. If not specified, defaults to the system DefaultConnectSecurityDescriptor, defined in HvSocketSystemWpConfig in V1.
ConnectSecurityDescriptor string `json:"ConnectSecurityDescriptor,omitempty"`
// If true, HvSocket will process wildcard binds for this service/system combination. Wildcard binds are secured in the registry at SOFTWARE/Microsoft/Windows NT/CurrentVersion/Virtualization/HvSocket/WildcardDescriptors
AllowWildcardBinds bool `json:"AllowWildcardBinds,omitempty"`
}

View File

@ -0,0 +1,22 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
// This is the HCS Schema version of the HvSocket configuration. The VMWP version is located in Config.Devices.IC in V1.
type HvSocketSystemConfig struct {
// SDDL string that HvSocket will check before allowing a host process to bind to an unlisted service for this specific container/VM (not wildcard binds).
DefaultBindSecurityDescriptor string `json:"DefaultBindSecurityDescriptor,omitempty"`
// SDDL string that HvSocket will check before allowing a host process to connect to an unlisted service in the VM/container.
DefaultConnectSecurityDescriptor string `json:"DefaultConnectSecurityDescriptor,omitempty"`
ServiceTable map[string]HvSocketServiceConfig `json:"ServiceTable,omitempty"`
}

View File

@ -0,0 +1,13 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type Keyboard struct {
}

View File

@ -0,0 +1,22 @@
/*
* HCS API
*
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
*
* API version: 2.1
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
*/
package hcsschema
type Layer struct {
Id string `json:"Id,omitempty"`
Path string `json:"Path,omitempty"`
PathType string `json:"PathType,omitempty"`
// Unspecified defaults to Enabled
Cache string `json:"Cache,omitempty"`
}

Some files were not shown because too many files have changed in this diff Show More